C:\Users\tanakalab\Desktop\parts\4thbody.stl:R3ĨVC6BBVCdB?!BC6B?!B U|"5ZVCdB?!BVC^ƆBUB=C6BUBA?b OAC6B?!BVCdB?!B=C6BUB9hގ˾VC^ƆBUBVC}B}BkC6B}BLZhDZ=C6BUBVC^ƆBUBkC6B}B9 oG*VC}B}BVCBBC6BBpj!;hkC6B}BVC}B}BC6BB>+U(旰~C]́B.B~CqB}BC]́B}B?$5~CqB}B~C3BBWgC]́BB 5pA2C]́B}B~CqB}BWgC]́BB%%ξ~CB B~CaB?!BlCB?!BS1y#~CaB?!B~CܲBUBA7CBUB ++xlCB?!B~CaB?!BA7CBUB 0?"l~CܲBUB~C]́B.BC]́B}Bu/>@"x~CܲBUBC]́B}BA7CBUB{S\{BFA7CBUBC]́B}B,CB}B,VUëC]́B}BWgC]́BB,CB}Ba^/˦WgC]́BBCBB,CB}B"0"~C6BSB~CbBB}JC6BB (:(lCB?!BVCdB?!BVC6BB1+Jݾ~CB BlCB?!BVC6BB5`P ~CB BVC6BB}JC6BB%V%ξ~CB B}JC6BB~CbBBt9xݭA7CBUBVCdB?!BlCB?!BU #)ZVC^ƆBUBVCdB?!BA7CBUB[VH,CB}BVC^ƆBUBA7CBUBGh˾iVC}B}BVC^ƆBUB,CB}B6i|v̾fDCBBVC}B}B,CB}B7o \VCBBVC}B}BCBBU((⨸C}1}B.BCp{B}BTC}1}B}B(1'1P_RCp{B}BCxyBBC}1}BB)1&1AbRTC}1}B}BCp{B}BC}1}BBx ''C]́B BC!B?!B׆C]́B?!Bu k#=^徥C!B?!BCD~BUB9C]́BUB3v1Ӿ׆C]́B?!BC!B?!B9C]́BUB_>+{(TC}1}B}B~CqB}B~C]́B.Bj((᧸C}1}B.BTC}1}B}B~C]́B.B8))ԱC}1}B.B~C]́B.B9C]́BUBT')빾C}1}B.B9C]́BUBCD~BUB|2/SC}1}BB~CqB}BTC}1}B}B?$~C3BB~CqB}BC}1}BBb,ھiH*CB0BCTBBICBBq1޾׆C]́B?!B~CaB?!B~CB B,\C]́B B׆C]́B?!B~CB BzD,QC]́B B~CB BICBB41C]́B BICBBCTBByp3(Ӿ9C]́BUB~CaB?!B׆C]́B?!BO/$~CܲBUB~CaB?!B9C]́BUB.Hs#׶9C]́BUB~C]́B.B~CܲBUBK]w-w-C6BʹBCeIBBC6BB|9alICBB~CbBB~C6BSBrɾG9CB0BICBB~C6BSBz{A6&CB0B~C6BSBC6BB|3%CB0BC6BBCeIBBh>qICBB~CB B~CbBBMrv:=VCBBVCBB=C6BBmnn=C6BBVCBB=C6BBx!J>VCBBVCȘBZ(BSC6BZ(Blmϛ^>=C6BBVCBBSC6BZ(Bäbs8C>VCȘBZ(BVC6BjBSC6BZ(B~C3BZ(B~CL{B\BFC]́B\Bs\RO_>}C]́BZ(B~C3BZ(BFC]́B\BO,㾻>~CL{B\B~C]́BBFC]́B\B _}C]́BZ(BFC]́B\BCBZ(B ` >FC]́B\B`CB\BCBZ(BLWT?~C]́BB~CBdB`CB\BBY$°>FC]́B\B~C]́BB`CB\Boe3=CBBVCBBCBBErCv:=VCBBVCBBCBBqzŞ =CBZ(BVCBBCBBxL6JE>VCȘBZ(BVCBBCBZ(BDb8>VCȘBZ(BMC6B\BVC6BjB8b(8>VCȘBZ(BCBZ(BMC6B\Bn>CBZ(B`CB\BMC6B\BĻI̾;L?~CBdB~C6BBMC6B\B:VU$ ?`CB\B~CBdBMC6B\Bf~9-5cCxyBBC;pxBBC}1}BBuQ4P4QC}1}BBCxyBBC}1}BBK.AɽC;pxBBCbwBZ(B5C}1}BZ(BI:^/]:<C}1}BBC;pxBB5C}1}BZ(B(W6 >mz=CbwBZ(BC|xB\Bw$C}1}B\BJp*z >5C}1}BZ(BCbwBZ(Bw$C}1}B\Bma&Ӿe>C|xB\BC-{BBtC}1}BBLV->w$C}1}B\BC|xB\BtC}1}BBNZ)_>C-{BBC}1}Bw$C}1}B\B~C3BZ(B5C}1}BZ(B\&BA>~CL{B\B~C3BZ(Bw$C}1}B\BgO$>~CL{B\BpC]́BB~C]́BBO2㾧>~CL{B\Bw$C}1}B\BpC]́BBZ̾>w$C}1}B\BtC}1}BBpC]́BB_6>,?C}1}BtC}1}BBC}1}B[CBB~C]́BBpC]́BBMRRP?~CBdB~C]́BB[CBB3;M[սg,?C]́BBCBkB[CBBLDA8?pC]́BBC]́BB[CBB{fW)!=H ?C6BB~CBdB[CBBIAо;+?~C6BB~CBdBC6BBj53=T3?CBkBC6B[BC6BB< =i-?[CBBCBkBC6BB3+ VC:kBBVC‰BBƓC:kBB5?U!^(VC‰BBVC6BBC6B?!Bn5G!nVC‰BBC6B?!BƓC:kBBbOݍƓC:kBBC6B?!BC:kB?!B^ A^C6B?!B=C6BUBC:kB?!BMuj=C6BUBU}C:kBUBC:kB?!Bbtt!t=C6BUBkC6B}BU}C:kBUB!Y{<<=kC6B}BC:kB}BU}C:kBUB {=C6BBC:kBBC:kB}B:::VC؟B 0BVCLBcBݠC؟BcB{F eϾVCLBcBVCBB!zC؟BB@+@+^楾ݠC؟BcBVCLBcB!zC؟BBG(ǾVCBBVC:kBBƓC:kBBjGǾVCBBƓC:kBB!zC؟BBU*u? !zC؟BBƓC:kBBG]C؟BBv1ƓC:kBBC:kB?!BG]C؟BB;}s==C:kB?!BfC؟B?!BG]C؟BBLb}~@C:kB?!BU}C:kBUBfC؟B?!B~~2&=U}C:kBUB!zC؟BUBfC؟B?!B'~?=U}C:kBUBC:kB}B!zC؟BUB0wO<}=C:kB}B(C؟B}B!zC؟BUB!y:H5 !zC؟BBG]C؟BBSCwԑBB?=G]C؟BBG]CwԑBBSCwԑBB ?=G]C؟BBfC؟B?!BG]CwԑBB|k|NS= >fC؟B?!B!zCwԑB?!BG]CwԑBBk}EX=EX=fC؟B?!B!zC؟BUB!zCwԑB?!Bcy6:>6:>!zC؟BUB/CwԑBUB!zCwԑB?!B^.|>=!zC؟BUB(C؟B}B/CwԑBUBGwwX>D_ >(C؟B}B CwԑB}B/CwԑBUBxY>=(C؟B}BC؟BB CwԑB}Bo >B>C؟BBCwԑBB CwԑB}BL4s4:4VC BOBVCwԑB/BdCwԑBcB444C BcBVC BOBdCwԑBcBp=p]ݬdCwԑBcBSCwԑBBC BcBBz >SCwԑBBpC BBC BcB;}s>a==SCwԑBBG]CwԑBBpC BBv#g>| >G]CwԑBB]C BBpC BBv"g> >G]CwԑBB!zCwԑB?!B]C BBt>'>!zCwԑB?!BC B?!B]C BBt>>!zCwԑB?!B/CwԑBUBC B?!B[l>3]>/CwԑBUBC BUBC B?!B(j>o*0>VC3B}BVC BBC BUBj>*0>VC3B}BC BUB CwԑB}Bto>\> CwԑB}BC BUB/CwԑBUBBX?600> CwԑB}BCwԑBBVC?KBB i>X>VC3B}B CwԑB}BVC?KBB*۪>*VC BOBC BcBVC=BcBNt_t>w_VC=BRзBVC=BcBC BcB}t_t>}t_VC=BRзBC BcBàC=BBjP>àC=BBC BcBpC BB0k>L>pC BB]C BBàC=BBibf>E>]C BBC=BBàC=BB^>&B>VCB?!BVC=B BC=BB]>:B>VCB?!BC=BBC B?!B1c>>C B?!BC=BB]C BBe}Sw?`HF>C B?!BC BUBVC-wBUB\>[>VCB?!BC B?!BVC-wBUBTc?>C BUBVC BBVC-wBUB>@#?>VC=BRзBàC=BBVCBBL?~3>àC=BBC=BBVCFBBߒ?ʡ$?u&>VCBBàC=BBVCFBBޮLa?n3>C=BBVC=B BVCFBB~ 0f~C:kBB~CBB.C:kBB"3}JC6BBVC‰BBVC:kBB>O)+ܾ~C6BSB}JC6BBVC:kBB95$?.7~C6BSBVC:kBB.C:kBBu~;(4~C6BSB.C:kBB~CBB5G!}JC6BBVC6BBVC‰BB\v GVC؟B 0B~C؟BB~CEBcB1ttVCLBcBVC؟B 0B~CEBcB aޑ#.C:kBB~CEBcB~C:kBB!7߾+7$.C:kBBVCBB~CEBcB~j&N VCBBVCLBcB~CEBcB?VӾ.C:kBBVC:kBBVCBB]Ծs6[~C؟BBVC؟B 0B~CwԑB{BŌ)5fY~CwԑB{BVC؟B 0BVCwԑB/BkKK~C B}B~CBNBC BNBlKlK~CBNBVC BOBC BNBlKpK~CBNB~CwԑB{BVC BOB:Oaa~CwԑB{BVCwԑB/BVC BOBj2>*0>VC3B}B,C B}BVC BB i>eX>VC?KBB,C B}BVC3B}BO'>ר>ZC BB,C B}BVC?KBBb >M~C=B;B~C B}BC BNBBF21>O2C=BNB~C=B;BC BNBo s>3@VC=BcBC BNBVC BOB//>Ӧ;VC=BcB%C=BcBC BNB2c6&5>-%C=BcBC=BNBC BNB`t_`t>Hw_VC=BcBVC=BRзB%C=BcB]>8B>VCB?!BC=B?!BVC=B B\>[>VC-wBUBC=B?!BVCB?!BiO ?E[>"dC=BUBC=B?!BVC-wBUBTtg?>VC BB"dC=BUBVC-wBUBTg?>VC BB,C B}B"dC=BUBz;30?x>,C B}BFC=B}B"dC=BUB)(X'?*>~CeBB~C=BBFC=B}B)T'?@>~CeBBFC=B}BZC BB:©?4җ>ZC BBFC=B}B,C B}BόHC?~C=B;BC=BNB~C>QBNByB?L~CTrBUcB~C>QBNBC=BNB/B?t~CTrBUcBC=BNBzCTrBcB Vv?&zCTrBcBC=BNB%C=BcB>m#?R>VCBB%C=BcBVC=BRзB>t#?a>VCBB)tCTrBB%C=BcBk5G*?cn)tCTrBBzCTrBcB%C=BcB?$? v&>VCFBB)tCTrBBVCBBuO?=0CTrBB)tCTrBBVCFBBa7Gr#?b>0CTrBB~CB?!B~CTrBKB G?^>VCFBB~CB?!B0CTrBB<7(?r&>VCFBBC=B?!B~CB?!BߥL$?\3>VCFBBVC=B BC=B?!B//?q>C=B?!B"dC=BUB~C$BUBt7d#?>~CB?!BC=B?!B~C$BUB ~.'z.?ES>"dC=BUBFC=B}B~CjB}B |.|.?>Q>~C$BUB"dC=BUB~CjB}B((?Ҳ>FC=B}B~C=BB~CjB}BM?M~CTrBUcBzCTrBcB~CbBcBDU0qV0?ogzCTrBcB)tCTrBB~CBB P0 [0?Wwg~CbBcBzCTrBcB~CBB4+4?a=)tCTrBB0CTrBB~C_BBͽ44?Ca=~CBB)tCTrBB~C_BBw{.|.?.R>0CTrBB~CTrBKB~C_BB&c!vCC:kB8#BCBcBC:kBcB3%C6BB~CBB~C:kBB4'C6BʹBC6BB~C:kBB"WyC=B"ȳB~C B}B~C=B;B&1)?}>~CeBB'C=BB~C=BB9̽%2?5C=B"ȳB~C=B;B~C>QBNB J>fCfBNBC=B"ȳB~C>QBNBؕ !I>yf~C>QBNBCTrB;BCfBNBݾ,!?$~CTrBUcBCTrB;B~C>QBNBz 0"*?A>~CB?!B֡CTrB?!B~CTrBKB0*?>~C$BUB֡CTrB?!B~CB?!BM&c1?&>8CTrBUB֡CTrB?!B~C$BUBA&O1?>8CTrBUBC8B}BCTrB+ B=&R1?Q>8CTrBUB~C$BUBC8B}B!P8?bg>~C$BUB~CjB}BC8B}Bs%#+?.>~C=BB'C=BBCęBBj%+?6>~C=BBCęBB~CjB}BnY6?@>~CjB}BCęBBC8B}B}۾3#?4#CTrB;B~CTrBUcB~CbBcB}۾4#?4#CBcBCTrB;B~CbBcBUgB?@CBL˹B~CBBlCBBRB??CBL˹BCBcB~CBB M?܋CBcB~CbBcB~CBB8MfL?~=~C_BBlCBB~CBB%aC?XDZlCBBlCBB~C_BB {O>?m>ZlCBBC~B?!BCBbIBS N>?m>~C_BBC~B?!BZlCBB&q4?U>~C_BB֡CTrB?!BC~B?!B&4?{U>~C_BB~CTrBKB֡CTrB?!BM&c1?S&>֡CTrB?!B8CTrBUBCxBUB.%-3?jȜ>C~B?!B֡CTrB?!BCxBUBF>&R1?>8CTrBUBCTrB+ BCxBUB B?ACBL˹BlCBBCBB%C?=YDlCBBZlCBBCBBL?-LCBBlCBBCBB M>?m>ZlCBBCBbIBCBBfb}ݽ=C6BB=C6BBC:kBBz}|U>=C6BBkC:kBBC:kBBxx?i>=C6BBSC6BZ(BkC:kBB"sSC6BZ(BC:kBZ(BkC:kBB$_=d>VC6BjBVC:kB3BC:kBZ(BWNfE<>SC6BZ(BVC6BjBC:kBZ(B |/= .>C:kBBkC:kBBC؟BBzz=u,>kC:kBBàC؟BBC؟BBi1D/>ݽ>VCiBZ(BVC؟B_BàC؟BBi-/>;Խ>VCiBZ(BàC؟BBC:kBZ(Bq=hŞ>C:kBZ(BàC؟BBkC:kBBV\+%>E?>C:kBZ(BVC:kB3BVCiBZ(BOf>t>VC}iBBVCwԑBBCwԑBBMf >t>VC}iBBCwԑBBàC؟BBvq>k%>àC؟BBCwԑBBC؟BB],[>[>àC؟BBVC؟B_BVC}iBB2V[>c>CwԑBBVCwԑBBVC?KBBIe>=!>"dC:kB\BVC6BjBMC6B\B_=>VC:kB3BVC6BjB"dC:kB\B6-)>!2.?~C6BB~C:kBbB"dC:kB\BHpۯ=?MC6B\B~C6BB"dC:kB\Bi+A/>qڽ>VCiBZ(B3C؟BZ(BVC؟B_B0O\|:%>|U>VC:kB3B3C؟BZ(BVCiBZ(BT3\K)%>>VC:kB3B"dC:kB\B3C؟BZ(B0Fr>΋?"dC:kB\BܭC؟B\B3C؟BZ(B.I>.?~C:kBbB~C؟B~BܭC؟B\BW3>*?"dC:kB\B~C:kBbBܭC؟B\B(Nf>t>VC}iBB3CwԑBBVCwԑBB]Y>lY>VC؟B_B3CwԑBBVC}iBB]X>X>VC؟B_B3C؟BZ(B3CwԑBB$Lv>v>3C؟BZ(B0CwԑBZ(B3CwԑBBM/X(>E?~C B\B~CwԑB|AB0CwԑBZ(B/ '>9E?~C B\B0CwԑBZ(BܭC؟B\B=Ĉ>K ?ܭC؟B\B0CwԑBZ(B3C؟BZ(B$ C>n$?ܭC؟B\B~C؟B~B~C B\BV|>d>VCwԑBBZC BBVC?KBBVv>d>VCwԑBB3CwԑBBZC BB B?Z>3CwԑBBC BBZC BB!?>~CWɒBZ(B~C B@BC BB !X?>~CWɒBZ(BC BB0CwԑBZ(B{<] ?UC>0CwԑBZ(BC BB3CwԑBB ?T??0CwԑBZ(B~CwԑB|AB~CWɒBZ(Bu-x-?[>ZC BBC BB~CBBB.+?~ē>~CeBBZC BB~CBBBz??>C BB~C B@B~CBBB D]>?'C:kBB~C6BBC6BB:68.)>2.?~C:kBbB~C6BB'C:kBBo>1P>=1?C6B[BC:kB}%B'C:kBB2W=I>0?C6BBC6B[B'C:kBBD1,>X(?}C؟BB~C:kBbB'C:kBBN->A> 0?~C؟B~B~C:kBbB}C؟BB*+h>.?C:kB}%BC؟BJB}C؟BB+->O-?'C:kBBC:kB}%B}C؟BB/&>D?~C B\BJ1CwԑB\B~CwԑB|AB %|>%?J1CwԑB\BC(BBCwԑBgBn#>k7&?~C B\BC(BBJ1CwԑB\B2$>Ut&?~C B\B}C؟BBC(BB^#>%?~C B\B~C؟B~B}C؟BB$R>&?}C؟BBC؟BJBC(BB1!?I>~CWɒBZ(BJC BZ(B~C B@Bj?;?JC BZ(BCAB\BC BTB?TD?~CWɒBZ(BCAB\BJC BZ(B?1;?~CWɒBZ(BJ1CwԑB\BCAB\B@S?X?~CWɒBZ(B~CwԑB|ABJ1CwԑB\B ??J1CwԑB\BCwԑBgBCAB\B!g&b+?S>'C=BBCBBC=B'C=BB~CeBBCBBf O7?>~CeBB~CBBBCBB?>~C B@BJC BZ(BCBZ(B<?$>~C B@BCBZ(B~CBBB+V.?>~CBBBCBZ(BCBBs?b?JC BZ(BC BTBCBZ(Bk&y+?v>'C=BBC=BCI#]BBCZBBCI#]B6B*]wcD>CYB6BC/r[BBդCI#]BBSy p+>CI#]B6BCYB6BդCI#]BB SR۞>C/r[BBCI#]B&BդCI#]BB ywDC VBBDCUB\B:C VB\BA >Cy DCUB\BDC,RBBxOC VBB5![:C VB\BDCUB\BxOC VBBґMKDC,RBBDCXPB6B2C VB6BH(xOC VBBDC,RBB2C VB6BZY6?F;DCXPB6BDCPBBIC VBBO**=2C VB6BDCXPB6BIC VBB_F߾,U>DCPBBDCSBt/BC VBt/BVQK6>IC VBBDCPBBC VBt/BQѾ>DCSBt/BDC VBBC VBt/B%AG,DCI#]BBDC\BZ(BCI#]BZ(BADC\BZ(BDC VBB:C VB\B٦DC\BZ(B:C VB\BCI#]BZ(B) CI#]BZ(B:C VB\BUCI#]B\BgD$vCI#]BBxOC VBBCZBBDxCI#]BBUCI#]B\BxOC VBB:g~UCI#]B\B:C VB\BxOC VBB„K_佟2C VB6BCZBBxOC VBB}U QCYB6BCZBB2C VB6B$U |=IC VBBCYB6B2C VB6Be+]C0C>C/r[BBCYB6BIC VBBVR>C/r[BB)CI#]Bt/BCI#]B&BfTRw쾇>C/r[BBIC VBB)CI#]Bt/BZھ`x>IC VBBC VBt/B)CI#]Bt/B8Z u>DC VBBDC[BdBCI#]BdBfZ1v2>DC VBBCI#]BdBC VBt/BxEPxžߖ?C VBt/BCI#]BdB)CI#]Bt/BwAa$lCIBMBlCPGB6BSCIB6B%U} WplCPGB6BlCWxFBBLFCIBB}Ii؅ISCIB6BlCPGB6BLFCIBBXd侌lCWxFBBlCfFBt/BSVCIBt/BtU( z=LFCIBBlCWxFBBSVCIBt/B1[k 緾\$>lCfFBt/BlCnCIBdBhCIBdB`[R>SVCIBt/BlCfFBt/BhCIBdB:::lCPPB BlCNB\B_CPPB\Ba1p;lCNB\BlCJBBCPPBB((M_CPPB\BlCNB\BCPPBB~:g} SlCJBBlCIBMBSCIB6B:C} [lCJBBSCIB6BCPPBBP#  )CPPBBSCIB6BƥCPPB6BRhRSCIB6BLFCIBBƥCPPB6BNY1LFCIBBƥCPPBBƥCPPB6BX8ba=LFCIBBSVCIBt/BƥCPPBBbKԾT>SVCIBt/B)CPPBt/BƥCPPBBbyԾT>SVCIBt/BhCIBdB)CPPBt/B8et->hCIBdB?CPPBdB)CPPBt/BIf lC VB\BlCUBZ(BLrC VBZ(B(g z_CPPB\BDCUB\BDC VBB lCPPB B_CPPB\BDC VBB$ 6lCPPB BDC VBBLrC VBZ(BH2 &lCPPB BLrC VBZ(BlCUBZ(B0bCPPBBDCUB\B_CPPB\BI >Fx翫DC,RBBDCUB\BCPPBB{3G֞!ƥCPPB6BDC,RBBCPPBB/McDCXPB6BDC,RBBƥCPPB6BmO+_ƥCPPBBDCXPB6BƥCPPB6BZ>>F;DCPBBDCXPB6BƥCPPBB6WVH>)CPPBt/BDCPBBƥCPPBB_߾U>DCSBt/BDCPBB)CPPBt/BQvѾ>DCSBt/B)C VBdBDC VBBQѾ>DCSBt/B)CPPBt/B)C VBdB7db>)CPPBt/B?CPPBdB)C VBdBWVLrC VBZ(BDC\BZ(BDCI#]BBlGXpULrC VBZ(BDCI#]BBlC VB\BQau5lC VB\BDCI#]BBlCI#]BmBZLrC VBZ(BDC VBBDC\BZ(BZ`y>)C VBdBDC[BdBDC VBB(Db b [C=BB[C&JL龔[CsHB\B[CXCBB CIBB""߾-CIB\B[CsHB\B CIBBvA$fCR~CB6BlCPGB6BlCIBMB07x 黾[CR~CBεBfCR~CB6BlCIBMBM4.(:[CR~CBεBlCIBMB CIBB&.D#;򸾔[CR~CBεB CIBB[CXCBBG̦CR~CBBlCPGB6BfCR~CB6B&Uj nlCWxFBBlCPGB6B̦CR~CBB)U' {缦CR~CBt/BlCWxFBB̦CR~CBBrdrAlCfFBt/BlCWxFBB缦CR~CBt/B7c7Ŏ=֦CR~CBdBlCfFBt/B缦CR~CBt/B\k෾V$>lCnCIBdBlCfFBt/B֦CR~CBdB: j"[CPPBB[COBZ(BGCPPBZ(BXW-CIB\BlCNB\BlCPPB B#i#[CIB B-CIB\BlCPPB BJ Y"[CIB BlCPPB BGCPPBZ(B "[CIB BGCPPBZ(B[COBZ(B"<"߾ CIBBlCNB\B-CIB\B#1e;lCJBBlCNB\B CIBB.:y . CIBBlCIBMBlCJBBq t{GCPPBZ(BlCUBZ(BlC VB\Be  GCPPBZ(BlC VB\B[CPPBB`|B[CPPBBlC VB\B[C VBB*  GCPPBZ(BlCPPB BlCUBZ(B\jQ[CI#]BWB[CtZBB֦CI#]BBcz|jQ[CtZBBlCI#]BmB֦CI#]BBHjQ[CtZBB[C VBBlCI#]BmBپ?Z,<[C VBBlC VB\BlCI#]BmB@7(C׫6BGB(C4BBC׫6BBk2C_c(C4BB(Cj52Bt/BﶧC׫6Bt/BŴ@sXC׫6BB(C4BBﶧC׫6Bt/BtNb[;B(Cj52Bt/B(CI1BdBC׫6BdB#1H[ HﶧC׫6Bt/B(Cj52Bt/BC׫6BdB*^.徻(C=B=B(C*j8B6BC=B6B)DUXC׫6BB[CH(CPPBWTB[CPPBB[C VBB=t𾎼UC VBB[CtZBB[CI#]BWB󒾮uĻUC VBB[CI#]BWB(C VBB_<;þg(C VBB[CI#]BWB(CI#]BlB~tvUC VBB[C VBB[CtZBBZ.ԾCB0B%BC -BBCB0BBK=~C -BBC*Bt/BkZCB0Bt/B.+:4%rhCB0BBC -BBkZCB0Bt/BOC$ tC*Bt/BC)BdBdJCB0BdBOC$"tkZCB0Bt/BC*Bt/BdJCB0BdB+ I50"C׫6BCBCf1B6BkZC׫6B6Bk>7BCB0BB(C4BB(C׫6BGBl.o[/վCB0B%BCB0BB(C׫6BGB1~CB0B%B(C׫6BGBkZC׫6B6B3+YY\ѾCB0B%BkZC׫6B6BCf1B6B?nokZCB0Bt/B(C4BBCB0BB72CPc(Cj52Bt/B(C4BBkZCB0Bt/BaG>bydJCB0BdB(Cj52Bt/BkZCB0Bt/BNZB(CI1BdB(Cj52Bt/BdJCB0BdBk Y0C=B#BC$7BB .C=BBG*.kZC׫6B6B(C*j8B6B(C=B=B, C׫6BCBkZC׫6B6B(C=B=B#}B\Bl-(C$CB\B(CR~CB0BCs>B\BV)W# .C=BBCs>B\BC=B#BD%G .C=BB(C;=BBCs>B\B$kT"Υ(C;=BB(C$CB\BCs>B\B)X .C=BB(C=B=B(C;=BB-Nu"ICIBBChFBZ(BRCIBZ(BlKvsIChFBZ(B(CIBnBRCIBZ(BLuIChFBZ(BCR~CB4/B(CIBnBM۾tq/CR~CB4/B(CR~CB0B(CIBnBjKuIRCIBZ(B(C|JBZ(B(CPPBWTB+Nu IRCIBZ(B(CPPBWTBCIBBl޾^CIBB(CPPBWTBCPPB]zBJu:IRCIBZ(B(CIBnB(C|JBZ(B]!Ftk(C VBBC VB9BC%SBBJLھMa(CVBB(C VBBC%SBB#NLھ:aC%SBB(CPPBWTB(CVBBuNմxygCPPB]zB(CPPBWTBC%SBB % spC VB9B(C VBBCI#]B,B?ƾBkCI#]B,B(C VBB(CI#]BlB;>%ex!?DC[BdBDCI#]BBCI#]BdB[~r,>lCnCIBdBlCIB˪BhCIBdBSuWg>lCIB˪BlCPPBB?CPPBdBE^7O>hCIBdBlCIB˪B?CPPBdB]}3>lCPPBBlCf~UBBhC VBB]&3>lCPPBBhC VBB?CPPBdBQHgC ??CPPBdBhC VBB)C VBdBYBL+P!?lCf~UBBlC VBiBhC VBBP;b"t!?DC[BdB_CI#]BBDCI#]BB;+t!?DC[BdB)C VBdB_CI#]BB)N=t?)C VBdBhC VBB_CI#]BB3J3?lC VBiBlCI#]BRB_CI#]BB%CZ!?hC VBBlC VBiB_CI#]BB3Wϒp6W>[CO;BdB[C=B~B9C=BdBg;g>[C=B~B[CHp>BBCR~CBBgg>[C=B~BCR~CBB9C=BdB[\>־>9C=BdBCR~CBB֦CR~CBdBYIYH?[CHp>BB[CR~CBBCR~CBBŲ[y>lCnCIBdB^CIBBlCIB˪B[ɡ>lCnCIBdB֦CR~CBdB^CIBB+kzŚ>֦CR~CBdBCR~CBB^CIBB#VNU) ?[CR~CBB[CIBTB^CIBBO{\k ?CR~CBB[CR~CBB^CIBBa\c]Xc) >CPPBBlCIB˪B^CIBBGsW>lCPPBBlCIB˪BCPPBB&Pm?[CIBTB[CdMBPB'MCPPBPBP)?[CIBTB'MCPPBPB^CIBBo`G\Gi?^CIBB'MCPPBPBCPPBB3d3?[CdMBPB[CPPBB'MCPPBPB]3>CPPBBlCf~UBBlCPPBBMB'N\Q!?lCf~UBBM0C VBPBlC VBiBBIVQ!?lCf~UBBCPPBBM0C VBPBJRF㽬?CPPBB'MCPPBPBM0C VBPB4צʽ#4?[CPPBB[C VBizBM0C VBPB4צʽ#4?'MCPPBPB[CPPBBM0C VBPB#E(CI1BdB(CA3BB2ڧC׫6BBQL0>C׫6BdB(CI1BdB2ڧC׫6BB>/ >(CA3BB(C׫6BB2ڧC׫6BB5W71W>[CO;BdB5mC=BB[C=B~BA5WL1W>[CO;BdBC׫6BdB5mC=BB _E'>C׫6BdB2ڧC׫6BB5mC=BBSPþ_>(C׫6BB(C8BPBC=BPBNPþr>(C׫6BBC=BPB2ڧC׫6BB8HԾ3>2ڧC׫6BBC=BPB5mC=BB;G:?(C8BPB(C=B/BC=BPBQgh g>5mC=BB[CHp>BB[C=B~BBZIH?[CHp>BBCR~CBPB[CR~CBB \IN|G?[CHp>BB5mC=BBCR~CBPBS>5mC=BBC=BPBCR~CBPBO<)_`$?(C=B/B(CR~CBw-BCR~CBPBA|~`?C=BPB(C=B/BCR~CBPB`PPf ?jpCIBPB[CR~CBBCR~CBPBSNYUa ?[CIBTB[CR~CBBjpCIBPBՋ7& q.?(CR~CBw-B(CIBBjpCIBPBYW=W=%?CR~CBPB(CR~CBw-BjpCIBPBP:?jpCIBPB[CdMBPB[CIBTBE/b7?[CdMBPB#CPPBB[CPPBBٱ/7?jpCIBPB#CPPBB[CdMBPB84rx0?jpCIBPB(CsdNBB#CPPBB:9?g/W0?jpCIBPB(CIBB(CsdNBBa0>g^8?(CsdNBB(CPPB+B#CPPBBY032<4C9?(CUBB[CPPBB#CPPBBv0M<<C9?(CUBB(C VBB[CPPBBۥfH?(C VBB[C VBizB[CPPBB0q<<99?#CPPBB(CPPB+B(CUBBIkޯ=H?(C VBB(CI#]BġB[C VBizB2PdJCB0BdBC)BdBmCB0BB9PUf>Co*BBCH-BPBaCB0BPBDߞw>mCB0BBCo*BBaCB0BPB@r>CH-BPBCB0B}BaCB0BPBbL >mCB0BB(CI1BdBdJCB0BdBMdY>(CA3BB(CI1BdBmCB0BBY>/ >(CA3BB/GC׫6BPB(C׫6BB >1 >(CA3BBmCB0BB/GC׫6BPB6VK:>mCB0BBaCB0BPB/GC׫6BPB7COXԣ>CB0B}BC`D4BB;ԨC׫6BB8COXΣ>CB0B}B;ԨC׫6BBaCB0BPBS@[Ҿ :?aCB0BPB;ԨC׫6BB/GC׫6BPBc7 ?C`D4BBC׫6B͛B;ԨC׫6BB~Pþ>/GC׫6BPB(C8BPB(C׫6BBr;="?(C8BPBC=BB(C=B/B;8o?(C8BPB/GC׫6BPBC=BBEJc) ?/GC׫6BPB;ԨC׫6BBC=BBV1`p|.?C׫6B͛BC=BJBC=BBs9M"?;ԨC׫6BBC׫6B͛BC=BBDA3?WCR~CBB(C=B/BC=BB:sa%?(CR~CBw-B(C=B/BWCR~CBB.M1"4?C=BJBCR~CBoBWCR~CBB3?1Q0?C=BBC=BJBWCR~CBB=d-(?6CIBB(CR~CBw-BWCR~CBBq'f=?(CIBB(CR~CBw-B6CIBB %üC?CR~CBoBCIBtB6CIBBKd2 z95?WCR~CBBCR~CBoB6CIBB3])zS??6CIBB(CsdNBB(CIBB$!tOC?(CsdNBB6CIBBCIBtB$)tOC?(CsdNBBCIBtB(CPPB+BzF]?C VB; BCI#]BUBUCI#]BB: '=6V?<+C VBBC VB; BUCI#]BB8 >YC?vB`BYCmtBBEC?vBB)ؾ\1YC}1}B'BYC" {BUBC}1}BUB]gFؾC}1}B.BC}1}BUBYC" {BUB.gFؾC}1}B.BYC" {BUBCp{B}Bh;m꾥Cp{B}BYC" {BUBYC\wB}BM> EC?vBBYC\wB}BYC?vB`B `>EC?vBBCxyBBYC\wB}B\ L6UsCxyBBCp{B}BYC\wB}Bg,,C]́B BYC]́BYBYCw9B?!BO:C!B?!BC]́B BYCw9B?!B'ؾ^1C}1}BUBYCw9B?!BYC}1}B'Bg)ؾ]1ǦC}1}BUBCD~BUBYCw9B?!BOC{ CD~BUBC!B?!BYCw9B?!BafNFߤؾC}1}BUBC}1}B.BCD~BUBx<-8CB0BYCBBYC܉BB4D7)09*CTBBCB0BYC܉BBA^C͉YC܉BBC]́B BCTBB%\0YC]́BYBC]́B BYC܉BBí{=O`YIC6BʹBYC6B BYC YBB\<55CeIBBC6BʹBYC YBBe<36EFYCBB&CBeB&C!RBBΕ(>,68YC܉BBYCBB&C!RBB?(>V,Y68&C!RBBYC]́BYBYC܉BB-=J2=J&C]́BHڿBYC]́BYB&C!RBB>@YC YBBYC6B BȣC6BB>@ȣC6BBYCBBYC YBB頖>3@ȣC6BB&C6BvKBYCBB]> P&C6BvKB&CBeBYCBBeR5)x&&C_pBBC_pBBClBBAt&C8pBB&C_pBBClBB9E3F3&C?vB2BC?vBBCKrB}B"4@"&CStB}B&C?vB2BCKrB}BCF{SOzCKrB}B&C_pBB&CStB}BGc>8)=&C_pBB&C_pBBCKrB}B=¤>H&C}1}BBC}1}BBCpyBUB><4G4&C¼yBUB&C}1}BBCpyBUBOٵK&C]́BHڿBC]́BBCVB?!BP>[#V>&CPB?!B&C]́BHڿBCVB?!B

}Z#Y>CVB?!B&C}1}BB&CPB?!B} =G PC}1}BB&C}1}BBCVB?!B>@&C!RBB&CBeBvCBBI>޼@vCBB&C]́BHڿB&C!RBB:>@vCBBCB2B&C]́BHڿBUx>g0 QCB2BC]́BB&C]́BHڿBæ>,-PCoBBvCBB&CBeB>U-PCoBB&CBeBC6BBx>xEC6BB&CBeB&C6BvKBȥ>/-PvCBBCoBBCB2B١$2DCiB;BDCfiBBCiBBU->*CiBBClBBC_pBB֐G-c+CiBBC_pBBDCiB;B2/ܣFDCiB;BC_pBBDC_pBB+=.SC?vBBDC?vBBDCqB}Bqǽ'4'4CKrB}BC?vBBDCqB}B`ɽ5$2DCqB}BC_pBBCKrB}B;Y PDC_pBBC_pBBDCqB}B>%o>fؑTC}1}BBDC}1}BBDC{BUB_D>&ECpyBUBC}1}BBDC{BUBώD>%,EDC{BUBC?vBBCpyBUBs=YDC?vBBC?vBBDC{BUB>0 ECVB?!BC]́BB%C]́B?!B >0 CE%C]́B?!BC}1}BBCVB?!BA>0 rE%C]́B?!BDC]́B(BC}1}BBs>XDC]́B(BDC}1}BBC}1}BBij>^۾ UDC%˃B?!B%C]́B?!BC]́BB<ó>۾^ UDC%˃B?!BC]́BBDCBB'>vcCDCBBC]́BBCB2B³>˴۾ U%C]́B?!BDC%˃B?!BDC]́B(B>ܦeDCoBBC6BB_C6BB>D_C6BBCB2BCoBB}>?⾯D_C6BBDC6BپBCB2B>ӾLDC6BپBDCBBCB2B׽AWDCiB;BlCiB+BlChBBsy+l:DCfiBBDCiB;BlChBBݽV]lCiB+BDCiB;BlC_pB^B=)-/IlC_pB^BDCiB;BDC_pBB^>^DC?vBBlC?vBBlCsB}B4>U ]RDCqB}BDC?vBBlCsB}B,>W [RlCsB}BDC_pBBDCqB}B=bblC_pB^BDC_pBBlCsB}B;>MDC{BUBDC}1}BBAC}1}BUB>MAC}1}BUBDC?vBBDC{BUB݈>TMAC}1}BUBlC}1}BOBDC?vBBܝd> ȾܝdlC}1}BOBlC?vBBDC?vBB@>haX]lCBUBAC}1}BUBDC}1}BBJ@>aB]lCBUBDC}1}BBlC]́BYBP>޾;)FlC]́BYBDC}1}BBDC]́B(BA>b]AC}1}BUBlCBUBlC}1}BOB ?~ľ>DC%˃B?!BDCBBCB?!B ?}ľ>CB?!BDC]́B(BDC%˃B?!B ?}ľ>CB?!BlCBBDC]́B(BJ>_ >QlCBBlC]́BYBDC]́B(B?nCjC6B?!BCB?!BDCBBd?_x<4DC6BپBjC6B?!BDCBB?o(:lCBBjC6B?!BlC6BB?n CCB?!BjC6B?!BlCBBn8پglCiB+B[CiBB[C0gBB-IXlChBBlCiB+B[C0gBBm[CiBBlCiB+B[C_pBB=V][C_pBBlCiB+BlC_pB^BUx>½\lCsB}BlC?vBB{JC?vB}BUx>㾱\{JC?vB}BlC_pB^BlCsB}BTx>B\{JC?vB}B[C?vBBlC_pB^BC=Co[C?vBB[C_pBBlC_pB^B>{8k[C\CwB}B{JC?vB}BlC?vBB>k[C\CwB}BlC?vBB[C}1}BGB$>FT^[[C}1}BGBlC?vBBlC}1}BOBH>zzk{JC?vB}B[C\CwB}B[C?vBBc>yTlCBUBlC]́BYBC]́BUBe>4ZyTC]́BUBlC}1}BOBlCBUBid>6yTC]́BUB[C]́BBlC}1}BOB>gg[C]́BB[C}1}BGBlC}1}BOB >tTZCBUBC]́BUBlC]́BYB ?)IlCBBCBUBlC]́BYBe?.B O[C]́BBCBUB[CBB>_t!ZC]́BUBCBUB[C]́BB+?e#>PRC6BUBCBUBlCBBXs#?`ޅ7lC6BBRC6BUBlCBB$(?kSX=[CBBRC6BUB[C6BuB*?ϙ#?PCBUBRC6BUB[CBB<p[CiBB(CiB+B(C%fBBĭ,Bپg[C0gBB[CiBB(C%fBBOfN9j(C_pBQB[CiBB[C_pBBk(>tct(C_pBQB[C_pBB(C?vBB>d@h(C?vBB[C_pBB[C?vBBv>>A4b[C\CwB}B[C}1}BGB&C}1}B}B9>Цb&C}1}B}B[C?vBB[C\CwB}B@>}b&C}1}B}B(C}1}BzB[C?vBB@È> ''"s(C}1}BzB(C?vBB[C?vBBm>Fj%C]́B}B&C}1}B}B[C}1}BGB!>qd[ d[[C]́BB%C]́B}B[C}1}BGB(>>B߽A_(C}1}BzB%C]́B}B(C]́BB>ğ1Fj&C}1}B}B%C]́B}B(C}1}BzBqu>B(j`(C VB}B%C]́B}B[C]́BBu>UN(j`(C VB}B[C]́BB(CBojB?>J(CBojB[C]́BB[CBB>-J(g`%C]́B}B(C VB}B(C]́BB!2?J =ר7'C6B}B(CحB}B(CBojB2? =7'C6B}B(CBojB[C6BuB??L[C6BuB(CBojB[CBBX3? =A6(CحB}B'C6B}B(C6BB )=h6x(CiB+BCiBxBCgBB8=p(C%fBB(CiB+BCgBBU=;ȍzCiBxB(CiB+BC_pBB'>)ctC_pBB(CiB+B(C_pBQBo+>\yC_pBB(C_pBQBC?vB^Bc>AppC?vB^B(C_pBQB(C?vBB>84vC?vB^B(C?vBBC}1}BcBi>#mC}1}BcB(C?vBB(C}1}BzBU#>}p8cC]́B6+B(C}1}BzB(C]́BBF?KjO(C VB}B(CBojB3CB}BE? HO3CB}B(C]́BB(C VB}BM?6O3CB}BCBAB(C]́BBP> >PbCBABC]́B6+B(C]́BBF?K=jO3CB}B(CBojB(CحB}BOV6?μ=}3(CحB}B(C6BBC6BB5?==33CB}B(CحB}BC6BB]2?fjU>1zD3CB}BC6BBCBB?>8H3CB}BCBBCBAB`3c+ BwYC_pB5BYCoBZ(BDC_pBZ(B!PWrYCoBZ(BYCrnB\B.C_pB\B080DC_pBZ(BYCoBZ(B.C_pB\B`zA`YCnBBYC_pBBBY;C_pBB]|.:|.8QYCmtBBYC~qBBUC?vBB*DGc:EC?vBBYCmtBBUC?vBB//ZqYC~qBBYC_pB5BDC_pBZ(B//lqYC~qBBDC_pBZ(BUC?vBBvC_!*bUC?vBBDC_pBZ(BC?vBZ(BxD_"i竽DC_pBZ(B.C_pB\BC?vBZ(BUC hU=.C_pB\B姢C?vB\BC?vBZ(BUC U=.C_pB\BY;C_pBB姢C?vB\Bz`ྡD>Y;C_pBBԢC?vBB姢C?vB\BBhd>YC_pBBBYCrB6BR+C?vB6BhBe>YC_pBBBR+C?vB6BY;C_pBB:V:־>Y;C_pBBR+C?vB6BԢC?vBB!P`5>YCrB6BYC?vBJBR+C?vB6B8Db:UC?vBBCxyBBEC?vBB}9- eC;pxBBCxyBBUC?vBBN9`-]C?vBZ(BC;pxBBUC?vBBKCɽCbwBZ(BC;pxBBC?vBZ(BjLiL=姢C?vB\BCbwBZ(BC?vBZ(B%W vuz=C|xB\BCbwBZ(B姢C?vB\B$Sy9>ԢC?vBBC|xB\B姢C?vB\BaӾe>C-{BBC|xB\BԢC?vBBN^>C-{BBC}1}B6BC}1}BC-{BBԢC?vBBC}1}B6Ba`*A>ԢC?vBBR+C?vB6BC}1}B6BA ;?h ?YC?vBJBYC}1}BBC}1}B6BSRx#8H?R+C?vB6BYC?vBJBC}1}B6BZL>췢C]́B6BC}1}B?C]́BBC}1}B?CBkBC]́BBJCB6B"!5w=FRF?YC]́BMBYCB BJCB6B4yxw4?췢C]́B6BYC]́BMBJCB6B'>t>?΢C6B6BCBkBJCB6BXy Sư=5T?C6B[BCBkB΢C6B6B ]>P?YCB BYC6B3B΢C6B6B4 =-E?JCB6BYCB B΢C6B6B -' &CiB4B&CHhBZ(BCiBZ(B@ٶp&CHhBZ(B&CeB\BǾCiB\B2x,CiBZ(B&CHhBZ(BǾCiB\BTqp&CeB\B&CcBBCiBB/IA-喽ǾCiB\B&CeB\BCiBBgc꾊;&CcBB&CdB6B0ţCiB6B?`VU `=CiBB&CcBB0ţCiB6Bh{r>&CdB6B&C}hBBSCiBBVݾ>0ţCiB6B&CdB6BSCiBBJ1O?&C}hBB&CiBcBSCiBBI;-Mؾ&C8pBB&C6lBBC_pBBYCnBB uC_pB6BYC_pBBBZgQu>YCnBBCiBB uC_pB6B2l {=CiBB0ţCiB6B uC_pB6B`J>0ţCiB6BSCiBB uC_pB6B^yb>SCiBBۣC_pBB uC_pB6BeEnS:?&CiBcB&C_pB|BۣC_pBBWNih ?SCiBB&CiBcBۣC_pBBQMLHMеC_pBBYCmtBBC_pBBwr#7CaYC~qBBYCmtBBC_pBB$+9A~C_pBBYC_pB5BYC~qBBhWc> uC_pB6BYCrB6BYC_pBBBP1|>YCrB6BVC?vBBYC?vBJBP4>YCrB6B uC_pB6BVC?vBBpt_t_t> uC_pB6BۣC_pBBVC?vBBˢ6A0?&C_pB|B&C?vBBVC?vBB~EE ?ۣC_pBB&C_pB|BVC?vBBY-6?C}1}BBYC?vBJBVC?vBB ?BZN#?YC}1}BBYC?vBJBC}1}BB~1~%+˵7?&C?vBB&C}1}Bk5BC}1}BBc71?VC?vBB&C?vBBC}1}BB+BWIW&?C]́BBYC}1}BBC}1}BBkԂ½aK?YC]́BMBYC}1}BBC]́BBi=A8K?&C}1}Bk5B&C]́B2BC]́BBM287?C}1}BB&C}1}Bk5BC]́BB  >J?:ãCBBYC]́BMBC]́BBo> =s^?YCB BYC]́BMB:ãCBB>f>$`Y?&C]́B2B&CB8B:ãCBB͎ >J?C]́BB&C]́B2B:ãCBB%T >T?&C]rBBYCB B:ãCBBh >T?&C]rBB&C6BOBYCB BHӾto>_a?&C6BOBYC6B3BYCB BS+ >T?:ãCBB&CB8B&C]rBB ACcB_BCebBZ(B?ϤCcBZ(Bz#73ʴ־CebBZ(BC/]B\B_CcB\B@(A()?ϤCcBZ(BCebBZ(B_CcB\BhB/aC/]B\BCI#]BBCI#]BBByłC/]B\BCI#]BB_CcB\B%R^ pD_CcB\BCI#]BB.CcBBUY g CI#]BBCI#]B6B.CcBBvZ7CI#]B6B.CcB6B.CcBB dWA />CI#]B6BդCI#]BB.CcB6BZyCZ>դCI#]BBBbCcBB.CcB6B5\ie{>CI#]B&BCEaBt/BtҤCcBt/BJ\f~>CI#]B&BtҤCcBt/BդCI#]BBiI7 L>դCI#]BBtҤCcBt/BBbCcBB;9J?CEaBt/BCcBBtҤCcBt/B('E CiBBBCgBBwCiBB -'] ?ϤCcBZ(B&CHhBZ(B&CiB4B;pL$jCcB_B?ϤCcBZ(B&CiB4B6#_(̾CcB_B&CiB4BwCiBB X - CcB_BwCiBBCgBBd$+%._CcB\B&CHhBZ(B?ϤCcBZ(B*@-&CeB\B&CHhBZ(B_CcB\B!aF9.CcBB&CeB\B_CcB\BUkI&CcBB&CeB\B.CcBBW .CcB6B&CcBB.CcBBce7;&CdB6B&CcBB.CcB6B^ F^>BbCcBB&CdB6B.CcB6Bhfpr>&C}hBB&CdB6BBbCcBBJ2P?&C}hBB*CiBt/B&CiBcBJ)P?&C}hBBBbCcBB*CiBt/Bd[Yd[>BbCcBBtҤCcBt/B*CiBt/B.22?CcBBCiB=B*CiBt/BA/AV ?tҤCcBt/BCcBB*CiBt/Bq(' wCiBBClBBCiBBB)n' wCiBB&C6lBBClBB'arBa&C6lBB&C8pBBClBB%u:juwCiBB&CiB4B&C6lBB\RYV ?{C_pBt/B&CiBcB*CiBt/B=iEPR57?&C_pB|B&CiBcB{C_pBt/B3L3?CiB=BC_pBIB{C_pBt/B3v?3?*CiBt/BCiB=B{C_pBt/BTIҼ?2uC?vBt/B&C_pB|B{C_pBt/B'3/!8?&C?vBB&C_pB|B2uC?vBt/Bq-=<<5Q{P?C?vBvBC}1}BiBၤC}1}Bt/Bm]-}+=QN?ϤC]́Bt/B&C}1}Bk5BၤC}1}Bt/B-i- > ]?&C]́B2B&C}1}Bk5BϤC]́Bt/Bs>X?C}1}BiBC]́B̂BϤC]́Bt/B zU>RN?ၤC}1}Bt/BC}1}BiBϤC]́Bt/BL{>,T?CBt/B&C]́B2BϤC]́Bt/Bc>T?CBt/BCBOB&C]́B2Bd;p>b?CBOB&CB8B&C]́B2B|F>T?ϤC]́Bt/BC]́B̂BCBt/B6>w7d?&C]rBBXC6BB&C6BOB} >@7d?XC6BB&C]rBB&CB8BW>7d?XC6BB&CB8BC6B8BpUþU>W?C6B8B&CB8BCBOBɭ<$DCcBBDCbBBCcBBR! fCI#]BZ(BCebBZ(BCcB_B<;PQDCI#]BBCI#]BZ(BCcB_B| DCI#]BBCcB_BCcBBG+$DCI#]BBCcBBDCbBBۛ >qUCI#]B\BCebBZ(BCI#]BZ(Bt'7־C/]B\BCebBZ(BUCI#]B\BB4UCI#]B\BCI#]BBC/]B\B{\Kbx>)CI#]Bt/BCEaBt/BCI#]B&B;8I?CEaBt/BY|CcBdBCcBB;Z7I?CEaBt/B)CI#]Bt/BY|CcBdB8QQ9| ?)CI#]Bt/BCI#]BdBY|CcBdB`(3-$CcBBCgBBCiBBBuؾ$h*mDCcBBCcBBCiBBB;8s"9N.DCcBBCiBBBCiBB|ڡ$2DCcBBCiBBDCfiBB)z4CcBBCcB_BCgBBDvD"?RlCiBdBCcBBY|CcBdB-2&2?CiB=BCcBBRlCiBdB8CiBBCiBBBClBB<4 ?4?^C_pBdBCiB=BRlCiBdBjkF?C_pBIBCiB=B^C_pBdBX|O;=F?ƄC?vBdBC_pBIB^C_pBdB3̟ZS?DCzBdBC?vBvBƄC?vBdB5!{>S?DCzBdBDC}1}BBC?vBvBp])>a?DC}1}BBC}1}BiBC?vBvB?پТ>0Y?DC}1}BBDC]́B,BC}1}BiBzc>e?DC]́B,BC]́B̂BC}1}BiBl^٫>!e?CBt/BCBt/BCBOB[!׫>!e?CBt/BCBt/BC]́B̂B]׫>!e?CBt/BC]́B̂BDCBT\B"A/>¯Z?DCBT\BC]́B̂BDC]́B,B鋾[|>2U?DCOBt/BCBOBCBt/B鋾>1U?DCOBt/BDC6BBCBOB L:>zIe?DC6BBC6B8BCBOB苾Oz>`3U?CBt/BDCBT\BDCOBt/B0 EEDCcBBlCcB,BlC}^BByӾ:"r'DCbBBDCcBBlC}^BBXwӾ98"t'lC}^BBDCI#]BBDCbBBUg6lCI#]BmBDCI#]BBlC}^BB#z+:lChBBDCcBBDCfiBBQvfLlCcB,BDCcBBlChBB>{c?DCzBdBAC}1}BdBDC}1}BB%>X?lC$BdBDC}1}BBAC}1}BdB8>X?lC$BdBlC]́BpBDC}1}BB]G٫>G!e?lC]́BpBDC]́B,BDC}1}BBE苾ր>1U?lC]́BpBlCBBDC]́B,BAL:>xIe?lCBBDCBT\BDC]́B,B??+P?DC6BBlC.Bt/BlC6BB) >ę[?DCOBt/BlC.Bt/BDC6BB% *>%[?lC.Bt/BDCOBt/BDCBT\B'@?>N?lCBBlC.Bt/BDCBT\B 0 E֦CI#]BBlC}^BBlCcB,B0 zE֦CI#]BBlCcB,B[CI#]BWBLe+t>־d[CI#]BWBlCcB,B[CcBB. rE֦CI#]BBlCI#]BmBlC}^BBT*.EIX[C0gBBlCcB,BlChBBe+?־φd[CcBBlCcB,B[C0gBBFR*>ac?lC$BdBJ(C]́BdBlC]́BpBa4r?&N?[C3 BdBlC]́BpBJ(C]́BdB`4?#N?[C3 BdB[CBOBlC]́BpBj>\?[CBOBlCBBlC]́BpBn=,?n;?lC6BB[C:Bt/B[C6Bq[BV =?hhQ?lC.Bt/B[C:Bt/BlC6BBV o=?thQ?[C:Bt/BlC.Bt/BlCBB%ӌ-?;?[CBOB[C:Bt/BlCBB ,Atm(CI#]BlB[CI#]BWB(CcBRBؾB8g(CcBRB[CI#]BWB[CcBB#ƭCپg(C%fBB[CcBB[C0gBB,tXDp(CcBRB[CcBB(C%fBB=,+?@??[C6Bq[B(C軅Bt/B(C6B1B=,?-2;?[C:Bt/B(C軅Bt/B[C6Bq[B=G,?1;?(C軅Bt/B[C:Bt/B[CBOBP=P4?P4?(CB`B(C軅Bt/B[CBOBH7O[tCI#]B,B(CI#]BlBCcB8Bl^lqCcB8B(CI#]BlB(CcBRB܁8=ǫpCgBB(CcBRB(C%fBBu!tiu!yCcB8B(CcBRBCgBB=_5?32?C]́B0OBרC]́BdBC۸BdB>M?, ?CBcBcCBt/BCBt/BS=]*?lo7?I*?C]́B0OBcCBt/B(CB`B&p>w6?[(?C]́B0OBCBt/BcCBt/BF?> CBBC6BBC6BNB A>ֶN?>C6BvB?C6BBCՆBBz>(??M?cCBt/B(C6B1B(C軅Bt/B>@?ӄ?CBcB(C6B1BcCBt/B[>VC?J?CBcB?C6BB(C6B1B>''E?Sw?CBcBCՆBB?C6BB pg>U0?U0?cCBt/B(C軅Bt/B(CB`B26(n2?DCI#]BBDCcBwBY|CcBdB>@>#?CI#]BdBDCI#]BBY|CcBdB4a4?DCcBwBDCiBܷBRlCiBdB4Ua4?Y|CcBdBDCcBwBRlCiBdB3~%<%H?DCiBܷBDC_pB7B^C_pBdB4k?4?RlCiBdBDCiBܷB^C_pBdBzB/>cW?DC_pB7BDC?vBBƄC?vBdB|:=F?^C_pBdBDC_pB7BƄC?vBdBj"ܣ{>S?ƄC?vBdBDC?vBBDCzBdBA{I&?RCcBBDCI#]BB_CI#]BB,-K8?DCcBwBDCI#]BBRCcBB2. n:?lCI#]BRBlCcByBRCcBB4IY<4?_CI#]BBlCI#]BRBRCcBB(/R<:?"[CiBBDCcBwBRCcBBtNv{~ZI?DCiBܷBDCcBwB"[CiBBsNa{=}ZI?lCcByBlCiB8B"[CiBB4/sS<:?RCcBBlCcByB"[CiBB!>2G?lCpBBDCiBܷB"[CiBBL>G?lCpBBlC_pBbBDCiBܷB/>2G?"[CiBBlCiB8BlCpBB >3S?lC_pBbBlC?vB֑BDC_pB7BHB 7>1Ia?lC?vB֑BDC?vBBDC_pB7Be>c?AC}1}BdBDCzBdBDC?vBB6>c?AC}1}BdBDC?vBBlC}1}B^BپТ>Y?lC}1}B^BDC?vBBlC?vB֑B>=X?AC}1}BdBlC}1}B^BlC$BdB 0=8?7MCcBPBlCI#]BRB4CI#]BPBt4I?lCcByBlCI#]BRB7MCcBPBR=H?[CI#]B`B[CcB1B7MCcBPBA 0=԰8?4CI#]BPB[CI#]B`B7MCcBPBӡ E>E?[CdBPBlCcByB7MCcBPBơ.E>.E?[CdBPB[CiB -BlCcByB<U=Z?[CiB -BlCiB8BlCcByBaE>E?7MCcBPB[CcB1B[CdBPBOe޾4>"b?lCpBBC_pBBlC_pBbB'\7>Qa?C_pBBlCpBBlCiB8B I 7> Ia?C_pBBlCiB8B[C_pB,BԵ>7S?[C_pB,BlCiB8B[CiB -Bn׾I\>[?$C?vBBlC_pBbBC_pBBdIž>rxa?lC?vB֑BlC_pBbB$C?vBB¾x[>]?[C_pB,B[C?vBB$C?vBB` ھ<>` Z?C_pBB[C_pB,B$C?vBB搼} >W?[CbxBBlC?vB֑B$C?vBBސ/ >W?[CbxBB[C}1}B1xBlC?vB֑Bݜ >P,d?[C}1}B1xBlC}1}B^BlC?vB֑B搼} >W?$C?vBB[C?vBB[CbxBBF,,>ac?J(C]́BdBlC$BdBlC}1}B^BF+>ac?J(C]́BdBlC}1}B^B[C]́BB6 լ>SS?[C]́BBlC}1}B^B[C}1}B1xBub4$?;&N?J(C]́BdB[C]́BB[C3 BdBBz+M>+M?(CI#]BġB(CcBB[CI#]B`BwW=`W\?(CcBB[CcB1B[CI#]B`Bپ`>`?[CdBPBMCiBPB[CiB -Bپ`><`?MCiBPB[CdBPB[CcB1Bپ`>`?MCiBPB[CcB1B(CiBB >kT?(CiBB[CcB1B(CcBBzӾ>FLZ?(CnBPB[CiB -BMCiBPB;|Ӿ,>iKZ?(CnBPB(C_pBʆB[CiB -BR?ة>b?(C_pBʆB[C_pB,B[CiB -BzӾ>CLZ?MCiBPB(CiBB(CnBPB>iX?(C_pBʆB(C?vB B[C_pB,BJ^ث>E!e?(C?vB B[C?vBB[C_pB,Be00?eX?[C}1}B1xB(C-{BB(C}1}BBT>`b?[CbxBB(C-{BB[C}1}B1xBhT>Jb?(C-{BB[CbxBB[C?vBB3>S?(C?vB B(C-{BB[C?vBB&ik?M?(C}1}BB(C]́BB[C}1}B1xBDig?[?(C]́BB[C]́BB[C}1}B1xB!?BQ?(CEBdB[C3 BdB[C]́BBYl,+?;_=?(C]́BB(CEBdB[C]́BB=>AZ?pɨCcBB(CI#]BġBUCI#]BBdӾOb>b?(CcBB(CI#]BġBpɨCcBBѾf>4 _?CI#]BUBCcBGUBpɨCcBB@辮>DZ?UCI#]BBCI#]BUBpɨCcBB̾>eZ?CC7eBB(CcBBpɨCcBB̾>‡Z?CC7eBBCiBB(CcBB/>o`?CiBB(CiBB(CcBBy̾k>Z?pɨCcBBCcBGUBCC7eBBȏЌ>j f?(CnBPB&aC_pBPB(C_pBʆBƏ'>Bf?&aC_pBPB(CnBPB(CiBBȏu> f?&aC_pBPB(CiBBC_pBdW?C_pBgGW?C rBPB(C_pBʆB&aC_pBPBGM0>5HW?C rBPBC?vBB(C_pBʆB0F+>\ac?C?vBB(C?vB B(C_pBʆB1>GW?&aC_pBPBC_pBQ!BCBcBC:kB8#BC:kBcBJG>Q!BC:kBcBC6BʹBCBcBF>Q!BC:kBcBYC:kBɷBC6BʹBM=QPYC:kBɷBYC6B BC6BʹBX;>iɾGfYCn BcBC:kBcBC:kB8#BY;>KɾfYCn BcBC:kB8#BYC؟BbB`>Fپ`YC؟BbBC:kB8#BC؟BBY;>ɾ=fC:kBcBYCn BcBYC:kBɷBm>mYC؟BbBC؟BBYCwԑBrbBw>n٠)iYCwԑBrbBC؟BBCwԑB{Bg>ݙkݙkCBNBC B}B6C BNB)>kk6C BNBCwԑB{BCBNB%>kk6C BNBYC BȴBCwԑB{Bj>5 rYC BȴBYCwԑBrbBCwԑB{BOl> eT=<=tC=B"ȳBZC=BNBC B}Bɷ>XtYC BȴBZC=BNBYC=BȴBm>)e?>D`ZC=BNBC=B"ȳBCfBNB@+>c@>D`CfBNBYC=BȴBZC=BNB*>>>^E`CfBNBCTrB;BYC=BȴB)=h>6xCTrB;BYCTrB鈵BYC=BȴB{\?+>C8B}BCTrB}BCTrB+ B \?>CTrB}BYCBBYCTrBKB|\?>CTrB}BC8B}BYCBBw~X\?q>C8B}BCęBBYCBBw=v4?v4YCTrB鈵BCTrB;BCBcB4R=1?$7YC"}BcBYCTrB鈵BCBcB:`t=TN?CBcBYCBBYC"}BcBml?CBL˹BYCBBCBcB g?s>C~B?!B9CB?!BCBbIB ya?qֶ>9CB?!BYCBUBYCB:B𼡾a?ն>9CB?!BC~B?!BYCBUB7\?,8>C~B?!BCxBUBYCBUB}\?>CTrB+ BCTrB}BYC\lB}B}ө\?>CTrB+ BYC\lB}BCxBUBjއZ?>CxBUBYC\lB}BYCBUBr\?|>CTrB}BYCTrBKBYC\lB}Bll?YCBBCBL˹BCBB@@wM?pYCrǟBBYCBBCBBh'x?UYCrǟBBCBBYCBBibu?luCBBCBBYCBB g?Xt>CBbIB9CB?!BYCg:B?!B ) g?Uv>CBbIBYCg:B?!BCBBTȧn?\n>CBBYCg:B?!BYCBBa?;ն>9CB?!BYCB:BYCg:B?!B>_O&C(BBȣC6BBYC6B Be>t`O&C(BBYC6B B&C:kBfWBΚ>B&C:kBfWBYC6B BYC:kBɷB}>u_OȣC6BB&C(BB&C6BvKB`>`VYCn BcBYC؟BbBC؟BcB>aVC؟BcBYC:kBɷBYCn BcB>`VC؟BcB&C؟B`BYC:kBɷB>?`V&C؟B`B&C:kBfWBYC:kBɷB>,\&CBcBC؟BcBYC؟BbB1>]h\&CBcBYC؟BbB&CwԑBBV>6f _&CwԑBBYC؟BbBYCwԑBrbB >\C؟BcB&CBcB&C؟B`B>>e+ d&CwԑBBYCwԑBrbB&C B>IB>>e+ d&C B>IBYCwԑBrbBYC BȴBN>Cg&C B>IBYC BȴB&C=B>IBN>Cg&C=B>IBYC BȴBYC=BȴB>IT>b&C=B>IBYC=BȴB&CTrB B>IT>b&CTrB BYC=BȴBYCTrB鈵Bj?>YCTrBKB&C8BB&CTrB;;BO_h?>YCBB&C8BBYCTrBKBN]>(?A.&CTrB BYCTrB鈵BYC"}BcBP>)?~,&CBcB&CTrB BYC"}BcB9>mF?U"CBBYC"}BcBYCBB>nG?"CBB&CBBYC"}BcBF>n7?`x&CBB&CBcBYC"}BcB>k?N&CBB"CBB&CBOպB=Dq?HW>YCB:B&CBUB&CB8B,m?Դ>YCBUB&CBUBYCB:B,m?>&CBUBYCBUB&CB}BWmgPmg?>YCBUBYC\lB}B&CB}Bdhdh?>&CB}BYC\lB}BYCTrBKB*j?^>&CTrB;;B&CB}BYCTrBKB.h>H?WD "CBBYCBBYCrǟBB)>ak?אN&CBOպB"CBBYCrǟBB>k?xN&CBOպBYCrǟBB&C TBB0Z>v\y?0ۛ&C TBBYCrǟBBYCBBY>K y?Ⱥ=&C TBBYCBB&CB?!Bw=w?Fw>YCBBYCg:B?!B&CB?!Bl=l?`>&CB?!BYCg:B?!BYCB:B=5q?`]>&CB8B&CB?!BYCB:B>D&C(BB&C:kBfWBpC:kBB>DpC:kBB&C6BvKB&C(BBc>^DpC:kBBC:kB1B&C6BvKB(>p۾(NC:kB1BC6BB&C6BvKBI>QNC xBBpC:kBB&C:kBfWB >faRNC xBB&C:kBfWBC؟BB>1l%{PC؟BB&C:kBfWB&C؟B`B>WRNpC:kBBC xBBC:kB1B,B>X9oZ&CBcB&CwԑBBtCwԑBcBB>YnZtCwԑBcB&C؟B`B&CBcBwB>XoZtCwԑBcBCwԑB>B&C؟B`B>YTCwԑB>BC؟BB&C؟B`B#>"aC BcBtCwԑBcB&CwԑBBg>8&Ԡ]&C B>IBC BcB&CwԑBBb>W ^CwԑB>BC BcBC B BS$>>"atCwԑBcBC BcBCwԑB>Brr>+=h`C=BcBC BcB&C B>IBR?9Y&C=B>IBC=BcB&C B>IBa?a=xXC B BC=BcBC=B!JB?r>+=h`C BcBC=BcBC B BN=?O+e>SKCTrBcBC=BcB&C=B>IB ?5>UB&CTrB BKCTrBcB&C=B>IBV?}>:C=B!JBKCTrBcBCTrB'B<?<)e>SC=BcBKCTrBcBC=B!JB8I>e?8>&CTrB;;BCBBCTrBB7I>We?9>&C8BBCBB&CTrB;;BN?6?/KCTrBcB&CTrB B&CBcB3??fCTrB'BKCTrBcB&CBcB?b?bCTrB'B&CBcBC/yBB@>>6.?ݔC/yBB&CBcB&CBB/>`c?FGCBB&CBB&CBOպBA*>ac??FGCBBCbӝBB&CBB?sH?O7CbӝBBC/yBB&CBB\>q?VCbӝBBlCB?!BCB?!B>g?&CB8BCB?!BlCB?!BDG>%=f?uG>&CB8B&CBUBCB?!B[q>[q?5\q>&CBUBCBUBCB?!B!di>!di?O >CBUB&CBUBC#B}BdK>sh?ݼ>&CBUB&CB}BC#B}B7I>e?67>C#B}B&CB}B&CTrB;;BM5I>He?5>CTrBBC#B}B&CTrB;;B+>Dac?.FGCBB&CBOպB&C TBB>g?_x==lCB?!BGCBB&C TBB˥>&q?ݴ=&CB?!BlCB?!B&C TBBJ>;f?L>lCB?!B&CB?!B&CB8B>YSξXHDCBB_C6BBC6BB>3SξfHDCBBC6BBDC:kB2Bkj>LҾEDC:kB2BC6BBC:kB1B4>RξH_C6BBDCBBDC6BپB?eIC xBBC؟BBUC؟BB?dIUC؟BBC:kB1BC xBB=?@mfIUC؟BBDC؟B˻BC:kB1Bk>OۇKDC؟B˻BDC:kB2BC:kB1B.?LDCaBBUC؟BBC؟BB|-?2aLDCaBBC؟BBDCwԑB!BL?j(NDCwԑB!BC؟BBCwԑB>B-?LUC؟BBDCaBBDC؟B˻B A?MrgXDCwԑB!BCwԑB>BDC B2>BY?p :QDC B2>BCwԑB>BC B Bv?v>CDuC=BBDC`BBDC B2>Bv?v>BDuC=BBDC B2>BC=B!JB? =RC=B!JBDC B2>BC B B!*?r"*>:DC`BBuC=BBDC=BeBK??q>X95CTrBBuC=BBC=B!JB,?nP>,CTrB'B5CTrBBC=B!JBʫ6?~> DC=BeB5CTrBBDCTrBB1{?rS>#.uC=BB5CTrBBDC=BeB/>^??>DCTrB8B@CTrBUBDClBUB > Z?>DClBUB1CTrB}BDCQB}Bv'>X?Ȱ>@CTrBUB1CTrB}BDClBUBH;>H;U?>CTrBBDCQB}B1CTrB}B;>J:U?ʓ>CTrBBCBBDCQB}B>_dW?>CBBDCBBDCQB}B[??5CTrBBCTrB'BC/yBB??DCTrBB5CTrBBC/yBB<??$DCTrBBC/yBBDCBBR?H?6DCBBC/yBBCbӝBB ? S?vpDCBBCbӝBBDCmB?!B>$ _? ߼CbӝBBCB?!BDCmB?!B>]?7B>@CTrBUBDCTrB8BDCmB?!B)>=]?8B>@CTrBUBDCmB?!BCBUBZ?Z>CBUBDCmB?!BCB?!B>w"W?\>1CTrB}B@CTrBUBCBUB>Y?Т>C#B}B1CTrB}BCBUB<>:U?>1CTrB}BC#B}BCTrBBy%?Q =-DCBBDC:kB2BC:kBB(?̈q;1C:kBBlC:kB@BlCTWB?!Be ?: 3DCBBC:kBBlCTWB?!BsU#?a4DCBBlCTWB?!BjC6B?!Bd?x24DCBBjC6B?!BDC6BپBz? 8jC6B?!BlCTWB?!BlC6BB)?ēfl1KC؟BBC:kBBDC:kB2Br+?Tf`+.DC؟B˻BKC؟BBDC:kB2B4?nd)lC:kB@BKC؟BBlC؟B B^)?`ēm1C:kBBKC؟BBlC:kB@B~.?RMz.DCaBBDCwԑB!B|̥CwԑBB].?Nx.DC؟B˻BDCaBB|̥CwԑBB -?X/DC؟B˻B|̥CwԑBBKC؟BB5?)"g`*KC؟BB|̥CwԑBBҌCwԑBBH?zJSlC؟B BҌCwԑBBlCwԑB1B_6?>gw*KC؟BBҌCwԑBBlC؟B Bt4?{m4ߥC BB|̥CwԑBBDCwԑB!Bv4?wv4DC B2>BߥC BBDCwԑB!B7S:?‹.lCBBߥC BBlC BfB~U:?.lCBBҌCwԑBBߥC BB,S:?X.ҌCwԑBB|̥CwԑBBߥC BBgL?*WҌCwԑBBlCBBlCwԑB1B5.3?ו>5.3ߥC BBDC B2>BDC`BB=?>V(DC`BBDC=BeBlC=BB=?p>V(ߥC BBDC`BBlC=BBʺ7?7>?,ߥC BBlC=BBlC-#BB7?I7>?,ߥC BBlC-#BBlC BfBk?k>1lC-#BBlC=BBlC=BNtB?=?7>lC=BneBoC=B}BlCg՗B}BӒ ?YI?.>lCg՗B}B_C=BBlCBB?:?ܺ>oC=B}B_C=BBlCg՗B}BP%?v >ϥCTrBBlC=BBDC=BeB6?> DCTrBBϥCTrBBDC=BeBO2? ,?vulC=BNtBCTrB?!BlC՘B?!B2?,?tulC=BNtBlC=BBCTrB?!BJ??FlC=BBϥCTrBBCTrB?!B45?/?>DCTrB8BlC՘B?!BCTrB?!BP4?1?>DCTrB8BDClBUBlC՘B?!B?I?;DClBUBlCBUBlC՘B?!BT?ٵD?>oC=B}BlC=BneBlCBUB ?D?>oC=B}BlCBUBDCQB}BA"?B?>DCQB}BlCBUBDClBUBC?A?>_C=BBoC=B}BDCQB}B0 ?kE?>DCBB_C=BBDCQB}Bz???ᄆϥCTrBBDCTrBBDCBB4?#4?ʽCTrB?!BϥCTrBBDCBB4?#4?ʽDCmB?!BCTrB?!BDCBB2?2?I>CTrB?!BDCmB?!BDCTrB8Bv-?[w-lCTWB?!BlC:kB@BƦC:kB?!BfFB?#ƦC:kB?!B[C:kBB[CBUB*?2a1lCTWB?!BƦC:kB?!B[CBUBC2?@5lCTWB?!B[CBUBRC6BUBd"?ۙ V6lCTWB?!BRC6BUBlC6BB)?h_h=RC6BUB[CBUB[C6BuBpU0?Epg:V0 C؟B?!BƦC:kB?!BlC:kB@BKL6?~(lC؟B B C؟B?!BlC:kB@BU?[C:kBB C؟B?!B[C؟BB~=?y! ƦC:kB?!B C؟B?!B[C:kBB8;?ҽ,&CwԑB?!B C؟B?!BlC؟B BhH?JlCwԑB1B&CwԑB?!BlC؟B Bi?yFӾ[C؟BB&CwԑB?!B[CwԑB(BV?" C؟B?!B&CwԑB?!B[C؟BBW:?۾.lCBBlC BfB C BBLXL??lCwԑB1BlCBB C BB9L?-+lCwԑB1B C BB&CwԑB?!BO_?=&CwԑB?!B C BB?C B?!Ba?g>)˾[CwԑB(BFC BUB[CZBUBa?>˾[CwԑB(B&CwԑB?!BFC BUB v?G=&CwԑB?!B?C B?!BFC BUBZ?M4?7[CZBUB3C B}B[CB}Bmt?h!>T=FC BUB3C B}B[CZBUBD=9?-?u>[CB}BC BB[CgBBƐT??!"o>3C B}BC BB[CB}B7?7>;, C BBlC BfBlC-#BBek?ϝk>lC-#BBlC=BNtBIC=B?!Bnk?k>lC-#BBIC=B?!B C BBP?U&>I C BBIC=B?!B?C B?!Bb?4d>p?C B?!BIC=B?!BFC BUB3R?3?CҼFC BUBIC=B?!BC=BUB6?^(?$p>lC=BneBlCg՗B}B3C B}B6?[(?!#p>lC=BneB3C B}BC=BUBSR?1?=C=BUB3C B}BFC BUBR8?)?\O>C BB3C B}BlCg՗B}B/?/?إu>lCBBC BBlCg՗B}B2?h,? vuIC=B?!BlC=BNtBlC՘B?!B7?\2?̷C=BUBIC=B?!BlC՘B?!B4?4?alCBUBC=BUBlC՘B?!BxV0?sU0?%mg>C=BUBlCBUBlC=BneB8MB?#[CBUB[C:kBBsC:kBUBo3?3[C6BuB[CBUBsC:kBUBd1?o߽]6[C6BuBsC:kBUB'C6B}BG?cx=>'C6B}BsC:kBUBC:kB}B T?D=l(C6BBC:kB}B(C:kBxBܾC:kB}BCC؟BUBC؟B}Bk?TV>YP(C:kBxBC؟B}B(C؟BBLQ?z> C:kB}BC؟B}B(C:kBxBCeW?>!=. CwԑBUBCC؟BUB[C؟BB i?AӾ[CwԑB(BCwԑBUB[C؟BBn0f?Ǧ,=߾CC؟BUBCwԑBUBC؟B}B0o?h>KQC؟B}BCwԑBUBCwԑB}B-O?/?D(C؟BB$CwԑBB(CBB'O??p?(C؟BBC؟B}B$CwԑBBt?>)7C؟B}BCwԑB}B$CwԑBBa?>v˾CwԑBUB[CwԑB(B[CZBUB0p?>,RCwԑB}BCwԑBUB[CZBUBXZ?4?7[CB}BCwԑB}B[CZBUBoZ??#$CwԑBBCwԑB}B[CB}B=9?+-?6u>[CgBB$CwԑBB[CB}B/?RN>-C:kBBC6BB(C6BBT?=]t(C:kBxBC:kBB(C6BB2BD?B>]:C؟BBC:kBB(C:kBxBk?\V>V(C؟BB]:C؟BB(C:kBxB֧O??E]:C؟BB(C؟BB(CBB8!>qK?@C:kB6BC6B[B΢C6B6B\1|>fV?C:kB}%BC6B[B@C:kB6B>ER?YC6B3BYC:kBB@C:kB6BdSH>#L?΢C6B6BYC6B3B@C:kB6Bڴ>=aJ?YCۋB6BC:kB}%B@C:kB6B>raJ?YCۋB6BYC؟BXBC:kB}%Bо>dW?YC؟BXBC؟BJBC:kB}%B꾿>_J?@C:kB6BYC:kBBYCۋB6B?aSZ?$H?CwԑBgBYCyUBBYCwԑB?>BY>]J?C(BBYCyUBBCwԑBgBO\>[J?YCyUBBC(BBC؟BJB-\/?EaF?YC؟BXBYCyUBBC؟BJBto;?`@?C BTBYCB\BYC BYB4@X6?֎?CAB\BYCB\BC BTB9 c,? c,?YCB\BCAB\BCwԑBgB9 c,? c,?YCwԑB?>BYCB\BCwԑBgBCV?>CBBC=BBC=BC=BBYCQ]BZ(BYC=BrBWQ?e>C=BBCBBYCQ]BZ(Bzæ?M?G?CBBCBZ(BYCQ]BZ(BW>8?5!?YCQ]BZ(BCBZ(BC BTBڼt;?u;?YC BYBYCQ]BZ(BC BTBV?>C=BC=BCęBBYCDBBYCBB Q?>C=BBYC=BrBYCDBBr ɾYX>+sV?&C6BOB&C:kBw@BYC6B3BޯX֨>a?&C:kBw@BYC:kBBYC6B3Bw݄ o>T?YC؟BXB&CGB6B&C؟B9YB1(>wVZ?YCۋB6B&CGB6BYC؟BXB->TZ?&CGB6BYCۋB6BYC:kBBf>P?&C:kBw@B&CGB6BYC:kBBI78+ ?TR?YCyUBB CwԑBBYCwԑB?>B48) ?R? CwԑBBYCyUBBYC؟BXB*88 * ?VR? CwԑBBYC؟BXB&CwԑBBK[x?oF?&CwԑBBYC؟BXB&C؟B9YB]rC?X!?YCB\BӣC B\BYC BYB7?F/?ӣC B\B&C4BB&C BB7?E/?YCB\B&C4BBӣC B\BLJU2?U2?YCB\B CwԑBB&C4BBLJT2?T2?YCB\BYCwԑB?>B CwԑBBʇU2?U2? CwԑBB&CwԑBB&C4BBMJq[?~i?YC=BrB&CnBZ(B&C=BoB)E$[?eh?YCQ]BZ(B&CnBZ(BYC=BrB^rC?!?YC BYBӣC B\B&CBB\B\[wC?!?YC BYB&CBB\BYCQ]BZ(BM?:?YCQ]BZ(B&CBB\B&CnBZ(Bg7?>/?ӣC B\B&C BB&CBB\Ba?>&C8BBYCBB&CBBa?>YCBBYCDBB&CBBC[?f?&CBBYCDBBYC=BrBFb[?Gf?&C=BoB&CBBYC=BrBn >T?CʼnBB&C6BOBXC6BB >6T?CʼnBBC:kB B&C6BOB[c >[c?C:kB B&C:kBw@B&C6BOBT `>{T?XC6BBC6B8BCʼnBB"'?QY?&CGB6BFC؟B6B&C؟B9YB%"f?PY?FC؟B6B&CGB6B&C:kBw@B"?(QY?FC؟B6B&C:kBw@BC؟BBz^?/>&C=BoBC5BZ(BC=BBEY>o(Z?ϊ?&CnBZ(BC5BZ(B&C=BoBn=ՒU?W( ?ߤC B\BC B4SBC5BZ(B{=U?e( ?ߤC B\BC5BZ(B&CBB\BF=8L?W?&CBB\BC5BZ(B&CnBZ(BLg=h 9?P0?ߤC B\B&CBB\B&C BBnC>Y_?T>CBB&C8BBCݘBB4>^?@o>&C8BB&CBBCݘBB.0>X??CݘBB&CBB&C=BoBk>^?>C=BBCݘBB&C=BoB䞽U?S?C:kB BDC|BBDC:kBZB޽m>]?CʼnBBDC|BBC:kB B=޽…>]?DC|BBCʼnBBC6B8B?*L ?Q?DC6BBDC|BBC6B8Bg=-?N>:?DC؟BBMC؟B6BDC]B6BϿ='???DC]B6BMC؟B6BC؟BB"Ͽ='???DC]B6BC؟BBDC:kBZB ?_U?DC:kBZBC؟BBC:kB BTMn>H?^?DCwԑB/B}eCwԑBBDCzgBBZ=)?X>?MC؟B6BCwԑB9BC<ҎB6B=w)?=?DC؟BBCwԑB9BMC؟B6BL>G6?Q,?DC؟BB}eCwԑBBCwԑB9BX>.6?s+?DC؟BBDCzgBB}eCwԑBBdZ=a)?EX>?MC؟B6BC<ҎB6BC؟BBZ#>N??C B4SBDC“B\BDC BQB>pK?щ?CB\BDC“B\BC B4SB`Ln>&H?O^?}eCwԑBBDCwԑB/BDC“B\BlLn>%H?N^?}eCwԑBBDC“B\BC[BB2>q(1?q(1?}eCwԑBBC[BBCwԑB9B&X>VU?ר>DC=B>BLC=BBDC$jBB&>0P?cN>C=BBDC$jBBLC=BB8%>zP?*G>C=BBC5BZ(BDC$jBBó>m U?Ҵ>C5BZ(BDCÕBZ(BDC$jBBCN>RI?Ju?DCÕBZ(BC5BZ(BC B4SB$> N??DC BQBDCÕBZ(BC B4SB\>TU?>LC=BBDC=B>BDCBB!V>VU?ܪ>LC=BBDCBBCݘBBu>P?>CݘBBDCBBCBBS%>P?L>LC=BBCݘBBC=BB?Ͽ='????DC:kBZBlC>BBlC:kBB+=s?NT?DC|BBlC>BBDC:kBZB +=?NT?lC>BBDC|BBDC6BBMkpH(?WT@?lC6BBlC>BBDC6BB;Q>F?U?DC؟BBlCB6BlC؟BnBz%>+g,?8?DC]B6BlCB6BDC؟BBO>ق&?yL>?lCB6BDC]B6BDC:kBZBP=P4?P4?lC:kBBlCB6BDC:kBZBd>DCwԑB/BlCG BBlCwԑBHBӤ>YC?v?DCzgBBlCG BBDCwԑB/B?>^2?X'?lCG BBDCzgBBDC؟BB?Q>F?X?lC؟BnBlCG BBDC؟BB3>J?=>lC BǟB C BZ(BlCΓBZ(B >U@?>DC BQBlCΓBZ(B C BZ(Bb >@?>DC BQBDC“B\BlCΓBZ(BoM>,K?[>DC“B\BlC*B\BlCΓBZ(B>=?K ?lC*B\BDC“B\BDCwԑB/B>JK?!>lCwԑBHBlC*B\BDCwԑB/B?B?>DC=B>BlCBB_C=BB;?B? >DC=B>BDC$jBBlCBB` ?K?b>DC$jBBlCn\BBlCBB8>*J?L> C BZ(BlC BǟBlCn\BBE2>J?±> C BZ(BlCn\BBDCÕBZ(BV>eE?:>DCÕBZ(BlCn\BBDC$jBB >@? > C BZ(BDCÕBZ(BDC BQB?B?ĝ>_C=BBDCBBDC=B>B^d>>? ?lC:kBB[C7BB[C:kB,BI>'?>?lC>BB[C7BBlC:kBB> '?5>?[C7BBlC>BBlC6BBP=P4?P4?[C6Bq[B[C7BBlC6BBq>N?>[C؟B=B#EC؟BB[CrBB>8 [ZI?H?lCB6B[CKB6B[CrBB}\>-?-?[CKB6BlCB6BlC:kBBd>4>?N ?[C:kB,B[CKB6BlC:kBBm?:H?ץ>[CwԑB5B>CwԑBZ(B[CBZ(B>N?>[CBZ(BCwԑB\B[C&B\B6& ?$>?A >>CwԑBZ(BCwԑB\B[CBZ(B>UG?>#EC؟BBlCwԑBHBlCG BB>KQH?{#>[C؟B=BlCwԑBHB#EC؟BB,w>^H?7>[C؟B=BCwԑB\BlCwԑBHBs>8H?>[C؟B=B[C&B\BCwԑB\B>(?X_>>[CgBBC BB[C6BB 3?'?J)>C BBC BB[CgBB= ?TsA?kf>>CwԑBZ(BlC BǟBlCΓBZ(BF%?X>?r>[CwԑB5BlC BǟB>CwԑBZ(B?փ>?>[CwԑB5BC BBlC BǟBbt!?%;?\+>[CwԑB5B[C6BBC BBu( ?>?>CwԑB\B>CwԑBZ(BlCΓBZ(Bs>3G?>lC*B\BCwԑB\BlCΓBZ(B:>A?c>CwԑB\BlC*B\BlCwԑBHB.?0.? >C BBC BBlCBB?#8?4>lCn\BBC BBlCBB3?$?6?̑>C BBlCn\BBlC BǟB >ExJ?>(C:kBNB,ŧC:kB6B(CB6Bv>I5??[C:kB,B(CB6B,ŧC:kB6Bڟ>G5??[C:kB,B[C7BB(CB6B *>I? ?[C7BB(C|cBB(CB6B:>.?.?(C|cBB[C7BB[C6Bq[B_g> @??(C6B1B(C|cBB[C6Bq[B?F?>(C؟B#BݧC؟B\B(CuB\B\ ?:|[C؟B=B(CuB\BݧC؟B\BY ?[C؟B=B[CrBB(CuB\B ?K?b>[CrBB(CBeBB(CuB\B>yJ?>,ŧC:kB6B(C:kBNB(CBeBB > yJ?g>,ŧC:kB6B(CBeBB[CKB6Bc>;?>[CKB6B(CBeBB[CrBB>LJ5??,ŧC:kB6B[CKB6B[C:kB,B:?.?(CBBCCwԑBB(C%=BB*rU?ng?):>$CwԑBBCCwԑBB(CBB&5?)?y>[CwԑB5B(C%=BBCCwԑBBOl4?>+?#l>[CwԑB5B[CBZ(B(C%=BB0$?B?D=[CBZ(B(C̎BZ(B(C%=BBB?F?>ݧC؟B\B(C؟B#B(C̎BZ(B?F?>ݧC؟B\B(C̎BZ(B[C&B\Bc?7:?>[C&B\B(C̎BZ(B[CBZ(By] ?0{ݧC؟B\B[C&B\B[C؟B=Bm8?I,?-a!>CCwԑBB$CwԑBB[CgBBE2?B2?1>[C6BBCCwԑBB[CgBB/?w/?q>CCwԑBB[C6BB[CwԑB5B1?c?cC6BNBC:kBBCQBB1?c?cC6BNBC6BBC:kBB#`?\>\C6BBC:kBBC:kBBM??ܳCQBBC:kBBC:kBB##?6VA?>C:kBBe٨C:kB\BC B\B?hF?>C B\B|C:kBBCBB4k?;?>e٨C:kB\B|C:kBBC B\B ?t:?>(C:kBNBCBB|C:kBB ?.:?>(C:kBNB(CB6BCBB)j> K?U>(CB6BCŖB6BCBB[>>RN?s>?C6BBC6BvBCŖB6B@>N?>?C6BBCŖB6B(C|cBBm>;??(C|cBBCŖB6B(CB6B> 8?W??C6BB(C|cBB(C6B1B(X?)>ިC:kBB]:C؟BBC:kBBG??/ÕC:kBB]:C؟BBMC؟BB1?N7?cC:kBBP4C؟BZ(BCBZ(B1?7?C:kBBC:kBBP4C؟BZ(BHG??'~=C:kBBMC؟BBP4C؟BZ(B[ ?h=?Ay>e٨C:kB\B(C؟B#B(CuB\B[--?W7?&>C:kBB(C؟B#Be٨C:kB\B"(?7?gd>C:kBBP4C؟BZ(B(C؟B#BA0?5?~>C:kBBCBZ(BP4C؟BZ(BCi?;?>|C:kBBe٨C:kB\B(CuB\B? B?>(CBeBB|C:kBB(CuB\BM ?:?>|C:kBB(CBeBB(C:kBNBHgX?FA?OMC؟BB]:C؟BB(CBBH:?.?(C%=BBMC؟BB(CBB:?b.?g=P4C؟BZ(BMC؟BB(C%=BBC1?6?Ō=(C̎BZ(BP4C؟BZ(B(C%=BB!_-?W2?j>P4C؟BZ(B(C̎BZ(B(C؟B#Bfb,xc,q:[CAB lB[CBnB3CABnB(Ne#+[CBnB[CB37uB3CAB37uBd553CABnB[CBnB3CAB37uBo}S=[CB37uB[CBq{BVCABq{BbLb >3CAB37uB[CB37uBVCABq{B [CBaB[CBzaB\PCBzaB:/e̾[CBzaB[CʩBdhB٦CBdhB''''\PCBzaB[CBzaB٦CBdhB5I!ʩBdhB[CAB lB3CABnBu5*G![CʩBdhB3CABnB٦CBdhB8_aý٦CBdhB3CABnBPæCBnB6`3CABnB3CAB37uBPæCBnBnL}>3CAB37uBCB37uBPæCBnB"sˆ<('>3CAB37uBVCABq{BCB37uBjkͼ>VCABq{B\PCBq{BCB37uBA+奾?+[C~%B^B[CBaB\PCBzaB3@+q祾+A+C~%BzaB[C~%B^B\PCBzaBdbLƾQ\PCBzaB٦CBdhBC~%BzaB2iVxv٦CBdhBBC~%BdhBC~%BzaBh vQ׽٦CBdhBPæCBnBBC~%BdhBs~;;=PæCBnBIC~%BnBBC~%BdhBv1>PæCBnBCB37uBIC~%BnBi D=x>CB37uB C~%B37uBIC~%BnBRy>(?[C Bq{B[C~%Bq$yB C~%B37uBERy>?[C Bq{B C~%B37uB\PCBq{BfjPA=-G>\PCBq{B C~%B37uBCB37uB~C&9X4M(CBlB(Cw'BnBCBnB//Mq(Cw'BnB(Ca B37uB+ʧCB37uBq>)ʓ7aCBnB(Cw'BnB+ʧCB37uB?! ;G(Ca B37uB(CBq{BCBq{B8s3r3Ք+ʧCB37uB(Ca B37uBCBq{Bh! (CABpbB(CtBdhB-CABdhBs$h2ԡCBnB[CBnB[CAB lB'|2(CBlBCBnB[CAB lBN&1(CBlB[CAB lB-CABdhB*09i(CBlB-CABdhB(CtBdhB=)7ma+ʧCB37uB[CBnBCBnBX(NFe#+[CB37uB[CBnB+ʧCB37uBvLKCBq{B[CB37uB+ʧCB37uBCoQ =[CBq{B[CB37uBCBq{B:6,[CBaB(CB]B(CrBzaB], V[CBzaB[CBaB(CrBzaBN&(~-CABdhB(CrBzaB(CABpbB";@-CABdhB[CʩBdhB(CrBzaBbw,9⾔[CʩBdhB[CBzaB(CrBzaB/2r#-CABdhB[CAB lB[CʩBdhB TgrA(C~%BYB(CpB=[B%ߧC~%B=[B zfvsA(CpB=[B[C~%B^B%ߧC~%B=[B$ jg'sA(CpB=[B(CB]B[C~%B^B- gsA(CB]B[CBaB[C~%B^B#Ry>/?[C Bq{BCC~%Bq{B[C~%Bq$yB>7CSBqBCeB37uBGCSB37uBh*h*aCeB37uBCBq{BPCSBq{BsU=A⎾GCSB37uBCeB37uBPCSBq{BQQ4iCB fBCBdhBVCBdhB4׾4Wڮ(CBlBVCBdhBCBdhB 6׾U4Wsܮ(CBlBCBdhB(Cw'BnB+44Aپ(Cw'BnBCBdhBC BnB>7GCSB37uBC BnBCSBqB(?7GCSB37uB(Ca B37uBC BnBӳMck(Ca B37uB(Cw'BnBC BnB?V=ᎾPCSBq{B(Ca B37uBGCSB37uBI?!n=G(CBq{B(Ca B37uBPCSBq{B$Q{.|.CAB _BCBzaBtECABzaBH켾H<3VCBdhB(CtBdhB(CABpbBx<CB fBVCBdhB(CABpbBx:CB fB(CABpbBtECABzaBg38%!CB fBtECABzaBCBzaB4׾4WڮVCBdhB(CBlB(CtBdhBcBJCB{8[BCqB=[BͨCB=[BZ[7_ؾY_ͨCB=[B(CpB=[B(C~%BYBG{`ؾY_ͨCB=[B(C~%BYBCB{8[B{a=naiCB{8[B(C~%BYBC~%BXBD{_ؾY_ͨCB=[B(CB]B(CpB=[Bzz[ >[CBq{B[CAB|{BVCABq{B:URǕs ?[CAB|{B[CB.)|B\PCBq{BWgRF>VCABq{B[CAB|{B\PCBq{B@O v>JV?\PCBq{B[CB.)|B[C Bq{Bii̾ެ(CBq{B(C~BBӧCBB|@Z"4>CBq{B(CBq{BӧCBBо|N)=(C~BB(CHBv9BCBv9B#^¾>ӧCBB(C~BBCBv9B=dof>(CHBv9B(CBBCBv9B^[ғP>[CBq{BﶧCABB[CAB|{B}[Jj>[CBq{BCBq{BﶧCABB(v g>CBq{BӧCBBﶧCABBc^1_=3>(CUBv9B(CAB .BﶧCABB^^=J>(CUBv9BﶧCABBCBv9B=nY>CBv9BﶧCABBӧCBB fbf=]>CBv9B(CBB(CUBv9BXeu>(>֧CBB[CAB|{BﶧCABBWUF•Xn ?[CB.)|B[CAB|{B֧CBB?so>'?(CAB .B(CB'B֧CBB]0 >ָ>ﶧCABB(CAB .B֧CBBm;>I?CC~%Bq{B(CrBB(C~%B̀BOCg> ?[C Bq{B(CrBBCC~%Bq{BEF>?[C Bq{B֧CBB(CrBBO3v>Q?[C Bq{B[CB.)|B֧CBBU<>_?֧CBB(CB'B(CrBBeoHo'w3CBBCBBICBB)joi[>CBBCB BICBB**CdB!~BC\$BBaCdBB|?\!DLC\$BBCO!Bv9BCdBv9BN2N2ԈaCdBBC\$BBCdBv9Bh˾CO!Bv9BC 3BnB%CdBnB&B7W$b=CdBv9BCO!Bv9B%CdBnB[j̾/C 3BnBCBBICBBQj;C/C 3BnBICBB%CdBnB3vQ)dW>%CdBnBICBBѨCdBBk>CB BCdB5BѨCdBBu)CYf>ICBBCB BѨCdBBê**CBq{BCdB!~BaCdBB**CBq{BaCdBBPCSBq{B\RV PCSBq{BaCdBB-CSBBQx 6aCdBBCdBv9B-CSBB nn=CdBv9B]:CSBv9B-CSBBl =CdBv9B%CdBnB]:CSBv9BYxo%3&>%CdBnB}CSBnB]:CSBv9Bou|8@W>%CdBnBѨCdBB}CSBnBmnnD>ѨCdBBͨCSBB}CSBnBdN <>CdB5BCSBBBͨCSBBnn7nB>ѨCdBBCdB5BͨCSBBA#^-CSBB(CBq{BPCSBq{Bi ̾(C~BB(CBq{B-CSBB#jI̾2-j=]:CSBv9B(C~BB-CSBB|/፞=(CHBv9B(C~BB]:CSBv9B4d *n>(CHBv9B
CBnB(CBB.dc7n>(CHBv9B]:CSBv9B
CBnB6ss<ț>]:CSBv9B}CSBnB
CBnBmn?n}CSBnBͨCSBB
CBnB*cp=p>ͨCSBBvCBB
CBnB wSk> ?CSBBBCBBvCBBc7=[>ͨCSBBCSBBBvCBBK^+_=>(CUBv9BV*CABv9B(CAB .B6eXf=J >(CBBV*CABv9B(CUBv9Bff=7>(CBB
CBnBV*CABv9BPP> ?
CBnB,CABnBV*CABv9BHB> ?CBBCABۈB,CABnB`EB^&> ?CBB,CABnBvCBBrt_t_>t>vCBB,CABnB
CBnB@GTҺ>?vCBBCBBCBB9S>b>yzCBv9B(CAB .BV*CABv9B?p>j?(CB'B(CAB .ByzCBv9B5>y?CBnBCBByzCBv9Bf5>y?CBnByzCBv9B,CABnBr"J>r?,CABnByzCBv9BV*CABv9B=>5?,CABnBCABۈBCBnBVl;>J?(CrBB3C~%BB(C~%B̀BЙ)iR>V!?3C~%BBCBv9BC~%B2B<0 >ў'?(CrBBCBv9B3C~%BB?*D>v?(CrBByzCBv9BCBv9B<=>`?(CrBB(CB'ByzCBv9Bz}2>?yzCBv9BCBBCBv9Bς0dcσ0[CZBv\B[C~%B^BC~%BzaB5GL-ICZBzaB[CZBv\BC~%BzaBhh=dC~%BzaBBC~%BdhBICZBzaBsx>IC~%BnBCZBnBwCZBdhBOU>>[C*B37uB[CZBctBCZBnB=OEר>>>[C*B37uBCZBnB C~%B37uBdϝd>S > C~%B37uBCZBnBIC~%BnB?M¦>2H? C~%B37uB[C~%Bq$yB[C*B37uB77=K/[CBq]B[CZBv\BICZBzaB\(?43>jG$^CBzaB[CBq]BICZBzaB:x;i>ԿxICZBzaBwCZBdhB^CBzaBMRj>R=wCZBdhBCBdhB^CBzaBD>9>[C4BnB[CBmBCBdhB;D:>>[C4BnBCBdhBCZBnBbh=>>CZBnBCBdhBwCZBdhB4@>>CZBnB[CZBctB[C4BnBv'? v[CBq]B^CBzaB[CBzaB52?&=^CBzaBCBdhB[CBdhBy 7CBdhB[CBmB[CBdhB@oJ(CZBXB(C~%BYB%ߧC~%B=[B h{wL6CZB=[B(CZBXB%ߧC~%B=[B0ՁH%ߧC~%B=[B[CZBv\B6CZB=[B(c]!I[C~%B^B[CZBv\B%ߧC~%B=[BOX>>[C*B37uBc`CZB37uB[CZBctB9M˦> O?[C~%Bq$yBc`CZB37uB[C*B37uBeAM]>KF?[C~%Bq$yBCC~%Bq{Bc`CZB37uBm6>^?CC~%Bq{BCZBq{Bc`CZB37uBEѽQ(CB6WB(CZBXB6CZB=[BA0=L8oCB=[B(CB6WB6CZB=[B.=8,=+6CZB=[B[CBq]BoCB=[BH5>yM[CZBv\B[CBq]B6CZB=[B+}Ct>>[C4BnB;jCBnB[CBmBz?<>>[CZBctB;jCBnB[C4BnB@P>h>[CZBctBc`CZB37uB;jCBnBl2\?>c`CZB37uB@CB37uB;jCBnBA??(CBq{B(CB vB@CB37uBN?!?(CBq{B@CB37uBCZBq{Bձ,?$ ?CZBq{B@CB37uBc`CZB37uBy%& >C-(C[BZB(CB6WBoCB=[B(N>(C[B=[B(C[BZBoCB=[B=?[CBzaBoCB=[B[CBq]B/!?n [CBzaBC[BzaBoCB=[BOT">BΥC[BzaBC[B=[BoCB=[B})>?"=[CBdhBC[BzaB[CBzaB*'ԧC[BdhB(C|BnB(C[BmB'"3?>[CBdhB(C|BnB'ԧC[BdhB'R*?Cv>[CBdhB;jCBnB(C|BnB)!)?>[CBdhB[CBmB;jCBnBW$"X$"?>;jCBnB@CB37uB(CHB37uBE!#?D>(C|BnB;jCBnB(CHB37uB::?:?@CB37uB(CB vB(CHB37uB?(C[BZBC[B=[B(CIB=[B!'?=C[BzaB'ԧC[BdhB(CBdhBKH&e}A?L=(CnJBzaBC[BzaB(CBdhBH!j5?2>'ԧC[BdhB(C[BmB(CBdhB; Bһ6nC~%BXB(C~%BYBCZB2VBz`f+qoCZB2VB(C~%BYB(CZBXBhT!xCZB2VB(CZBXBCBVBM;ͼyCBVB(CZBXB(CB6WBGǾ:C?'2?(CB vBCSBq{BCBO{B&G;x?O"?(CBq{BCSBq{B(CB vB0cg?ATCBVB(CB6WBC[BeZB.cjH>.cC[BeZB(CB6WB(C[BZBZcZc?u>(C|BnBAoC[BnB(C[BmBt_]t_?t>AoC[BnBCB37uBC[B~pBot_ot_?t>AoC[BnB(C|BnBCB37uBɤsF?o?(C|BnB(CHB37uBCB37uBP,?,?CB37uB(CHB37uB(CB vBy3ȾC?qg?CBO{BCB37uB(CB vB44?4C[BeZB(C[BZB(CIB=[B44?4CG}B=[BC[BeZB(CIB=[Bss?qCG}B=[B(CIB=[BC}BzaBss?q(CIB=[B(CnJBzaBC}BzaB}}?=C}BzaB(CnJBzaBCnJBdhB\ݽ|? ]=(CnJBzaB(CBdhBCnJBdhBZcZc?u>(C[BmBAoC[BnBCIBnB%Yc#\c? >(C[BmBCIBnB(CBdhBԽs?>(CBdhBCIBnBCnJBdhBt_t_?t>AoC[BnBC[B~pBCIBnBk>?(C~%B̀B(CZBZ|BCZBq{BE5ݘ>_I?CC~%Bq{B(C~%B̀BCZBq{Bb??CZBq{B(CZBZ|B(CBq{B'{ ?.?>ܨCZBB(C~%B̀B3C~%BBLu^>#?(CZBZ|B(C~%B̀B>ܨCZBB" ?p?C~%B2BCZBeB>ܨCZBBV??3C~%BBC~%B2B>ܨCZBBr q??(CZBZ|B>ܨCZBBCHBB"-Ti??(CZBZ|BCHBB(CBq{B{$?H??(CBq{BCHBBCSBq{Bs ??>ܨCZBBCZBeBCHBB\y>:!_CAIB!_CUAB|6CAB_L*8mGD!_CUAB!_CmA6BCA6B YB,|6CAB!_CUABCA6B d4We4-!_CmA6B!_C[A,kBCA,kBa@-;maCA6B!_CmA6BCA,kBfP8/=!_C[A,kB!_C>A˟BCA˟B3j3=CA,kB!_C[A,kBCA˟BF/~'>!_C>A˟B!_CA8BCA˟B,3/3̗ éCp#BB éCɯ"BdBCp#BdB<"<"߾ éC\)BdB éCJ&BB?QC\)BBq/Oq/13| éCJ&BB éC)#Bt/BC\)Bt/Bq/q/:2|?QC\)BB éCJ&BBC\)Bt/B*3g13] éC)#Bt/B éCp#BBCp#BdB].3.3Ɩ éC)#Bt/BCp#BdBC\)Bt/BP@lL(pC\)Bt/BCp#BdBwC\)BdB/}2S3CBVKB3C0`BdB{CBdB.|߾3Cp#BjB3C BBZ-Cp#BBr#[7`3C BB3CoGBt/B֩Cp#Bt/B 6;~Z-Cp#BB3C BB֩Cp#Bt/BT14 {CBdB éCɯ"BdB éCp#BB7#+,B7WwN3CBVKB{CBdB éCp#BBX.n7l3CBVKB éCp#BB֩Cp#Bt/Bp9&`:]3CBVKB֩Cp#Bt/B3CoGBt/B$k 93C\)BO,B3C$B6BC\)B6B(,UZ-Cp#BB éCJ&BB éC\)BdB.+53Cp#BjBZ-Cp#BB éC\)BdB{*3Cp#BjB éC\)BdBC\)B6BML]+{۾3Cp#BjBC\)B6B3C$B6B 6;y֩Cp#Bt/B éCJ&BBZ-Cp#BBt$8׳ éC)#Bt/B éCJ&BB֩Cp#Bt/BjY(<֩Cp#Bt/B éCp#BB éC)#Bt/B$ w74Z]CBkBZ]CFBB);CBB999Z]CFBBZ]CBt/BCBt/B ^ 3FE);CBBZ]CFBBCBt/BODA'e3CBVKBCBt/BZ]CBt/BO;Ake3CBVKBZ]CBt/B3C0`BdBZ" 9ҫ3C0`BdBZ]CBt/BZ]CBdB߾ޥ&Z]Cp#BFBZ]CA B6BaժCp#B6BhlL}9h);CBB3C BB3Cp#BjBinwL9 Z]CBkB);CBB3Cp#BjBS9̿Z]CBkB3Cp#BjBaժCp#B6Ba9aZ]CBkBaժCp#B6BZ]CA B6B6] v4FDCBt/B3C BB);CBB|#>⋔3CoGBt/B3C BBCBt/B:OA,eCBt/B3CBVKB3CoGBt/B۾D#x#Z]C\)BBZ]C&BBǪC\)BBk߾0&'aժCp#B6B3C$B6B3C\)BO,B~߾&Z]Cp#BFBaժCp#B6B3C\)BO,B߾&Z]Cp#BFB3C\)BO,BǪC\)BB߾D&FZ]Cp#BFBǪC\)BBZ]C&BB1;daժCp#B6B3Cp#BjB3C$B6B 5wݾ*CBB*CBt/BCBt/B\F8=*CBt/B*CABdBbCBdB,BEFCBt/B*CBt/BbCBdBڽҾs,ӥ*CBB*CB6BCB6BU=)Z]CBkBCB6B*CB6B>6=Z]CBkB*CB6BZ]CFBBFp5>Z]CFBB*CB6B*CBBB&5ˣݾCBt/B*CBB*CBBf5 ݾCBt/BZ]CBt/B*CBBBDBľZ]CBt/BZ]CFBB*CBBKBEbCBdBZ]CBt/BCBt/B [;Z]CBdBZ]CBt/BbCBdB׾3$3$*Cp#BB*C|"BBCp#BBξ)*!CB6BZ]CA B6BZ]Cp#BFBԾ$*8*CBBCB6BZ]Cp#BFB׾|+v*CBBZ]Cp#BFBCp#BBn߾%**CBBCp#BB*C|"BBY羨=\CB6BZ]CBkBZ]CA B6B׾3$3$Cp#BBZ]C&BBZ]C\)BBB׾3$*3$Cp#BBZ]C\)BB*Cp#BB/`l<*Cp#BBZ]C\)BB*C\)BىBǯ۾5b']Cp#BBZ]Cp#BFBZ]C&BBD@U5>Ce4BuBC@Bt/BϬCe4Bt/B=k1ƘǾC@Bt/BC BdBPCe4BdB)'@)#ϬCe4Bt/BC@Bt/BPCe4BdB\X,#lCB'BCuBBhCBB Q8'ZϬCe4Bt/B*CBt/B*CBB} 8y]꾪Ce4BuBϬCe4Bt/B*CBB_],8辪Ce4BuB*CBBhCBB~v8+Ce4BuBhCBBCuBB>&@~$PCe4BdB*CBt/BϬCe4Bt/B 6*CABdB*CBt/BPCe4BdBľ$'$'*CBBCBBCB6B4ξ8-S*CB6B*CBBCB6BeZZ,jhCBBCB6BCB'B:]MY,YkhCBB*CBBCB6BݾB:*CBB*CB6BCB6Bj;nhCBB*CBB*CBB](A.*Cp#BBCp#BBCZBB 5+v+*C|"BB*Cp#BBCZBB"O\2+!CZBB*CBB*C|"BB7Ǿ$a)CBB*CBBCZBBaa EJC\)BbBC'B\BIC\)B\BbN ]DJC'B\B*C\)BىBIC\)B\Bla EJC'B\BCp#BB*C\)BىB9p;Cp#BB*Cp#BB*C\)BىB 8\ĭC( BYBĭCBdBFC( BdBcپT.XĭCe4BBĭCtBBZCe4BBm=(Ce4BuBZCe4BBĭCtBB\ȱ=Ce4BuBĭCtBBC@Bt/Bq`3kC@Bt/BĭCtBBĭCǾ Bt/B :87\ྻFC( BdBĭCǾ Bt/BĭC( BYB 8?]ྻFC( BdBC BdBĭCǾ Bt/B=>־C BdBC@Bt/BĭCǾ Bt/B4ƾ&&ĭCBwBĭC&B6B#qCB6Bܾ߯F0ZCe4BBCuBBCB'BؾY0IDĭCe4BBZCe4BBCB'BF`־/OĭCe4BBCB'B#qCB6Bbо/nĭCe4BB#qCB6BĭC&B6B=ZCe4BBCe4BuBCuBBʿ'%{*ĭCB~BĭCBBwCBB3ƾ&&#qCB6BCB6BCBB4ƾ&&ĭCBwB#qCB6BCBB˿o'%{*ĭCBwBCBBwCBB˿p'%L{*ĭCBwBwCBBĭCBBDӾy,2S#qCB6BCB'BCB6BrͿ'%z*wCBBCZBBCp#BBRʿ?'%{*wCBBCp#BBĭCB~B}vCĭCB~BCp#BBĭCp#B4pBr̿&%{*wCBBCBBCZBB`yƄRC\)BbBĭC\)BQoBĭC#B\B)" `JC'B\BC\)BbBĭC#B\BԂA" `JĭC#B\BCp#BBC'B\BCOĭCp#B4pBCp#BBĭC#B\B a9\CaBBCBdBkiCaBdB߾=6 C( BeABCBt/BC( Bt/Bĝ=kiCaBdBĭCBdBĭC( BYBF\=aBCaBBkiCaBdBĭC( BYBkC=GCaBBĭC( BYBC( Bt/BY=)CaBBC( Bt/BCBt/B7qƾށ-ĭCe4BBCe4BBC8 BBA̾0ĭCtBBĭCe4BBC8 BB߾%6 C( Bt/BC8 BBC( BeAB޾B6 C( Bt/BĭCǾ Bt/BC8 BBo@ؾ~;qY ĭCǾ Bt/BĭCtBBC8 BBuU6AYC( Bt/BĭC( BYBĭCǾ Bt/B &u)&u)ĭCBwBCBKBC=B6Bp Pu)t)ĭC&B6BĭCBwBC=B6B2SC=B6BĭCe4BBĭC&B6Bmƾ6-~Ce4BBĭCe4BBC=B6B[<ĭCB~BCBBC^BBӪE'U-ĭCBBĭCB~BC^BBӪ'dU-C^BBĭCBwBĭCBB>X|6CBKBĭCBwBC^BB6"AJCp#BbBC B\ByӭCp#B\B4CJC B\BĭCp#B4pByӭCp#B\B5AJC B\BCBBĭCp#B4pB?$BCBBĭCB~BĭCp#B4pB5A=$QyӭCp#B\BĭC#B\BĭC\)BQoB?˶j$QyӭCp#B\BĭC\)BQoBCp#BbB@r4VWCp#BbBĭC\)BQoBC\)BB=&QyӭCp#B\BĭCp#B4pBĭC#B\BN־u4Ԗ!_CaB5B!_C)Bt/BCaBB CaBB!_C)Bt/BCBdB&H쾇j8CBdB!_C)Bt/B!_C AdBDly-Ŝ"!_C( B&B!_C=BBFC( BBTھ 7 B éCp#B(B éCa#BPB>C\)BPB :QB0> éCp#B(B>C\)BPBCp#BBD94ZDP>Cp#BB>C\)BPBC\)BB~Y{> éCa#BPB éCn1'BBC\)BBAG>>C\)BPB éCa#BPBC\)BBC'־a> éCn1'BB éC\)B#$BC\)BBB333C0`BdB3CFBBXCBBLQ2'5{CBdB3C0`BdBXCBBFn!G_3CFBB3C<=BPBaCBPBP44j=XCBB3CFBBaCBPBN[=3C<=BPB3CBBB~CBB˂E{ .=aCBPB3C<=BPB~CBB3C l>3CBBB3CBB~CBB%R2&5XCBB éCɯ"BdB{CBdBC/%i=e éC,"BB éCɯ"BdBXCBBLB#= éC,"BB˩Cp#BPB éCp#B(B:GB3#= éC,"BBXCBB˩Cp#BPB60NPl\=XCBBaCBPB˩Cp#BPBM6=aCBPB~CBB˩Cp#BPBU^p>~CBBCp#BB˩Cp#BPB)_VϾ>3CBB3C!B6BtCp#B6B\VϾ>3CBBtCp#B6B~CBB<3Gҋ쾛>~CBBtCp#B6BCp#BBnAg ?3C!B6B3Cp#B*BtCp#B6B@QG>˩Cp#BPB éCa#BPB éCp#B(BM? ;g>Cp#BB éCa#BPB˩Cp#BPBôY{> éCn1'BB éCa#BPBCp#BBC+$־L> éCn1'BBC\)B6B éC\)B#$BC'־> éCn1'BBCp#BBC\)B6BP&G>Cp#BBtCp#B6BC\)B6B9?3Cp#B*B3C\)BqpBC\)B6BCȰ}? ?tCp#B6B3Cp#B*BC\)B6Bi0\2Z]C_BBZ]C%B6B"RCB6BCBBZ]C_BB"RCB6B; w@>Z]C%B6BZ]CBB"RCB6BS032 AI'CBBZ]CBdBZ]CBqBn0I2[=I'CBB3CFBBZ]CBdB/'?s[3CFBB3C0`BdBZ]CBdBM2Ah5]ٽhCBPB3CFBB'CBBxFm!E_3C<=BPB3CFBBhCBPB"FR!=CBB3C<=BPBhCBPBN=3CBBB3C<=BPBCBB2C Pe>3CBBBRتCB6B3CBB Cy :d>3CBBBCBBRتCB6BTq7܄>CBB"RCB6BRتCB6Ba?|޾?Z]CBBZ]CBNBRتCB6B0G}>"RCB6BZ]CBBRتCB6B3aVϾ>RتCB6B3C!B6B3CBBuA/^ ?3C!B6BhCp#B,kB3Cp#B*BsAf ?RتCB6BhCp#B,kB3C!B6B@GH®1?RتCB6BZ]C^B,kBhCp#B,kBGA.?RتCB6BZ]CBNBZ]C^B,kBb0_(?Z]C^B,kBZ]Cp#BBhCp#B,kBHA҃^?ŪC\)B,kB3Cp#B*BhCp#B,kB9q៾?3C\)BqpB3Cp#B*BŪC\)B,kB2_0=/?Z]Cp#BBZ]C\)BBŪC\)B,kBM4l+?hCp#B,kBZ]Cp#BBŪC\)B,kB9(|6pz*Ce4BB*C| BBCe4BB-11B=*C| BB*CY BPB&ϫCe4BPB+Ց90X+Ce4BB*C| BB&ϫCe4BPB444*CY BPB*C BBT«Ce4BBg4%44&ϫCe4BPB*CY BPBT«Ce4BB72A&=*C BB*C} B6BCe4B6BT.3.3a>T«Ce4BB*C BBCe4B6B48>*C} B6B*Ce4B;BCe4B6B)R8\OCe4BBZ]CBBZ]CBqB*g#i;s*Ce4BBCe4BBZ]CBqBE%8F;HY*Ce4BBZ]CBqBbCBdBt!&;](*Ce4BBbCBdB*CABdB+9_X+&ϫCe4BPBZ]CBBCe4BBʙ60 Z]CBPBZ]CBB&ϫCe4BPB7)17T«Ce4BBZ]CBPB&ϫCe4BPBB'B& 58Z]C_BBZ]CBPBT«Ce4BB?$>Ce4B6BZ]C_BBT«Ce4BBrRH=T>Z]C%B6BZ]C_BBCe4B6B+;? 9>Z]C%B6BT«CB,kBZ]CBB; `8>Ce4B6BT«CB,kBZ]C%B6BfLv>Ce4B6B*C!hB,kBT«CB,kBgL}v>Ce4B6B*Ce4B;B*C!hB,kB2tt߾>?*C!hB,kB*CBlBT«CB,kB!#=˱UbCBdBZ]CBqBZ]CBdBOپ¾2>)bCB,kBZ]CBBT«CB,kBuq?md޾?Z]CBNBZ]CBB)bCB,kBI"<?*CBlB*CB˟BCCB˟B#<?*CBlBCCB˟BT«CB,kB187j?T«CB,kBCCB˟B)bCB,kB,Q,?*CB˟B*CB BCCB˟BGڮp?)bCB,kBZ]C^B,kBZ]CBNB0?b(?Z]C^B,kB˫Cp#B˟BZ]Cp#BB 0{d(?Z]C^B,kB)bCB,kB˫Cp#B˟B=ey! ?)bCB,kBCCB˟B˫Cp#B˟BV0UpgU0?*CB B*Cp#B B˫Cp#B˟BV0qgT0?CCB˟B*CB B˫Cp#B˟B 6<>-?#C\)B˟BZ]Cp#BB˫Cp#B˟B_l%m:?Z]C\)BBZ]Cp#BB#C\)B˟BG/'\G??*Cp#B B*C\)BB#C\)B˟B21:1?˫Cp#B˟B*Cp#B B#C\)B˟BD&'4UC( BSBCw$ BBC( BB+6MCw$ BBCVBPB䣬C( BPB*Z}8JC( BBCw$ BB䣬C( BPBTP4Q4QCVBPBCBB{C( BB.U:d䣬C( BPBCVBPB{C( BB:p /÷CB6BCB,kB߬C( B,kBW5+G*cn>NC( B6BCB6B߬C( B,kB8yU>CB,kBC( BB߬C( B,kB9( |6bzC( BB*C| BB*Ce4BB$i7C( BSBC( BB*Ce4BB >&f7*C} B6BBCe4B,kB*Ce4B;B;85>*C} B6BNC( B6BBCe4B,kB)Dؘ>NC( B6B߬C( B,kBBCe4B,kB2FkF>C( BBCuPB˟BҬCe4B˟BFlh>C( BBҬCe4B˟B߬C( B,kB={1>߬C( B,kBҬCe4B˟BBCe4B,kB=0־u?CuPB˟BCe4BdKBҬCe4B˟B5#C:49PCe4BdB*Ce4BB*CABdBzeL*y>BCe4B,kB*C!hB,kB*Ce4B;B2t߾>?*C!hB,kBiCB˟B*CBlB2Wv߾J??*C!hB,kBBCe4B,kBiCB˟B@Aƾ?BCe4B,kBҬCe4B˟BiCB˟BuB,N)?Ce4BdKBCBrBiCB˟B4we?ҬCe4B˟BCe4BdKBiCB˟B"4?CBjBCBBGCBjBTZ,O47?Cp#BjB*CB BGCBjB\CaB6BĭCy B6BCaB,kB|;.Ow>ĭCB,kBĭCaB BCaB,kBzCC( BSBFC( BdBĭCBdB'zCC( BSBĭCBdBCw$ BBJJn;ܩCw$ BBĭCBdBĭCBB4#::_CaBPBĭCBBĭCaBeB4#::_CaBPBCVBPBĭCBB'B`ZCVBPBCw$ BBĭCBBf'P?)_cCaBBCVBPB_CaBPB^].9CBBCVBPB_cCaBBN /:޷\CaB6BCBB_cCaBB:H /÷CaB,kBCB6B\CaB6B&D>O, M>CB,kBCB6BCaB,kB8vU>CB,kBOC( B˟BC( BB8V>CaB,kBOC( B˟BCB,kBxL9->CaB,kBĭCB˟BOC( B˟BLv.a>CaB,kBĭCaB BĭCB˟B:|A?ĭCB˟BĭC( BHBOC( B˟ByC FC( BdBC( BSBC BdB(FYft>OC( B˟BCuPB˟BC( BB<0־u?CuPB˟BCe4BjBCe4BdKB>0n־\u?OC( B˟BCe4BjBCuPB˟BdtFn?OC( B˟BĭCĂ BjBCe4BjB%sFHn?OC( B˟BĭC( BHBĭCĂ BjB,%P,?ĭCĂ BjBĭCe4BEBCe4BjB:Xq ?5CBjBCe4BdKBCe4BjB'>{2-?CBrBCe4BdKB5CBjBf+-Bwt3?ĭCe4BEBĭCB[B5CBjB.t.?Ce4BjBĭCe4BEB5CBjB?,!䁾s1?5CBjBCBjBCBrB*怾%W3?CBjB5CBjBĭCB[B*怾1W3?CBjBĭCB[BCBB'e+C?CBBĭCB[BĭCBިB! )F?ĭCBިBĭCp#BBCBBXA'N?ĭCp#BBCp#BʹBCBBRzR?)C\)B BĭCp#BBĭC%B B7fRR?)C\)B BC\)BBĭCp#BBoCP?C\)BBCp#BʹBĭCp#BBwf@CYAE{BC qAPBCYAPB:&ϣ:]C qAPBCABDCYABfE4JCYAPBC qAPBDCYAB3L3CABCvnA6B)CYA6BƟ)Bt>??DCYABCAB)CYA6Bl7CPA,kBC* A˟BlCYA˟Bs74)]X>40CYA,kBCPA,kBlCYA˟B(J8I/= >C* A˟BCYAʽBlCYA˟B >}ľCBdBCXsABܭCaBB[}F]ȶkiCaBdBCBdBܭCaBB.BGޅCYAPBĭCȺBPBĭCaBeBzCzCYAE{BCYAPBĭCaBeB|cC>CYAE{BĭCaBeBܭCaBBȈFDCYAE{BܭCaBBCXsAB?4E4JDCYABĭCȺBPBCYAPB(kS=G ĭC BBĭCȺBPBDCYABi)t>>)CYA6BĭC BBDCYAB]4'4^4ĭCy B6BĭC BB)CYA6B@4 4<40CYA,kBĭCy B6B)CYA6BB0$=ĭCB,kBĭCy B6B40CYA,kB|:hz>ĭCB,kByӭCaB˟BĭCaB B_o;&ܒ>ĭCB,kB40CYA,kByӭCaB˟B;Gsj>40CYA,kBlCYA˟ByӭCaB˟BvDG>CYAʽBCPUBjByRCaBjBxDǴl>CYAʽByRCaBjBlCYA˟B7& >lCYA˟ByRCaBjByӭCaB˟BA.Y_?CPUBjBCaBByRCaBjB?\}FȶܭCaBBĭCBdBkiCaBdBTAvĭCBBĭCBdBܭCaBBFܭCaBBĭCaBeBĭCBBKo՚>yӭCaB˟BĭCB˟BĭCaB B+9ET?ĭCB˟B>ݭC( BjBĭC( BHB%9 W?ĭCB˟ByӭCaB˟B>ݭC( BjBuC߾ve>yӭCaB˟ByRCaBjB>ݭC( BjB+g]&?CaBBC( BB>ݭC( BjBtN2˾H?yRCaBjBCaBB>ݭC( BjBd1EMy ?>ݭC( BjBĭCĂ BjBĭC( BHB&)| j/?ĭCĂ BjBTCe4B BĭCe4BEB*0/?>ݭC( BjBTCe4B BĭCĂ BjB1+?>ݭC( BjBCAC B BTCe4B Bd1$Y+?>ݭC( BjBC( BBCAC B BIv.vN4? CB BĭCe4BEBTCe4B B >?ĭCB[BĭCe4BEB CB BW[!B?DCB BĭCB[B CB B 3̫L?ĭCBިBĭCB[BDCB Bm"HO?˭Cp#B BĭCBިBDCB B-P?ĭCp#BBĭCBިB˭Cp#B B )Q&Q?˭Cp#B BĭC%B BĭCp#BBO=ھ!_CYAB!_CYoABCYAB/B zG֛CYAE{BCYAB!_CYoABD }wGޛCYAE{B!_CYoABC qAPBkowC?TC qAPB!_CYoAB!_CAPB^>|6CAB!_CAPB!_CAIB\=>|6CABCAB!_CAPByEjCABC qAPB!_CAPB YB,CA6BCAB|6CAB&,:aCvnA6BCABCA6B@-s;/aCA,kBCvnA6BCA6B):".\̻CPA,kBCvnA6BCA,kBM[9-,t>CA˟BCPA,kBCA,kBCoP8>C* A˟BCPA,kBCA˟B6|l>C* A˟BٮCYAjBCYAʽB8< >CA˟BٮCYAjBC* A˟B@;>CA˟B!_CXAjBٮCYAjBAH} k>CA˟B!_CA8B!_CXAjB_,H* ?!_CXAjB!_CYAmBٮCYAjBnQ=ھCYAB!_C AdB!_CYABP=ھCYABCXsAB!_C AdB}VkEA˾CXsABCBdB!_C AdBB zG֛CYABCYAE{BCXsAB*C>ٮCYAjBCPUBjBCYAʽB:+%?CPUBjBCaB BCaBB!,ǧ~?ٮCYAjBCaB BCPUBjBP4վW?ٮCYAjB!_CSA BCaB B[5Ҿ9q?ٮCYAjB!_CYAmB!_CSA B45C ?mC( B BCaBBCaB B #5~e,?C( BBCaBBmC( B B)vbxk2?mC( B BCAC B BC( BBRR?ĭC%B BĭC\)B)B)C\)B B+'1?CAC B BCe4B?BTCe4B BQ!ESB?Ce4B?BCBB CB Bv..N4?TCe4B BCe4B?B CB B -O?CBBCBBDCB Bp\!B? CB BCBBDCB BQP?CBBCp#BfC˭Cp#B BHO?DCB BCBB˭Cp#B Bt .Q$Q?ĭC%B B˭Cp#B BCp#BfCI ;#Q$Q?ĭC%B BCp#BfCĭC\)B)Bno =^?ĭC\)B)BCp#BfCC\)BB%YþQ(?!_CSA B!_CaBgBCaB Bs#&2w4?!_CaBgB!_C( BoZCmC( B B}*"dH-?CaB B!_CaBgBmC( B B$vA?CAC B BLCe4BԞCCe4B?BT8` @?mC( B BLCe4BԞCCAC B B'IT:?mC( B B!_C HBԞCLCe4BԞCT*U0J9?mC( B B!_C( BoZC!_C HBԞCb=C?!_C HBԞC!_Ce4BCLCe4BԞCas+H?"CBԞCCe4B?BLCe4BԞCkQ&M?CBBCe4B?B"CBԞC7轈iM?!_Ce4BC!_CBC"CBԞCd޼E?LCe4BԞC!_Ce4BC"CBԞCXkO? CBԞCCBB"CBԞC.*S?CBBCBB CBԞCwVR'S?!_CBC!_CBC CBԞCUJN?"CBԞC!_CBC CBԞC-}T?# Cp#BԞCCBB CBԞC& `?Cp#BfCCBB# Cp#BԞCj7=Xa`?!_CBC!_Cp#BC# Cp#BԞCQ qS? CBԞC!_CBC# Cp#BԞCo=Q_?0C\)BԞCCp#BfC# Cp#BԞCz܍=wb?C\)BBCp#BfC0C\)BԞCOo&@=a?!_Cp#BC!_C\)BC0C\)BԞC=<_?# Cp#BԞC!_Cp#BC0C\)BԞCOT éCB0BB éCY*B6BCB0B6Bw.Ծ?QC\)BBC -BBCB0B%BB&G éC\)BdB?QC\)BBCB0B%B%)B\BCR~CB4/BADܾ4 éC=BBWC=B\BCR~CB4/BרJO éC=BBCR~CB4/BCR~CBZ(B٨O éC=BBCR~CBZ(B éCÐBBZ(BkEܾĻ4WC=B\BC=B#BCs>B\B1;JCR~CBZ(BChFBZ(BCIBB@4JCR~CBZ(BCIBB éCR~CBBut_t߾ut_ éCR~CBBCIBB éCIBGBb,ҨJCR~CBZ(BCR~CB4/BChFBZ(B4di 4di éCIBGBCIBB éCPPBBAAc éCPPBBCIBBCPPB]zB疽oqC VB9B éC VBB éCS QBB/% lC%SBBC VB9B éCS QBBU⽨#l éCS QBBCPPB]zBC%SBBlzElp éCPPBBCPPB]zB éCS QBB^:u éC VBBC VB9B éCI#]BB"G"s éCI#]BBC VB9BCI#]B,BMC9ؿ)3CB0BpB3C6+BBکCB0BBiiC\)B6B éCY*B6B éCB0BB z3C\)BO,BC\)B6B éCB0BB?aQ"3C\)BO,B éCB0BBکCB0BB(4"%3C\)BO,BکCB0BB3C6+BBC%zC\)B6B éC\)BdB éCY*B6B>ؾ\X@3C׫6BKIB3C8w3B\BC׫6B\B\((کCB0BB éC0BB éC׫6BB$ (3CB0BpBکCB0BB éC׫6BBؾ\M@3CB0BpB éC׫6BBC׫6B\Bؾ] @3CB0BpBC׫6B\B3C8w3B\B کCB0BB éCB0BB éC0BBԾ#=C׫6B\B éC/8B\B éC=BBDԾ=C׫6B\B éC=BB3C׫6BKIBe辖yT3C׫6BKIB éC=BB3C=BBԾ=C׫6B\B éC׫6BB éC/8B\B[c ξ[c éCR~CBB3CR~CBB3C>BZ(B0I oR éCÐBBZ(B éCR~CBB3C>BZ(Bq1 R3C>BZ(B éC=BB éCÐBBZ(B񠫾Ǿ[3C=BB éC=BB3C>BZ(B7di 7di3CR~CBB éCR~CBB3CIBBx1c3CIBB éCR~CBB éCIBGB`sgo5s3CPPBB3COBBDCCPPBBsls3COBB éCPPBBDCCPPBBsrs3COBB3CIBB éCPPBB;Pn3CIBB éCIBGB éCPPBBqm'bqDCCPPBB éCS QBB éC VBBq''qqDCCPPBB éC VBB3CPPBBQYubu3CPPBB éC VBB3C VBB}q!_qDCCPPBB éCPPBB éCS QBBzZz3C VBB éC VBB3CI#]B]9Bġ8=z90v3CI#]B]9B éC VBB éCI#]BBBľBDZ]CB0BVBZ]C۱.B\B CB0B\B .ǪC\)BB3C6+BB3CB0BpB .Z]C\)BBǪC\)BB3CB0BpBCľBDZ]C\)BB3CB0BpB CB0B\B?ľCDZ]C\)BB CB0B\BZ]C۱.B\B)ǪC\)BB3C\)BO,B3C6+BBCľBD CB0B\B3C8w3B\B3C׫6BKIBCľCD CB0B\B3C׫6BKIBZ]CB0BVB[ZUZ]CB0BVB3C׫6BKIBZ]C׫6BBDľBD CB0B\B3CB0BpB3C8w3B\BeLyeZ]C=B\BZ]Cc;BZ(B]C=BZ(BeeZ]Cc;BZ(B3C=BB]C=BZ(BeOeZ]Cc;BZ(BZ]C׫6BB3C=BB[ZUZ]C׫6BB3C׫6BKIB3C=BB_Yc ξ[c]C=BZ(B3C>BZ(B3CR~CBB]c ξ[c]C=BZ(B3CR~CBBZ]C=B\B PZnZ]C=B\B3CR~CBBZ]CR~CBsBd[c ξd[c]C=BZ(B3C=BB3C>BZ(B.rZ]CR~CBsB3CR~CBBZ]CIBԠBkzKoZ]CIBԠB3CR~CBB3CIBB8z30v3CPPBBZ]CPPBBZ]C~NBB|U5t3COBB3CPPBBZ]C~NBBPUقtZ]C~NBB3CIBB3COBB:uZ]CIBԠB3CIBBZ]C~NBB ;9KzZ]CPPBB3CPPBBZ]C VBWBn7='*uZ]C VBWB3CPPBB3C VBB:}==|Z]C VBWB3C VBBZ]CI#]BB!=YxZ]CI#]BB3C VBB3CI#]B]9B-հ6SZ]CB0BVB*CB0BmB*Ct*B\B6&P]GZ]C۱.B\BZ]CB0BVB*Ct*B\B $8^G*Ct*B\BZ]C\)BBZ]C۱.B\BSN*C\)BىBZ]C\)BB*Ct*B\BVmξk\*CB0BmBZ]CB0BVB*C׫6B.BRuZ*C׫6B.BZ]CB0BVBZ]C׫6BBwNkZ]C=B\B*C=BB*C6BZ(B[gedZ]Cc;BZ(BZ]C=B\B*C6BZ(Bj_ed*C6BZ(BZ]C׫6BBZ]Cc;BZ(B sh*C׫6B.BZ]C׫6BB*C6BZ(BlSإe&q*C=BBZ]C=B\B*CR~CB !BYWE6n*CR~CB !BZ]C=B\BZ]CR~CBsBZ {>*u*CR~CB !BZ]CR~CBsB*CIBGBÏսc됾at*CIBGBZ]CR~CBsBZ]CIBԠBt-L|Z]CPPBB*CPPBB*CdMBB:B0 ~5vZ]C~NBBZ]CPPBB*CdMBBB0}5v*CdMBBZ]CIBԠBZ]C~NBB|۽t,z*CIBGBZ]CIBԠB*CdMBBl}*CPPBBZ]CPPBB*C VBFBHhz=uKHhz*C VBFBZ]CPPBBZ]C VBWB}=}*C VBFBZ]C VBWB*CI#]BWB0;>`;Ly*CI#]BWBZ]C VBWBZ]CI#]BBM SIC\)B\B*Ct*B\B*CB0BmB/nSIC\)B\B*CB0BmBC\)BbBw40eYC\)BbB*CB0BmBCB0BB#SIC\)B\B*C\)BىB*Ct*B\BDƾcC׫6BGBC2BZ(B50C׫6BZ(Bv?ƾ!cC2BZ(B*C׫6B.B50C׫6BZ(Bhdƾ7cC2BZ(BCB0BB*C׫6B.BfѾ _CB0BB*CB0BmB*C׫6B.Bn킾#fh50C׫6BZ(B*C6BZ(B*C=BB(d8h50C׫6BZ(B*C=BBC׫6BGBD qC׫6BGB*C=BBC=B)aBk0th50C׫6BZ(B*C׫6B.B*C6BZ(BF::etC=B)aB*C=BBCR~CBԠBOzsCR~CBԠB*C=BB*CR~CB !Bo:xCR~CBԠB*CR~CB !BCIBB4ȷvCIBB*CR~CB !B*CIBGBO}*CPPBBCPPBcBCKKBBe -{*CdMBB*CPPBBCKKBB$ -{CKKBB*CIBGB*CdMBBoKy:C}CIBB*CIBGBCKKBBgCPPBcB*CPPBBC VBBF=,|C VBB*CPPBB*C VBFB=U'<0C VBB*C VBFBCI#]BB>s|@s|CI#]BB*C VBFB*CI#]BWBl޾^ĭCB0BBĭC9.BZ(B`vCB0BZ(Bl޾v^ĭC9.BZ(BCB0BB`vCB0BZ(Bl޾^ĭC9.BZ(BĭC\)BQoBCB0BB؁ZɯZĭC\)BQoBC\)BbBCB0BB_"rfǾc`vCB0BZ(BC2BZ(BC׫6BGBK#rfǾkc`vCB0BZ(BC׫6BGBĭCB0BB sLXiĭCB0BBC׫6BGBĭC׫6BsB!rBfǾc`vCB0BZ(BCB0BBC2BZ(BSFrĭC׫6BsBC׫6BGBĭC=ByBۂD qĭC=ByBC׫6BGBC=B)aB~{H9vĭC=ByBC=B)aBĭCR~CB Bvcg#ivĭCR~CB BC=B)aBCR~CBԠB/^|ĭCIBBĭC]LFBB*CIBBd|ĭC]LFBBCIBB*CIBBu|ĭC]LFBBĭCR~CB BCIBBp:xĭCR~CB BCR~CBԠBCIBBⱽ_|*CIBBCKKBBCPPBcB+LY|*CIBBCPPBcBĭCIBB]?#ĭCIBBCPPBcBĭCPPBB|*CIBBCIBBCKKBB@W<ĭCPPBBCPPBcBĭC VB5B?=@ĭC VB5BCPPBcBC VBB} >=|CI#]BBĭC[BBĭC VB5Bv >̇=|CI#]BBĭC VB5BCI#]BB?=~<'CI#]BBĭC VB5BC VBB >n|=h|ĭC[BBCI#]BBĭCI#]BB\nپ`ĭCB0BBCB0BBCrf+BZ(Bvj=޾:^ĭC9.BZ(BĭCB0BBCrf+BZ(B@vG;޾s;^Crf+BZ(BĭC\)BQoBĭC9.BZ(BE{\ؾ{Z_C\)BBĭC\)BQoBCrf+BZ(Bhyyl(jCB0BBĭCB0BBC׫6BBpLkiC׫6BBĭCB0BBĭC׫6BsBTr6rC׫6BBĭC׫6BsBC=BBBE;rC=BBĭC׫6BsBĭC=ByBp+mm\yCR~CBBCd>BBCR~CBBl+C\yCd>BBĭCR~CB BCR~CBBm+\yCd>BBC=BBĭCR~CB BzH9vC=BBĭC=ByBĭCR~CB B&,g_hzCR~CBBĭC]LFBBĭCIBBB(,hKhzCR~CBBĭCIBBCR~CBB*ܽw{CR~CBBĭCIBBCIB9B$,dhzCR~CBBĭCR~CB BĭC]LFBB|==|CIB9BĭCIBBCPPBF`B8m?8CPPBF`BĭCIBBĭCPPBBc~+˾=c~CPPBF`BĭCPPBBC VB5BT<C VB5BĭCPPBBĭC VB5Bͭ=v{~C VB5BĭC VB5BĭC[BB=>x|C@ZBBC VB5BĭC[BB=>|ĭC[BBCI#]Bn-BC@ZBB<>=]c=5~ĭCI#]BBCI#]Bn-BĭC[BBH{_ؾY_tC\)BZ(BCrf+BZ(BCB0BBE{y_ؾY_tC\)BZ(BCB0BB!_C\)BB[c5 ξ[c!_C\)BBCB0BB!_CB0B-BD{\ؾZ_tC\)BZ(BC\)BBCrf+BZ(B&j/&j!_CB0B-BCB0BB!_C׫6BB}zylj!_C׫6BBCB0BBC׫6BBцpp!_C=B9B!_CE7BB$C=BBpp!_CE7BBC=BB$C=BBwpp!_CE7BB!_C׫6BBC=BBdpp!_C׫6BBC׫6BBC=BB="t$C=BBCd>BBCR~CBB_3t$C=BBCR~CBB!_C=B9Bvk v!_C=B9BCR~CBB!_CR~CBhBWt$C=BBC=BBCd>BBwww!_CR~CBhBCR~CBB!_CIBBJ\Cڽry!_CIBBCR~CBBCIB9BK=>x!_CPPBìBCPPBF`B!_C VBWBV;=ɍz!_C VBWBCPPBF`BC VB5BQX>)9wC@ZBBӮCI#]BB!_CI#]ByB6SX+>8wC@ZBB!_CI#]ByBC VB5BM;=ͼyC VB5B!_CI#]ByB!_C VBWBoRX0>9wC@ZBBCI#]Bn-BӮCI#]BBMrD]m#u=C\)BBC)BdBwC\)BdBwcLL 2=Co*BBC)BdBC\)BBRH@T>>C\)BPBCo*BBC\)BBP8wf>CH-BPBCo*BB>C\)BPB2@>CH-BPB-CB0BBCB0B}B@>CH-BPB>C\)BPB-CB0BB:V:־>>C\)BPBC\)BB-CB0BB!?G=[V? éC\)B#$B éCB0B B-CB0BBFDƾ>C\)BB éC\)B#$B-CB0BBAOZ>-CB0BBC`D4BBCB0B}B6+ ?C`D4BBC׫6B6BC׫6B͛B6n ?-CB0BBC׫6B6BC`D4BB̲D?-CB0BB éC1B6BC׫6B6B[D?-CB0BB éCB0B B éC1B6BU0qgV0? éC1B6B éC׫6B#BC׫6B6B=&,)&?YC=B6BC׫6B͛BC׫6B6B,u2?C=BJBC׫6B͛BYC=B6B.oW7? éC׫6B#B éC=BtBYC=B6B2"f2?C׫6B6B éC׫6B#BYC=B6Bc0`s6?6CR~CB6BC=BJBYC=B6B,4H?CR~CBoBC=BJB6CR~CB6B)4˼3K? éC=BtB éCR~CBB6CR~CB6Bnu/8?YC=B6B éC=BtB6CR~CB6BCK?4CIB6BCR~CBoB6CR~CB6BҼRR?CIBtBCR~CBoB4CIB6B=lR? éCR~CBB éCIBB4CIB6B BK?6CR~CB6B éCR~CBB4CIB6B}Q=2R?lGCPPB6BCIBtB4CIB6B\+RW?C VB6BCPPBoBlGCPPB6BԎY=c?C VB; BCPPBoBC VB6BྞR>`? éCPPBcB éC VBBC VB6B6^0>RSW?lGCPPB6B éCPPBcBC VB6BDNݾSh>M]? éCDYB6BC VB; BC VB6BMݾe>N]? éCDYB6B éCI#]BBC VB; B@þgPJ>U8g? éCI#]BBCI#]BUBC VB; B4Lݾg>jm+ ?3C\)BqpB3Cg#/B,kBCB0B,kB7N>1m' ?3C\)BqpBCB0B,kBC\)B6B|6>%?C\)B6BCB0B,kB˩CB0B6B0[\0?3Cg#/B,kB3CB0B BCB0B,kBbDH?˩CB0B6B éC1B6B éCB0B B(&p6? éC1B6BAaC׫6B,kB éC׫6B#B_+`:5? éC1B6B˩CB0B6BAaC׫6B,kB!<~*?˩CB0B6BCB0B,kBAaC׫6B,kB`,U=:?3CB0B B3C׫6BFBAaC׫6B,kB3<3?CB0B,kB3CB0B BAaC׫6B,kBM-bs;?KC=B,kB éC׫6B#BAaC׫6B,kB? #{H? éC=BtB éC׫6B#BKC=B,kBDŽUK?3C׫6BFB3C=B>BKC=B,kB -SaŹ;?AaC׫6B,kB3C׫6BFBKC=B,kB<<;K?AQCR~CB,kB éC=BtBKC=B,kBZ)ҼR? éCR~CBB éC=BtBAQCR~CB,kB7=R?3C=B>B3CR~CBFBAQCR~CB,kB<;K?KC=B,kB3C=B>BAQCR~CB,kBd= R?DsCIB,kB éCR~CBBAQCR~CB,kB#=oZ? éCIBB éCR~CBBDsCIB,kBuv`=2`Y?3CR~CBFB3CIBBDsCIB,kBeق=R?AQCR~CB,kB3CR~CBFBDsCIB,kB <>+V?3CTlLB,kB éCIBBDsCIB,kB}<>sV?3CTlLB,kB3CPPB/B éCIBB@㾷e=c?3CPPB/B éCPPBcB éCIBBO <>V?DsCIB,kB3CIBB3CTlLB,kB ܾӉ>\?3CPPB/B3C VBB éCPPBcB¾$X>f?3C VBB éC VBB éCPPBcBƦÉ>h? éCDYB6B CI#]B6B éCI#]BBǦĉ>3h? CI#]B6B éCDYB6B éC VBBĦÉ>h? CI#]B6B éC VBB3CI#]BB$>_?3CI#]BB éC VBB3C VBBM>m* ?ŪC\)B,kB3Cg#/B,kB3C\)BqpB2^K/?3Cg#/B,kBŪC\)B,kBZ]C\)BB1<[/?3Cg#/B,kBZ]C\)BB3CB0B BP(E?=?3CB0B BZ]C\)BBZ]CB0BrB(*H ??Z]CB0BrBZ]C׫6BbB3CB0B BlG8H?Z]C׫6BbB3C׫6BFB3CB0B BO<I?Z]C׫6BbBZ]C=BB3C׫6BFB#+BQ?Z]C=BB3C=B>B3C׫6BFB9H = P?Z]C=BBZ]CR~CBW B3C=B>BU#=nZ?Z]CR~CBW B3CR~CBFB3C=B>B|<>V?Z]CR~CBW BZ]CIBXB3CR~CBFB96龀$=;$b?Z]CIBXB3CIBB3CR~CBFBj@ϾFH>d?3CTlLB,kBT̪CPPB,kB3CPPB/BBϾH> d?T̪CPPB,kB3CTlLB,kB3CIBB>Ͼ*H>d?T̪CPPB,kB3CIBBZ]CPPBrBX㾻Ux>\?Z]CPPBrB3CIBBZ]CIBXBǾ>\?Z]CUB,kB3CPPB/BT̪CPPB,kBtǾz>\?Z]CUB,kBZ]C VBL>B3CPPB/B޲>jd?Z]C VBL>B3C VBB3CPPB/BiǾe>-\?T̪CPPB,kBZ]CPPBrBZ]CUB,kBceA>]?Z]C VBL>BZ]CI#]BB3C VBBlr>0f?Z]CI#]BB3CI#]BB3C VBBL(o =?PlCB0B˟BZ]C\)BB#C\)B˟BrGtJ?Z]CB0BrBZ]C\)BBPlCB0B˟BhLAL?*C\)BB*CB0BbBPlCB0B˟B$'A?C>?#C\)B˟B*C\)BBPlCB0B˟B8zL?_C׫6B˟BZ]CB0BrBPlCB0B˟B 'SQ?Z]C׫6BbBZ]CB0BrB_C׫6B˟B>=jQ?*CB0BbB*C׫6BbB_C׫6B˟B~L?PlCB0B˟B*CB0BbB_C׫6B˟BFimX?CR~CB˟BZ]C=BBjC=B˟B_e=Z`?Z]CR~CBW BZ]C=BBCR~CB˟B~뾃:B>Q]?*C=BsB*CR~CBKBCR~CB˟BUs>jX?jC=B˟B*C=BsBCR~CB˟B0龤o>[? CIB˟BZ]CR~CBW BCR~CB˟B*վxF>gac?Z]CIBXBZ]CR~CBW B CIB˟BҾ_|>`?*CR~CBKB*CIB~B CIB˟Bzo>[?CR~CB˟B*CR~CBKB CIB˟B}Ͼ&>S]?*CK7KB˟BZ]CIBXB CIB˟B}Ͼ)>S]?*CK7KB˟B*CPPBhBZ]CIBXBvz>e?*CPPBhBZ]CPPBrBZ]CIBXB}Ͼ~&>S]? CIB˟B*CIB~B*CK7KB˟BH^>0c?Z]CUB,kB|C VB,kBZ]C VBL>B2MAc>N.c?|C VB,kBZ]CUB,kBZ]CPPBrBI$c>.c?|C VB,kBZ]CPPBrB*C VB5eB{b>\?*C VB5eBZ]CPPBrB*CPPBhB4\>q7[?*CnZB,kBZ]C VBL>B|C VB,kB4\>o7[?*CnZB,kB*CI#]BBZ]C VBL>B>c?*CI#]BBZ]CI#]BBZ]C VBL>B_]>6[?|C VB,kB*C VB5eB*CnZB,kBJ!O?nCB0BjB*C\)BBQC\)BjB~R3R?*CB0BbB*C\)BBnCB0BjBҼR?C\)BBCB0BBnCB0BjBfK!O?QC\)BjBC\)BBnCB0BjB>"=LR?ɓC׫6BjB*CB0BbBnCB0BjBm\?*C׫6BbB*CB0BbBɓC׫6BjBUF2=Si[?CB0BBC׫6BBɓC׫6BjB#?"=R?nCB0BjBCB0BBɓC׫6BjB8/%>=Y?xլC=BjB*C׫6BbBɓC׫6BjB5龘$=S$b?*C=BsB*C׫6BbBxլC=BjBNV5>_?C׫6BBC=BBxլC=BjBN/%>}=Y?ɓC׫6BjBC׫6BBxլC=BjBP>0^?Cn?BjB*C=BsBxլC=BjB9\P>~^?Cn?BjBCR~CBZB*C=BsBD>`?CR~CBZB*CR~CBKB*C=BsB P>%^?xլC=BjBC=BBCn?BjBWھw>Z?CR~CBZBCIB@B*CR~CBKBcƾ;>(c?CIB@B*CIB~B*CR~CBKB_>a?*CK7KB˟BCPPB˟B*CPPBhBk@\>a?CPPB˟B*CK7KB˟B*CIB~B坷q^>a?CPPB˟B*CIB~BCPPB B¾[>]?CPPB B*CIB~BCIB@Bڮf4>5W?CRB˟B*CPPBhBCPPB˟Bڮ4>5W?CRB˟BC VByrB*CPPBhBF*>a?C VByrB*C VB5eB*CPPBhBڮ4>5W?CPPB˟BCPPB BCRB˟BVE>b?*CnZB,kBӬCI#]B,kB*CI#]BB E>b?ӬCI#]B,kB*CnZB,kB*C VB5eBE> b?ӬCI#]B,kB*C VB5eBCI#]B;B>>S?CI#]B;B*C VB5eBC VByrBu=R?ĭC -B BC\)BB)C\)B B1=R?ĭC -B BĭCB0BBC\)BBTFݼՋ]?ĭCB0BBCB0BBC\)BB|D >[?ĭCB0BBĭC׫6BhBCB0BB龨=Cb?ĭC׫6BhBC׫6BBCB0BBgUnC>Y_?ĭC׫6BhBĭC=B?BC׫6BBI 7>Ha?ĭC=B?BC=BBC׫6BBVȾV>Ne?Cn?BjBE=CR~CBjBCR~CBZBfȾV>Ne?E=CR~CBjBCn?BjBC=BBȾV>Oe?E=CR~CBjBC=BBĭCR~CBB^Nݾ/f>M]?ĭCR~CBBC=BBĭC=B?B¾>^?ĭCuHBjBCR~CBZBE=CR~CBjB4¾T>s^?ĭCuHBjBĭCIBBCR~CBZB>I`?ĭCIBBCIB@BCR~CBZB¾>^?E=CR~CBjBĭCR~CBBĭCuHBjB~>C[?ĭCIBBĭCPPB@BCIB@B%>)b?ĭCPPB@BCPPB BCIB@BL >W?C VByrBĭCDVB˟BĭC VBB&>V[?CRB˟BĭCDVB˟BC VByrB>l[?ĭCDVB˟BCRB˟BCPPB BP\>ZU?ĭCPPB@BĭCDVB˟BCPPB Bf6?AJ?ĭC VBBĭCI#]B>BC VByrBI=q?[TX?ĭCI#]B>BCI#]B;BC VByrBロ=Ƌa?ĭC -B BӭCB0B BĭCB0BBC#">z5_?LC׫6B BĭCB0BBӭCB0B BD+׾r>e?ĭC׫6BhBĭCB0BBLC׫6B BҾ|>`?C`?C"sh?C=BBĭC=B?BĭC׫6BhBιWȇ>خd?C=BBCR~CBBĭC=B?B͹LJ>d?CR~CBBĭCR~CBBĭC=B?Bᆢ>>b?ĭCuHBjBCIBjBĭCIBB4d>nb?CIBjBĭCuHBjBĭCR~CBBO>b?CIBjBĭCR~CBBCIBEBO>3 `?CIBEBĭCR~CBBCR~CBB8>Z?CINBjBĭCIBBCIBjB>rZ?CINBjBCPPBZBĭCIBB >f`?CPPBZBĭCPPB@BĭCIBBEa>Z?CIBjBCIBEBCINBjBOux>Z?ĭCDVB˟BPC VB˟BĭC VBBDZuڂ>IZ?PC VB˟BĭCDVB˟BĭCPPB@BSu܂>Z?PC VB˟BĭCPPB@BC VBfB5\>PQ?C VBfBĭCPPB@BCPPBZBp]?D?CӶXB˟BĭC VBBPC VB˟B]?D?CӶXB˟BCI#]BnBĭC VBB'@?7N?CI#]BnBĭCI#]B>BĭC VBB]d?D?PC VB˟BC VBfBCӶXB˟BtD> e?Cmb??CR~CB BC=BB땮C=B BLƦĉ>mh?CR~CBBC=BB?CR~CB B𠾗>[_?!_CSDB BCR~CBB?CR~CB B𠾎>_?!_CSDB B!_CIBBCR~CBBȏ> f?!_CIBBCIBEBCR~CBBi|>`?CINBjB@CPPBjBCPPBZB|>j`?@CPPBjBCINBjBCIBEB|>Ơ`?@CPPBjBCIBEB!_CPPBgABZӉą>]\?!_CPPBgABCIBEB!_CIBBdj?gYP?!_CQBjBCPPBZB@CPPBjBzejc?HXP?!_CQBjB!_C VB&BCPPBZBrH?[V?!_C VB&BC VBfBCPPBZB{dj?YP?@CPPBjB!_CPPBgAB!_CQBjBՌ-?;?CI#]BnB!_Cv ZB˟B!_CI#]B]2B0iW?H?CӶXB˟B!_Cv ZB˟BCI#]BnBiW?H?!_Cv ZB˟BCӶXB˟BC VBfBE-*?|9?!_C VB&B!_Cv ZB˟BC VBfBV+=ڄR?)C\)B BĭC\)B)BĭC -B By=֋a?ӭCB0B BĭC -B BĭC\)B)B'i=a?ӭCB0B BĭC\)B)BCB0BBsY=^?CB0BBĭC\)B)BC\)BB&*վF>ac?CB0BBC׫6BlBLC׫6B B_'">A4_?ӭCB0B BCB0BBLC׫6B BҾZ|>`?LC׫6B BC׫6BlBCo`?!_C"-BԞCC\)BB0C\)BԞCFtqV(>o`?!_C"-BԞC!_CB0BCC\)BB1̾1=6^i?!_CB0BCCB0BBC\)BBU2U*>i_?0C\)BԞC!_C\)BC!_C"-BԞCȾV>eOe?!_CB0BC!_C׫6B!CCB0BBþgQJ>/8g?!_C׫6B!CC׫6BlBCB0BByr(>e?땮C=B BC&e?땮C=B BC׫6BlB!_C=BPB(>c?!_C=BPBC׫6BlB!_C׫6B!CYŖ>8e?!_C=BPB!_CR~CB5B?CR~CB BTn>kb?땮C=B B!_C=BPB?CR~CB B_>_??CR~CB B!_CR~CB5B!_CSDB BBm={gkwCgBBCiBxBCiBB=M| éCkBBCiBBCiBxB-={]| éCkBBCiBxB éC_pBxB9>P9rw éC_pBxBCiBxBC_pBBV;>껽ȍz éC_pBxBC_pBB éC?vB+Bu>^w@u éC?vB+BC_pBBC?vB^BZx>U[x éC?vB+BC?vB^B éC}1}B+B/>r éC}1}B+BC?vB^BC}1}BcBK>c)>aֿC]́BB éC.BB éC}1}B+B>^)>aֿC]́BB éC}1}B+BC]́B6+B>@s<6sC]́B6+B éC}1}B+BC}1}BcB*> >+\[BCBBֿC]́BBC]́B6+BNs%?\>E@CBAB[BCBBC]́B6+Bt!?V*>;[BCBBCBABCBB6Y>!?>x éCkBB éC_pBxBC_pBBZ>9@y7?C?vBBC_pBB éC_pBxB!>Rmt éC?vB+B7?C?vBB éC_pBxB>*==T&uC}1}BB7?C?vBB éC?vB+Bƴ>,m éC}1}B+BC}1}BB éC?vB+Bܽ>A/>iC}1}BB éC}1}B+B éC.BBHZHy éCI#]BBCI#]B,B éCcBc_B>7=Ǒw*u éCcBc_BCI#]B,BCcB8Bk=gkwCiBBCcB8BCgBBg=gkwCiBB éCiB*BCcB8B:==| éCiB*B éCcBc_BCcB8B=y|CiBB éCkBB éCiB*BS>[g)>a éC.BBֿC]́BB éC]́BBA>,J??C]́B0OB éCBdB éC]́BCB '>.4?}0?C۸BdB éCBdBC]́B0OBp?W>64 éC]́BB[BCBB éCBzyB>[>\ֿC]́BB[BCBB éC]́BBժ>L}Q?: >CBcB éCqTBt/B éCBB8>H??CBt/B éCqTBt/BCBcB;>G3?%%? éCqTBt/BCBt/BC]́B0OB*A>jCBBC6BNBC6BBD?mٜ> [BCBBCBBC6BB}v?%>([BCBBC6BB éCUBBk?9$>([BCBB éCUBB éCBzyB}D? ?y éCUBBC6BB éC6BƇB2?K?q%> éC6BBؐC6BB éC&BB=?O?SZ> éC&BBkC6B6B éCB6B?mC?I>ؐC6BBkC6B6B éC&BB>C?*)>C6BvB éCB6BkC6B6B>>C?'>C6BvBCՆBB éCB6BH>·P?&>CՆBB éC8BB éCB6BР>M}A?0? éC8BBCՆBBCBcBk>^wQ?]-> éCBB éC8BBCBcBN|==|3CI#]B]9B éCI#]BB3CcB$B=Yëx3CcB$B éCI#]BB éCcBc_Bߴ= ib}3CcB$B éCcBc_B3CiB5lBn+>}\y3CiB5lB éCcBc_B éCiB*B4Y><->xC_pBB éCiB*B éCkBB6Y>=>xC_pBB3C_pB,B éCiB*BB,>7]{3C_pB,B3CiB5lB éCiB*BV>Yubu3C_pB,B7?C?vBB3C?vBGBZ>-9JyC_pBB7?C?vBB3C_pB,B>w=k3C?vBGBC}1}BB3C}1}ByBy>־==}&u7?C?vBBC}1}BB3C?vBGBeܽ>gA/>i éC.BB3C}1}ByBC}1}BB޽>sF/>oi éC.BB éC]́BB3C}1}ByB?>zB éC]́BB3C]́BB3C}1}ByB->kYP?> éC]́BCB3CBdB3C]́BOB}>{G?g}? éCBdB3CBdB éC]́BCB4?[\?5!CBB3CBB3C]́BB[5?\?4!CBB3C]́BB éCBzyB; ?f>#@ éCBzyB3C]́BB éC]́BB14?)?Dо3CBB!CBB3CBBJ ?P?P>3CBEBTCB6B3CaB6Bs>U?>3CaB6B˩CBB3CGBB?#G?륲>TCB6B˩CBB3CaB6B>iI?P> éCBB3CGBB˩CBB>8jI?dK> éCBB éCqTBt/B3CGBBM>X?> éCqTBt/B3CBt/B3CGBB>pA?U?3CBt/B éCqTBt/B éC]́BCB. >SP?>3C]́BOB3CBt/B éC]́BCBo?>!CBB éCBzyB éCUBBD?Ü?v éCUBB éC6BƇBxѩC6BZ(BMD?(?vw!CBB éCUBBxѩC6BZ(B)?&$?Xľ!CBBxѩC6BZ(B3C#BZ(B)??$?sSľ!CBB3C#BZ(B3CBB_($?B?nؽ3C#BZ(BȩC6B\B3CqB\B7?+ 2?) éC6BB3CqB\BȩC6B\B!#?XA?> éC6BB éC&BB3CqB\B?EJ?E= éC&BB3C.BB3CqB\B ?P?P>TCB6B3CBEB3C.BB ?P?P>TCB6B3C.BB éCB6B!?D?І> éCB6B3C.BB éC&BB?"G?r>˩CBBTCB6B éCB6B>GO?> éC8BB˩CBB éCB6B;>dI?`X>˩CBB éC8BB éCBB=}Z]CI#]BB3CI#]B]9BZ]CcBSB1:>0p xZ]CcBSB3CI#]B]9B3CcB$BՃ<><8Y{Z]CcBSB3CcB$BZ]CiB,Bh>;)6xZ]CiB,B3CcB$B3CiB5lBi>>yZ]CiB,B3CiB5lBZ]C_pB,BK>0JsZ]C_pB,B3CiB5lB3C_pB,B>'=_sZ]C_pB,B3C_pB,BZ]C?vBzyB>`k$kZ]C?vBzyB3C_pB,B3C?vBGB>>I`Z]C?vBzyB3C?vBGBZ]C}1}BB ?+~=f#UZ]C}1}BB3C?vBGB3C}1}ByB[>RU?,>Z]C}1}B!BKC}1}BdBZ]C`|BdB5?S\?4˪C]́BBZ]C~BBZ]C}1}BB5?f\?4˪C]́BBZ]C}1}BB3C]́BB/?->`F3C]́BBZ]C}1}BB3C}1}ByB*?.c ? Z]C~BB˪C]́BBZ]C]́BB]`?fQ?&k>Z]C]́BB#C]́BBZ]C9BB>R?6>Z]C9BBC]́Bt/BZ]C-Bt/Bg?xiJ?>#C]́BBC]́Bt/BZ]C9BBø>K?y>KC}1}BdB3C]́BOB3CBdB>jL?>Z]C}1}B!B3C]́BOBKC}1}BdB>HwL? >Z]C}1}B!BC]́Bt/B3C]́BOBR>bL?>Z]C}1}B!BZ]C-Bt/BC]́Bt/B26?[?4˪C]́BB3C]́BB3CBB%4?#?;о3CBB3CBB6CBZ(B4?(?Aо˪C]́BB3CBB6CBZ(B+??タ˪C]́BB6CBZ(BZ]CkBZ(B??タ˪C]́BBZ]CkBZ(BZ]C]́BBN%?3CBEBZ]CfǂBB(CBBH?yH?yH>3CBEB3CaB6BZ]CfǂBBRA?N?'>3CaB6BZ]C B6BZ]CfǂBBZc?Q?dk>#C]́BBZ]C]́BBZ]C B6B`?Q?,k>#C]́BBZ]C B6B3CGBB̿ ?I?>3CGBBZ]C B6B3CaB6Bū?iJ?q>C]́Bt/B#C]́BB3CGBB>@O?|X>3CBt/BC]́Bt/B3CGBB^>D?>C]́Bt/B3CBt/B3C]́BOB)?8$?@Lľ6CBZ(B3CBB3C#BZ(BO6?0?TCB\B6CBZ(B3C#BZ(BD'???~ս3CqB\BTCB\B3C#BZ(B'?~??Y=(CBBTCB\B3CqB\B?]K?=3C.BB(CBB3CqB\B\?H?H>(CBB3C.BB3CBEB>|*CI#]BWBZ]CI#]BB*CcBB=K>@V%z*CcBBZ]CI#]BBZ]CcBSBΞK>I;=ќz*CcBBZ]CcBSB*CiB* B>7*u*CiB* BZ]CcBSBZ]CiB,B9> =gt*CiB* BZ]CiB,B*C_pByB>-m*C_pByBZ]CiB,BZ]C_pB,B*"?{>0SC?vBB*CsBB*C_pByB ?{>SC?vBB*C_pByBZ]C?vBzyB>G7=FIlZ]C?vBzyB*C_pByBZ]C_pB,BT!? {>S*CsBBC?vBB*C?vBmB>癡>goOeuC}1}BBC?vBBZ]C?vBzyB/?q>/Z]C}1}BBeuC}1}BBZ]C?vBzyB}%?F>X*C?vBmBeuC}1}BB*C}1}BB>f>oOC?vBBeuC}1}BB*C?vBmBdp>T?ބ>*C}1}BB8C}1}Bt/B*C=|Bt/BrM>,4K?>Z]C}1}B!B*C=|Bt/B8C}1}Bt/BU>/K?T>Z]C}1}B!BZ]C`|BdB*C=|Bt/B|y>gLZ?o>Z]C`|BdB*CgyBdB*C=|Bt/B4?%]?5euC}1}BBZ]C}1}BBZ]C~BB*?il ?>Z]C~BBZ]C]́BB^eC]́BZ(B*?d ? euC}1}BBZ]C~BB^eC]́BZ(BA?D?! euC}1}BB^eC]́BZ(B*CX}BZ(B]3??) euC}1}BB*CX}BZ(B*C}1}BB?m8?w盾*CX}BZ(BC]́B\B*C-B\B1?6/?`^eC]́BZ(BC]́B\B*CX}BZ(BrN?}ZI?b{*C-B\B]C]́BB*CJFBB&?|B?>C]́B\B]C]́BB*C-B\Bq?ۈN?@[=*CJFBBWzC]́B6B*CƥB6B?(iG?>]C]́BBWzC]́B6B*CJFBB?J?Wc>Z]C]́BB*CƥB6BWzC]́B6B? J?c>Z]C]́BBZ]C9BB*CƥB6B* ?\R?78>Z]C9BB*C>~BB*CƥB6Bl>kT?܄>8C}1}Bt/B*C}1}BB*C>~BBp>#T?݄>8C}1}Bt/B*C>~BBZ]C-Bt/B?9L?+>Z]C-Bt/B*C>~BBZ]C9BBtM>+4K?>8C}1}Bt/BZ]C-Bt/BZ]C}1}B!B2?+?x^eC]́BZ(BZ]C]́BBZ]CkBZ(B0?0?^C]́B\B^eC]́BZ(BZ]CkBZ(B#?U>?U;JZ]CfǂB\BC]́B\BZ]CkBZ(B&?B?K>]C]́BBC]́B\BZ]CfǂB\B?I?Z]CfǂBB]C]́BBZ]CfǂB\B?'iG?>WzC]́B6B]C]́BBZ]CfǂBBk?DM? &>Z]C B6BWzC]́B6BZ]CfǂBB?˧J?d>WzC]́B6BZ]C B6BZ]C]́BB >s|=Bs|CI#]BB*CI#]BWBCcBB>x>>>xCcBB*CI#]BWB*CcBBO>>\ZnCiBBCeBBCcBBP>>ZnCiBBCcBB*CiB* Bx>:=x*CiB* BCcBB*CcBBMO>>fZnCeBBCiBBCiBGB0J> >PncC_pBBCiBB*CiB* B>=a*C_pByBcC_pBB*CiB* B|>v>^i[CiBGBcC_pBBC_pB-BH>>PnCiBBcC_pBBCiBGB'Z>ف>ZcC_pBB*C_pByB*CsBB<:&?i]>ʣ:*CsBB*C?vBmBC?vBZ(B?Hѩ>*;cC_pBB*CsBBC?vBZ(BG?>;O@cC_pBBC?vBZ(BCfvBZ(B>%]?zCcC_pBBCfvBZ(BC_pB-BQ5??CfvBZ(BC?vBZ(BC?vBX^B>^?2>C?vB|NB[C?vBdBCmvBdB??s"Q/C}1}BZ(BC?vBZ(B*C?vBmBR%?4>M*C}1}BBQ/C}1}BZ(B*C?vBmB?b.?zϾC?vBX^BC}1}B\BCVzB\B?,.?ϾC?vBX^BC?vBZ(BC}1}B\B0?.$?~C?vBZ(BQ/C}1}BZ(BC}1}B\BI?J?>CVzB\BC}1}BBCJ{BB2(?VI=?+xC}1}B\BC}1}BBCVzB\Bw?Q T?܇=CJ{BBfC}1}B6BCW{B6BC?̚M?H=C}1}BBfC}1}B6BCJ{BB"g?fT?~>CW{B6B _C}1}BBCU#zBB ?PQ?s0>fC}1}B6B _C}1}BBCW{B6B?$wP?[H>*C}1}BBCU#zBB _C}1}BBv?bvP?eK>*C}1}BB*C=|Bt/BCU#zBB(>Z?L>*C=|Bt/BCxBt/BCU#zBB>^?+>[C?vBdBC?vB|NBCxBt/Bt>e^?a)>[C?vBdBCxBt/B*CgyBdB>>T?>*CgyBdBCxBt/B*C=|Bt/BD?K?s Q/C}1}BZ(B*C}1}BB*CX}BZ(B,?*?C}1}B\BQ/C}1}BZ(B*CX}BZ(Bg"?&Z6?*C-B\BC}1}B\B*CX}BZ(B(?uI=?xC}1}BBC}1}B\B*C-B\B:?M?*CJFBBC}1}BB*C-B\Bo?M?=fC}1}B6BC}1}BB*CJFBB/ ?TS?r=*CƥB6BfC}1}B6B*CJFBB ?~PQ?Ns0> _C}1}BBfC}1}B6B*CƥB6BM?RS?<~9>*C>~BB _C}1}BB*CƥB6Bx?vP?H> _C}1}BB*C>~BB*C}1}BB>=|$CcBBCI#]BBCI#]BBw>w=bwCcBB$CcBBCI#]BBbt>[l(>btĭCI#]BB$CcBBĭCcBB>=F|CI#]BB$CcBBĭCI#]BBKu>Vx>ӌu$CcBBCcBBCeBBCu>1u>CuCeBBĭCcBB$CcBB4u>Jx>uCeBBCiBGBĭCcBBg٭>nb>)gCiBGBĭCiBzBĭCcBBA>>Q}[ĭCiBzBCiBGBĭC_pByB>s>XĭC_pByBCiBGBC_pB-B>3>AĭC_pByBC_pB-BCfvBZ(B?i?gĭCøpBZ(BĭC_pByBCfvBZ(B~%??dC?vB\BCfvBZ(BC?vBX^B ?i7?dC?vB\BĭCuB\BCfvBZ(BD?'?IĭCuB\BĭCøpBZ(BCfvBZ(B?xE?‡ĭCuB\BdC?vB\BĭC?vB:/B>֓f?lW;>ĭC?vBB6C?vBt/BĭCuBt/B>Pb?U_>C?vB|NBĭCuBt/B6C?vBt/Bh>Mb?g>C?vB|NBCmvBdBĭCuBt/B>Mf?t>CmvBdBĭC tBdBĭCuBt/B ?q8?q۾dC?vB\BC?vBX^BCVzB\Bw?wE?1ÇĭC?vB:/BdC?vB\BCVzB\BN?xE?‡ĭC?vB:/BCVzB\BĭC޻wBBO{?zS?CFĭC޻wBBCVzB\BCJ{BB7 ?jW?WĭC޻wBBCJ{BBĭCwB6Br>`? =CJ{BBCW{B6BĭCwB6B>F_?=ĭCwB6BCW{B6BĭC"wBB>>d?he+>CW{B6BCU#zBBĭC"wBB> f?7Z;>6C?vBt/BĭC?vBBĭC"wBB>f?X;>6C?vBt/BĭC"wBBCxBt/B>\b?T>CxBt/BĭC"wBBCU#zBB=>vPb?_>6C?vBt/BCxBt/BC?vB|NB`;=Z>yCI#]Bn-BĭCI#]BBCcBB7l=u,>:{CcBBĭCI#]BBĭCcBB4=>FnCcBBĭCcBBCiBB5>sj>rCiBBĭCcBBĭCiBzBz>R?s(խC_pBZ(BCAlBZ(BCiBB>?t(խC_pBZ(BCiBBĭC_pByB=e+>>>dĭC_pByBCiBBĭCiBzB+>?&CAlBZ(BխC_pBZ(BC_pBBL>5$?F3$խC_pBZ(BĭC_pByBĭCøpBZ(B>C%?ά"C_pBBխC_pBZ(BĭCøpBZ(B1>|D%?]"C_pBBĭCøpBZ(BCKrB\Bƹ> B?CKrB\BĭCøpBZ(BĭCuB\BѸ>`?旚 C?vBBĭCuB\BĭC?vB:/B>`?U C?vBBCxuBBĭCuB\B>f`?pCxuBBCKrB\BĭCuB\B>9n?2CxuBBC?vB6BCgTuB6B>2k?Yؼ C?vBBC?vB6BCxuBB>n?J=CgTuB6BC?vBBCtBB_>dFm?wJ=C?vB6BC?vBBCgTuB6BU>6zk?[?>ĭC?vBBCtBBC?vBB>zk?S?>ĭC?vBBĭCuBt/BCtBB>yp?%`>ĭCuBt/BCsBt/BCtBBϛ>lm?f^>CsBt/BĭCuBt/BCm9rBdBG5>m?9|>ĭCuBt/BĭC tBdBCm9rBdB>`?4 C?vBBĭC?vB:/BĭC޻wBB>k?BؼC?vB6B C?vBBĭC޻wBB$D>mn?nnĭCwB6BC?vB6BĭC޻wBB]>Fm?HH=C?vBBC?vB6BĭCwB6BӲ>tn?)=ĭC"wBBC?vBBĭCwB6Bo>({k?V?>C?vBBĭC"wBBĭC?vBBY=ɫx!_CcBB!_CI#]ByBӮCI#]BB/@/>9oFCcBB!_CcBBӮCI#]BB@I/>oӮCI#]BBCcBBFCcBBUU>|tCI#]Bn-BCcBBӮCI#]BBŚz>k!_CcBBFCcBB!_C}dBBÚ}z>kFCcBB!_CiBB!_C}dBB8ƚz>'kFCcBBCcBB!_CiBB5¾r[>]CcBBCiBB!_CiBB ?0 CAlBZ(Bc C_pBZ(B!_C_pBB(;m ?иCAlBZ(B!_C_pBBCiBB>ľ>H`CiBB!_C_pBB!_CiBB6?TCAlBZ(BC_pBBc C_pBZ(Bf? !_C_pBBc C_pBZ(B!_CU$sBZ(BԔ??c C_pBZ(BC_pBBCKrB\BY ?c C_pBZ(BCKrB\B!_CU$sBZ(BWRv?2)'!_CU$sBZ(BCKrB\B!_CQ:tB\BYN y?~Ǻ!_CQ:tB\BCKrB\B!_C.tBBw<|q?-^CKrB\BCxuBB!_C.tBB`<`?j^=!_C.tBBCxuBB!_CmtB6Bp>;}?=CxuBBCgTuB6B!_CmtB6BU; ><{?< >!_CmtB6BCgTuB6B!_CΆsBB;>ύz?=CgTuB6BCtBB!_CΆsBB:>x?֑*>!_CΆsBBCtBB!_ClrBt/B-}I>w?j>CtBBCsBt/B!_ClrBt/BoE>s?s>!_ClrBt/BCsBt/B!_ChpBdBMU>8s?Sd>CsBt/BCm9rBdB!_ChpBdB>_? éCI#]BB éCcBBCI#]BUB牬ȏ> f? éCcBBCcBGUBCI#]BUB;|Qu>*_?CiBB éCEiBB éCiBBfu&>ؖf?CC7eBB éCEiBBCiBBe_$>yf? éCEiBBCC7eBBCcBGUBYz>ULZ? éCcBB éCEiBBCcBGUBiuk> Z? éCiBB éC_pB:BCiBBE>]b? éC_pB:BC_pBMU]?C rBPB éCʞtBPBC?vBB>|>T]? éCʞtBPBC rBPBC_pBy ?Q? éC_pB:B éCʞtBPBC_pB,?-p8? éCBdBC۸BdBC}1}B,RBҖ=;? -? éC}1}BB éCBdBC}1}B,RBL>R_?3C`B6B éCI#]BB CI#]B6B>E_?3C`B6B3CcB|B éCI#]BBĉŦ>h?3CcB|B éCcBB éCI#]BB>_? CI#]B6B3CI#]BB3C`B6BCo/>b? éCEiBB^ʩCiBB éCiBB; F>u b?^ʩCiBB éCEiBB éCcBB0ET>b?^ʩCiBB éCcBB3CiBBA>VX?3CiBB éCcBB3CcB|B7)h?iT?3C'lBB éCiBB^ʩCiBBb9#?S?3C'lBB3C_pBSB éCiBBA߽=>A_?3C_pBSB éC_pB:B éCiBB|9?S?^ʩCiBB3CiBB3C'lBB"q}=)?>? éC?vBdB3CŒtBPB3C?vBSB;^?}T? éCʞtBPB3CŒtBPB éC?vBdB8;?|T?3CŒtBPB éCʞtBPB éC_pB:B?п'????3C_pBSB3CŒtBPB éC_pB:B>CL?? éC}1}BB3C#{BB3C}1}B2B=+7?41? éC {BB3C#{BB éC}1}BBn=p/?:8?3C#{BB éC {BB éC?vBdBm="6?qH3?3C?vBSB3C#{BB éC?vBdB'p>6?(?3CBdB éCBdB éC}1}BB >YDL??3C}1}B2B3CBdB éC}1}BBB8>Q^?3CcB|BZ]CbtcB6BZ]CcB>0BK*>Z'g?3C`B6BZ]CbtcB6B3CcB|BK" >&g?Z]CbtcB6B3C`B6B3CI#]BBz>$Y?Z]CI#]BBZ]CbtcB6B3CI#]BBt:k?TnU?Z]CcB>0BZ]CiBA/B3CcB|B- >]?Z]CiBA/B3CiBB3CcB|B*?$5H?3C_pBSBZ]ClBBZ]C_pBSB 񐽦 ?qW?3C'lBBZ]ClBB3C_pBSBm ?W?Z]ClBB3C'lBB3CiBBj\?F?Z]CiBA/BZ]ClBB3CiBB>G?8?3C?vBSBZ]CtBPBZ]C?vB Bg]=y)?)??3CŒtBPBZ]CtBPB3C?vBSBu[=U(?3b@?Z]CtBPB3CŒtBPB3C_pBSB 5?5?Z]C_pBSBZ]CtBPB3C_pBSB>A?W?3C}1}B2BZ]C`|BdBKC}1}BdB>A?U?3C}1}B2B3C#{BBZ]C`|BdB$>eR?#F?3C#{BBZ]C? yBBZ]C`|BdB*i> 1?_.?Z]C? yBB3C#{BB3C?vBSB>G?3?Z]C?vB BZ]C? yBB3C?vBSB>;A?T?KC}1}BdB3CBdB3C}1}B2B2l>^_?Z]CbtcB6B>eCcB6BZ]CcB>0B4n>4^?>eCcB6BZ]CbtcB6BZ]CI#]BB4o>^?>eCcB6BZ]CI#]BB*CcBBHy ?R?*CcBBZ]CI#]BB*CI#]BBS <)?hH?*C&eB6BZ]CcB>0B>eCcB6Bc!K?3G?*C&eB6B*CiBUBZ]CcB>0B"y?X?*CiBUBZ]CiBA/BZ]CcB>0B"!?2G?>eCcB6B*CcBB*C&eB6B_>9?C-?Z]C_pBSB*CWlBB*C_pB BMn0[?Z>*C?vBxB &C?vBB*CmvBB{>R"B??Z]C?vB B*CmvBB &C?vBB}>eB??Z]C?vB BZ]CtBPB*CmvBB~9>uS? ?Z]CtBPB*CrBPB*CmvBBއ>l2?;2?*CrBPBZ]CtBPBZ]C_pBSB>=9?-?*C_pB B*CrBPBZ]C_pBSB:b>=[?b> &C?vBB*C?vBxB*CgyBdB>6[?|]> &C?vBB*CgyBdBZ]C? yBB>J?3>Z]C? yBB*CgyBdBZ]C`|BdB킋>@B?? &C?vBBZ]C? yBBZ]C?vB Ba3>?bL?C}|]B,kB*CI#]BBӬCI#]B,kB63?L?C}|]B,kBCcBh=B*CI#]BB׽?W?CcBh=B*CcBB*CI#]BB3?UL?ӬCI#]B,kBCI#]B;BC}|]B,kB =0?U49?*CiBUBCeB6BCiBA/BXYb?sI?*C&eB6BCeB6B*CiBUB}X0b?sI?CeB6B*C&eB6B*CcBB/?\8?CcBh=BCeB6B*CcBBA>K?:K?*C_pB BCiPlBBC_pBMB[ =:?.?*CWlBBCiPlBB*C_pB B=4?b4?CiPlBB*CWlBB*CiBUB=]4?4?CiBA/BCiPlBB*CiBUBs>3S?>*C?vBxBCmvBdB[C?vBdB>$S?ܷ>*C?vBxB*CmvBBCmvBdB4>)b?i>*CmvBBCStBBCmvBdBТ>tY?t>CStBB*CmvBBCWqBPBBF>7{S?z?*CmvBB*CrBPBCWqBPBX,>?8?X,?CWqBPB*CrBPB*C_pB BA>*K?J?C_pBMBCWqBPB*C_pB B>Z3S?>[C?vBdB*CgyBdB*C?vBxBzM'*???CcBh=BĭC[^B,kBĭCcBcBA5 6?M?C}|]B,kBĭC[^B,kBCcBh=B6 ?M?ĭC[^B,kBC}|]B,kBCI#]B;B9%_ (?BĭC[^B,kBCI#]B;B=F{D?"?CiBA/BĭC+eB6BĭCiBxBp毼+0?D9?CeB6BĭC+eB6BCiBA/B毼q0?mD9?ĭC+eB6BCeB6BCcBh=B,]4?4?ĭCcBcBĭC+eB6BCcBh=Bɦ>a?>ĭC_pBBHC_pBPBĭC8oBPBl>AG?.q?C_pBMBĭC8oBPBHC_pBPBl>AG?`q?C_pBMBCiPlBBĭC8oBPB>eV?B?CiPlBBĭCR6kBBĭC8oBPB]=L3?3?ĭCR6kBBCiPlBBCiBA/B=9zD?ɶ"?ĭCiBxBĭCR6kBBCiBA/B>c?3c>ĭC tBdBCmvBdBĭCrBBߜ>,d? >CmvBdBCStBBĭCrBB>Sa?>HC_pBPBĭC_pBBĭCrBBݦ>a?>HC_pBPBĭCrBBCWqBPBmx>Z?>CWqBPBĭCrBBCStBB{l>BG?!q?HC_pBPBCWqBPBC_pBMBf4x@?x(?ĭCcBcBC`B,kBCcBqB))?Q=?ĭC[^B,kBC`B,kBĭCcBcB{+)?=?C`B,kBĭC[^B,kBĭCI#]B>B˕s.3?-3?CI#]BnBC`B,kBĭCI#]B>BH>/>5[?I>CiBBCiBBC%iBB>D??ĭCiBxBC%iBBCiBBq,>B?Q!?ĭCiBxBĭC+eB6BC%iBBzl?1Č>C_pBBFC_pBBC/RpBB"~>sa?>ĭC_pBBC/RpBBFC_pBBo ~>a?'>ĭC_pBBĭC8oBPBC/RpBB0e>e?>ĭC8oBPBCɝmBPBC/RpBB 1>JZ?d>CiBBCiBBCɝmBPBY1>eGZ?ub>CiBBCɝmBPBĭCR6kBB]T>3^T?Ǻ?ĭCR6kBBCɝmBPBĭC8oBPBhE>B?fR!?CiBBĭCR6kBBĭCiBxB08>l?a>FC_pBBC_pBBCm9rBdBH>l?>FC_pBBCm9rBdBĭCrBBϕ>Bk?>ĭCrBBCm9rBdBĭC tBdB*~>a?b>FC_pBBĭCrBBĭC_pBB?sUN??CcBqB!_C`B,kB!_CcByB]#'/@?((?C`B,kB!_C`B,kBCcBqBw4?94?!_C`B,kBC`B,kBCI#]BnBsw4?D4?!_CI#]B]2B!_C`B,kBCI#]BnB> (c? (>CiBB!_C%iBB!_CiBPBg=>\?>C%iBB!_C%iBBCiBBu\=v]?q%>!_C%iBBC%iBB!_CfeB6Bc ='U?] ?C%iBBCeB6B!_CfeB6Bf= @?Ez(?!_CfeB6BCeB6BCcBqB?FUN??!_CcByB!_CfeB6BCcBqBk>Il?U>C_pBB!_CnBB!_C_pBBun> n?jǍ>C/RpBB!_CnBBC_pBB\=h?o>!_CnBBC/RpBB!_C6lBPBPJ>G8g?p>C/RpBBCɝmBPB!_C6lBPB~>>QY? >!_C6lBPBCɝmBPBCiBB> (c? (>!_CiBPB!_C6lBPBCiBB)R>0p?>!_ChpBdBCm9rBdBC_pBBk>l?S>!_C_pBB!_ChpBdBC_pBB**ĭCBoBĭCP BI|B)CBI|B^7HĭCP BI|BĭCfΝB谪B]CB谪Bx55f4<)CBI|BĭCP BI|B]CB谪B\_@ >ĭCfΝB谪BĭCBuB]CB谪B((ЪĭCۡBj2BĭCԠB BCۡB B1O.alĭCԠB BĭCBGB?CۡBGBV0T0qgCۡB BĭCԠB B?CۡBGB+))QګĭCBGBĭCBoB)CBI|B+M+)ګĭCBGB)CBI|B?CۡBGB\jw?CۡBGB)CBI|B,CۡBI|B]p]<)CBI|B]CB谪B,CۡBI|BLj; y]>>]CB谪B:VCۡB谪B,CۡBI|B\vhW)>ĭCBuBĭCBBCۡBBvWƏ)>ĭCBuBCۡBB]CB谪Bcj!>]CB谪BCۡBB:VCۡB谪B8gBNJ>ĭCBBĭCۡBoaBCۡBB`++iC=BBCЗBBvC=BB_"4 4=CЗBBC=BBvC=BB((eCTrBBCBI|BQpCTrBI|BI3G%{ޛCBI|BChB谪BCTrB谪BRx-u-]QpCTrBI|BCBI|BCTrB谪B1 $ӦChB谪BC=BBvC=BBc19 $ӦChB谪BvC=BBCTrB谪B_姽CTrB谪BvC=BBCTrBBol>C=BBCNB%BpCCTrB%B$ol >C=BBpCCTrB%BvC=BBZYk>vC=BBpCCTrB%BCTrBB; >;gӾCBBàBCzB BCB Bɕ#+CzB BCxBGB! CBGB~gC7vCB BCzB B! CBGB**QpCTrBI|BĭCP BI|BĭCBoB7'?J*_mCTrBBQpCTrBI|BĭCBoBn(+밾CTrBBĭCBoB! CBGB:$L,rCTrBB! CBGBCxBGBv-w-\CTrB谪BĭCP BI|BQpCTrBI|B^·`6HĭCfΝB谪BĭCP BI|BCTrB谪Bݦ\rF>ĭCfΝB谪BɭCBBĭCBuB\u?E>ĭCfΝB谪BCTrB谪BɭCBBmt!TCTrB谪BCTrBBɭCBB5 l&&>CTrBBpCCTrB%BɭCBByBk#\>pCCTrB%B[CB%BɭCBBF|t7pCۡBvBCGBmޝB|CۡBmޝB <ξCB BĭCԠB BĭCۡBj2BT (<^ҾCBBàBCB BĭCۡBj2B bɭCBBĭCBBĭCBuBw8g}OJ>ĭCBBLCۡB%BĭCۡBoaBQ8gPJC>ĭCBBɭCBBLCۡB%BYn]R>ɭCBB[CB%BLCۡB%B%43V!_C B${B!_C5ܔBBRC BB211t=!_C5ܔBB!_C;B%BjC B%B*Z9g]2RC BB!_C5ܔBBjC B%BF$=!_C=BB!_Ch6B谪BٮC=B谪BL $1ԦRC BBCЗBBC=BB&ƌ2!_C B${BRC BBC=BB %1L!_C B${BC=BBٮC=B谪Bw*U/y!_C B${BٮC=B谪B!_Ch6B谪B52s=CЗBBC=B%BC=BBn,;;=CЗBBRC BBC=B%BO XRC BBjC B%BC=B%B<%!_CTrB?9B!_ChBGBCTrBGBfFؾCTrBBCTrBGB!_ChBGBNhSFHؾCTrBB!_ChBGBCBI|B" Ȉ/TCBI|B!_ChBGB!_CjBI|B<$жٮC=B谪B!_CjBI|B!_C=BB%%e&$ٮC=B谪BChB谪B!_CjBI|B1$=jUChB谪BCBI|B!_CjBI|B/&\ٮC=B谪BC=BBChB谪BC=B%BCNB%BC=BBV/ H%CBBàB!_CB`B!_CB B"ǾiM;CzB BCBBàB!_CB BBņ<CTrBGB!_CB B!_CTrB?9BNp<ڛCTrBGBCxBGB!_CB B!Ǿ^Mr@CxBGBCzB B!_CB BIgaFؾCTrBGBCTrBBCxBGBM7&!_CۡBB!_CJ;BΩBCۡBΩBSjLfCۡBvBCۡBΩB!_CJ;BΩB,SL߃CۡBvB!_CJ;BΩBCGBmޝBEwƺF" CGBmޝB!_CJ;BΩB!_CKBmޝB㪾SR!_CKBmޝBCBBàBCGBmޝB%ȾH>+!_CB`BCBBàB!_CKBmޝBw5gI>CNB%BCԚBNBCTrBNBcoj>pCCTrB%BCNB%BCTrBNBg2d< >CԚBNBCTrBBCTrBNBV\la]}>pCCTrB%BCTrBNB[CB%Bg"5>CTrBNBQpCBNB[CB%B+mfDi޽>CTrBBCBmBQpCBNBOj@GZ>CTrBNBCTrBBQpCBNB fK5>[CB%BQpCBNBLCۡB%B1bG>QpCBNB]CۡBNBLCۡB%B^Y?YP>CBmBCۡBƵB]CۡBNBtf<$>QpCBNBCBmB]CۡBNBE"!_C;B%B!_Cj.BNBC BNB*!4!41ʽjC B%B!_C;B%BC BNBFj@̾A!_Cj.BNB!_C͒BcB C BcBFm]n=C BNB!_Cj.BNB C BcB|1 C BcB!_C͒BcBMC BB}oh>!_CEBB!_C B*BMC BBK S 5qjC B%BC BNBC=B%B3,m ߱[>C BNBC=BNBC=B%B -m߱?>C BNB C BcBC=BNB`n2> C BcB'C=BcBC=BNBxuy8R;W> C BcBMC BB'C=BcBtpg4>MC BBCC=BB'C=BcBkXμc>!_C B*B!_C=B[BCC=BBqf5K>MC BB!_C B*BCC=BBil[>C=BNBCNB%BC=B%BwdI.>CԚBNBCNB%BC=BNBogrY<>CԚBNBCTrBcBCTrBBgbCԚBNBC=BNBCTrBcB6lplH>C=BNB'C=BcBCTrBcBDoRD<>'C=BcBCC=BBCTrBcBi z;>CC=BBx=CTrBBCTrBcBcɺ_>!_C=B[B!_CTrBBx=CTrBBkϻu>CC=BB!_C=B[Bx=CTrBBBk>{ЮCBcBCTrBBCTrBcBmf?g޽>CBmBCTrBB{ЮCBcBh]>CTrBcBx=CTrBB{ЮCBcB _m<>x=CTrBBCCBB{ЮCBcBMh]"5=?!_CTrBB!_CBtBCCBB=qchx=CTrBB!_CTrBBCCBBgM>{ЮCۡBcBCBmB{ЮCBcB^mCۡBƵBCBmB{ЮCۡBcB_>{ЮCBcBCCBB{ЮCۡBcBWv= ?CCBBSCۡBB{ЮCۡBcBޚPx_=?!_CBtB!_CۡBBSCۡBBm]:=ï>CCBB!_CBtBSCۡBB41?e?eC6BBC6BNBCQBBM?l?߳CQBBC:kBBC:kBZ(B0M?x?߳C6BBCQBBC:kBZ(Bܻ0?'-?~C6BBC:kBZ(B éC;qBZ(B0?-?#~C6BB éC;qBZ(B éC6BƇBi4?k1?>C:kBB éC;qBZ(BC:kBZ(B}4?p1?>C:kBBC B\B éC;qBZ(B&? B?W=C B\B éCIB\B éC;qBZ(B?K?@z%>ؐC6BB éC6BB éCIB\B?4K?s%>ؐC6BB éCIB\BCBB!?hCBB éCIB\BC B\B)?mC?OJ>kC6B6BؐC6BBCBB?FJ?6>CŖB6BkC6B6BCBB>6C?%>kC6B6BCŖB6BC6BvBw4?~4?흽C:kBZ(BC:kBBCBZ(Bf*3?23?֕>C:kBZ(BCBZ(BC:kBBy0?-? ~xѩC6BZ(B éC6BƇB éC;qBZ(BH]6?(3?:<ȩC6B\BxѩC6BZ(B éC;qBZ(B8$?vC?+= éCIB\BȩC6B\B éC;qBZ(B!#?WA?b#>ȩC6B\B éCIB\B éC6BBv8@ éCB2B éC9BBCBB\ٌc éC9BB éCLBS׍BėCBS׍BLEy 7޽CBB éC9BBėCBS׍BkǾ < éCLBS׍B éC_B BCB BJ^զ^=ėCBS׍B éCLBS׍BCB B/e]Q!ls> éC_B B éCB֒BCB BB0=}-43CJBrB3CܴB BƁCJB BgR{3CܴB B3CB@B~CJB@Bo6j3e6ƁCJB B3CܴB B~CJB@B0QJ=3CB@B3CJB6B~CJB@B8""3CKBuB3CXxBBN[CKBB1)J3CXxBB3CBS׍B+ CKBS׍B={.}.cON[CKBB3CXxBB+ CKBS׍B2]v*7"3CBS׍B3CJBrBƁCJB B2t*c!3CBS׍BƁCJB B+ CKBS׍BǒU<( {+ CKBS׍BƁCJB B$CKB BVq VƁCJB B~CJB@B$CKB B.c3CJB6B3C(B/uBQCKB/uBqnas]>3CJB6BQCKB/uB~CJB@B^b޾y>~CJB@BQCKB/uBCKB@Bdr 3CBB3CXBnBfCBnBNu8<BN[CKBB éC9BB éCB2Bٷ,3CKBuBN[CKBB éCB2B} 33CKBuB éCB2BfCBnB"("y3CKBuBfCBnB3CXBnB#>|+ CKBS׍B éC9BBN[CKBB\b éCLBS׍B éC9BB+ CKBS׍B^Go| $CKB B éCLBS׍B+ CKBS׍B+k:Ǿ"< éC_B B éCLBS׍B$CKB BeNhs> éC_B B۩CB@B éCB֒BeO is> éC_B B$CKB B۩CB@B6sh>$CKB BCKB@B۩CB@Bl-H>CKB@BQCKB/uB۩CB@BwkUuN>QCKB/uB$CB/uB۩CB@B,,RZ]CBjBZ]C&B BKCB B00S\Z]C&B BZ]CB@B CB@B00$\KCB BZ]C&B B CB@B/L)d/Z]CB@BZ]CB/uBCB/uBC44D CB@BZ]CB@BCB/uB\'L*uZ]CJBAiBZ]CiBBFOCJBBE"@*+ʾZ]CiBBZ]C+BS׍BѪCJBS׍B;BcFOCJBBZ]CiBBѪCJBS׍BB@0{-c6KCB B3CܴB B3CJBrB=-k,ᖗZ]CBjBKCB B3CJBrBf..tZ]CBjB3CJBrBѪCJBS׍BCb(u0Z]CBjBѪCJBS׍BZ]C+BS׍Bb2PK/=^ CB@B3CܴB BKCB BR>t3CB@B3CܴB B CB@BQ κ=3CB@BkCJB/uB3CJB6BQd=3CB@B CB@BkCJB/uBd+ CB@BCB/uBkCJB/uBX_!)_!Z]CKBBZ]CkBnBNCKBnB m/FOCJBB3CXxBB3CKBuBll-Z]CJBAiBFOCJBB3CKBuBiǎ-їZ]CJBAiB3CKBuBNCKBnBTr/" Z]CJBAiBNCKBnBZ]CkBnB ;`ѪCJBS׍B3CXxBBFOCJBBq-q-퐒3CBS׍B3CXxBBѪCJBS׍Bke.ke.:ѪCJBS׍B3CJBrB3CBS׍B4n|S>kCJB/uB3C(B/uB3CJB6BѾ"'Z]CBrBZ]C`Bv9B CBv9Bg%NCKBnB3CXBnB3CBB.R$Z]CKBBNCKBnB3CBB9۾-C"$Z]CKBB3CBB CBv9BѾ1"6'Z]CKBB CBv9BZ]C`Bv9B)4]NCKBnB3CKBuB3CXBnBWy%- *C B B*CB@BޫC B@B0-Aـ*CB@B*C`]B/uBC B/uB+Z47kޫC B@B*CB@BC B/uBx\v:*CB,B*CHBS׍BЫCBS׍BjKmZ]CBjBЫCBS׍B*CHBS׍Bk"KZ]CBjB*CHBS׍BZ]C&B B  :yҾZ]C&B B*CHBS׍B*C4B By%- ޫC B@B*C4B B*C B Bx%-? ޫC B@BZ]CB@B*C4B BcF[xZ]CB@BZ]C&B B*C4B Bg+K[46kC B/uBZ]CB@BޫC B@BLeW2Z]CB/uBZ]CB@BC B/uBtk0v"Z]CJBAiB*CJBB*CHCBBc:?Z]CiBBZ]CJBAiB*CHCBB|s:ЫCBS׍B*CHCBB*CB,B u:ЫCBS׍BZ]C+BS׍B*CHCBBϾi;IZZ]C+BS׍BZ]CiBB*CHCBB[iKЫCBS׍BZ]CBjBZ]C+BS׍BP:..Z]CKBB*CKBYB*C7BnB:P..Z]CkBnBZ]CKBB*C7BnBvA %*C7BnBZ]CJBAiBZ]CkBnBuj0Y"*CJBBZ]CJBAiB*C7BnB% T${TyTCBBĭCBn?BĭC;Bv9Bf=}RKCTBv9BCBBĭC;Bv9Bm=\~QKĭC;Bv9BCKB5BCTBv9B)=l 3VĭCKB#MBCKB5BĭC;Bv9Be?62%CDBT+BC1B@BCDB@B-řDkĭCDBڕBCDB@BC1B@B™DʈĭCDBڕBC1B@BĭC}B/uBľ/gĭC}B/uBC1B@BCIB/uB@2@2^B2CnyBǫBCCB B1CnyB B쫗m$BCDB@BĭC!rB@BĭCnyBJBKX?vCDBT+BCDB@BĭCnyBJBnX(; &CDBT+BĭCnyBJB1CnyB B::)CDBT+B1CnyB BCCB B0™KDCDB@BĭCDBڕBĭC!rB@Bb13v7C B͐BC?eBS׍BխC BS׍BV=V=V%1CnyB BĭCkB BĭC BލB'C BBĭCBBĭCBBr7<,r7KCBŠBĭCBBC BBVx>W QĭCKB#MBCKB@BCuBnB,>W]FĭCaBnBĭCKB#MBCuBnB ,>c^FCuBnBĭCJB@·BĭCaBnBБ>*ŷUCJBxNBĭCJB@·BCuBnBi>rHĭC;Bv9BĭCBn?B+JCBv9B9>9sH+JCBv9BĭCKB#MBĭC;Bv9Be> s܁H+JCBv9BCBBĭCKB#MB>nѾ_CBBCKB@BĭCKB#MB1|q/q/!_C0BB!_C"B/uBC0B/uB10˩3CDBT+B!_CDB-`B!_C`B@BU=Ns:(C1B@BCDBT+B!_C`B@B ~ -]0C0B/uB!_C`B@B!_C0BBzW.|0C0B/uBCIB/uB!_C`B@B#=Ki:g(CIB/uBC1B@B!_C`B@Bj<-;CnyBǫB!_CnyBkB!_C˪B BxLj4l4CCB BCnyBǫB!_C˪B BM:= }+!_C˪B BCDBT+BCCB B;_75*H.9!_CDB-`BCDBT+B!_C˪B Bb=13v7C?eBS׍BC B͐BNC BS׍B=ȸ1t7NC BS׍BCnyBǫBC?eBS׍B="1t7NC BS׍B!_C BݍBCnyBǫBy&>G!_C BݍB!_CnyBkBCnyBǫB\=M!_CʶBS׍BNC BS׍BC B͐BS=ɿM!_CʶBS׍BC B͐B!_CBB1>&=!_CBBC B͐BCBŠB/V=IMNC BS׍B!_CʶBS׍B!_C BݍB(>LNCJBxNB!_CJB4B!_CIBB#4j>JqEC BBCJBxNB!_CIBB0-j>{eE!_CIBBCBŠBC BB.G>[zT!_CBBCBŠB!_CIBB'>CCuBnBCKB@BCKBnB(> CCKBnBCJBxNBCuBnB%>(CCKBnB!_CKBBCJBxNB>;Z}[!_CKBB!_CJB4BCJBxNBF>򦍾W!_CJ BnBCKBnBCKB@B>zW!_CJ BnBCKB@B!_CBEBI?|D!_CBEBCKB@BCBB>>WCKBnB!_CJ BnB!_CKBB^(\>3C(B/uB3CKBBQCKB/uB^J=@>3CKBB3CBB$CB/uBe24I;>QCKB/uB3CKBB$CB/uBgFپZ]CB/uBZ]CEͯBΩBCBΩBM=CB/uBZ]CB/uBCBΩBss*>Z]CEͯBΩBZ]C˱BmޝB[CBmޝB_VѾ>CBΩBZ]CEͯBΩB[CBmޝBfh>Z]C˱BmޝBZ]CBB[CBmޝB.cCBΩB۪CJBΩBkCJB/uBj`>CBΩB[CBmޝB۪CJBΩB$sh!fK7ݼ>[CBmޝB.CJBmޝB۪CJBΩB`B>Z]CBBZ]CJBERB.CJBmޝBҲi}LXJ>[CBmޝBZ]CBB.CJBmޝBf^dW>3C(B/uBrCKBΩB3CKBB^h>3C(B/uBkCJB/uBrCKBΩB3tnv_>kCJB/uB۪CJBΩBrCKBΩBWgHYP>۪CJBΩB.CJBmޝBrCKBΩB$b$⽬4>.CJBmޝB:CKBmޝBrCKBΩB3X ms?Z]CJBERBZ]CKBB:CKBmޝB8c8>.CJBmޝBZ]CJBERB:CKBmޝB_i9̽->CBΩB3CKBBrCKBΩBi^A%6>3CBB3CKBBCBΩBwwbJ.ƽ>rCKBΩB:CKBmޝBCBΩBZ*lZ4?:CKBmޝBCBmޝBCBΩB2Ndl=5l?Z]CKBBZ]CBxBCBmޝBxYhX?:CKBmޝBZ]CKBBCBmޝB 5$*CnyBB*CBΩB CnyBΩBUe*CBΩB*C//BmޝBCnyBmޝB=Y+*CB B*CnyBzB*CnyBzB*CGBGBJC BGBt>*CnyBzBJC BGB*CGBGB*C BSBJC BGByKM KͽC BΩBZ]CB/uBC B/uBsg/HپBZ]CEͯBΩBZ]CB/uBC BΩBƪfBؾM=sC BmޝBZ]CEͯBΩBC BΩBsG~*>Z]C˱BmޝBZ]CEͯBΩBsC BmޝBf⁾3>Z]C˱BmޝB㫫CB BZ]CBBWfZ5>Z]C˱BmޝBsC BmޝB㫫CB B-t/>sC BmޝB˫C B B㫫CB B~jZ0>˫C B BJC BGB㫫CB Be{>JC BGBCCBGB㫫CB BA]o|>*C BSB*CB1BCCBGBeФӝ>JC BGB*C BSBCCBGB9m.ϽU>sCJB BZ]CBB㫫CB Be`fBf>Z]CJBERBZ]CBBsCJB B2IeȽ >㫫CB BCCBGBsCJB B]ʵ]?CCBGB CJBGBsCJB B?Rg< ?*CB1B*CJBB CJBGB]׶]'?CCBGB*CB1B CJBGBd>sCKB BZ]CJBERBsCJB B XG m.t?Z]CKBBZ]CJBERBsCKB Bˠ] ?sCJB B CJBGBsCKB BhN\=yr? CJBGB(CKBGBsCKB BSIm.=!x?*CJBB*CKBPB(CKBGBQ=? CJBGB*CJBB(CKBGB^gXO="A?CB BZ]CKBBsCKB B1Nm=m?Z]CBxBZ]CKBBCB B@K(>"?*C6iBGB*CBzBCB B1@0(>"?*C6iBGBCB B(CKBGB{FOw=?(CKBGBCB BsCKB B3+a?(CKBGB*CKBPB*C6iBGBz;/{C0BfBCpB B֬C0B BYCJCpB BCBGB¬C0BGB(C($y`֬C0B BCpB B¬C0BGB0Wn9C.BI|BC0BUBjܬC0BI|Bk&A&3ƾCDB[BC~BΩBŬCDBΩBŖ:pC~BΩBCBmޝB yCDBmޝB.g.:ŬCDBΩBC~BΩB yCDBmޝBx;2=zCBmޝBC0BfB֬C0B Bz;\0yCBmޝB֬C0B B yCDBmޝB`X> m yCDBmޝB֬C0B BXCDB BxY mq֬C0B B¬C0BGBXCDB Bk⸿u=¬C0BGBmoCDBGBXCDB Bܙkl%=¬C0BGBjܬC0BI|BmoCDBGB oWoņ>jܬC0BI|B CDBI|BmoCDBGB,gFKL>C0BUBCDBdB CDBI|Bk?k>jܬC0BI|BC0BUB CDBI|B 5G$ŬCDBΩB*CBΩB*CnyBBF)#ɾCDB[BŬCDBΩB*CnyBB;.G)yCDB[B*CnyBB\gCnyB/uB(`,̾CDB[B\gCnyB/uBCOeB/uB6% yCDBmޝB*CBΩBŬCDBΩBUa*C//BmޝB*CBΩB yCDBmޝB?UapXCDB B*C//BmޝB yCDBmޝBjj;*CB B*C//BmޝBXCDB Bcƾ>*CB B8CnyBGB*CnyBzBcƾ>*CB BXCDB B8CnyBGB vxG=XCDB BmoCDBGB8CnyBGBnp}L>moCDBGB CDBI|B8CnyBGB70kkH> CDBI|BGCnyBI|B8CnyBGBÕk"0!>CDBdBCB谪BCnyB谪Bk0>CDBdBCnyB谪B CDBI|B,aN> CDBI|BCnyB谪BGCnyBI|B]^'7>CB谪BCnyBSBCnyB谪B'U2ۘ\gCnyB/uB*CnyBB*C`]B/uB)t߯>8CnyBGB*CGBGB*CnyBzBGd|4>*CGBGBC BI|B*C BSB]d>*CGBGB8CnyBGBC BI|Bl^1>8CnyBGBGCnyBI|BC BI|BVVc,*o>GCnyBI|BCnyB谪BC BI|B_>CnyB谪BC B谪BC BI|B$Y:C:?CnyBSBC B,BC B谪B%!_>CnyB谪BCnyBSBC B谪B<_fzf<,>ޅCBI|B*C BSBC BI|B?]&o->*CB1B*C BSBޅCBI|BX__=a?CB谪BCBTBޅCBI|BXu=Kf?CB谪BޅCBI|BC B谪Bp_5_<>C B谪BޅCBI|BC BI|BMXX=x?C B谪BC B,BCB谪B\=l>CJBI|B*CB1BޅCBI|BR<?*CJBB*CB1BCJBI|BqEHQ/>U?CBTBCJBWjBCJBI|BgXG=@?ޅCBI|BCBTBCJBI|BOJ5>й?ŬCKBI|B*CJBBCJBI|B,I=k?*CKBPB*CJBBŬCKBI|B*:[>,O&?CJBWjBCKBl[BŬCKBI|BDHT?CJBI|BCJBWjBŬCKBI|B@g(>"?*C6iBGBUCBGB*CBzBa3XP>b(?UCBGBCHBI|BCB\B[>b&>&?*C6iBGBCHBI|BUCBGBAD>l?*C6iBGBŬCKBI|BCHBI|B/FH/>U?*C6iBGB*CKBPBŬCKBI|B7s`>u#?ŬCKBI|BCKBl[BCHBI|B(M+$a@ĭC0B BĭCaBΩB7C0BΩB%Б%ξĭCaBΩBĭC}BmޝB%&C0BmޝBg/7C0BΩBĭCaBΩB%&C0BmޝBz;/(|CۡB BCpB BC0BfB/ΨPĭCۡBj2BCۡB BC0BfB3 ((svĭCۡBj2BC0BfB%&C0BmޝB((ĭCۡBj2B%&C0BmޝBĭC}BmޝB=0! .y?CۡBGBCpB BCۡB BUYGwCBGBCpB B?CۡBGBYq,CۡBI|BCBGB?CۡBGBSXn3R{C.BI|B"C0B谪BC0BUBcaj>C.BI|B,CۡBI|B"C0B谪BssE>,CۡBI|B:VCۡB谪B"C0B谪Bkkm>:VCۡB谪BCۡBB"C0B谪B:h* >CۡBB}yC0BB"C0B谪B`ڽf>ĭCۡBoaBĭC0BB}yC0BBh+ >CۡBBĭCۡBoaB}yC0BBZu-/ξ7C0BΩBC~BΩBCDB[B)&8+ĭC0B B7C0BΩBCDB[BFE,_3ĭC0B BCDB[B\CDB/uBS/# ĭC0B B\CDB/uBĭC}B/uB  /%&C0BmޝBC~BΩB7C0BΩB:>oCBmޝBC~BΩB%&C0BmޝB{;/w%&C0BmޝBC0BfBCBmޝB nI$F>CDB谪BC0BUB"C0B谪Bf/gk;K}>CDBdBC0BUBCDB谪B:h* >"C0B谪B}yC0BBCDB谪Baal>}yC0BBlCDBBCDB谪B^!>ĭC0BBĭCDBiXBlCDBBaa[>}yC0BBĭC0BBlCDBB?;b[޾\CDB/uBCDB[BCOeB/uBik0^>CDB谪BCB谪BCDBdBv^'>CB谪BviCnyBBCnyBSB^''>CB谪BCDB谪BviCnyBBmba/>CDB谪BlCDBBviCnyBBY<?ĭCDBiXBĭCnyB=.BviCnyBB_^>lCDBBĭCDBiXBviCnyBB^O^=>HvC BBCnyBSBviCnyBBYC:խ?C B,BCnyBSBHvC BB#Rf=x?ĭCnyB=.BĭC BwBHvC BBXPX={?viCnyBBĭCnyB=.BHvC BBXM\=^?CB谪BCB谪BCBTB"Xc='K?C B,BCB谪BCB谪BX3^=a?C B,BHvC BBCB谪B%J>$>?HvC BBCBBCB谪B?O]>/-!?ĭC BwBĭCBGBCBBP )>J ?HvC BBĭC BwBCBB%TG>:?,6CJB谪BCBTBCB谪BgEHa/>U?CJBWjBCBTB,6CJB谪Bz9>"?ĭC|BBĭCJB"?ĭC|BB,6CJB谪BCBBJI<>'?CBB,6CJB谪BCB谪B<#>X2?CBBĭCBGBĭC|BBDΆ>"?|CKB谪BCJBWjB,6CJB谪BX:m[>K&?CKBl[BCJBWjB|CKB谪B,>,?ĭCJB4#?,6CJB谪BĭCJBc(?CHBI|BCBI|BCB\B*>C*?CBI|BĭC錺B谪BĭCB7B"1c>ta+?CHBI|BĭC錺B谪BCBI|Bh-h׭>&?CHBI|B|CKB谪BĭC錺B谪B67]>rr#?CHBI|BCKBl[B|CKB谪B*>*?|CKB谪BĭCKBhѫBĭC錺B谪BG8*BĭC0B BC0BشBC3bBΩB`1 ĭCaBΩBĭC0B BC3bBΩB t7 |CۡBmޝBC3bBΩBCۡBvBt7|CۡBmޝBĭC}BmޝBC3bBΩB;mĭC}BmޝBĭCaBΩBC3bBΩBݍ=Ͼ|CۡBmޝBĭCۡBj2BĭC}BmޝBzkqkͮ>zC0B%BĭCۡBoaBLCۡB%B`ڽZ>ĭC0BBĭCۡBoaBzC0B%B{Ͼcm8CIB/uBĭC0B BĭC}B/uB4*DC0BشBĭC0B BCIB/uBa h>CDB%BĭC0BBzC0B%B1^x>ĭCDBiXBĭC0BBCDB%B^"'=>CnyB%BĭCDBiXBCDB%BY <?ĭCnyB=.BĭCDBiXBCnyB%BW=|?SC B%BĭCnyB=.BCnyB%Bk#R=x?ĭC BwBĭCnyB=.BSC B%BDEJ^c> ?MCB%BĭC BwBSC B%B?˰]>,!?ĭCBGBĭC BwBMCB%B79>\"?ĭC|BBCJBBĭCJBT<(?CJBBCB%BCJBnB2@5E>W(?ĭC|BBCB%BCJBBO2d>!?ĭC|BBMCB%BCB%B<<>I1?ĭC|BBĭCBGBMCB%B(L4#>?dPCKBBĭCJB]u0?ĭCKBhѫBĭCJB,?CJBnBCKB߮BdPCKBB_-?><'?CJBBCJBnBdPCKBBu>u:?ĭC錺B谪BCB谪BĭCB7B >V2?CB谪BCȹBBCBŬB?W>ɞ2?ĭC錺B谪BCȹBBCB谪BB->31?ĭC錺B谪BdPCKBBCȹBBd&?>?.?ĭC錺B谪BĭCKBhѫBdPCKBB->b'?dPCKBBCKB߮BCȹBB0N7d&CۡBΩBC3bBΩBC0BشB㾃&N7&!_CۡBBCۡBΩBC0BشB׽M79&!_CۡBBC0BشBC0B/uB)N7&!_CۡBBC0B/uB!_C"B/uBTLBCۡBΩBCۡBvBC3bBΩBĿgK7!&C0B/uBC0BشBCIB/uB-7> A(?CB%BmCJB%BCJBnB$>?:>CKB%BCJBnBmCJB%BSE>R5?CKB߮BCJBnB:>CKB%Bk辛M>d>?CȹBBUCBBCBŬBmվ;?F/?UCBB!_CzȸB%B!_CBB ?=,?CȹBB!_CzȸB%BUCBBt6 ?,?CȹBB:>CKB%B!_CzȸB%BK>O/?CȹBBCKB߮B:>CKB%B.c(&cPI>LCۡB%B]CۡBNBzC0B%Bˠ] ?]CۡBNB]C0BNBzC0B%B1\I<?CۡBƵBC0BB]C0BNB:_>]CۡBNBCۡBƵB]C0BNB ]ݼ?zC0B%B]C0BNBCDB%B?U6h =Y ?]C0BNBfCDBNBCDB%B3iRg=?C0BBCDBJBfCDBNB[$=z?]C0BNBC0BBfCDBNBHUW = Y ?CDB%BfCDBNBCnyB%BlP&=}?fCDBNByCnyBNBCnyB%BnE= ?CDBJBCnyBŴByCnyBNBTR=?fCDBNBCDBJByCnyBNB>WE],>A?C 1BNBC B/BSC B%BVE%,>A?C 1BNBSC B%ByCnyBNB>TPT=H{?yCnyBNBSC B%BCnyB%BCsg+>)?yCnyBNBCnyBŴBC 1BNBG3'>"?C B/BCBSJBMCB%B.@|>Ö?SC B%BC B/BMCB%B2>g!?MCB%BCBSJBCB%B _<>֮C0BcBCۡBƵB{ЮCۡBcB\٦Ic"?!_C0BliB!_CDBxBCDBcBMx=?֮C0BcB!_C0BliBCDBcBOm5>T? CnyBcBCDBJBCDBcBE= ?CnyBŴBCDBJB CnyBcB3$U>8.?!_CDBxB!_CnyB|B CnyBcBu@L(>0"?CDBcB!_CDBxB CnyBcB VE,>B?C 1BNBϦC BNBC B/BD1z$>+?ϦC BNB!_C/BcB!_C BGB@8B7!>-?C 1BNB!_C/BcBϦC BNB7E>$?C 1BNB CnyBcB!_C/BcBCme+>'?C 1BNBCnyBŴB CnyBcB1(>s+? CnyBcB!_CnyB|B!_C/BcB_;9>2?CBNBC B/BϦC BNB3>q"?CBSJBC B/BCBNB*I>*?!_C BGB!_CB`BCBNBB.^>(?ϦC BNB!_C BGBCBNB'7>'?mCJB%B!_CDBNB!_CJBԳB->(?CB%B!_CDBNBmCJB%Bu)z!>$?CB%BCBNB!_CDBNB92>W!?CB%BCBSJBCBNBN'>N'?CBNB!_CB`B!_CDBNB >,?!_CJBԳB!_CKB#B:>CKB%B`"U>`"?mCJB%B!_CJBԳB:>CKB%B(h?c#?:>CKB%B!_CKB#B!_CzȸB%B 6V éCdB#wB éC~Bq{B+0CdBq{B?D éCSBHmB éCBnBCSBnBXnZ=CCSBqBCSBnB éCBnBXoZBCSBqB éCBnBCeB37uB þA CoCeB37uB éCBnB éC~B37uB9U64X+0CdBq{B éC~B37uB éCdB#wB6W+0CdBq{BCBq{B éC~B37uBϾ-Ol־CBq{BCeB37uB éC~B37uB 4=4CB fB éCB]=fB éCsBdhBJѿJ?'CBdhBCB fB éCsBdhB"DǘCSBnB éCsBdhB éCSBHmB8'DCSBnBC BnB éCsBdhBݽ]VC BnBCBdhB éCsBdhBXoZBᾋCSBnBCSBqBC BnBҷ<27CAB _B éCABj`B éC(BzaB|/x(3CdBJtB3CgB37uB@CdB37uB-tI éCdB#wB@CdB37uB3CgB37uB×EI éCdB#wB3CgB37uB éC~Bq{B}7 éC~Bq{B3CgB37uB3CBq{B-sbV4н4 éCSBHmB3CSBsmB3CBnB-}J éCBnB éCSBHmB3CBnBz}6A:(@CdB37uB3CBnB3CdBJtBz{6z:(@CdB37uB éC~B37uB3CBnBַfR(r éC~B37uB éCBnB3CBnBӘI @CdB37uB éCdB#wB éC~B37uB >=z-9 éCB]=fB3CBqgB3CBdhB4=33 éCsBdhB éCB]=fB3CBdhBD>FI3CBdhB éCSBHmB éCsBdhBȜi.Ou:3CSBsmB éCSBHmB3CBdhBN>L+1 éC(BzaB éCABj`BcCABzaBN>R+1cCABzaB éCB]=fB éC(BzaBM>"+ 1cCABzaB3CABbB éCB]=fB> I3CABbB3CBqgB éCB]=fBl>N3C-BzaBcCABzaB éCABj`B\>|(N3C-BzaB éCABj`B3CB^B:>E3CB^B éCABj`B éCB[BT>ZNcCABzaB3C-BzaB3CABbBL>4odW éCB=[B éC~%BXBkrC~%B=[BL> mWkrC~%B=[B éCB[B éCB=[B> eWkrC~%B=[B3C~%B\B éCB[B->d[3C~%B\B3CB^B éCB[BB0c5Z]CByzBZ]CQBq{BߧCBq{BN273CdBJtBZ]CdBCtBZ]CB37uBu|/<փ-3CgB37uB3CdBJtBZ]CB37uBB0n5ߧCBq{BZ]CB37uBZ]CByzB8405ߧCBq{B3CBq{BZ]CB37uBvC%3CBq{B3CgB37uBZ]CB37uBZ>(Ț=3CSBsmBZ]CSBٍnBZ]C/BnBJ="333CBnB3CSBsmBZ]C/BnB=:q8,Z]C/BnB3CdBJtB3CBnB#$WB*+?Z]CdBCtB3CdBJtBZ]C/BnB8R>c(m33CBdhB3CBqgB(ުCBdhBRQ>sb(3(ުCBdhB3CSBsmB3CBdhBmR>zb(]3(ުCBdhBZ]CB5iB3CSBsmB- >pMZ]CB5iBZ]CSBٍnB3CSBsmB> 7SZ]CBdhB(ުCBdhB3CBqgB> 8SZ]CBdhB3CBqgBZ]CABWfBWU> 7Z]CABWfB3CBqgB3CABbB>M7S(ުCBdhBZ]CBdhBZ]CB5iBa??t߾&23C-BzaB3CB^BOCBzaB>?r߾2OCBzaB3CABbB3C-BzaB>?s߾2OCBzaBZ]CBAcB3CABbBt>OبOZ]CBAcBZ]CABWfB3CABbB?]qAZ]CBzaBOCBzaB3CB^BJ?ZqbAZ]CBzaB3CB^BZ]C~%B^aBs#?``7Z]C~%B^aB3CB^B3C~%B\B ?\qmAOCBzaBZ]CBzaBZ]CBAcBy=@GZ]CByzB*CBzB*C1Bq{BJ%=1#7Z]CQBq{BZ]CByzB*C1Bq{BJ>d. ;4Z]CB37uBZ]CdBCtBɫCdB37uBYJ>ܘ.:4ɫCdB37uBZ]CByzBZ]CB37uBJ>ߘ.:4ɫCdB37uB*CdB.vBZ]CByzB3}=S%J*CdB.vB*CBzBZ]CByzB[>!5Z]C/BnBZ]CSBٍnBoCSBnB/E>MBoCSBnB*CSB[qB*C̲B37uB>5@Z]C/BnBoCSBnB*C̲B37uBx>HJ";Z]C/BnB*C̲B37uBɫCdB37uBwyR>]&5;Z]C/BnBɫCdB37uBZ]CdBCtBbb>:IɫCdB37uB*C̲B37uB*CdB.vB ,>L*CkBnBoCSBnBZ]CSBٍnB.>!L*CkBnBZ]CSBٍnB*CBsmB>[j=*CBsmBZ]CSBٍnBZ]CB5iB/>ԔLoCSBnB*CkBnB*CSB[qB ?iӾ<;Z]CBdhBZ]CABWfBֶCABdhB ?8kӾ;ֶCABdhBZ]CB5iBZ]CBdhB ?jӾ;ֶCABdhB*CABL kBZ]CB5iBj[>I"[U*CABL kB*CBsmBZ]CB5iB?"[I]OJYCBdhBֶCABdhBZ]CABWfB'?C}(3Z]CBAcBYCBdhBZ]CABWfB{i3?!n3*CABL kBYCBdhB*CBiB9?\INJֶCABdhBYCBdhB*CABL kB0?\0Z]CBzaBZ]C~%B^aB^eC~%BzaB`0?\0Z]CBAcBZ]CBzaB^eC~%BzaB*?)a(6Z]CBAcB^eC~%BzaBYCBdhBvOA?徽" &YCBdhB^eC~%BzaBC~%BdhB \?Iá*CBiBC~%BdhB*C~%B}iBR4?a!X4YCBdhBC~%BdhB*CBiB҇>;@*C1Bq{B*CBzB|dCBq{B)>NRCNBq{B|dCBq{B*CBzBR(> ORCNBq{B*CBzBCdByyBH>c*I;CdByyB*CBzB*CdB.vBe?eo1*C̲B37uB*CSB[qBҬCSB37uBgf?fO1ҬCSB37uB*CdB.vB*C̲B37uBf?f01ҬCSB37uBCSB.vB*CdB.vBtv>vپ0LCSB.vBCdByyB*CdB.vBT?Ҿ,,*CkBnB*CBsmBBZCBnB#?㝾s4BZCBnBCB#CsBCLB37uBT?xǾuD7*CkBnBBZCBnBCLB37uB͎?RƵ/e8*CkBnBCLB37uBҬCSB37uB?O49*CkBnBҬCSB37uB*CSB[qBE?FBҬCSB37uBCLB37uBCSB.vB'?1rN8CABnBBZCBnB*CBsmB-?0A0*CABL kBCABnB*CBsmB4?A.CB#CsBCABnBCAB |qB'?<0rO8BZCBnBCABnBCB#CsB2?2໽5CBnBCABnB*CABL kB89?U-*CBiBCBnB*CABL kBL?UCAB |qBCBnBCBL$qB7?\LJ1CABnBCBnBCAB |qB8?,>̔,{C~%BnBCBnB*CBiB \?QP*C~%B}iB{C~%BnB*CBiB-8?>ҡCBL$qBC~%B37uBCB37uBT>?>CBL$qBCBnBC~%B37uBa?zS>پCBnB{C~%BnBC~%B37uB#[?>KxCB37uBC~%B37uBC~%B uB ?u۾8CNBq{BCdByyBSCdBq{B? 茾DoCSBq{BSCdBq{BCdByyBA#?$.CSB.vBoCSBq{BCdByyB,?P,CLB37uBCB#CsB,6CB37uB.9?PPK(,6CB37uBĭCBa"zBĭC+ Bq{B+?/CLB37uB,6CB37uBĭC+ Bq{Bҹ/?QRƋ2CLB37uBĭC+ Bq{BoCSBq{B &?"1CLB37uBoCSBq{BCSB.vBgA2?A2gA2viCAB37uB,6CB37uBCB#CsB6?h@Az-CAB |qBviCAB37uBCB#CsBc"T?p$nĭCBa"zBviCAB37uBĭCABvyB}:?: ),6CB37uBviCAB37uBĭCBa"zB9?Cg=W0oYCB37uBviCAB37uBCAB |qBWL?SCBL$qBoYCB37uBCAB |qBŢQ?kA>{ ĭCABvyB=íCBq{BĭCBq{BJP?sC>d$ ĭCABvyBviCAB37uB=íCBq{B9b?ۍ=8viCAB37uBoYCB37uB=íCBq{BP'>?P'>oYCB37uBCBL$qBCB37uB^?M>lCB37uBC~%B uBY)C~%Bq{B^?>KlCB37uBY)C~%Bq{BoYCB37uBpO=?I?DþoYCB37uBY)C~%Bq{B=íCBq{BR9? P*I(ĭC+ Bq{BĭCBa"zBCBq{B=?=+LCABq{BCBq{BĭCBa"zB"T?#n;ĭCABvyBLCABq{BĭCBa"zBP?C>y# LCABq{BĭCABvyBĭCBq{B/3" W1 éC'BʅB éCJTBnB~C'BnB4: éCJTBnB éCB2BCBB : éCJTBnBCBB~C'BnBXV?~C'BnBCBB8AC'BBow]%)CBBėCBS׍B8AC'BBxoT3=ėCBS׍BJC'BS׍B8AC'BBJouTo=ėCBS׍BCB BJC'BS׍Bt8e F>CB BtC'B BJC'BS׍Buvg> éCB֒B éC݁B@BqC'B@Byu}> éCB֒BqC'B@BCB B!j}[>CB BqC'B@BtC'B Bedb> éC݁B@B éC'BMBqC'B@Bm)0 éCBZB éC|BB$CBB((򩸾 éC|BB éCBv9B7CBv9Bb+; $CBB éC|BB7CBv9BM2$4$E׾ éCBv9B éC'BʅB~C'BnB3$3$K׾ éCBv9B~C'BnB7CBv9B*Sm7CBv9B~C'BnBCBnBwoz[3CBB8AC'BBCBBwoG3CBBCBnB8AC'BBORyCBnB~C'BnB8AC'BB$j䂯[>CBB^$CBS׍BCB B jJ[>CBB8AC'BB^$CBS׍BY{<<=8AC'BBJC'BS׍B^$CBS׍BҾv9zH>JC'BS׍BtC'B B^$CBS׍BmtU!>tC'B BFaCB B^$CBS׍B_fL$f<+> éCvOB@B éCBW3BFaCB Bw_f3f<+> éCvOB@BFaCB BqC'B@B%nT>qC'B@BFaCB BtC'B B\fU0fqC'B@B éC'BMB éCvOB@BS_J7$CBBC\$BBCdB!~B 6F8sپ éCBZB$CBBCdB!~B 8-о éCBZBCdB!~B+0CdBq{BA(: éCBZB+0CdBq{B éC~Bq{BH+;%7CBv9BC\$BB$CBB?!DLCO!Bv9BC\$BB7CBv9B,J?Pf!2WCBnBCO!Bv9B7CBv9Bh˾C 3BnBCO!Bv9BCBnBPj ;/CBnBCBBC 3BnB7yUyi>)!CdBS׍BCB B^$CBS׍BFkCK>CdB5BCB B)!CdBS׍BbuuH>^$CBS׍BFaCB B)!CdBS׍B!j/U=>FaCB BwCdB B)!CdBS׍B ^">> éCBW3B éCdB2BwCdB BIe\=>FaCB B éCBW3BwCdB B C þ+0CdBq{BCdB!~BCBq{B}m+=>e4CSBS׍BCdB5B)!CdBS׍Bd<>CSBBBCdB5Be4CSBS׍BZjFA=bG>)!CdBS׍BwCdB Be4CSBS׍B\LA>WC>wCdB BCSB Be4CSBS׍BN%y>\u ? éCdB2B éCSBBBCSB BҔ\A>UB>wCdB B éCdB2BCSB B?^Ay> >nCBS׍BCSBBBe4CSBS׍B|Syb> ?CBBCSBBBnCBS׍BD? éCFB B éCB$BnCBS׍Bz<@>B? éCFB BnCBS׍BCSB BZRu>1>CSB BnCBS׍Be4CSBS׍BCDD>?CSB B éCSBBB éCFB BaFB!> ?CBBGCABBCABۈB4F>?GCABB éC9BS׍B éCAB-B8?F>?CBB éC9BS׍BGCABB;=@>,?CBBnCBS׍B éC9BS׍BGGȺ>?CBBCBBnCBS׍B6>b ?nCBS׍B éCB$B éC9BS׍B5>Y|?CBnB^$CBnBCBBL! >?^$CBnB éC4BB éCBB\U0>?CBnB éC4BB^$CBnB ='_?)?CBnBGCABB éC4BB=>7?CBnBCABۈBGCABB.*x?v$?GCABB éCAB-B éC4BB=K?>P2?CBv9BC~%Bv9BC~%B2BP?Lm?C~%Bv9B éCBnB éC~%BņBN><+?CBv9B éCBnBC~%Bv9BC ?%?CBv9B^$CBnB éCBnBz2+>?CBv9BCBB^$CBnB ?@?^$CBnB éCBB éCBnB= '13C'B,B3CBv9B# C'Bv9B13 .fCBnB éCJTBnB éC'BʅB8. 3CBBfCBnB éC'BʅB%Ơ=3CBB éC'BʅB# C'Bv9B'˅3CBB# C'Bv9B3CBv9B:J)fCBnB éCB2B éCJTBnBu {>۩CB@B éC݁B@B éCB֒B[d> éC݁B@B$C'B/uB éC'BMBdG> éC݁B@B۩CB@B$C'B/uBp)>۩CB@B$CB/uB$C'B/uB}۾4 éCBZB3CB{B3CoBB[= éC|BB éCBZB3CoBB! 2# C'Bv9B3CoBB3C'B,B 2# C'Bv9B éCBv9B3CoBBJ~C'־ éCBv9B éC|BB3CoBBrs(ݾ# C'Bv9B éC'BʅB éCBv9B\fU0f éCvOB@BĩCB@B éCBW3B\fU0f éC'BMBĩCB@B éCvOB@B_f+f<+> éC'BMB$C'B/uBĩCB@B Y)=C?$C'B/uBACB/uBĩCB@B[Gb3CBq{B éCBZB éC~Bq{B*۾#43CB{B éCBZB3CBq{BZc>q>CdB@B éCBW3BĩCB@B`^>> éCdB2B éCBW3BCdB@BJX>N?ĩCB@BACB/uBCdB@BJ"c>?ACB/uB\{CdB/uBCdB@B WOד> 5>n.CSB@B éCdB2BCdB@BNy>w ? éCSBBB éCdB2Bn.CSB@BO4T>?3CB/uB3CSB}Bn.CSB@BbN4 W>?3CB/uBn.CSB@B\{CdB/uB9H⧉>t?\{CdB/uBn.CSB@BCdB@BY? éCFB B+ CB B éCB$Bq( >?+ CB B3C!sB@B3CBmaB:8:>? éCFB B3C!sB@B+ CB Bb26? p? éCFB Bn.CSB@B3C!sB@BADG>!? éCFB B éCSBBBn.CSB@Bt)>G?n.CSB@B3CSB}B3C!sB@BO3E>#? éC9BS׍BCABS׍B éCAB-Bg!!K?m?CABS׍B3C0B B3CABBa,f>KR? éC9BS׍B3C0B BCABS׍B&%f?&? éC9BS׍B+ CB B3C0B B6>% ? éC9BS׍B éCB$B+ CB B%??+ CB B3CBmaB3C0B B\ ?+(? éC4BB1CBB éCBB%+??1CBB3CCBS׍B3CBBͼ?? éC4BB3CCBS׍B1CBB,EO?h? éC4BBCABS׍B3CCBS׍B'\)d? ? éC4BB éCAB-BCABS׍Bz? ?CABS׍B3CABB3CCBS׍BOưB+?(? éCBnB.C~%BnB éC~%BņB@?)o ?.C~%BnB3CBB3C~%BɈB ž>? ? éCBnB3CBB.C~%BnB ?? éCBnB1CBB3CBBS?l? éCBnB éCBB1CBB$+?>?1CBB3CBB3CBB|)zj/Z]C'BWBZ]CwBBpC'BBBܾ>0 CBv9B3CBv9B3C'B,B<ž/IZ]CBrB CBv9B3C'B,Ḇ*_)Z]CBrB3C'B,BpC'BB})ti/Z]CBrBpC'BBZ]CwBB jԾ)O CBv9B3CBB3CBv9Bgl=pC'BB3CoBB3CB{B1D,=?Z]C'BWBpC'BB3CB{Bgh4y30Z]C'BWB3CB{BߧCBq{BB0e5Z]C'BWBߧCBq{BZ]CQBq{B\9pC'BB3C'B,B3CoBB EߧCBq{B3CB{B3CBq{BR4P>?3CB/uBCSB/uB3CSB}B#>?3C!sB@BTĪCB@B3CBmaBh?;?TĪCB@BZ]CuB/uBZ]CBΚBw!p>?3C!sB@BZ]CuB/uBTĪCB@B~Q|??3C!sB@BCSB/uBZ]CuB/uBw)Ғ>tE?3C!sB@B3CSB}BCSB/uB6뾀?Q~-?3C0B B˻CAB B3CABBN94?7c ?˻CAB BZ]C B@BZ]CABBhoe"?D?3C0B BZ]C B@B˻CAB BX d?A?3C0B BTĪCB@BZ]C B@Bv E??3C0B B3CBmaBTĪCB@B:??TĪCB@BZ]CBΚBZ]C B@B|l >??3CCBS׍BCBS׍B3CBB ꥾4D?{X ?CBS׍BZ]C'PB BZ]CB$ȎBD?X ?3CCBS׍BZ]C'PB BCBS׍Bվi+??3CCBS׍B˻CAB BZ]C'PB Bվ4 +?V?3CCBS׍B3CABB˻CAB B|84?b ?˻CAB BZ]CABBZ]C'PB B$/ M]?>3C~%BɈBZ]CTBBZ]C~%BBoJ?>?3CBBZ]CTBB3C~%BɈB"l!>??3CBBCBS׍BZ]CBS׍BTl& >?ȁ?3CBBZ]CBS׍B3CBBuRN?& ?3CBBZ]CBS׍BZ]CTBB쥾˦D?Z ?CBS׍BZ]CB$ȎBZ]CBS׍B_䖽 ,0IZ]C'BWB*C'B B*CuBB 0Ր6Z]CwBBZ]C'BWB*CuBBm0ُ6*CuBBZ]CBrBZ]CwBBv]D*CB닂BZ]CBrB*CuBBJ%=1$7*C1Bq{BZ]C'BWBZ]CQBq{B  G*C'B BZ]C'BWB*C1Bq{B˾1?/?Z]CuB/uBbCB/uBZ]CBΚB!.WhW?M?Z]CABB*CB@B*CAB!BQ.tE?jC?Z]C B@B*CB@BZ]CABB;ɿy*?Q)%?Z]CBΚBbCB/uB*CB/uBUɿ{*?='%?Z]CBΚB*CB/uBZ]C B@By\BO?k ?Z]C B@B*CB/uB*CB@B sW?A ?Z]CB$ȎB*CB B*CBBtuFGO??Z]C'PB B*CB BZ]CB$ȎB㖽/I?,?*CB BZ]C'PB BZ]CABBO.RmW??F?*CAB!B*CB BZ]CABB1=g?(>Z]C~%BB*CBB*C~%BڞB<`?ݎ>Z]CTBB*CBBZ]C~%BB<Y??*CBBZ]CTBB*C˪BS׍BHqTyT??Z]CTBBZ]CBS׍B*C˪BS׍BOOjO??h?*C˪BS׍BZ]CBS׍BZ]CB$ȎBBqW? ?*CBB*C˪BS׍BZ]CB$ȎB(!>yW*C'B BC'BBCTBBl=-rBH*CuBB*C'B BCTBBno=s"AHCTBB*CB닂B*CuBBZٖ̽@|dCBq{B*C'B B*C1Bq{Bq>ޖv@|dCBq{BCBG}B*C'B B >@dVCBG}BC'BB*C'B BG(>blOR|dCBq{BCNBq{BCBG}Bg?:s>*CAB!BC׵B@BCAB2B؉Z^Z?];?*CB@BC׵B@B*CAB!Bdd?=>C׵B@B*CB@BCB/uBDyQ? ?*CB@B*CB/uBCB/uBuO>`k]?>CB@ˍBCBS׍BCvBS׍B6F>S?t?*CBBCvBS׍BCBS׍B^>F>|S?z?*CBB*CB BCvBS׍Bk=k`?>*CB BC6B BCvBS׍B_=_Y?v?C6B B*CB B*CAB!Bg?L>CAB2BC6B B*CAB!Bc>ei?ai>C~%BB٬C~%BnBCBnB䘤>K[?G>*C~%BڞBCBnB٬C~%BnB>}[?>*C~%BڞB*CBBCBnBE*>a?>*CBBCkBBCBnBO>a]?8>CBS׍BCB@ˍBCkBBfO>|b]?<9>CBS׍BCkBB*C˪BS׍B?>c$Q??*C˪BS׍BCkBB*CBBBF>%zS?|?CBS׍B*C˪BS׍B*CBB0&>CRCTBBC'BB@C'BB)>GFR@C'BBCBBCTBBk$>ER@C'BBĭC'BBCBBc&8>}۾bĭC'BBĭCBn?BCBB>ajbĭC=_BB@C'BBC'BB>_ bĭC=_BBC'BBĭCBdBg>0-DĭCBdBC'BBCBG}B>`b@C'BBĭC=_BBĭC'BBs ?I۾8SCdBq{BCBG}BCNBq{B ?߬۾8SCdBq{BĭCdBH~BCBG}Bre>qyTĭCdBH~BĭCBdBCBG}B0?n./ĭCdBH~BoCSBq{BĭCSB|B[?猾/DSCdBq{BoCSBq{BĭCdBH~B1?(|T 1oCSBq{BĭC+ Bq{BĭCSB|B˯=kp?>CAB2BĭC\B@BĭCAB(B=tf?f>C׵B@BĭC\B@BCAB2BL=9m?T>ĭC\B@BC׵B@BĭCB/uBC׵B@BCB/uBĭCB/uBG f?oT>žĭCBq{B=íCBq{BĭCB˽{B5>1Y?>ĭCB+BCBBĭCvBBȁ>;L?ȁ>CB@ˍBĭCvBBCBB_>L?^>CB@ˍBCvBS׍BĭCvBB>`? >CvBS׍BĭCBS׍BĭCvBB߯>ra?ը>ĭCBS׍BCvBS׍BĭC-vB BO>b]?8>CvBS׍BC6B BĭC-vB BT>b?>ĭC-vB BC6B BCAB2B=jp?>ĭCAB(BĭC-vB BCAB2B?9?^ĭCB˽{B&:C~%BBĭC|QBB[%?5?MiĭCB˽{B=íCBq{B&:C~%BBYL?oI?ᅽ=íCBq{BY)C~%Bq{B&:C~%BBM?O?xĭC|QBBi/C~%Bv9BĭCwBv9Bc$?C?- =&:C~%BBi/C~%Bv9BĭC|QBBl?K?.K>C~%BBĭCwBv9Bi/C~%Bv9Bl?K?IK>C~%BBCBnBĭCwBv9Bū?7VU?>CBnBĭCBnBĭCwBv9B>Y?+>CBBĭCB+BĭCBnB>)Y?4>CBBĭCBnBCkBB ?K?b>CkBBĭCBnBCBnBWw>ɫL?Ww>CBBCkBBCB@ˍB+>ȸLZC4ټBv9B+JCBv9BĭCBn?B>ZC4ټBv9BĭCBn?BC'BB?>"ǾxMC'BBĭCBn?BĭC'BBU>븪:Z+JCBv9BC4ټBv9BCBB?SDĭC=_BBĭCBdBbCBBF?T=DbCBBĭC'BBĭC=_BB?TDbCBBCB5BĭC'BB>1LZCB5BC'BBĭC'BBI? C/J>CdBBbCBBĭCBdBI-?LO/ĭCdBH~B>CdBBĭCBdBD7?Qҫs1CB5B>CdBBCdB[B?CbJbCBB>CdBBCB5Bg0??*53vCSBB>CdBBĭCdBH~Bz5?QgƐ*ĭCSB|BvCSBBĭCdBH~B0V?G@2 CdB[BvCSBBCSBBY4?UZD.>CdBBvCSBBCdB[BD6?Mz+ĭCSB|BĭC+ Bq{BCBq{B~6?M+ĭCSB|BCBq{BvCSBByT?PT;vCSBBCBq{ByCBBld?\"FICB-ŁBI`CABBCAB-Bc?=yCBBI`CABBCB-ŁBC>q?%>CABqBYCAB BCuB B>z+h?>ĭCAB(BCuB BYCAB B:>^*h?>ĭCAB(BĭC\B@BCuB BF>t?&:e>ĭC\B@BCfB@BCuB B:+A>ÿm? t>CfB@BĭC\B@BCOB/uBz>k?[Y>ĭC\B@BĭCB/uBCOB/uBJe?]W>+ȾĭCBq{BĭCB˽{BCBBUOe?V>ȾĭCBq{BCBBLCABq{B%Y?h>GLCABq{BCBBI`CABBrRN? -?GCAB-B&CBv9BC]RBv9BUQN?O-?LCAB-BI`CABB&CBv9Br?w>zB6I`CABBCBB&CBv9BS2?[5?νC]RBv9BXCBnBCJBnBĔU?? n >&CBv9BXCBnBC]RBv9B #/?1?a>ĭCB+BCJBnBXCBnB8.?^2?l^>ĭCB+BĭCvBBCJBnBr?R?Rۋ<ĭCvBBCIBBCJBnB?O?5>CIBBĭCvBBCBS׍Bݩ>V?o>ĭCvBBĭCBS׍BCBS׍B_>q?%>YCAB BCABqBCBS׍B>q?:%>YCAB BCBS׍BĭC-vB B>W?>ĭC-vB BCBS׍BĭCBS׍B>+h?H>YCAB BĭC-vB BĭCAB(B ,?,?*RCBBĭCB˽{BĭC|QBB4?B4?²&CBv9BCBBĭC|QBB4?4? ĭCwBv9B&CBv9BĭC|QBB3?3?" =XCBnB&CBv9BĭCwBv9BS0?|6?=ĭCBnBXCBnBĭCwBv9B-?h3?D`>XCBnBĭCBnBĭCB+Bg!?h8C4ټBv9BC'BBǮC'Bv9B-!?tg8ǮC'Bv9BCBBC4ټBv9B!?g8ǮC'Bv9B!_C'BMBCBBo ?U )P!_C'BMB!_CBEBCBB'?dt>CBv9BǮC'Bv9BC'BB2?k'$2CB5BCBv9BC'BB͆:?oMT.!_C'BMBCBv9B!_CBTB'?O>ǮC'Bv9BCBv9B!_C'BMB4?y64CdBv9BCBv9BCB5B!8?m0CdB[BCdBv9BCB5B]BK?T;7!_CBTBCdBv9B!_CdBBS:?C.CBv9BCdBv9B!_CBTBc49?D =0'CSBv9BCdBv9BCdB[B+.V?~F.6 CSBB'CSBv9BCdB[BY?I=JN!_CdBB'CSBv9B!_CSBBІBK?AY=CdBv9B'CSBv9B!_CdBB`V?C`=V CBv9B'CSBv9BCSBBd?t FE!_CSBBІB3CBnB!_CxBnBR?t&>F!_CSBBІB'CSBv9B3CBnBܙk?%=l'CSBv9BCBv9B3CBnB-i?>Ͼ!_CxBnB3CBnB!_CBB N>e?js>!_CBkBV5CB/uB!_CAB/uB^?l>޾CABv9BCBv9BCB-ŁB+Ln?>ECAB-BCABv9BCB-ŁBNf?lt>CBv9BCABv9B3CBnBc?>m:93CBnBCABv9BӮCABnB|B??s!_CBB{ЮCABB!_C7BB${B??gs!_CBB3CBnB{ЮCABB~g?H>g<3CBnBӮCABnB{ЮCABBt$??B?경!_C7BBަCABS׍B!_C`NBS׍BE??n >{ЮCABBަCABS׍B!_C7BB"#?$A?&]>CABqB!_C`NBS׍BަCABS׍BA#?A?a_>CABqBCuB B!_C`NBS׍B9g?ՠ[?ECuB B!_C}B B!_C`NBS׍B? Z?k=!_C}B BCuB B!_CB@B+>+`?>R>CuB BCfB@B!_CB@BeP>Fe?ms>V5CB/uB!_CBkB!_CB@BEO>e?ms>V5CB/uB!_CB@BCOB/uB>Z?w>COB/uB!_CB@BCfB@BQN?.?ICABv9BCAB-BC]RBv9BHxT??k,ӮCABnBCABv9BC]RBv9B5?a2?2˽CJBnBӮCABnBC]RBv9Bm6?|3?Y6<{ЮCABBӮCABnBCJBnB4?4?pަCABS׍B{ЮCABBCIBB"?@?(>CBS׍BަCABS׍BCIBBw#?A?k]>ަCABS׍BCBS׍BCABqBVN=j ?3CBB3C'BB$C'B/uBv`>$CB/uB3CBB$C'B/uB>K90>B?3C'BB3CB BACB/uBV=" ?$C'B/uB3C'BBACB/uB;I">g!?3CB B3CdB'֗B\{CdB/uB^;Ibb>p?ACB/uB3CB B\{CdB/uB̓5># ?\{CdB/uB3CdB'֗B3CB/uBL_=x>=C'BΩB3CBBCBΩBVL=q ?3C'BB3CBB=C'BΩBYq=?CBΩBCBmޝB=C'BΩBN2=>#?CBmޝB}8C'BmޝB=C'BΩBb@6d:>U"?Z]CBxBZ]C'B-B}8C'BmޝBL>;?CBmޝBZ]CBxB}8C'BmޝBr|SCF>x?RتCBΩB3C'BB=C'BΩB?K00>B?3CB B3C'BBRتCBΩB:>8>5!?Z]C! BmޝBZ]CB BRتCBΩB&>8강>5!?Z]C! BmޝBRتCBΩB}8C'BmޝBiM@>?}8C'BmޝBRتCBΩB=C'BΩB:ZЗ>?}8C'BmޝBZ]C'B-BZ]C! BmޝBDT>?+CdBΩB3CB BRتCBΩB;>v_!?3CdB'֗B3CB B+CdBΩBD*T>*?Z]CB BZ]CdBpB+CdBΩB=8ʳ>{5!?RتCBΩBZ]CB B+CdBΩB$D>$?CSB/uBZ]CTBΩBZ]CSBbBc1a>a!?3CB/uBZ]CTBΩBCSB/uB,/>K?3CB/uB+CdBΩBZ]CTBΩBË5x>9?3CB/uB3CdB'֗B+CdBΩB$8B>h$?+CdBΩBZ]CdBpBZ]CTBΩBu?Ų?CSB/uBZ]CSBbBZ]CuB/uBHLn>_?C'B BZ]CBxBCB Bc@b:>fT"?Z]C'B-BZ]CBxBC'B B^/'!>,?*CBzB*C'B+BC'B B>b> ?CB B*CBzBC'B Bo<86>{7!?Z]C! BmޝBՋCBmޝBZ]CB B)>}T'?ՋCBmޝB*C@B B*CB1cBȪ3>'?Z]C! BmޝB*C@B BՋCBmޝB/N>kK?Z]C! BmޝBC'B B*C@B B:\ϗ>?Z]C! BmޝBZ]C'B-BC'B B)>U'?C'B B*C'B+B*C@B B1Uf>,?xCdBmޝBZ]CB BՋCBmޝB>&9>"K.?Z]CdBpBZ]CB BxCdBmޝByj"4>ef*?*CB1cB*CdB~BxCdBmޝB)B>r&?ՋCBmޝB*CB1cBxCdBmޝB />4?Z]CTBΩBūCSBΩBZ]CSBbB ?)?ūCSBΩB*CBmޝB*CSBB x>&?Z]CTBΩB*CBmޝBūCSBΩBk>%?Z]CTBΩBxCdBmޝB*CBmޝB; d>}(?Z]CTBΩBZ]CdBpBxCdBmޝB)???xCdBmޝB*CdB~B*CBmޝBþV-?WX ?bCB/uB*C(BΩB*CBgBaپ2&?3!?Z]CuB/uB*C(BΩBbCB/uBRu?{'?Z]CuB/uBūCSBΩB*C(BΩB5?e '?Z]CuB/uBZ]CSBbBūCSBΩB7#s?#s?ūCSBΩB*CSBB*C(BΩBþ-?X ?bCB/uB*CBgB*CB/uB9_>Տ?C'BGB*CBzBUCBGB_/>,?*C'B+B*CBzBC'BGB +> +?CB\BC'B*hBC'BGB1>&?UCBGBCB\BC'BGBہ b>yU.?*C@B BBZCB B*CB1cBNw>*?BZCB BClBGBCBMB-#>*?*C@B BClBGBBZCB BS >)?*C@B BC'BGBClBGBY)>>T'?*C@B B*C'B+BC'BGBu3$>u3$?C'BGBC'B*hBClBGB5? ?C B B*CB1cBBZCB B#S?KP"?C B BCdBᲠB*CB1cB`j>W=?CdBᲠB*CdB~B*CB1cBF ?}"?BZCB BCBMBC B Ba[-?5$?*CSBBC'#BmޝBCSB BwϾ?5?*CBmޝBC'#BmޝB*CSBBJϾ?5?C'#BmޝB*CBmޝB*CdB~Be?&?CdBᲠBC'#BmޝB*CdB~B٬eaP?u?*CBgBCBΩBCBܙBԡҒ2? $?*C(BΩBCBΩB*CBgB9 c,? c,?CBΩB*C(BΩB*CSBBsAP3??CSB BCBΩB*CSBB \u:?s+?CB/uB*CB/uB*CBgBeDP??CBܙBCB/uB*CBgB6(*>?TC'BI|BCB\BCBI|B꙳>97?C'B*hBCB\BTC'BI|BJ>$.?ĭCB7BĭC'BBTC'BI|B%>C%?CBI|BĭCB7BTC'BI|B>:?ClBGBTCBGBCBMBO뾘?/?TCBGBĭCvBI|BĭCBtBrQ?-?ClBGBĭCvBI|BTCBGB57?^-?ClBGBTC'BI|BĭCvBI|B͌>2.?ClBGBC'B*hBTC'BI|B~ ?R%?TC'BI|BĭC'BBĭCvBI|B)þx>?;7?C B B$CdB BCdBᲠB Ʒ$?,?$CdB BĭC%BGBĭCdBfB( ̾ ?p/?C B BĭC%BGB$CdB BԾr?[1?C B BTCBGBĭC%BGB#?,0?C B BCBMBTCBGB߾?ݥ&?TCBGBĭCBtBĭC%BGBJAd3?\a*?C'#BmޝBMCSBmޝBCSB B>̓:?5#?MCSBmޝBĭC.rB BĭCSBBn8?ߛ$?C'#BmޝBĭC.rB BMCSBmޝBs!%?.?C'#BmޝB$CdB BĭC.rB BBQA#?8$.?C'#BmޝBCdBᲠB$CdB B u)?u)?$CdB BĭCdBfBĭC.rB Bb?>CBܙBĭCftBΩBĭCB}B"nT?~ ?CBΩBĭCftBΩBCBܙB~,9?$?CSB BMCSBmޝBĭC9@BmޝBo~*9?f$?CSB BĭC9@BmޝBCBΩBFwQ?-?CBΩBĭC9@BmޝBĭCftBΩBĭCB}BĭCB/uBCBܙB) ?r (?CB谪BĭCB7BCB谪Br) ? (?CB谪BC'BsBĭCB7BR>m=?C'BsBĭC'BBĭCB7B5) ?2 (?CB谪BCBŬBCB谪B(0?3\(?ĭCBtBCaBI|BCBBS?W>8?ĭCvBI|BCaBI|BĭCBtBTV?k=8?CaBI|BĭCvBI|BĭC'BBQо $?&?C'BsBCaBI|BĭC'BBH>\A?A$ ?ĭCdBfBCxdBGBCdB-gBt*?*3?ĭC%BGBCxdBGBĭCdBfB>tٛ*?(3?CxdBGBĭC%BGBĭCBtB~:2?x'?CBBCxdBGBĭCBtB(r Q??ĭCSBBC B BCSB BB(6>?k&?ĭC.rB BC B BĭCSBB6r3?r3?C B BĭC.rB BĭCdBfBOH^A?H! ?CdB-gBC B BĭCdBfBx=\Gh?9>ĭCB}BCw'BΩBCBՙB=b?p>ĭCftBΩBCw'BΩBĭCB}B =\?j>Cw'BΩBĭCftBΩBC MBmޝBRR??ĭCftBΩBĭC9@BmޝBC MBmޝBq@@?(?C MBmޝBĭC9@BmޝBĭCSBB&rB Q??CSB BBC MBmޝBĭCSBB. >^a?j>COB/uBĭCB/uBĭCB}Bxu=LHh?>>CBՙBCOB/uBĭCB}Bo)?(:?CB谪BTC'B谪BC'BsBU*?-?TC'B谪B!_CtWBB!_C'BKBR#?M/?CB谪B!_CtWBBTC'B谪B}H?j02?CB谪BUCBB!_CtWBB'پs?}2?CB谪BCBŬBUCBB˾+$?V'?UCBB!_CBB!_CtWBBsO5?^,?CaBI|B CBI|BCBBM>WI??f!? CBI|B!_CB谪B!_CBHBAZ>?!?CaBI|B!_CB谪B CBI|BM_+?z-?CaBI|BTC'B谪B!_CB谪BV*?-?CaBI|BC'BsBTC'B谪B_9 c,? c,?TC'B谪B!_C'BKB!_CB谪B}ԼvU?g ?CdB-gB!_CBGB!_CdB Bv%D?"?CxdBGB!_CBGBCdB-gB#M6?׆+?CBB CBI|B!_CIBI|BYM6?+?CBB!_CIBI|BCxdBGBM?:?CxdBGB!_CIBI|B!_CBGBL8W>M??4b!? CBI|B!_CBHB!_CIBI|Bv>i[?W>CSB BB!_CB B!_CSBcXB=P??C B B!_CB BCSB BB~=ϨD?l"?!_CB BC B BCdB-gB}ԼU?h ?!_CdB B!_CB BCdB-gB> Y?E?>CBՙB!_CAB/uBV5CB/uB>TY?C>CBՙBCw'BΩB!_CAB/uB>+h?>Cw'BΩB!_C'BΩB!_CAB/uB>o]?>!_C'BΩBCw'BΩB!_CBmޝB>>Y?V>Cw'BΩBC MBmޝB!_CBmޝB-_4>$N?y?!_CBmޝBC MBmޝBCSB BB }>4f[?ǻ>!_CSBcXB!_CBmޝBCSB BB>Y?r@>V5CB/uBCOB/uBCBՙB"8=z-0v éC~%BXBC~%BXB éCZBWB=Gr éCZBWBC~%BXBCZB2VB =^=gb} éCZBWBCZB2VB éCBWB:;>Uu éCBWBCZB2VBCBVBR?Q ?CSBq{B%CBq{BCBO{BLL>-#?rp(*BC[B=[B éCB=[B éCBWBJI>-#?q(*BC[B=[B éCBWBC[BeZBkk>i`?%QC[BeZB éCBWBCBVB>dxB?X éCB=[B*BC[B=[B éC[B,_B)>v?W> éC[B\nBC[BnB éCBnB(>Nb?W>C[B~pB éCBnBC[BnB?>lPb? Q>C[B~pBCB37uB éCBnBCB37uB éCB37uB éCBnB R?T ?CBO{B%CBq{B éCBq{B̹R?ĕ ?CBO{B éCBq{BCB37uBMCB37uB éCBq{B éCB37uBԚ>X>&?X>&*BC[B=[BC[BeZBCG}B=[B(>ME?ݾ éC[B,_B*BC[B=[BCG}B=[B>'>E?ݾ éC[B,_BCG}B=[B éCVBzaBC> g?,t éCVBzaBCG}B=[BC}BzaB>p? éCVBzaBC}BzaB éCtpBdhB3>^v?v=C}BzaBCnJBdhB éCtpBdhBnw)>\v?W>C[BnB éC[B\nB éCtpBdhB)>Lv?W>C[BnB éCtpBdhBCIBnB{>vl?$>CIBnB éCtpBdhBCnJBdhB>Pb?P>C[BnBCIBnBC[B~pB>%8b3CAB=[BkrC~%B=[B éC~%BXB>:%8b3CAB=[B éC~%BXB3CZBCZB>s+X3CZBCZB éC~%BXB éCZBWB>#8bkrC~%B=[B3CAB=[B3C~%B\B '?б>bl,!?CB=[B3C{-B=[B3CZBCZBO '?sб>l,!?CB=[B3CZBCZB éCBWBO>ZZ=^ éCBWB3CZBCZB éCZBWB}6?˨>@j3C{-B=[B!?CB=[B3CB^BEb4>džp?S>3CBIzBueCBq{B3CnBq{B(6? 7?!?CB=[B éCBWB éCB=[Bu?6?BԾ éCB=[B éC[B,_B1C[BzaB[%?\%?Oо!?CB=[B éCB=[B1C[BzaBB?X0?4!?CB=[B1C[BzaB3CBzaB?U?#U!?CB=[B3CBzaB3CB^B3>Z?L3CBzaBC[BdhB3CۢBdhB?އJ?O 1C[BzaBC[BdhB3CBzaB\>,[??> éC[B\nB3CۢBdhBC[BdhB>([??> éC[B\nB éCBnB3CۢBdhB>Sf?T= éCBnB3CGb?^b>3CG7d?> éCBnB éCB37uB3CoB37uB3c4>p?S>ueCBq{B3CBIzB3CoB37uB-d4>p?S>ueCBq{B3CoB37uB éCBq{B?>6[??]> éCBq{B3CoB37uB éCB37uB?9?eо1C[BzaB éC[B,_B éCVBzaB?J?I C[BdhB1C[BzaB éCVBzaB> _? ߼ éCtpBdhBC[BdhB éCVBzaB>)-[?z?>C[BdhB éCtpBdhB éC[B\nB /3?i-33CAB=[B3CZBCZBrCZB=[B<.3?p@.3rCZB=[B3C~%B\B3CAB=[B;? *rCZB=[BZ]CZB´aB3C~%B\BTC*?E}+?Z]CZB´aBZ]C~%B^aB3C~%B\B-*?a>*rCZB=[B3CZBCZB3C{-B=[B`9?|>3C{-B=[B3CB^B%CBzaB!9?z>GrCZB=[B3C{-B=[B%CBzaBg!,?B)>rCZB=[B%CBzaBZ]CgBzaB$,? >#rCZB=[BZ]CgBzaBZ]CZB´aBf#?K&?7ҾZ]CgBzaBCBdhBZ]CڕBdhBOS??j%CBzaBCBdhBZ]CgBzaB'? O?>߲Z]CڕBdhB%CBnBZ]CuBnBv3?q6?)ҼCBdhB%CBnBZ]CڕBdhBg?4W?/>Z]CuBnBCB37uBZ]C%CBnBCB37uBZ]CuBnBs'?Q?&>3CBIzBZ]C3CBIzB3CnBq{BZ]C j?vW=3CnBq{BZ]C{Bq{BZ]CCB37uB%CBnB3CG3CoB37uBCB37uB3CGCB37uB3CoB37uB3CBIzBN4? 5^eCZBzaB^eC~%BzaBZ]C~%B^aBͤ=?G1(+Z]CZB´aB^eCZBzaBZ]C~%B^aB'B?&^eC~%BzaB^eCZBzaBC~%BdhB@T?+G>C~%BdhB^eCZBzaBCZBdhBB=?+?N侂*C~%B}iBCZBnB*C~BnBi>?%u?⾂*C~%B}iBC~%BdhBCZBnB"v?jg>?C~%BdhBCZBdhBCZBnB?)L?<*C~BnBCZB37uB*CB37uB3#S?M?U]CZBnBCZB37uB*C~BnBK>=^?^*CB37uB!CZBq{B*CFBq{Ba?!N?(6CZB37uB!CZBq{B*CB37uBS,?'> ^eCZBzaBZ]CZB´aBZ]CgBzaB??9>rラCZBdhB^eCZBzaBZ]CgBzaBD)?6!??;Z]CڕBdhBCZBdhBZ]CgBzaB-8?^?UY=Z]C{Bq{B!CZBq{BZ]C?d?W{C~%BnB*C~%B}iB*C~BnB=E??wC~%B37uB{C~%BnB*C~BnB-?Q%9?m*CB37uBC~%B37uB*C~BnBg+?UZ7?yBC~%B uBC~%B37uB*CB37uB+?Y7?BC~%B uB*CB37uBC=Bq{BV?N?NC=Bq{B*CB37uB*CFBq{B1?21?G=Y)C~%Bq{BC~%B uBC=Bq{B!?? éC_Bv9BC~%B2BC~%Bv9B+x.? ? éC_Bv9B éCZBt0BC~%B2Bvƾ$O?1? éCZBt0BCZBeBC~%B2B1"?{?C~%Bv9B éC~%BņB éC_Bv9BeU?P?%CBq{B éCBB éCB}B+U??%CBq{BCSBq{B éCBBfg8?λ!?CSBq{BCHBB éCBBPT|.?U|.? éCBBCHBBCZBeB "B?U? éCZBt0B éCBBCZBeBU?W?%CBq{B éCB}B éCBq{Br3ҽ`?> éCZBt0B3C<-Bv9B3CZBB J?? éC_Bv9B3C<-Bv9B éCZBt0B=T>.?&? éC~%BņB.C~%BnB3CBnB=k@.?D&? éC~%BņB3CBnB éC_Bv9BCfT?8g? éC_Bv9B3CBnB3C<-Bv9B_@?Wq ?.C~%BnB3C~%BɈB3CBnB>T?g? éCB}B3CnBq{BueCBq{B׭>T?f? éCB}B éCBB3CnBq{BM éCBB3C1BB3CnBq{Bڻ<ڻL??3C1BB éCBB éCZBt0B=ҽ`?>3CZBB3C1BB éCZBt0B߯>_T?h?ueCBq{B éCBq{B éCB}BAF= o?J>3CZBBZ]CBv9BZ]CZB9Ba=a?\>3C<-Bv9BZ]CBv9B3CZBBRh=0h?>Z]CBv9B3C<-Bv9BZ]CBnBX_ֽd`V?U ?3C<-Bv9B3CBnBZ]CBnBνN?[?Z]CBnB3CBnB3C~%BɈB|'/K]? >Z]C~%BBZ]CBnB3C~%BɈBQ>Sd?Vo>Z]C{Bq{B3CnBq{BZ]C-BByE>Lb?>3CnBq{B3C1BBZ]C-BB:B>]?6>Z]C-BB3C1BB3CZBBE= o?}J>Z]CZB9BZ]C-BB3CZBB>n?A=*CFBq{BfCZBB*CBB>+]?|>!CZBq{BfCZBB*CFBq{B>F)b?>Z]CZB9B*CBBfCZBB>)b?Ο>Z]CZB9BZ]CBv9B*CBBPc>r?c>Z]CBv9B*C9Bv9B*CBBM^>lm?8ϛ>*C9Bv9BZ]CBv9B*CY,BnB=h?F>Z]CBv9BZ]CBnB*CY,BnB=Z_?ъ>*CY,BnBZ]CBnBZ]C~%BB1=sg?>*C~%BڞB*CY,BnBZ]C~%BB>.]?>fCZBB!CZBq{BZ]C{Bq{B^ح>Ag?"c>Z]C-BBfCZBBZ]C{Bq{B>*b?>fCZBBZ]C-BBZ]CZB9Bz?EN?FμC=Bq{B*CFBq{BCBB?Y?xo=*CFBq{B*CBBCBB ?Z?,U=CBB*CBBCBv9B >K d?ZU>*CBB*C9Bv9BCBv9B>di?di>٬C~%BnBC~%BBCBv9B >ci?ei>٬C~%BnBCBv9B*CY,BnBw>i_?l>*CY,BnBCBv9B*C9Bv9B>}}[?>٬C~%BnB*CY,BnB*C~%BڞBϸ4?4?_l&:C~%BBY)C~%Bq{BC=Bq{B %?șC?$üCBB&:C~%BBC=Bq{B$?C?- =i/C~%Bv9B&:C~%BBCBB?tO?=CBv9Bi/C~%Bv9BCBBm?K?K>i/C~%Bv9BCBv9BC~%BBt߾2W(pCAaLBpCAdBCAdB-f־P00pCAaLBƱCABƱCAdBGھ3DpCAdBpCAaLBƱCAdBoD̾ت0%CbLA;BCAdBHCbLAdB|:3(3(CABC(At/B:CAt/Bř;1PHCbLAdBƱCAdBƱCABQ'˾|1dCbLA;BHCbLAdBƱCAB7ʾ)|1_]CbLA;BƱCAB:CAt/BŗǾvj1>CbLA;B:CAt/BC(At/BM&q.0 CbLA;B`CbLAB`CaAdBǾk1;CAdBCbLA;B`CaAdBobo*@*CAB`CAtB`C3At/Bbz***C(At/BCAB`C3At/BJ9ٛ3V)`C3At/BCbLA;BC(At/BNp. `CbLABCbLA;B`C3At/Bw-h".CyAKB.C|^AdB嵳CyAdB 'u)u).CbLAOB.CcAt/B:CbLAt/B[. 嵳CyAdB`CaAdB`CbLAB7.ĥ!.CyAKB嵳CyAdB`CbLABw,G[.0i".CyAKB`CbLAB:CbLAt/B#.A#.CyAKB:CbLAt/B.CcAt/Bԡ$F2.CAB.CABCAB Iu)u):CbLAt/B`C3At/B`CAtBv @u)t).CbLAOB:CbLAt/B`CAtBӡ $ 2.CbLAOB`CAtBCABtԡ$Ԓ2.CbLAOBCAB.CAB$FQ/U!:CbLAt/B`CbLAB`C3At/B%WŮ)).CyAKB7CyAqB7C`[AdB}w-U".C|^AdB.CyAKB7C`[AdBf9U* -.CbLAOB7CbLAtB7C4At/B5AT+T+.CcAt/B.CbLAOB7C4At/B,0z*%7C4At/B.CyAKB.CcAt/B.(*7CyAqB.CyAKB7C4At/B,l=.CAB7CAB7C͘ABs$=2.CAB.CAB7C͘ABr'$ʞ27C͘AB.CbLAOB.CABLޭuu97CbLAtB.CbLAOB7C͘AB% t)u)^ȵClAB^ȵCAdB.ClAdBc +u)t)^ȵCyA|B^ȵC ^At/B.CyAt/B u)?u).ClAdB7C`[AdB7CyAqB u)u)^ȵClAB.ClAdB7CyAqBU t)iu)^ȵClAB7CyAqB.CyAt/B t)u)^ȵClAB.CyAt/B^ȵC ^At/B9–ua9^ȵCbLAD'B^ȵCsAB-FCbLABG'*.CyAt/B7C4At/B7CbLAtBIe'*^ȵCyA|B.CyAt/B7CbLAtBa6t9^ȵCyA|B7CbLAtB-FCbLAB%t׌9^ȵCyA|B-FCbLAB^ȵCsABH'*.CyAt/B7CyAqB7C4At/Bφf%VD^ȵCAB^ȵCdA6BaCA6B 瘾+<-FCbLAB7C͘AB7CAB䘾,<^ȵCbLAD'B-FCbLAB7CABІ!"D^ȵCbLAD'B7CABaCA6B̆^"D^ȵCbLAD'BaCA6B^ȵCdA6B䘾* .<-FCbLAB7CbLAtB7C͘ABJ# ;V_yH,CbLAcBH,CA6BGCbLA6BA+:RzH,CA6BH,CSKA,kBïCbLA,kBcJ'?GCbLA6BH,CA6BïCbLA,kB44x$=H,CSKA,kBH,CYA˟BׯCbLA˟B-{;:=ïCbLA,kBH,CSKA,kBׯCbLA˟B3#//7>H,CYA˟BH,CAjB#CbLAjB//>ׯCbLA˟BH,CYA˟B#CbLAjB ?$F5$[>H,CAjBH,CbLAB#CbLAjBB@:H,CAfBH,CAB CABdH;MƾH,CABH,CAPBwCAPB]!D CABH,CABwCAPB< vCN!_CAIBwCAPBH,CAPBئvC|!_CAIBH,CAPB!_CUABx?)!_CUABH,CAPBH,CAB!xaA˟B!_C[A,kBׯCbLA˟BkI+K+֔>!_C>A˟BqCAjB!_CA8BWD.( >!_C>A˟BׯCbLA˟BqCAjB=:(!>ׯCbLA˟B#CbLAjBqCAjB/N>H,CbLABH,CPA BCA Bus2o >H,CbLABCA B#CbLAjBS)X>#CbLAjBCA BqCAjBI >pCyA*BpC A6B۰CyA6B)$@!pC A6BpCMA,kBCyA,kB)!@CͿ۰CyA6BpC A6BCyA,kB/& cBR8=pCMA,kBpCJA˟BCyA˟Bq&,B5=CyA,kBpCMA,kBCyA˟B"=Qh>pCJA˟BpCyAmhBCyA˟BG:ݾpCbLA/(BpCAdAPBRCbLAPB`]`@pCyA*B۰CyA6BH,CbLAcBg]'@+܀pCyA*BH,CbLAcBW6CbLABޖ&@1pCyA*BW6CbLABpCAB)!@CϿCyA,kBH,CA6B۰CyA6B'%}@H,CSKA,kBH,CA6BCyA,kBo& .BA5=CyA˟BH,CSKA,kBCyA,kB/&hBL:1=H,CYA˟BH,CSKA,kBCyA˟Bt"=Nh>pCyAmhBH,CYA˟BCyA˟B\"pCyAmhBpCpAjBH,CYA˟B'5>pCpAjBH,CAjBH,CYA˟Bn(;>ACbLA BH,CbLABH,CAjBH"H"h>ACbLA BH,CAjBpCqA BÜ+>pCqA BH,CAjBpCpAjBz>qH,CAfBCAdBpCAdBt>TjH,CAfBpCAdBH,CAB,8H,CABpCAdBpC:AB7@:ݾRCbLAPBpC:ABpCbLA/(Bi:ݾRCbLAPBH,CAPBpC:ABmBξH,CAPBH,CABpC:ABMnDښW6CbLABH,CAPBRCbLAPB|"|?형H,CABH,CAPBW6CbLAB3A~W6CbLABH,CbLAcBH,CAB,J '>ACbLA BH,CPA BH,CbLAB.8Ik(ƱClA"OBƱC6A,kBClA,kBD"oF%qƱC6A,kBƱCMA˟B!ClA˟BALb;ClA,kBƱC6A,kB!ClA˟B3 A$c>ƱCMA˟BƱClAlB!ClA˟BTg8Fj쾘ƱCyAOBƱC,APB翱CyAPB"u#=dƱC,APBƱCAB;CyAB B;;翱CyAPBƱC,APB;CyABHCDȎpCyA*B;CyABƱCAB8C6ǎpCyA*BƱCABpC A6BiEvpC A6BƱCABƱCJbA6BHqJ;'ClA,kBƱCJbA6BƱClA"OBUqJ;'ClA,kBpCMA,kBƱCJbA6BpJ1'pCMA,kBpC A6BƱCJbA6B1Md`;!ClA˟BpCMA,kBClA,kB UGO<=pCJA˟BpCMA,kB!ClA˟BMƻD,q>pCJA˟B CyAjBpCyAmhBDLAn>!ClA˟B CyAjBpCJA˟B]LXAi>!ClA˟BƱCAjB CyAjB 3!7> #h>!ClA˟BƱClAlBƱCAjB/&yn/>ƱCAjBƱCA B臱CyA BF2 8Y> CyAjBƱCAjB臱CyA Bge4kJƱCbLABƱCcABQCbLAB- @;0Y޾翱CyAPBpCAdAPBpCbLA/(B:z龘ƱCyAOB翱CyAPBpCbLA/(BN:\辘ƱCyAOBpCbLA/(BQCbLAB$;aƱCyAOBQCbLABƱCcABg !BbA;CyABpCAdAPB翱CyAPBgh@|pCABpCAdAPB;CyABmDx;CyABpCyA*BpCABmCws> CyAjBpCpAjBpCyAmhB:>臱CyA BpCpAjB CyAjBZ e) E>pCqA BpCpAjB臱CyA Baj+c4KQCbLABƱCAdBƱCbLABfd4\KQCbLABpC:ABƱCAdBX|<›pC:ABpCAdBƱCAdB>Y⾴QCbLABpCbLA/(BpC:AB|ArоClA6BCABXClABl I&͒CABCmA6B:ClA6B K XClABCAB:ClA6BN*ƱClA"OB:ClA6BCmA6B]NmM-ƱClA"OBCmA6BƱC6A,kBQM3ƱC6A,kBCmA6BCA,kBRwP˶$ClAjBƱClAlBƱCMA˟B^E|o>$ClAjBƱCMA˟BCοAjB¥ n@Q s1>CοAjBƱCMA˟BCA˟Bj9Ŕ>CοAjBCA BsClA BDqOAW>$ClAjBCοAjBsClA B >;6ƱCyAOBCyABBC!APBg =2ƱC,APBƱCyAOBC!APB{TlBcξXClABC!APBClA6BCpAξXClABƱCABC!APB+GľƱCABƱC,APBC!APBҒ K :ClA6BƱCABXClAB pI쌾ƱCJbA6BƱCAB:ClA6BN*:ClA6BƱClA"OBƱCJbA6BEgq>$ClAjBƱCAjBƱClAlBqOAqW>sClA BƱCAjB$ClAjBh7e>ƱCA BƱCAjBsClA B־9i ƱCbLABHCbLAdBCAdB,־9h ƱCbLABCAdBƱCcABݾ5ƱCcABCAdBCABr龮?ָCABƱCyAOBƱCcAB)D;CyABBƱCyAOBCAB־(9_j HCbLAdBƱCbLABƱCAdB? zEO`CԹA2B`C)EA6BCԹA6BX OV#`C)EA6B`CA,kBղCԹA,kB+lM*CԹA6B`C)EA6BղCԹA,kBEdpN`CA,kB`CA˟BܲCԹA˟B%_Q<ղCԹA,kB`CA,kBܲCԹA˟B%ZEHNS>`CA˟B`CϵAjBeCԹAjBKL&>ܲCԹA˟B`CA˟BeCԹAjB+`B&^>`CϵAjB`CԹA^BeCԹAjBoH;`ClADtB`CAPBClAPBilENҾClA6BClAPB`CAPB[EɣԾClA6B`CAPBCAB!A@uIݾCAB`CAPB`CΏABT xECԹA6B`CΏAB`CԹA2BL yyE$CԹA6BCmA6B`CΏABKr͔CmA6BCAB`CΏABhkM*ղCԹA,kBCmA6BCԹA6BG _P6CA,kBCmA6BղCԹA,kBÎS<ܲCԹA˟BCA,kBղCԹA,kBObeCԹAjBCA˟BܲCԹA˟BE@ G(>CοAjBCA˟BeCԹAjB`B]>`CԹA^BCοAjBeCԹAjBd "@b&>`CԹA^B`C~gA BCοAjBB?m<=/>`C~gA BCA BCοAjBHپs}2~`CyADB`CIABaCyAB뾍.CuAjB.CuATB""CuAjBr`>i.CԹA{.B.CABlCԹABMcuIJ`CԹA2BlCԹAB.CABeM=vIF`CԹA2B.CAB`C)EA6B.ݳI&`C)EA6B.CAB.CɾA6Bm {8QX2CuA,kB.CɾA6B.CuA|Bq1P3CuA,kB`CA,kB.CɾA6B| \]R%`CA,kB`C)EA6B.CɾA6BfRS$1CuA˟B`CA,kBCuA,kBP`CA˟B`CA,kB1CuA˟BN=""CuAjB`CA˟B1CuA˟B%My>`CϵAjB`CA˟B""CuAjBYCp>`CϵAjBMlCԹA B`CԹA^BFٌ>""CuAjBMlCԹA B`CϵAjB.xԶB!`>""CuAjB.CA BMlCԹA BFmKb>""CuAjB.CuATB.CA B;1:.ClAB.CYABKClABb3ܾr>`ClADtBKClAB.CYAB2ܾls>`ClADtB.CYAB`CAPBJXg6Ƙ`CAPB.CYAB.CrAPBY>lCԹAB.CrAPB.CԹA{.B1`>lCԹAB`CΏAB.CrAPB) B߾`CΏAB`CAPB.CrAPBlMuIcJlCԹAB`CԹA2B`CΏAB?IJ>MlCԹA B`C~gA B`CԹA^B6DоR4(KClAB`CIAB`CyADB\˾$3#.ClABKClAB`CyADB8ɾo3 ^.ClAB`CyADB嵳CyAdB&ľ4W3.ClAB嵳CyAdB.C|^AdB4ܾ*r>]KClAB`ClADtB`CIABƾ5{|嵳CyAdB`CyADB`CaAdB+`<*$7CuAB7CRABCuAB.gI7CRAB7CAA6B?CuA6BJ]CuAB7CRAB?CuA6B WRf0.CuA|B?CuA6B7CAA6Bz; Qf5.CuA|B7CAA6B.CA,kB O\F.CA,kB7CAA6B7C)/A,kBo S0R7C)/A,kB7C3ѡA˟B.CA,kBSh~S.CA,kB7C3ѡA˟B.CEA˟B{R%=7C3ѡA˟B7C,AjB.CEA˟BzM=.CEA˟B7C,AjB.CuAjB<g9G>[>mCuA B.CuATB.CuAjB![tDL_>mCuA B.CuAjB7CA B L5>7CA B.CuAjB7C,AjBھM57CԹAB7CAPB[FCԹAPBmCuA B.CA B.CuATBƾ1a.ClAB7ClAB7C4#ABRȾ2fv.CYAB.ClAB7C4#ABؾ6~[FCԹAPB7C4#AB7CԹAB۾=5c[FCԹAPB.CrAPB7C4#ABa3Ҿ:c .CrAPB.CYAB7C4#AB?B5[FCԹAPB.CԹA{.B.CrAPB'ľW37C`[AdB.ClAB.C|^AdBƾʔ1_7ClAB.ClAB7C`[AdBw{Ix^ȵC/A>B^ȵCY0A6B|C/A6B18%SjL^ȵCY0A6B^ȵCA,kB.C/A,kB5nT$J|C/A6B^ȵCY0A6B.C/A,kBT6 g^ȵCA,kB^ȵCK9A˟B"C/A˟BN/+X.C/A,kB^ȵCA,kB"C/A˟B-6R=^ȵCK9A˟B^ȵC.TAjBt@C/AjB[aS^="C/A˟B^ȵCK9A˟Bt@C/AjB`U@K&W>^ȵC.TAjB^ȵCA BzC/A B{e P@#>t@C/AjB^ȵC.TAjBzC/A BE>Ӿ3er^ȵCuAVB^ȵC{APBȞCuAPB>@ߐ7CuABȞCuAPB^ȵC{APB3@7CuAB^ȵC{APB7CRABjHᾼAA7CRAB^ȵC{APB^ȵC/ABwzI\x|C/A6B^ȵC/AB^ȵC/A>BqzyIx|C/A6B7CAA6B^ȵC/ABtOo7CAA6B7CRAB^ȵC/ABpmTS'J.C/A,kB7CAA6B|C/A6BTK7C)/A,kB7CAA6B.C/A,kBJ0Y3"C/A˟B7C)/A,kB.C/A,kB U=ü7C3ѡA˟B7C)/A,kB"C/A˟Bϴ Tm=t@C/AjB7C3ѡA˟B"C/A˟BQs=7C,AjB7C3ѡA˟Bt@C/AjB{ P{@#>zC/A B7C,AjBt@C/AjBBMKO5>7CA B7C,AjBzC/A B@ľ/^ȵCԹAфB^ȵCAB>YCԹABվ#+6}ȞCuAPB7CAPB7CԹAB Ѿ5^ȵCuAVBȞCuAPB7CԹABdҾZ6M^ȵCuAVB7CԹAB>YCԹAB1̾6k^ȵCuAVB>YCԹAB^ȵCABS@tȞCuAPB7CuAB7CAPBҘǾj1=>YCԹAB7C4#AB7ClAB,¾1^ȵCԹAфB>YCԹAB7ClABLh0{^ȵCԹAфB7ClAB.ClAdB0^ȵCԹAфB.ClAdB^ȵCAdB}ϾJn8>YCԹAB7CԹAB7C4#ABs2'.ClAdB7ClAB7C`[AdB ?H,CPA BH,CABCA B?pCqA BpCbLAiVBACbLA Bы`?H,CPA Bs̰CAԞCH,CAB2?ACbLA Bs̰CAԞCH,CPA B+fy?ACbLA BpC"6AԞCs̰CAԞC+py?ACbLA BpCbLAiVBpC"6AԞC: [w #?pC"6AԞCpCAACs̰CAԞC>l#<{>ƱCA BƱCyAqKB臱CyA BM?pCqA BcCbLAԞCpCbLAiVB^x?臱CyA BcCbLAԞCpCqA B`">臱CyA BƱCAԞCcCbLAԞC ?>臱CyA BƱCyAqKBƱCAԞCS}b YC?ƱCAԞCƱCbLA`CcCbLAԞC+(?cCbLAԞCpC"6AԞCpCbLAiVBeWt3-?pC"6AԞC軱CA#9CpCAAC|b޾/?cCbLAԞC軱CA#9CpC"6AԞCY}Ѿ,?cCbLAԞCƱClA#9C軱CA#9C&J!)?cCbLAԞCƱCbLA`CƱClA#9C%+;0?ƱClA#9CƱCAKC軱CA#9CLg0]>CA BClA BsClA B<#}>ƱCA By'CyAԞCƱCyAqKBT-74>sClA By'CyAԞCƱCA BsZ#`&`>sClA BCAԞCy'CyAԞC.Q->sClA BClA BCAԞCcZ1?CAԞCCyA Cy'CyAԞC A>y'CyAԞCƱCAԞCƱCyAqKB"I&?ƱCAԞC8CbLA#9CƱCbLA`C5 G-?y'CyAԞC8CbLA#9CƱCAԞC'M'?y'CyAԞCCA#9C8CbLA#9C('7?y'CyAԞCCyA CCA#9Cbݣ ?CA#9CCbLAC8CbLA#9C8"Bľй+?8CbLA#9CƱClA#9CƱCbLA`CC'%mǾRG(?ƱClA#9C8CbLA#9CCbLAC $7ž}n)?ƱClA#9CCbLACƱCAKCHo5?ƱCAKCCbLACCAwCS- =>{ClAԞCClA BCA BP)e>{ClAԞCCA B`CAԞC-r7*Y>`CAԞCCA B`C~gA BO&>`CAԞC`ClAC{ClAԞCB,C>{ClAԞCCAԞCClA Bfb ?CAԞC%ڲCyA#9CCyA C߻{ClAԞC`C]#A#9C%ڲCyA#9Cyx&(m>{ClAԞC`ClAC`C]#A#9CjL ?`C]#A#9C`CyAjC%ڲCyA#9C9#88?%ڲCyA#9CCA#9CCyA C|,l$?CA#9CCbLAsCCbLAC2/K$?%ڲCyA#9CCbLAsCCA#9C-[q׾?%ڲCyA#9C`C;AsCCbLAsC٫.XԾ?%ڲCyA#9C`CyAjC`C;AsC( Ѿ"!?`C;AsC`CbLA#zCCbLAsC{$~.1?CAsCCbLACCbLAsC^lzW4?CAwCCbLACCAsC&31?`CbLA#zC`CA2CCAsC,E&?CbLAsC`CbLA#zCCAsCm$ˍ5Ԕ>.CA B.C([AԞC޳CԹAԞCXV<6>MlCԹA B.CA B޳CԹAԞCj 0>.C([AԞC.CԹAC޳CԹAԞC\XaW޳CԹAԞC`C~gA BMlCԹA B; g1;>`CAԞC`C~gA B޳CԹAԞC6(>`CAԞC=ClA#9C`ClACN()>޳CԹAԞC=ClA#9C`CAԞC +h!3>޳CԹAԞC.CzA#9C=ClA#9CU*?#i>޳CԹAԞC.CԹAC.CzA#9Cd2Rz>.CzA#9C.CO,AsC'ClAsC%g\|>=ClA#9C.CzA#9C'ClAsC- >.CO,AsC.ClAC'ClAsC$Fu">=ClA#9C`C]#A#9C`ClAC"?`C]#A#9CCyAsC`CyAjCI[?`C]#A#9C=ClA#9CCyAsC3>=ClA#9C'ClAsCCyAsC+ 1?.ClAC.CyAICCyAsC3!>'ClAsC.ClACCyAsC(9ھIc?CyAsC`C;AsC`CyAjC&Ҿ?#?`C;AsC;سCbLAmC`CbLA#zC|%.վ|#?CyAsC;سCbLAmC`C;AsC.8 l6?CyAsC.CXAmC;سCbLAmC7#?CyAsC.CyAIC.CXAmC43ⰾt?.CXAmC.CbLA_1C;سCbLAmC.ޔh+?CAmC`CbLA#zC;سCbLAmC$ɖ͞2?`CA2C`CbLA#zCCAmC:`,[o`3?.CbLA_1C.CACCAmCG7 ?;سCbLAmC.CbLA_1CCAmC$Y:_ q>7CA B7C,AԞCǴCuAԞC&B6>mCuA B7CA BǴCuAԞC!R6>7C,AԞC7CuALuCǴCuAԞC'B5>ǴCuAԞC.CA BmCuA BK ư8 g>.C([AԞC.CA BǴCuAԞC 0>.C([AԞCVCԹA#9C.CԹAC'=3i>ǴCuAԞCVCԹA#9C.C([AԞC7*->ǴCuAԞC7CA#9CVCԹA#9C&b1H>ǴCuAԞC7CuALuC7CA#9C-k2>7CA#9C7CAsCҴCԹAsC"%kq(o`>VCԹA#9C7CA#9CҴCԹAsC,u>7CAsC7CԹA_UCҴCԹAsCW*>#>VCԹA#9C.CzA#9C.CԹACi)Z"i>ҴCԹAsC.CzA#9CVCԹA#9C1 >.CO,AsC.CzA#9CҴCԹAsC)pEf>.CO,AsCIClAmC.ClAC*I>ҴCԹAsCIClAmC.CO,AsC}8wO>ҴCԹAsC7CAmCIClAmC:>ҴCԹAsC7CԹA_UC7CAmC<51bO>7CAmC7ClACIClAmC26?Q龗?V=CyAmC.ClACIClAmC)^?.CyAIC.ClACV=CyAmC2A'ξ?7ClAC7Cm$AC޴CyACAξ?7ClAC޴CyACIClAmC3ň ?IClAmC޴CyACV=CyAmCx>ʾ ?7Cm$AC7CyAVC޴CyAC{5Aʝ?V=CyAmC.CXAmC.CyAIC$0.!?.CXAmCECbLAC.CbLA_1Co0KO!?.CXAmCV=CyAmCECbLAC@uV?V=CyAmC޴CyACECbLACo?h?7CyAVC7CbLACECbLAC<F̺Q?޴CyAC7CyAVCECbLAC9L;P)?WCAC.CbLA_1CECbLACta*qD5?.CAC.CbLA_1CWCACHU^ȵCA B^ȵCPџAԞC C/AԞCIEM>zC/A B^ȵCA B C/AԞC+sA7Rn>^ȵCPџAԞC^ȵC/AKC C/AԞC: uJJ> C/AԞC7CA BzC/A Bk!Ay>7C,AԞC7CA B C/AԞC?!6>7C,AԞC *CuA#9C7CuALuCf9= > C/AԞC *CuA#9C7C,AԞC(K7-l> C/AԞC^ȵCA#9C *CuA#9C\>s> C/AԞC^ȵC/AKC^ȵCA#9CL,,h>^ȵCA#9C^ȵCAsCCuAsC,$Js2,> *CuA#9C^ȵCA#9CCuAsC))6>^ȵCAsC^ȵCuA%CCuAsCކ&`1F> *CuA#9C7CA#9C7CuALuC%L0ȥ>CuAsC7CA#9C *CuA#9C$}."#n=>7CAsC7CA#9CCuAsC({6>7CAsCVCԹAmC7CԹA_UC(,+6>CuAsCVCԹAmC7CAsCl8:>CuAsC^ȵCAmCVCԹAmC8'>CuAsC^ȵCuA%C^ȵCAmCg5a>^ȵCAmC^ȵCԹAGCVCԹAmCQ6{>VCԹAmC7CAmC7CԹA_UC43>7CAmCMClAC7ClAC3>VCԹAmCMClAC7CAmCA8>VCԹAmC^ȵC~ACMClACA>VCԹAmC^ȵCԹAGC^ȵC~AC?>^ȵC~AC^ȵClA+CMClAC?оN?MClAC7Cm$AC7ClAC:uϾ ?7Cm$ACxCyAaC7CyAVC;o˾M- ?MClACxCyAaC7Cm$ACK *?MClAC^ȵCAaCxCyAaCMtLɨ@?MClAC^ȵClA+C^ȵCAaCFE^H ?^ȵCAaC^ȵCyAĂ CxCyAaC2E{͗?l7CbLAaC7CyAVCxCyAaC=G?7CbLAC7CyAVCl7CbLAaC+Ff?^ȵCyAĂ C^ȵCbLAc Cl7CbLAaCI]N?xCyAaC^ȵCyAĂ Cl7CbLAaCJ*Co5!?HCAaC7CbLACl7CbLAaCt:(?*?7CAmvC7CbLACHCAaCCJnӽ4?^ȵCbLAc C^ȵC A< C¸CA< C0J0nӽ.?^ȵCbLAc C¸CA< Cl7CbLAaCb(C7!?l7CbLAaC¸CA< CHCAaCHDѽ?^ȵC A< C^ȵCAd C¸CA< CV6Vh H,CYABH,C|AdBCYAdB0̾1!_CaB5BH,CaB(BH,CAt/BѾI5B!_C)Bt/B!_CaB5BH,CAt/BA=6f CYAdBH,CAt/BH,CYABԙ㾯6ig CYAdB!_C AdBH,CAt/Bپ,#!_C=BB!_C( B&BH,CBB*þ7>H,CBB!_CaB5B!_C=BB̾1!H,CaB(B!_CaB5BH,CBB)s,!_Ce4B.BH,Ce4B>BH,C B6BԸ**!_CT@B6B!_Ce4B.BH,C B6B|/p$H,C B6B!_C( B&B!_CT@B6B;a9*U'H,C( BkB!_C( B&BH,C B6B>l=!_CBBH,CBBH,CxBBǡG&y11!_CBB!_CBBH,CxBBǡU&g11H,CxBB!_Ce4B.B!_CBB!8H,Ce4B>B!_Ce4B.BH,CxBB5AJH,CBVBH,C/B\BdCB\B̈́aH1JH,C/B\B!_CBbcBdCB\B 6@JH,C/B\BH,CBB!_CBbcB*)DH,CBB!_CBB!_CBbcBǀOdCB\B!_CB\B!_Cp#BUBZOdCB\B!_Cp#BUBH,CBVB{!SH,CBVB!_Cp#BUBH,Cp#B bBxROdCB\B!_CBbcB!_CB\B؁4[辧Z!_C\)BBH,C\)BBH,CXI$BZ(BWׁY3Z!_C{'BZ(B!_C\)BBH,CXI$BZ(BI؁[辛ZH,CXI$BZ(B!_Cp#BUB!_C{'BZ(B؁sYZH,Cp#B bB!_Cp#BUBH,CXI$BZ(B@ɾL`.pCYAlpBpC+(pCaBByC( B6BpCrB6BAV4ƃCaBBH,CaB(BH,CBBؙ2d"W6pCe4B~BpCBBܒCe4BBᚰm(=+yC( B6BH,C B6BH,Ce4B>B9q([>+pC( B[ByC( B6BH,Ce4B>Bٙe"?V6pC( B[BH,Ce4B>BܒCe4BBٙ e"V6pC( B[BܒCe4BBpCBBA* <(yC( B6BH,C( BkBH,C B6B:J;ܒCe4BBH,CxBBH,CBBi7Iڄ;ܒCe4BBH,CBBpCe4B~B}vCpCe4B~BH,CBBpCB4pB8Hm;ܒCe4BBH,Ce4B>BH,CxBB㋆& MMH,CBVBpCBHBpCB\BL HH,C/B\BH,CBVBpCB\BM HpCB\BH,CBBH,C/B\BYCўKpCB4pBH,CBBpCB\Bs~T/UVpCp#BnnBpC BZ(B\Cp#BZ(B~.VpC BZ(BH,Cp#B bB\Cp#BZ(B~}1VpC BZ(BpCBHBH,Cp#B bB$&F|RpCBHBH,CBVBH,Cp#B bB؁/[辡Z\Cp#BZ(BH,CXI$BZ(BH,C\)BB6؁$[込Z\Cp#BZ(BH,C\)BBpCp#BnnBl޾^pCp#BnnBH,C\)BBpC\)BBׁY3Z\Cp#BZ(BH,Cp#B bBH,CXI$BZ(B<+w%pCYAlpBƱCYADBƱCAt/Bľ/5pCpCe4B~BƱCe4BgBƱC BB۫#ֵ7pCBBpCe4B~BƱC BB#7ƱC BBpC( B[BpCBB㘾,<ƱC( BqBpC( B[BƱC BB2І;"DƱCBVBƱCB\BmCB\BІ"DƱCB\BpCB4pBmCB\B4І)"DƱCB\BƱCe4BgBpCB4pBEІ/"DƱCe4BgBpCe4B~BpCB4pBx6J VLmCB\BpCB\BpCBHBY{J kVLmCB\BpCBHBƱCBVBIvPƱCBVBpCBHBƱCBhHB4{L TLmCB\BpCB4pBpCB\BRuLZpCp#BnnBƱCp#BBƱC!|BZ(Bgτz> VpC BZ(BpCp#BnnBƱC!|BZ(BЄ|w VƱC!|BZ(BpCBHBpC BZ(BbXƱCBhHBpCBHBƱC!|BZ(B/oSdƱCp#BBpCp#BnnBƱC\)Bn-B 7QI IaƱC\)Bn-BpCp#BnnBpC\)BB(5?+CYABC3ABMCYABʿ{*&%:CAt/BƱCAt/BƱCYADBb2*_e&CAB:CAt/BƱCYADBz´()CABƱCYADBMCYAB(=+CABMCYABC3ABȾՓ2z:CAt/BƱCABƱCAt/BF>&R1CaBBCB6BCaB6Bc9*)*MCYABƱCurABƱCaB}fB`?**CYABMCYABƱCaB}fBӲ=&R1CYABƱCaB}fBCaB6B#=&1S1CYABCaB6BCB6B2бj,A 'MCYABƱCYADBƱCurAB^`>C( BKBC BBbC( BB`ҡ$R2CaB6BƱCB6BƱC( BqBԡ+$2CaBBCaB6BƱC( BqBy],>CaBBƱC( BqBbC( BBf ]>CaBBbC( BBC BBӡv$Ñ2CaB6BƱCaB}fBƱCB6Bp]>bC( BBƱC BBƱCe4BgBV]>bC( BBƱCe4BgBC( BKB~zAC( BKBƱCe4BgBCe4B#Bɔ\>bC( BBƱC( BqBƱC BBjcX\JƱCBVBCBQoBC@B\B||DƱCB\BƱCBVBC@B\Bd|DC@B\BƱCe4BgBƱCB\B?҃N^:HCe4B#BƱCe4BgBC@B\B0a]SCBnnBCBZ(BCBZ(B\a_SCBZ(BƱCBhHBCBZ(B"a\wSCBZ(BCBQoBƱCBhHBkA`MQCBQoBƱCBVBƱCBhHBwh@ZCBZ(BƱC!|BZ(BƱCp#BBih@ԾZCBZ(BƱCp#BBCBnnBn$8۾bCBnnBƱCp#BBCp#BB7oh7ZCBZ(BƱCBhHBƱC!|BZ(BOW$nC\)BBCA(BB,-C\)BBOW$nCA(BBƱC\)Bn-B,-C\)BBWAnCA(BBCp#BBƱC\)Bn-B^C BBC( BKB`CTvBBDVj>`CTvBBCaBBC BB@`CaBBCaBB`CTvBBtC`Ce4BB`CB\BCe4B\BVt kC`CB\BCe4B#BCe4B\BQtjC`CB\B`C( B=BCe4B#B?~nA`C( B=BC( BKBCe4B#B[{|ICe4B\BC@B\BCBQoB{}ICe4B\BCBQoB`Ce4BB:Og@rU`Ce4BBCBQoB`CBλB{4~ICe4B\BCe4B#BC@B\B\^CBnnB`CBB`CBZ(Bv%<;VCBZ(BCBnnB`CBZ(B\u%t<.CABܳCYA6B.CٯA6B0ӡ$Q2CAB`CAtB`Ca/AB<ܳCYA6B`CbA6B`CaBB<ܳCYA6B`CaBB.CYAfLBj5yE.CYAfLB`CaBB.CaBBok<ܳCYA6B`CYA"B`CbA6BQShFF`C( B=B.C( BcB.C"BBmdo#C`CTvBB`C( B=B.C"BBd"C.C"BB`CaBB`CTvBB:jzVE.CaBB`CaBB.C"BB=TN`Ce4BB.Ce4B"B.Cٶ B\B6F`CB\B`Ce4BB.Cٶ B\Bݣ6F.Cٶ B\B`C( B=B`CB\BmY7L.C( BcB`C( B=B.Cٶ B\B"CQY.Ce4B"B`Ce4BB.CB;B4W.CB;B`Ce4BB`CBλBFؾ]8g`CBB.CBB.CBZ(B*^`CBZ(B`CBB.CBZ(Bj}^.CBZ(B`CBλB`CBZ(BZq.׾(e.CB;B`CBλB.CBZ(B~)CDp.CBB`CBB.Cp#BBm.Cp#BB`CBB`Cp#BBH[tQt`C\)BcB.C\)BB.Cq'BBt;GP0s`Ca'BB`C\)BcB.Cq'BB)90s.Cq'BB`Cp#BB`Ca'BB= =t.Cp#BB`Cp#BB.Cq'BBStC.CYAfLB7CYAKB7C`A6B =.CٯA6B.CYAfLB7C`A6B =7C`A6B.CAB.CٯA6B$vA7CAB.CAB7C`A6B6l@qBG7CaB~B7CQBBriCaBBlNr/AG7CQBB.CaBBriCaBB4lqAG7CQBB7CYAKB.CaBBvn HE7CYAKB.CYAfLB.CaBBj>yEriCaBB.C"BB.C( BcB6j;yEriCaBB.C( BcB7CaB~BJ5CÛO7CaB~B.C( BcB7C( BPBjz@EriCaBB.CaBB.C"BBU.Ce4B"B7Ce4BB7C[ B\Bq,$lN.Cٶ B\B.Ce4B"B7C[ B\B q,$ mN7C[ B\B.C( BcB.Cٶ B\B~9S7C( BPB.C( BcB7C[ B\BXeNa7CBB7CiBZ(BYaCBZ(B[ᆭPa7CiBZ(B.CB;BYaCBZ(BlcヘNa7CiBZ(B7Ce4BB.CB;BYֈ)Z7Ce4BB.Ce4B"B.CB;B.ؾfYaCBZ(B.CBZ(B.CBB;=ؾpfYaCBZ(B.CBB7CBBm7CBB.CBB7CBFB@2ؾfYaCBZ(B.CB;B.CBZ(B"^"s7CBFB.CBB7Cp#BBh(Ep7Cp#BB.CBB.Cp#BBdlu5ܾ CAB!_CYoAB!_CYAB'e=BH,CAfB CAB!_CYAB!C=4H,CAfB!_CYABCYAdBr>gH,CAfBCYAdBH,C|AdB |DjwCAPB!_CYoAB CABWoC? U!_CAPB!_CYoABwCAPBvC~wCAPB!_CAIB!_CAPB=8k_>qCAjB!_CXAjB!_CA8Bw)Yb5 ?!_CXAjBCYA B!_CYAmBw)5 ?!_CXAjBqCAjBCYA B56?qCAjBCA BCYA B B^CYAdB!_CYAB!_C AdB՜2kR־6?CYA B!_CSA B!_CYAmB|q>8hCAdBH,CAfBH,C|AdBt#lӾ-&?H,CABH,CYA5XCCYA Bv(߾!?CA BH,CABCYA B(];Y0?!_CSA BCaBԞC!_CaBgB3/?CYA BCaBԞC!_CSA B}&精,?CYA BH,CΕAԞCCaBԞC3*V,?CYA BH,CYA5XCH,CΕAԞC4?H,CΕAԞCH,CaBECCaBԞCx!6Zަ9?C( BԞC!_CaBgBCaBԞCkbhC?!_C( BoZC!_CaBgBC( BԞCcF?H,CaBECH,C( B_CC( BԞCA#+48?CaBԞCH,CaBECC( BԞC`?I?C( BԞC!_C HBԞC!_C( BoZC A*RH?!_C HBԞCC( BԞCH,C( B_CA;RH?!_C HBԞCH,C( B_C!_Ce4BCG'O?!_Ce4BCH,C( B_CH,Ce4BChSQ?H,Ce4BCH,CBC!_Ce4BC UT?H,CBC!_CBC!_Ce4BC$ Q^a?H,Cp#B[CH,C\)B>C!_Cp#BCO׾(=f?H,C\)B>C!_C\)BC!_Cp#BCǻ)Ǿh#?-TCYAԞCH,CABs̰CAԞC$kܾ-?H,CYA5XCH,CAB-TCYAԞCz' hR1?pCAACpCYAKC-TCYAԞC%Ě¾ (?s̰CAԞCpCAAC-TCYAԞC_!4?-TCYAԞCH,CΕAԞCH,CYA5XC򲵾M??H,CΕAԞCCaB#9CH,CaBECG>?-TCYAԞCCaB#9CH,CΕAԞC{ 7:?-TCYAԞCpCBB#9CCaB#9C9&Gv8?-TCYAԞCpCYAKCpCBB#9C?C?pCBB#9CpCaB{QCCaB#9CtgE?H?רC( B#9CH,CaBECCaB#9C xkCN?H,C( B_CH,CaBECרC( B#9C )y/WO?pCaB{QCpC( B!CרC( B#9C*C['F?CaB#9CpCaB{QCרC( B#9CkrDR?zCe4B#9CH,C( B_CרC( B#9CkX?H,Ce4BCH,C( B_CzCe4B#9CAƽCX?pC( B!CpCe4B6CzCe4B#9Cci%Q?רC( B#9CpC( B!CzCe4B#9C9炽mZ? aCB#9CH,Ce4BCzCe4B#9Cojb?H,CBCH,Ce4BC aCB#9CًWa?pCe4B6CpCBEC aCB#9CX?zCe4B#9CpCe4B6C aCB#9Cx2/= ac?qCB#9CH,CBC aCB#9C+߾-WKg?pCBCpCp#B?C.Cp#B#9C݉=8c?qCB#9CpCBC.Cp#B#9C6ɾ3I>Oe?pCM(B#9CH,Cp#B[C.Cp#B#9C#8ɾ9I>e?pCM(B#9CpC\)B)CH,Cp#B[C᱾b=>,m?pC\)B)CH,C\)B>CH,Cp#B[CXkξ iN>ބd?.Cp#B#9CpCp#B?CpCM(B#9C M99?)HCYA#9CpCAAC軱CA#9C# þ>@?pCYAKCpCAAC)HCYA#9C12A?ƱCAKCƱCYAC)HCYA#9Ch{4?軱CA#9CƱCAKC)HCYA#9C兾H?)HCYA#9CpCBB#9CpCYAKCMu_D?pCBB#9C)HCYA#9CƱCYAC[!F?pCBB#9CƱCYACpCaB{QC# (8aSN?pCaB{QCƱCYACƱCaBgCGн R?ƱCaBgCƱC( BFCpCaB{QCx:7X?ƱC( BFCpC( B!CpCaB{QC) b\?ƱC( BFCƱCe4BCpC( B!Cnjн c?ƱCe4BCpCe4B6CpC( B!C9_R<4d?ƱCe4BCƱCBСCpCe4B6C߾  e?ƱCBzCƱCp#B\-CpCBCXcL>j?ƱCp#B\-CpCp#B?CpCBC9ɾ9I>Oe?pCM(B#9C C\)B#9CpC\)B)ChξiN>hd? C\)B#9CpCM(B#9CpCp#B?C˾FaN>"e? C\)B#9CpCp#B?CƱC\)B:C+в1>/Ki?ƱC\)B:CpCp#B?CƱCp#B\-Cӛo`E?XCYAsCCAwCCŃAsCEnF?XCYAsCƱCYACCAwC .e7?ƱCYACƱCAKCCAwCtrB?CŃAsCCYAp2CXCYAsCO\6I?GCaBsCƱCYACXCYAsCFdQ?ƱCaBgCƱCYACGCaBsC#WQ?CYAp2CCaBOxCGCaBsCc<D?XCYAsCCYAp2CGCaBsC Ľ{;V?C( BsCƱCaBgCGCaBsC ֽ Y?ƱC( BFCƱCaBgCC( BsC+J A5W?CaBOxCC( BCC( BsCM˽R?GCaBsCCaBOxCC( BsCJ/ȣZ?Ce4BsCƱC( BFCC( BsCy3p꼼_?ƱCe4BCƱC( BFCCe4BsCdVKʗg?CBhCCB/C,-CBsCྀ=ud?CBsCCBhC,-CBsCBɾ2>g?ZCp#BsCƱCBzC,-CBsCƾ->?g?ƱCp#B\-CƱCBzCZCp#BsC˾Տ8>"Cf?CB/CCp#BCZCp#BsC ξ&7>Ie?,-CBsCCB/CZCp#BsCjľh>#e?C $BsCƱCp#B\-CZCp#BsCjľh>V#e?C $BsCC\)BuCƱCp#B\-CӬO4>l?C\)BuCƱC\)B:CƱCp#B\-CXɾn>c?ZCp#BsCCp#BCC $BsCa$dM;?CAsCCŃAsCCAwCQJp'??CŃAsCPCYAmCCYAp2Cw!Bc`_>?CAsCPCYAmCCŃAsCd,V((8?CAsC`CAmCPCYAmC-$8?CAsC`CA2C`CAmCs%1!??`CAmC`CYAaCPCYAmCt#79D?`;CaBmCCYAp2CPCYAmC$Hc L?CaBOxCCYAp2C`;CaBmCZZso&J?`CYAaC`CaBϧC`;CaBmC('ꠌA?PCYAmC`CYAaC`;CaBmC7u?N?Q7C( BmCCaBOxC`;CaBmCJ 'A 6W?C( BCCaBOxCQ7C( BmC,+q ; +S?`CaBϧC`C( B¦CQ7C( BmC:VIF{J?`;CaBmC`CaBϧCQ7C( BmC0 =sW?WCe4BmCC( BCQ7C( BmC<__?Ce4BCC( BCWCe4BmCMmT=G[?`C( B¦C`Ce4BxCWCe4BmC&@Y=VR?Q7C( BmC`C( B¦CWCe4BmC 2 >Yy]?`CEBmCCe4BCWCe4BmC?T&>y]?`CEBmC`CB9CCe4BC=Bc?`CB9CCBhCCe4BCu >nZ?WCe4BmC`Ce4BxC`CEBmCq'1>X`?`CB9C`CBgCCBhCoо#>&g?`CBgCCB/CCBhC;;.f[>ld?`CBgC`Cp#BCCB/C+뾾h:> h?`Cp#BCCp#BCCB/C,* j>_f?C $BsC)C\)BsCC\)BuCW)þ1p>d?)C\)BsCC $BsCCp#BC5*þ 2p>pd?)C\)BsCCp#BC`C\)B COU0c>f?`C\)B CCp#BC`Cp#BC+E}9?CAmC`CAmC`CA2C/ d6?`CAmCCAmC.CACղ.7?`CAmC.CAC`CYAaC@!,Ƈ{:?`CYAaC.CAC.CYACY-1`<K?.C( BC.Ce4BqC`C( B¦Cn=qQ?.Ce4BqC`Ce4BxC`C( B¦CTvt.>[?`CEBmC(CBmC`CB9Ck >X?(CBmC`CEBmC`Ce4BxC >Y?(CBmC`Ce4BxC.CB,CP>%N?.CB,C`Ce4BxC.Ce4BqC3V>jX?ACBmC`CB9C(CBmC}yu2>wa?`CBgC`CB9CACBmClav>[?.CB,C.CBWCACBmC[>عV?(CBmC.CB,CACBmC޾m>X^?.C;!BmC`CBgCACBmC޾m>P^?.C;!BmC.Cp#B%HC`CBgC?־dY>b?.Cp#B%HC`Cp#BC`CBgClv>[?ACBmC.CBWC.C;!BmC Ӿ>T^?.Cp#B%HC.C\)BC`Cp#BCSS1c>Df?.C\)BC`C\)B C`Cp#BC-88?V0CYAC.CACWCAC_\&# |??.CYAC.CACV0CYAC2=Y6?7CAmvC7CYACV0CYACB?7CaB|C7C( B(CMC( BCף.r=o:?4CaBC7CaB|CMC( BCav>u8G?Ce4BC.C( BCMC( BCZ5>޽P?.Ce4BqC.C( BCCe4BCY>I?7C( B(C7Ce4BCCe4BC V%>B?MC( BC7C( B(CCe4BC _k>TL?,״CBC.Ce4BqCCe4BCWT> R?.CB,C.Ce4BqC,״CBC }>ՂL?7Ce4BC7CBt9C,״CBCWRt>3H?Ce4BC7Ce4BC,״CBC>cM?7CBC.CB,C,״CBCڶ>UM?7CBC7CBC.CB,CIq>=IW?7CBC.CBWC.CB,C_ >oI?,״CBC7CBt9C7CBC޾Zm>^?.C;!BmCSCp#BmC.Cp#B%HC/kZv>T[?SCp#BmC.C;!BmC.CBWCRWv>r\?SCp#BmC.CBWC7Cp#BCnҐ>T?7Cp#BC.CBWC7CBC]ھL>_Z?C\)BmC.Cp#B%HCSCp#BmC;;Ҋ>_?.C\)BC.Cp#B%HCC\)BmCVӾ>+[?7Cp#BC7C\)BCC\)BmC.>VX?SCp#BmC7Cp#BCC\)BmC=6?CaBaC7CYAC CYAaC-2=Y:?AC( BaC7CaB|CCaBaC%>B??7C( B(C7CaB|CAC( BaC-QE>m5?^ȵCaB C^ȵC( B CAC( BaC`2ui.>^2?CaBaC^ȵCaB CAC( BaC ~#Pf_>u+A?7Ce4BC7C( B(CCe4BaCM=# >G:?^ȵC( B C^ȵCe4Bm CCe4BaCN,pk>3?AC( BaC^ȵC( B CCe4BaCF>;?^ȵC#BaC7Ce4BCCe4BaC>4=?^ȵC#BaC^ȵCBaC7Ce4BCMU{>.I?^ȵCBaC7CBt9C7Ce4BC2>gO6?Ce4BaC^ȵCe4Bm C^ȵC#BaCMyz>yL?7CBCDCBC7CBC> i>`H?DCBC7CBC7CBt9CW \> I?DCBC7CBt9C^ȵCB־C>E?^ȵCB־C7CBt9C^ȵCBaCƯ"> J?Cp#BC7CBCDCBCgf>iR?7Cp#BC7CBCCp#BCǰL>K?^ȵCB־C^ȵCp#BCCCp#BC >GG?DCBC^ȵCB־CCp#BC-5>M?^ȵC#BC7Cp#BCCp#BC,%A>fM?^ȵC#BC^ȵC\)BaC7Cp#BC>WW?^ȵC\)BaC7C\)BC7Cp#BCI?Cp#BC^ȵCp#BCC^ȵC#BCZ-9,rpCIBBpCHBB߰CIBBprpCPPBz8BpCIBB߰CIBBSؾ½}fCPPBBpCPPBz8B߰CIBBپ-ٖgpC VBBpCPPBz8BCPPBBY^]C VBBpC VBBCPPBBtݼ.]pCI#]B]BpC VBBC VBB@SiDYCI#]BBpCI#]B]BC VBBk(tqtƱCR~CBiBƱCABBrCR~CBB+, ryrCR~CBBpCHBBpCIBB+ fyrCR~CBBpCIBBƱCR~CBiBs1[9bNqƱCR~CBiBpCIBBƱCIBBj1:bNqƱCIBBpCIBBƱCPPBBm<nƱCPPBBpCIBBpCPPBz8B7H1lƱCPPBBpCPPBz8BƱC VBjB%p*GVcƱC VBjBpCPPBz8BpC VBB4$⽒$bƱC VBjBpC VBBƱCI#]BMB*qڼZƱCI#]BMBpC VBBpCI#]B]Bsֽ܉^uƱCR~CBiBCR~CB+BCe?BBlwwmwƱCABBƱCR~CBiBCe?BB ս_됾ZtCR~CB+BƱCR~CBiBCIB8BA)MvfuCIB8BƱCR~CBiBƱCIBBz&Ə &rCIB8BƱCIBBCPPBiDB?ccrCPPBiDBƱCIBBƱCPPBB/5.jC VB]BCzUB}BqC VB}B70HjCzUB}BƱC VBjBqC VB}B7/[jCzUB}BCPPBiDBƱC VBjBeB71uCPPBiDBƱCPPBBƱC VBjB)L>llCI#]BuBC VB]BqC VB}Bξ;QBd CI#]B}BCI#]BuBqC VB}BZξ?QAdqC VB}BƱCI#]BMB CI#]B}B⃞͊qƱC VBjBƱCI#]BMBqC VB}B>4BB}2G6t`C*?BB`CR~CBB.Ct>BB՗3b9xo.CR~CBB`CR~CBB.CIBϷB>疽pq.CIBϷB`CR~CBB`CIBBϽY8m.CPPBAwB.CUOB}BCPPB}B|ϽVI9m.CUOB}B`CPPBBCPPB}BDϽT9m.CUOB}B.CIBϷB`CPPBB+>Dp.CIBϷB`CIBB`CPPBBaҽΎpCPPB}B`CQB}B`C VBBҽmpCPPB}B`C VBB.CPPBAwBz[Yk.CPPBAwB`C VBB.C VB6BҽCpCPPB}B`CPPBB`CQB}BZP)Zn.C VB6B`C VBB.CI#]BBBm앾Ro.CI#]BB`C VBB`CI#]B{B%92n.CR~CBB7CR~CBB7C{=BBA(sr.Ct>BB.CR~CBB7C{=BB4Fn7CR~CBB.CR~CBB7CIBjB]2n7CIBjB.CR~CBB.CIBϷBwνk.CPPBAwB7CPPBB7C98NB}BŽoUm.CUOB}B.CPPBAwB7C98NB}BŽk$Vm7C98NB}B.CIBϷB.CUOB}Bi4Hl7CIBjB.CIBϷB7C98NB}BRWͽƾ@j7CPPBB.CPPBAwB7C VBMBnl7C VBMB.CPPBAwB.C VB6B8˾/h7C VBMB.C VB6B7CI#]BH\BwN虩k7CI#]BH\B.C VB6B.CI#]BB]q!]q^ȵC=BB^ȵCZx`CB0BìBCB0BhB`C׫6BBĞZpv`C׫6BBCB0BhBC׫6BB[x=[x`C׫6BBC׫6BB`C=BtB[x=[x`C=BtBC׫6BBC=BtBR$ Zmv`C*?BBC=BtBCe?BB Yt`C=BtBC=BtB`C*?BBnw@mZdw.C\)BB`C\)BcB.CB0BBUlu<4bu.CB0BB`C\)BcB`CB0BìBnw<-m]dw.CB0BB`CB0BìB.C׫6BBgZxO[x.C׫6BB`CB0BìB`C׫6BBSFpv.C׫6BB`C׫6BB.C=BB >X>x >x.C=BB`C׫6BB`C=BtB>06t.Ct>BB`C=BtB`C*?BB`"󼢌`"s.C=BB`C=BtB.Ct>BBUlu<4bu7C\)BcB.C\)BB7CB0BìBnw@mZdw7CB0BìB.C\)BB.CB0BBrv6iv7CB0BìB.CB0BB7C׫6BBNaNw7C׫6BB.CB0BB.C׫6BBMMu7C׫6BB.C׫6BB7C=BXB8@{$0v7C=BXB.C׫6BB.C=BBVAp2r7C{=BB.C=BB.Ct>BBZ3Ɲwo7C=BXB.C=BB7C{=BBciu^ȵC\)BcB7C\)BcB^ȵCB0BìBciu^ȵCB0BìB7C\)BcB7CB0BìBiu^ȵCB0BìB7CB0BìB^ȵC׫6B$Btv5iv^ȵC׫6B$B7CB0BìB7C׫6BB,q#q^ȵCZa?!_CIBBH,CHB BH,CIBVB*">Q@c?!_CSDB BH,CHB B!_CIBBBt>ZY?H,CIBVBH,CPPBB!_CIBByu_t>bt_?H,CPPBB!_CPPBgAB!_CIBB!5D?O?!_C VB&BH,CSBjBH,C VBbBxC ?R?!_CQBjBH,CSBjB!_C VB&BuC ?R?H,CSBjB!_CQBjB!_CPPBgABĞN& ?N?H,CPPBBH,CSBjB!_CPPBgAB-=?u+?!_CI#]B]2BH,C8/[B˟BH,CI#]BBB,?W:?!_Cv ZB˟BH,C8/[B˟B!_CI#]B]2BC,?:?H,C8/[B˟B!_Cv ZB˟B!_C VB&Bwd2?<2?H,C VBbBH,C8/[B˟B!_C VB&B>a?H,CHB B\CIB BH,CIBVBE}C>SIU?pCYLB BH,CIBVB\CIB BG}G>-HU?pCYLB BpCPPBBH,CIBVB*d[>*d[?pCPPBBH,CPPBBH,CIBVB3?L?H,C VBbBpCUBjBpC VBB8?~O?H,CSBjBpCUBjBH,C VBbB8,?@O?pCUBjBH,CSBjBH,CPPBBdKl?dK?pCPPBBpCUBjBH,CPPBB:D?^?H,CI#]BBpC=\B˟BpCI#]BHB#=;?ѳ)?H,C8/[B˟BpC=\B˟BH,CI#]BBnk2?C2?pC=\B˟BH,C8/[B˟BH,C VBbB[2?[2?pC VBBpC=\B˟BH,C VBbBH?&\V?pCPPBBƱCNB BƱCPPB BeM ?W?pCYLB BƱCNB BpCPPBB3?L?pCUBjB JC VBjBpC VBB3?L? JC VBjBpCUBjBpCPPBBN3?L? JC VBjBpCPPBBƱC VBgAB>E?JJ?ƱC VBgABpCPPBBƱCPPB Bpf+qC?&?pC=\B˟B JCI#]B˟BpCI#]BHBV2?W2? JCI#]B˟BƱCWBjBƱCI#]B BL2?\2?pC=\B˟BƱCWBjB JCI#]B˟B\2?Q2?pC=\B˟B JC VBjBƱCWBjB S2?S2?pC=\B˟BpC VBB JC VBjBW2?W2? JC VBjBƱC VBgABƱCWBjB{Hݞ?\V?ƱCNB B:CPPB BƱCPPB Bߴ<'?ZII?C /QB BƱCPPB B:CPPB B<? KI?C /QB BC VBBƱCPPB Bk1-:?3K?C VBBƱC VBgABƱCPPB B;4JR/?;4?ƱCI#]B BC YBjBCI#]BBs$u2?u2?ƱCWBjBC YBjBƱCI#]B Bs$v2?w2?C YBjBƱCWBjBƱC VBgABH?.CI#]B#4B7C\BjB7CI#]BB^ؽ'???.C[BjB7C\BjB.CI#]B#4Bؽ'???7C\BjB.C[BjB.C VB.BZy)?7=?7C VBgB7C\BjB.C VB.B2YKD'?y??7C VBgB^ȵC^VB B^ȵC VBBT"?C?7CtUB B^ȵC^VB B7C VBgBսU)?>?7C\BjBJCI#]BjB7CI#]BBսT)?[ >?JCI#]BjB7C\BjB7C VBgBսT)?S >?JCI#]BjB7C VBgB^ȵCI#]BB뽥*?oHlh?!_C"-BԞCRCB0BԞC!_CB0BCbƾ=0>wg?RCB0BԞC!_C"-BԞC!_C\)BCsƾ0>g?RCB0BԞC!_C\)BCH,CB0B[1CԾO>#!c?H,CB0B[1C!_C\)BCH,C\)B>C8f >.d? C׫6BԞC!_CB0BCRCB0BԞCA\>Bk?!_C׫6B!C!_CB0BC C׫6BԞC'>ܶg?H,CB0B[1CH,C׫6BDC C׫6BԞC¾>Dc?RCB0BԞCH,CB0B[1C C׫6BԞCv>R g?H,C 7BԞC!_C׫6B!C C׫6BԞC^t> g?H,C 7BԞCH,C=B 5C!_C׫6B!C>,e>mi?H,C=B 5C!_C=BPB!_C׫6B!C&u> g? C׫6BԞCH,C׫6BDCH,C 7BԞCꖝ>L8e?H,C=B 5CH,CR~CB.CB!_C=BPBZa>88g?H,CR~CB.CB!_CR~CB5B!_C=BPB r>@c?H,CHB B!_CSDB B!_CR~CB5Bϝxx>i_?H,CR~CB.CBH,CHB B!_CR~CB5BqS?>zk?pC\)B)CpCB0BCH,C\)B>CGT>rh?pCB0BCH,CB0B[1CH,C\)B>CJ7>md?pCB0BCpC׫6BsXCH,CB0B[1C'G>e?pC׫6BsXCH,C׫6BDCH,CB0B[1Cjȏ> f?H,C 7BԞCTC=BԞCH,C=B 5Cꊬ.ɏ> f?TC=BԞCH,C 7BԞCH,C׫6BDCgȏ> f?TC=BԞCH,C׫6BDCpC=BCxB>c?pC=BCH,C׫6BDCpC׫6BsXC}> `?pC>BԞCH,C=B 5CTC=BԞCY>/ `?pC>BԞCpCR~CB9(CH,C=B 5Cr>0f?pCR~CB9(CH,CR~CB.CBH,C=B 5C}> `?TC=BԞCpC=BCpC>BԞCW&>a?\CIB BH,CHB BH,CR~CB.CB(>a?\CIB BH,CR~CB.CBpCIBB_>N\?pCIBBH,CR~CB.CBpCR~CB9(C|F}vD> IU?\CIB BpCIBBpCYLB BǾi>ZYd?CB0B#9CpC\)B)C C\)B#9C_ C@>l?pCB0BCpC\)B)CCB0B#9C>+Bh?ƱC\)B:CƱCB0BiCCB0B#9CSʾl>ʚc? C\)B#9CƱC\)B:CCB0B#9Cῤĕ>8e?ƱCr2B#9CpCB0BCCB0B#9C%ܖ>D8e?ƱCr2B#9CƱC׫6B-CpCB0BCG>. j?ƱC׫6B-CpC׫6BsXCpCB0BCSϦD>d?CB0B#9CƱCB0BiCƱCr2B#9CB>g?ƱC׫6B-CƱC=B"OCpC׫6BsXCt>h?ƱC=B"OCpC=BCpC׫6BsXCy>c?pCR~CB9(CƱCaCBԞCƱCR~CBC{e?pC>BԞCƱCaCBԞCpCR~CB9(CWt>v{e?ƱCaCBԞCpC>BԞCpC=BCi쌾J>Bza?ƱC=B"OCƱCaCBԞCpC=BCTxT>\?ƱCR~CBCƱCIBBpCR~CB9(C`s>`?ƱCIBBpCIBBpCR~CB9(CUM ?W?ƱCNB BpCYLB BpCIBBZUG?ZU?ƱCIBBƱCNB BpCIBB;L>g?C\)BuCCB0B`CƱC\)B:C%>mh?CB0B`CƱCB0BiCƱC\)B:C̖>.8e?ƱCr2B#9CGC׫6B#9CƱC׫6B-CϦK>d?GC׫6B#9CƱCr2B#9CƱCB0BiCݦj>}d?GC׫6B#9CƱCB0BiCC׫6BpCӣ!>e?C׫6BpCƱCB0BiCCB0B`CD>b?C8B#9CƱC׫6B-CGC׫6B#9C>>,b?C8B#9CC=B[CƱC׫6B-C*>v+h?C=B[CƱC=B"OCƱC׫6B-Cdݲ>Qa?GC׫6B#9CC׫6BpCC8B#9CKm#>XHb?ƱCaCBԞC˱CR~CBԞCƱCR~CBC5Z>UQb?˱CR~CBԞCƱCaCBԞCƱC=B"OC_l>Pb?˱CR~CBԞCƱC=B"OCCR~CBoC5+>> E`?CR~CBoCƱC=B"OCC=B[CM>W?CFBԞCƱCR~CBC˱CR~CBԞC}A>dX?CFBԞCCIB.CƱCR~CBC^Z>^?CIB.CƱCIBBƱCR~CBC1A>YX?˱CR~CBԞCCR~CBoCCFBԞCdH?B[V?:CPPB BƱCNB BƱCIBBHğ?[V?:CPPB BƱCIBBCPPBa\B&]Tٺ?/^T?CPPBa\BƱCIBBCIB.C$b?`C\-BsCC\)BuC)C\)BsCЬȖ>X$b?`C\-BsC`CB0BCC\)BuC溺y>8g?`CB0BCCB0B`CC\)BuCUe藚>`?)C\)BsC`C\)B C`C\-BsC/s>b?`CB0BC`C׫6BCCB0B`Cڜ>qf?`C׫6BCC׫6BpCCB0B`C'>n d?C8B#9C4C=B#9CC=B[Cbk>qGc?4C=B#9CC8B#9CC׫6BpCh'a>Lc?4C=B#9CC׫6BpC`C=BpVCE%>2a?`C=BpVCC׫6BpC`C׫6BC.Q>[?`C=B#9CC=B[C4C=B#9C5H|>[?`C=B#9C`CR~CBCC=B[COx>8b?`CR~CBCCR~CBoCC=B[CՑ8>Z?4C=B#9C`C=BpVC`C=B#9Cf>VY?CIB.C`CIBԞC`CIBCuf>_Y?CFBԞC`CIBԞCCIB.Cf>_Y?`CIBԞCCFBԞCCR~CBoCUmm>?8X?`CR~CBC`CIBԞCCR~CBoC*ZV ?cN?`CIBC`CPPBBCIB.C9-?U?`CPPBBCPPBa\BCIB.C&Y?"MJ?`CRB BC /QB BCPPBa\B ##?ͫH?`CPPBB`CRB BCPPBa\Bha>Hc?`C\-BsCݮCB0BsC`CB0BCJ j>вa?ݮCB0BsC`C\-BsC`C\)B Cyh>7a?ݮCB0BsC`C\)B C.CB0B;Cj>Wa?.CB0B;C`C\)B C.C\)BCJ3J3>c=_?.C)<4BsC`CB0BCݮCB0BsC33>?=_?.C)<4BsC.C׫6BC`CB0BCp>~yc?.C׫6BC`C׫6BC`CB0BCii>@}]?ݮCB0BsC.CB0B;C.C)<4BsC'O0>\?.C׫6BC.C=BC`C׫6BC/l>~c?.C=BC`C=BpVC`C׫6BCn>CsZ?`CR~CBC.CAB#9C.CR~CBCw{>@]?`C=B#9C.CAB#9C`CR~CBCPk{y>D]?.CAB#9C`C=B#9C`C=BpVC툾>.W?.C=BC.CAB#9C`C=BpVCL>Z?`CIBԞCgCIBԞC`CIBC4O>Y?gCIBԞC`CIBԞC`CR~CBC4L>Y?gCIBԞC`CR~CBC.CIBC h?T?.CIBC`CR~CBC.CR~CBC>[?J?.CKBԞC`CIBCgCIBԞC > ?J?.CKBԞC.CPPBB`CIBCU\T?{P?.CPPBB`CPPBB`CIBC>?J?gCIBԞC.CIBC.CKBԞCY5f?FI?.C3TB B`CRB B`CPPBBv?zD?.CPPBB.C3TB B`CPPBBɾ~^>[?7C*BmC.C\)BCC\)BmCɾb>([?7C*BmC7CB0BC.C\)BCj>*a?7CB0BC.CB0B;C.C\)BC0оGҲ>X?C\)BmC7C\)BC7C*BmCNڲ>DRa?.C)<4BsĈC׫6BsC.C׫6BCQ>_?̂C׫6BsC.C)<4BsC.CB0B;C Q>_?̂C׫6BsC.CB0B;C7C׫6BA.C̮ >*4[?7C׫6BA.C.CB0B;C7CB0BCj}^>Y?7C=`9BsC.C׫6BĈC׫6BsCzy>Y Y?7C=`9BsC7C=BZC.C׫6BC܍3> r_?7C=BZC.C=BC.C׫6BC&T>W?̂C׫6BsC7C׫6BA.C7C=`9BsC G>ZZY?.CAB#9CoCR~CB#9C.CR~CBCDž-r>cX?oCR~CB#9C.CAB#9C.C=BCʊs>aX?oCR~CB#9C.C=BC7CR~CBpC# ,>HV?7CR~CBpC.C=BC7C=BZCFu ?QN?7CDB#9C.CR~CBCoCR~CB#9Ct ?dRN?7CDB#9C7CIB[C.CR~CBCrH?[V?7CIB[C.CIBC.CR~CBCwG ?'M?oCR~CB#9C7CR~CBpC7CDB#9Ci?lF?.CPPBB7CMBԞC7CPPBC!U?K?.CKBԞC7CMBԞC.CPPBBя!S? K?7CMBԞC.CKBԞC.CIBC)8?pD?7CIB[C7CMBԞC.CIBCW5 ?!/E?7CtUB B.C3TB B.CPPBB ak!?vC?7CPPBC7CtUB B.CPPBB`#ϾMm>Y?7C*BmC=CB0BmC7CB0BC־>V?=CB0BmC7C*BmC7C\)BCjԾ> W?=CB0BmC7C\)BC^ȵCB0BܨCE))>Q?^ȵCB0BܨC7C\)BC^ȵC\)BaCǾʍ>!R?^ȵC2BmC7CB0BC=CB0BmCǾ>!R?^ȵC2BmC^ȵC׫6BlC7CB0BC > 4[?^ȵC׫6BlC7C׫6BA.C7CB0BCC̾U>O?=CB0BmC^ȵCB0BܨC^ȵC2BmC73Ma>Y?7C=`9BsCC=BsC7C=BZCě9>_W?C=BsC7C=`9BsC7C׫6BA.C>›p>QW?C=BsC7C׫6BA.C^ȵC=BC.>{7Q?^ȵC=BC7C׫6BA.C^ȵC׫6BlCƐU?ULO?^ȵC=BsC7C=BZCC=BsCƐ8?MO?^ȵC=BsC^ȵCR~CBC7C=BZC~v>W?^ȵCR~CBC7CR~CBpC7C=BZCzԓe?L?C=BsC^ȵC=BC^ȵC=BsCAt?*?66L?7CIB[C^ȵC/GB#9C^ȵCIBCrSʰ ?O?7CDB#9C^ȵC/GB#9C7CIB[CͮU* ?SN?^ȵC/GB#9C7CDB#9C7CR~CBpC;f?tI?^ȵCR~CBC^ȵC/GB#9C7CR~CBpC ES!?B?7CPPBC^ȵCIOBԞC^ȵCPPBUhCh$w?E?7CMBԞC^ȵCIOBԞC7CPPBC܅$iw?mE?^ȵCIOBԞC7CMBԞC7CIB[Cg5 ?B?^ȵCIBC^ȵCIOBԞC7CIB[CV"?C?^ȵC^VB B7CtUB B7CPPBC,e&?Qr>?^ȵCPPBUhC^ȵC^VB B7CPPBCZ t)`u)7C6BB7CvB%BbgC6B%B/ t)t)7C6BB^ȵC6B ,B^ȵCHB%B t)Yu)7CvB%B7C6BB^ȵCHB%B_YfTH,C}1}BtBH,CwBBC}1}BBT H,C]́B}QBH,CwB}BE$C]́B}BTGjH,CwB}BH,C}1}BtBC}1}BB5T QH,CwB}BC}1}BBE$C]́B}BStս됾E$C]́B}BC}1}BB]C]́BBlNXH,CBŭBH,C]́B}QBE$C]́B}Bg9w݂LX7CB}BH,CBŭBE$C]́B}BrE$C]́B}B]C]́BB7CB}B\~=(z]C]́BBCBB7CB}BJKcH,C6B:BH,CB?!B!C6B?!BssrGH,CB?!BH,CNBUBC6BUBVB!C6B?!BH,CB?!BC6BUBrrTH,CNBUBH,CBŭB7CB}BYrYrvTH,CNBUB7CB}BC6BUB&~j>CBBz'C6BBkC6B}BAK.gXpCcBoBpCI#]B]BCI#]BB|@TܒCcBBpCcBoBCI#]BBR\ӽ[SpCiBDBpCcBoBܒCcBB'I!t-сF CiBBpCiBDBܒCcBBlC7_zCpC_pBBpCiBDB CiBBH4G4jC_pBBpC_pBB CiBB,Q,pC?vBBpC tB}B1ްC?vB}B,O,pC tB}BpC_pBBjC_pBB,`Q,pC tB}BjC_pBB1ްC?vB}B*AP?M1ްC?vB}BjC_pBBL4C?vBB(J\g(pC}1}BWBpC?vBB1ްC?vB}B/+Pk&4qC}1}B}BpC}1}BWB1ްC?vB}B\YfoH,C}1}BtBL4C?vBBH,CwBBD_YfH,C}1}BtB4qC}1}B}BL4C?vBB{64qC}1}B}B1ްC?vB}BL4C?vBBDM!{ pC]́BBpCBUBC]́BUBT4qC}1}B}BH,CwB}BH,C]́B}QB˜0oT+pC}1}BWB4qC}1}B}BH,C]́B}QB[A4eھpC}1}BWBH,C]́B}QBC]́BUBrX 5XpC}1}BWBC]́BUBpCBUBT4qC}1}B}BH,C}1}BtBH,CwB}B-"F pCB?oBpC|B?!BICB?!B5l pC|B?!BpC]́BBC]́BUBj tpC|B?!BC]́BUBICB?!BiM;aICB?!BC]́BUB1CBUB`DC]́BUBH,CBŭB1CBUBNT3H,C]́B}QBH,CBŭBC]́BUB #b1ZpC6BpZBpCABB~C6BBLJL뫷ICB?!BH,CB?!BH,C6B:B%_0뾮KpCB?oBICB?!BH,C6B:B9;pCB?oBH,C6B:B~C6BB?iHpCB?oB~C6BBpCABBD<-g׾1CBUBH,CB?!BICB?!BNsys(uGH,CNBUBH,CB?!B1CBUB2rZrHT1CBUBH,CBŭBH,CNBUBjC/ YƱCI#]BMBpCI#]B]BƱCcBB _UƱCcBBpCI#]B]BpCcBoBq%PKƱCiB6BƱCcB}BCiB}Bq%gKƱCcB}BpCiBDBCiB}BAu%KƱCcB}BƱCcBBpCiBDB ԽvTƱCcBBpCcBoBpCiBDB~\肾zGƱC_pBBƱCiB6BCiB}Bh@DC_pB}BƱC_pBBCiB}B6h@CiB}BpC_pBBDC_pB}B >YJpCiBDBpC_pBBCiB}B}3ƱC?vBBBƱCP{vBUB2C?vBUB~:DC_pB}BpC tB}BpC?vBB~X:ƱC_pBBDC_pB}BpC?vBByod3ƱC_pBBpC?vBB2C?vBUB3ƱC_pBB2C?vBUBƱCP{vBUB{a}:DC_pB}BpC_pBBpC tB}BQᾫ+ƱC}1}B(BƱC?vBBB2C?vBUB";ؾ^%8C}1}BUBƱC}1}B(B2C?vBUB$۾~L"2C?vBUBpC}1}BWB8C}1}BUBrbdTþ0pC?vBBpC}1}BWB2C?vBUBs*5tƱC]́BsBƱCB?!B5[C]́B?!B>c8C}1}BUBpCBUBpC]́BBsCƱC}1}B(B8C}1}BUBpC]́BB߱uƱC}1}B(BpC]́BB5[C]́B?!BNs*!uƱC}1}B(B5[C]́B?!BƱCB?!BFK8C}1}BUBpC}1}BWBpCBUBzR] ƱCBX BƱCqTBBPCBBЂ"G 5[C]́B?!BpC|B?!BpCB?oBUƱC]́BsB5[C]́B?!BpCB?oB }\+ƱC]́BsBpCB?oBPCBB 5iiƱC]́BsBPCBBƱCqTBBl g5[C]́B?!BpC]́BBpC|B?!B*4)L ƱC6B8BƱCN/BBk C6BB?I$YPCBBpCABBpC6BpZB1 O'ƱCBX BPCBBpC6BpZBYW (,ƱCBX BpC6BpZBk C6BB`^ %ƱCBX Bk C6BBƱCN/BB04 $PCBBpCB?oBpCABBb;#pbCcB{BCI#]BuB CI#]B}B$Z]ɱCcB}BCcB{B CI#]B}BOWZ CI#]B}BƱCcBB]ɱCcB}B}Ѿ[IgƱCI#]BMBƱCcBB CI#]B}B4P1C}1}BeBCUyB?!B,-C}1}B?!BZh*q>CUyB?!BƱC}1}B(B,-C}1}B?!Bhns>CUyB?!BC?vBHBƱC}1}B(B9:C?vBHBƱC?vBBBƱC}1}B(B}9hj&C]́B%BCBBNC]́BB?'D=/,-C}1}B?!BƱCB?!BƱC]́BsB:%D/C}1}BeB,-C}1}B?!BƱC]́BsB7i,j&C}1}BeBƱC]́BsBNC]́BB;i-i&C}1}BeBNC]́BBCBB?&8D/,-C}1}B?!BƱC}1}B(BƱCB?!B(ؾ^1CBs̹BC>;BB6BCBB\"q(UNC]́BBƱCqTBBƱCBX Bc'GC]́B%BNC]́BBƱCBX B Pܾ,% C]́B%BƱCBX B6BCBBʾe>&>&C]́B%B6BCBBC>;BB9羃_!_!NC]́BBƱC]́BsBƱCqTBB־9^i C6BoϵBCBcB\C6BcBھ3H6BCBBƱCN/BBƱC6B8Bվ3yCBs̹B6BCBBƱC6B8BӾr93uCBs̹BƱC6B8B\C6BcBξ(2NCBs̹B\C6BcBCBcBԾ).6BCBBƱCBX BƱCN/BBNzlƚ'k`CI#]B{BCI#]BuB`CcB6Bƚz k`CcB6BCI#]BuBCcB{BǾ8R\`CiB{uB`C IeBUBCiBUB4Ǿs\`C IeBUBCiBSBCiBUBǾc}\`C IeBUB`CcB6BCiBSBOll`CcB6BCcB{BCiBSB*Ǿ^#[CiBUBClBUBC_pBŨB#Ǿ\'[CiBUBC_pBŨB`CiB{uBо_dW`CiB{uBC_pBŨB`C_pBHB^ǾDE[CiBUBCiBSBClBUBcᾴ`WH`C?vBMB`CsB?!BC?vB?!B~caᾡWH`CsB?!BC?vBHBC?vB?!B dZcVH`CsB?!B`C_pBHBC?vBHB3̾̾3S`C_pBHBC_pBŨBC?vBHB.lܾ CC?vB?!BCUyB?!BC}1}BeBnܾ>CC?vB?!BC}1}BeB`C?vBMBgs7`C?vBMBC}1}BeB`C}1}BBnܾCC?vB?!BC?vBHBCUyB?!B۾mL]+C]́B%B`C]́B,B`C[}BB,b޾JE)CBBC]́B%B`C[}BBc޾Kʉ)`C[}BBC}1}BeBCBB@߾*`C}1}BBC}1}BeB`C[}BBi־=,CBs̹B`CBB`C-BB'k/OCC>;BBCBs̹B`C-BBDӾ$$`C-BBC]́B%BC>;BBEӾ$$`C]́B,BC]́B%B`C-BB68+u8`C6BB`CBNBC6BNB=þS=c C6BoϵBC6BNB`CBNB>þS=R C6BoϵB`CBNBCBcBəѾ F5HCBcB`CBNB`C8BcBiξ21`C8BcBCBs̹BCBcBlo־PN,Z `CBBCBs̹B`C8BcBxpe.CcBjB.C`BUBCcBUBxwŃe.C`BUB`CcB6BCcBUB{e.C`BUB.CI#]BB`CcB6B Bkn.CI#]BB`CI#]B{B`CcB6BBcI٭gCcBUB`C IeBUB`CiB{uBb ٭.gCcBUB`CiB{uB.CcBjB ̙þl_.CcBjB`CiB{uB.CiBd[Ba~׭gCcBUB`CcB6B`C IeBUB6߾Q.C_pBpB.CjnB?!BC_pB?!BF8߾XQ.CjnB?!B`C_pBHBC_pB?!BU8)߾1Q.CjnB?!B.CiBd[B`C_pBHB}ṽY`.CiBd[B`CiB{uB`C_pBHB vUOC_pB?!B`CsB?!B`C?vBMBrvOC_pB?!B`C?vBMB.C_pBpBAԾyB.C_pBpB`C?vBMB.C?vB茾Bx#OC_pB?!B`C_pBHB`CsB?!Bݾ5.C}1}B B.CbxBBhC}1}BBݝݾ5.CbxBB`C}1}BBhC}1}BBݾ5.CbxBB.C?vB茾B`C}1}BBϾS=.C?vB茾B`C?vBMB`C}1}BBE$E!#.C]́BB.CBBC]́BBVҾ,hC}1}BB`C[}BB`C]́B,BijҾ,.C}1}B BhC}1}BB`C]́B,B+AD!#.C}1}B B`C]́B,BC]́BBFE!#.C}1}B BC]́BB.CBBݤҾ,hC}1}BB`C}1}BB`C[}BB9Ҿ1#.CBbB.C-BcBiCBcBd辄).C]́BB`C-BB`CBB0׾.+0.C]́BBC]́BB`CBBe!Ҿ)]< .C]́BB`CBBiCBcB&3ƾ&&.C]́BBiCBcB.C-BcB߾ ""C]́BB`C]́B,B`C-BB&@G3҂`C6BB.C6B䧱B.C2BNBbȾM6`CBNB`C6BB.C2BNB9Ҿ1~#iCBcB.C2BNB.CBbBB>ҾA1$iCBcB`C8BcB.C2BNB Ⱦ6ƙ`C8BcB`CBNB.C2BNBBξϫ-HiCBcB`CBB`C8BcB|Ҿנ`.CcBjB7CcBB7C>]BUBnOLҼhh.C`BUB.CcBjB7C>]BUBRLռgh7C>]BUB.CI#]BB.C`BUBFJվ\Zc7CI#]BH\B.CI#]BB7C>]BUB}UxŽ\7CcBB.CcBjB7CiB{4BC¾^7CiB{4B.CcBjB.CiBd[B?sH.C_pBpB7C_pB&B7C1jB?!Bou侾DW.CjnB?!B.C_pBpB7C1jB?!BRqCW7C1jB?!B.CiBd[B.CjnB?!BK/*SN7CiB{4B.CiBd[B7C1jB?!Bƾd@7C?vBB7CsBB{C?vBBƾ@7CsBB.C?vB茾B{C?vBBJƾܫ@7CsBB7C_pB&B.C?vB茾BRѺEG7C_pB&B.C_pBpB.C?vB茾B9Ҿb%117C}1}B$B7CX{BB!C}1}BB1 ,:{C?vBB.CbxBB.C}1}B B; ):7C?vBB{C?vBB.C}1}B B9Ҿf#17C?vBB.C}1}B B!C}1}BB7Ҿ~# 17C?vBB!C}1}BB7CX{BBP:{C?vBB.C?vB茾B.CbxBB9ҾL,7C]́BB7C9BcBC]́BcBǾ6d%(!C}1}BB.CBB.C]́BBǾd%(7C}1}B$B!C}1}BB.C]́BBʾR>&>&7C}1}B$B.C]́BBC]́BcBʾk>&>&7C}1}B$BC]́BcB7C9BcBǾ e%(!C}1}BB.C}1}B B.CBBGƾ}@07CBRB7C!BNB|CBNB־@>0uC]́BcB.C-BcB.CBbBϾ/3v7C]́BBC]́BcB.CBbBt̾S /M7C]́BB.CBbB|CBNBľ9/z7C]́BB|CBNB7C!BNB՛ʾ1>&1>&C]́BcB.C]́BB.C-BcBȾ;2_x|CBNB.C2BNB.C6B䧱B%þ.27CBRB|CBNB.C6B䧱Bf2m7CBRB.C6B䧱BbgC6B%BμG1B7CBRBbgC6B%B7CvB%BȾJ2Ix|CBNB.CBbB.C2BNBF*վacCI#]BUB7C>]BUB7CcBBF*վkacCI#]BUB7CcBB^ȵCI#]BŨBIk]r]^ȵCI#]BŨB7CcBB^ȵCcBBGHվwXcCI#]BUB7CI#]BH\B7C>]BUB sS^ȵCiBeB^ȵCbfB?!B4 CiB?!B.LOǯC_pBBH,C_pBB?CiBB:9> )?CiBB!_C_pBBOǯC_pBB݀#zy>g:!_CiBB!_C_pBB?CiBB=n?(>H,C_pB0BC_pBdBH,C8pBdB/Er1H,C?vB'BH,C_pBBOǯC_pBB:ol>(C?vBBH,C?vB'BOǯC_pBBe? !_CU$sBZ(BOǯC_pBB!_C_pBB[e? !_CU$sBZ(BʯC?vBZ(BOǯC_pBB'{ >ʯC?vBZ(B(C?vBBOǯC_pBB::b,?!_CQ:tB\BʯC?vBZ(B!_CU$sBZ(BP4CQ4?&Q߰C?vB\BʯC?vBZ(B!_CQ:tB\B144?w!_C.tBB߰C?vB\B!_CQ:tB\B4E4?yC?vBB߰C?vB\B!_C.tBB44? 4=!_CmtB6BC?vBB!_C.tBBW J?a=C?vB6BC?vBB!_CmtB6Bi 6?:>C?vB6BH,CgTuBBH,C?vB^B^g :6?1>C?vB6B!_CmtB6BH,CgTuBB^5t?^ >!_CmtB6B!_CΆsBBH,CgTuBBoSd?>H,CgTuBB!_CΆsBBH,CrBt/B/P.|?`->!_CΆsBB!_ClrBt/BH,CrBt/B=,n?!>C_pBdBH,C_pB0BH,CrBt/Bj=Bn?>C_pBdBH,CrBt/B!_ChpBdBE?>x?>x>!_ChpBdBH,CrBt/B!_ClrBt/B^zguxִH,CwBBH,C?vB'B(C?vBB"yguִH,CwBB(C?vBBC}1}BBy}H}C}1}BB(C?vBBC}1}BBD} }(C?vBBʯC?vBZ(BC}1}BB{->r{=ʯC?vBZ(BC}1}BZ(BC}1}BBzhz#,>iʯC?vBZ(B߰C?vB\BC}1}BZ(BZ_S>cpC>߰C?vB\BC}1}B\BC}1}BZ(B;ߟ&?xR>H,C{BBH,C}1}BWBC}1}B\Bx;*&?FxR>H,C{BBC}1}B\BC?vBBb>%C?vBBC}1}B\B߰C?vB\BeJ?r=C?vBBC?vB6BH,C.VyB6B|G9%?O|>H,C{BBC?vBBH,C.VyB6B$h 6?>C?vB6BH,C?vB^BH,C.VyB6BB|ܽ C}1}BBC}1}BB]C]́BBC}1}BZ(BkC]́BZ(B(C]́BB}rD5>Ki>H,CB\BH,C]́B4BkC]́BZ(Br5>*i>H,CB\BkC]́BZ(BC}1}B\B=xj>=7Y>C}1}B\BkC]́BZ(BC}1}BZ(Br5>gi>C}1}B\BH,C}1}BWBH,CB\Bs~=~]C]́BB(C]́BBCBB$z]BK>_=(C]́BB CBBCBBOq+>1b>H,CBZ(BH,CB{B CBBNq0>44b>H,CBZ(B CBBkC]́BZ(BdwI>*>kC]́BZ(B CBB(C]́BBn}>fK>kC]́BZ(BH,C]́B4BH,CBZ(Bp:>E4>H,CɇBBH,C6B%Bz'C6BBpO>[4>H,CɇBBz'C6BB CBB$z\BK>_= CBBz'C6BBCBB!un<>_> CBBH,CB{BH,CɇBB|@TCI#]BBH,CcBBܒCcBB""XH,CI#]BABH,CcBBCI#]BBCI!-FܒCcBBH,CiBB CiBBgHTH,C8pBdBa=C_pBdBH,C_pB0Bug>u贾jC_pBBH,C?vB'BL4C?vBB*Esx1#H,C_pBBH,C?vB'BjC_pBB%%?;>H,CgTuBBZC?vBBH,C?vB^Bk?3?ZC?vBBpC!vBt/BpC?vB0B??ZC?vBBH,CgTuBBpC!vBt/B1cR?d>H,CgTuBBH,CrBt/BpC!vBt/B[bg?ۭ>H,C_pB0Ba=C_pBdBpC#rBdBqb4g?'٭>H,C_pB0BpC#rBdBH,CrBt/B?'־TC?+>H,CrBt/BpC#rBdBpC!vBt/B9ug-uy贾L4C?vBBH,C?vB'BH,CwBB; &?yR>H,C{BBZTC}1}BBH,C}1}BWBF9%? Q|>H,C.VyB6BZTC}1}BBH,C{BB--?1\>C}1}B6BZTC}1}BBH,C.VyB6B20?>C}1}B6BpC@|BBpC}1}B-B4(_(?>H,C.VyB6BpC@|BBC}1}B6B{-V?h>H,C.VyB6BZC?vBBpC@|BB%8%?>H,C.VyB6BH,C?vB^BZC?vBB*>?E ?ZC?vBBpC?vB0BpC@|BBrZ5>m>H,CB\BAC]́B\BH,C]́B4BrM5>m>H,C}1}BWBAC]́B\BH,CB\Br5>j>H,C}1}BWBZTC}1}BBAC]́B\Bav*>?>ZTC}1}BBC]́BBAC]́B\B{8Vδ>8>pCɟB6BpC]́BBC]́BB:Vo>L:>pCɟB6BC]́BBC}1}B6Bb>p_>C}1}B6BC]́BBZTC}1}BBS˿>G>C}1}B6BpC}1}B-BpCɟB6B?Mq6>fDb>H,CBZ(B=CBZ(BH,CB{Bqnz}>Q>H,C]́B4B=CBZ(BH,CBZ(Bnu}>N>H,C]́B4BAC]́B\B=CBZ(B~-i>>AC]́B\B;CB\B=CBZ(Bb㪍>?>AC]́B\BC]́BB;CB\B3l\(m>>C]́BBeCBB;CB\BxO>>pC]́BBpCB7BeCBB(YZ>p>C]́BBpC]́BBeCBBplV>g4>H,CɇBBMC6BBH,C6B%Bsn >_>H,CB{BMC6BBH,CɇBBrnO >I_>H,CB{B=CBZ(BMC6BBdBݲ>h>=CBZ(B C6BZ(BMC6BBf d&>馕>=CBZ(B;CB\B C6BZ(B]>&\>;CB\BڰC6B\B C6BZ(BL= >>pC{BBpC6B;BڰC6B\BL >V>pC{BBڰC6B\BeCBBuWt> >eCBBڰC6B\B;CB\B_J>>eCBBpCB7BpC{BB?ҭ?pC!vBt/BFC?vBt/BpC?vB0B$$?QD>pC#rBdBFC?vBt/BpC!vBt/B$$?D>C?vBdBFC?vBt/BpC#rBdB|0?}>pC@|BBC}1}BBpC}1}B-B).>?E ?pC?vB0BC}1}BBpC@|BBv.<?B ?pC?vB0BFC?vBt/BC}1}BBu9$> >FC?vBt/BQC}1}Bt/BC}1}BB* ??ƱC xBdBƱC}1}BBQC}1}Bt/B{*m ??ƱC xBdBQC}1}Bt/BC?vBdB :jA?^>C?vBdBQC}1}Bt/BFC?vBt/B8Vkδ>8>pCɟB6B?C]́B6BpC]́BBSɲ>%>pC}1}B-B?C]́B6BpCɟB6BS>>pC}1}B-BC}1}BB?C]́B6BD> >C}1}BBC]́BB?C]́B6Bj-5<>ߵ ?ƱCMBt/BƱC]́BbBC]́BB*5$> ?ƱCMBt/BC]́BBQC}1}Bt/BC> ]?QC}1}Bt/BC]́BBC}1}BB*5%> ?QC}1}Bt/BƱC}1}BBƱCMBt/B:U>:>XCB6BpC]́BB?C]́B6BWzOC>m>pCB7BpC]́BBXCB6BA>I?ƱCBBƱCBZ;BXCB6B>A0>I?ƱCBBXCB6BC]́BBmEJ>?C]́BBXCB6B?C]́B6B<~>'?C]́BBƱC]́BbBƱCBBL>>pC{BB.KC6BBpC6B;B?>>.KC6BBƱCB6BƱC6B؁B Ev?>,>pC{BBƱCB6B.KC6BBC'>w>pC{BBXCB6BƱCB6B6aJ>g>pC{BBpCB7BXCB6B^]s?XCB6BƱCBZ;BƱCB6B* ??ƱC xBdBd8C}1}BdBƱC}1}BB,5 >U ?ƱCMBt/BC]́Bt/BƱC]́BbB#,$b@?<?C]́Bt/BClBdBC]́B3B/g>~?ƱCMBt/BClBdBC]́Bt/B)? ?ƱCMBt/Bd8C}1}BdBClBdB+5#> ?ƱCMBt/BƱC}1}BBd8C}1}BdBA>G?ƱCBB@CBBƱCBZ;B1%,> ?@CBBCvBt/BCBB0t>"?ƱCBBCvBt/B@CBB*>?ƱCBBC]́Bt/BCvBt/B<*>?ƱCBBƱC]́BbBC]́Bt/B)h>-?C]́Bt/BC]́B3BCvBt/B.?f>$>ƱCB6BѱC6B6BƱC6B؁B_<>Hr?ƱCBZ;BѱC6B6BƱCB6B`<>q?ƱCBZ;B@CBBѱC6B6B %?;?@CBBC6BBѱC6B6B7s6?)?CBBC6B'BC6BBM! >?@CBBCBBC6BB5"?d?ClBdBٲC]́BdBC]́B3Br>_#?CvBt/BԭCBt/BCBBr?|?ԭCBt/B`CDBdB`CBBG!>!p$?CvBt/B`CDBdBԭCBt/B(??CvBt/BٲC]́BdB`CDBdB'q>9?CvBt/BC]́B3BٲC]́BdB??`CM·Bt/BCBBԭCBt/B[@[?|?`CM·Bt/B`C6BIBCBB ?&?`C6BIBC6B'BCBBdc?N?ԭCBt/B`CBB`CM·Bt/B7ʾ?ڿ3?`CDBdB#CBdB`CBBþ[ ?-?`CM·Bt/BC6Bt/B`C6BIBpþX ?-?C6Bt/B.CHBdB.C6BBrþZ ?V-?`CM·Bt/B.CHBdBC6Bt/BpþW ?-?`CM·Bt/B#CBdB.CHBdBtþW ?-?`CM·Bt/B`CBB#CBdB|'?3?.C6BB7CBdB7C6BCBZ-&?A4?.CHBdB7CBdB.C6BBoM+?6?7CBdB}gC6BdB7C6BCBN9V?u ?!_CcByBH,C`B,kBH,CcBxB@0N?k?!_C`B,kBH,C`B,kB!_CcByBr4?P4?H,C`B,kB!_C`B,kB!_CI#]B]2BYk0=?q+?H,CI#]BBH,C`B,kB!_CI#]B]2B.M=7k?+>!_CiBPBH,ChBBH,CiBnBj!_C%iBBH,ChBB!_CiBPBz H,ChBB!_C%iBBH,C3eB6Bv !_C%iBB!_CfeB6BH,C3eB6BfF!_C_pBBH,C8pBdBC_pBdB;=Gr?>!_C_pBB!_CnBBH,C8pBdB=p?>!_CnBBH,C]nBBH,C8pBdBs=9m?T>H,C]nBB!_CnBBH,CAkBPBt=9m?T>!_CnBB!_C6lBPBH,CAkBPBPg=c?>H,CAkBPB!_C6lBPB!_CiBPB3*M=k?>H,CiBnBH,CAkBPB!_CiBPBn=JHr?>C_pBdB!_ChpBdB!_C_pBB@ƽV?r ?H,CcBxBpCaB,kBpCcB BԽT? ?H,C`B,kBpCaB,kBH,CcBxBd⼽OH,CiBnBpCOiBBpCiBUB_ 3Bk?>H,ChBBpCOiBBH,CiBnBa?I>pCOiBBH,ChBBpC+eB6BZ½^?>H,ChBBH,C3eB6BpC+eB6B$U? ?pC+eB6BH,C3eB6BH,CcBxB?ƽV?q ?pCcB BpC+eB6BH,CcBxB ~"a?>a=C_pBdBpCtoBBpC_pB6BA~a?~>a=C_pBdBH,C8pBdBpCtoBBH$n?H>H,C8pBdBH,C]nBBpCtoBB* Zh?>pCtoBBH,C]nBBpCjlBPBlnl?>H,C]nBBH,CAkBPBpCjlBPBӓZi?[>pCjlBPBH,CAkBPBH,CiBnBJ4*ae?4>pCiBUBpCjlBPBH,CiBnBn~a?F>a=C_pBdBpC_pB6BpC#rBdB.q9+T??pCcB BƱC2cB,kBƱCcB%B<~9S??pCaB,kBƱC2cB,kBpCcB B'f+C?s&?pCI#]BHB JCI#]B˟BƱCC]B˟B#f+C?'?pCI#]BHBƱCC]B˟BpCaB,kBe+C?z'?pCaB,kBƱCC]B˟BƱC2cB,kBW2?W2? JCI#]B˟BƱCI#]B BƱCC]B˟Bue]?>pCOiBBpCOiBBpC+eB6BƱC0NgB6B[~9S??ƱC0NgB6BpC+eB6BpCcB Bz95S??ƱCcB%BƱC0NgB6BpCcB BKJ?>pCtoBB9C_pBBpC_pB6Bo>?f>9C_pBBƱCoBPBƱC_pBBpy>?9C_pBBpCtoBBƱCoBPBT{\?b>pCtoBBpCjlBPBƱCoBPBP]?>pCiBUBpCiBUBƱCOkBBpCjlBPB2ߩQ?>pCjlBPBƱCOkBBƱCoBPB'EQ?<%?pC#rBdB9C_pBBƱC: sBBcJJ?>pC#rBdBpC_pB6B9C_pBB"ro>?9C_pBBƱC_pBBƱC: sBB%'u?Oh ?C?vBdBƱC?vBcBƱC xBdBRR?1?ƱC2cB,kByCcB,kBƱCcB%BC+ C?2y?yCcB,kBC_B˟BCcBj0BP C~ C?y?yCcB,kBƱC2cB,kBC_B˟B C; C?y?ƱC2cB,kBƱCC]B˟BC_B˟B@2mA2?lA2?C_B˟BƱCC]B˟BƱCI#]B BFA2A2?FA2?CI#]BBC_B˟BƱCI#]B BɀX@? ?ƱCiBBCiB6BCiB-B<æ^?M?H?ƱC0NgB6BCiB6BƱCiBB@R@R?6?ƱCcB%ByCcB,kBCdB,kBTRiR?N"?ƱCcB%BCdB,kBƱC0NgB6B>? ?ƱC0NgB6BCdB,kBCiB6B C C?|?yCcB,kBCcBj0BCdB,kBFB6?>ƱCoBPBKC_pBPBƱC_pBB+? ?KC_pBPBC;nBBC_pBBD+? ?KC_pBPBƱCoBPBC;nBBо6aJ?o>ƱCoBPBƱCOkBBC;nBB;F?՝>C;nBBƱCOkBBƱCiBBM@?^ ?CiB-BC;nBBƱCiBB54?\?ƱC: sBB;C?vBBƱC?vBcB .2+?Tl?;C?vBBCsBPBC?vB$B-3,?Xl?ƱC: sBBCsBPB;C?vBBYiB6?r>ƱC: sBBKC_pBPBCsBPB@6?M>ƱC: sBBƱC_pBBKC_pBPBy+?ڄ ?KC_pBPBC_pBBCsBPBIVv?%?d8C}1}BdBCyBBC}1}B|B|#1 ?i?ƱC xBdBCyBBd8C}1}BdB?D?ƱC xBdB;C?vBBCyBB#'?i ?ƱC xBdBƱC?vBcB;C?vBB{g?y ?;C?vBBC?vB$BCyBBM! >?d8C}1}BdBC}1}B|BClBdB%m8?='?CcBj0B`C1aB˟B`CcBRSB C C?x?C_B˟B`C1aB˟BCcBj0BdB2A2?>A2?`C1aB˟BC_B˟BCI#]BB+B2yA2?MA2?`CI#]BB`C1aB˟BCI#]BB﴾'@? ?CiB6B+CiB6BCiB-B@Ԧ<1?M $?+CiB6B`CBgB,kB`CiBB㦾1?|$?+CiB6BCiB6B`CBgB,kB섾WA??CiB6BCdB,kB`CBgB,kB b???`CBgB,kBCdB,kBCcBj0B"m8?w;'?`CcBRSB`CBgB,kBCcBj0BK/?k?C;nBBXC_pBBC_pBB v%?< ?XC_pBB`CFlB6B`C_pBsfBft%? ?C;nBB`CFlB6BXC_pBB"8A? ?C;nBB+CiB6B`CFlB6BA? ?C;nBBCiB-B+CiB6B@Ԧ<1?M $?+CiB6B`CiBB`CFlB6B _ ?f?CsBPBC?vBPBC?vB$B??C?vBPB`CsBB`C?vB!BY??CsBPB`CsBBC?vBPBOK/?l?CsBPBXC_pBB`CsBBB I/?l?CsBPBC_pBBXC_pBB依%??XC_pBB`C_pBsfB`CsBBU?)&?CyBBC}1}BBC}1}B|BL ?ɤ?C}1}BB`ClyBPB`C}1}B,BLm ?m?CyBB`ClyBPBC}1}BBv??CyBBC?vBPB`ClyBPBkvq?u?CyBBC?vB$BC?vBPB ?MK?C?vBPB`C?vB!B`ClyBPB+o?3Y?ٲC]́BdB`CswBB`C]́B1xB%>?ClBdB`CswBBٲC]́BdB?W?ClBdBC}1}BB`CswBB/M!= >?ClBdBC}1}B|BC}1}BBtI)?/t?C}1}BB`C}1}B,B`CswBBW?Y?ٲC]́BdB`C]́B1xB`CDBdBGZ+?-7?`CcBRSB.CbB˟B.CcB2B(;?))?`C1aB˟B.CbB˟B`CcBRSB^B!2?2?.CbB˟B`C1aB˟B`CI#]BB~n-?O9?.CI#]B#4B.CbB˟B`CI#]BB3)?1?`CiBB.CaiB,kB.CiB$BZX5?h'?`CBgB,kB.CaiB,kB`CiBBj6?4%?.CaiB,kB`CBgB,kB`CcBRSB'FI-?5?.CcB2B.CaiB,kB`CcBRSBHb"?˧-?`C_pBsfB.C5pB6B.C_pBR#B E-?ʉ%?`CFlB6B.C5pB6B`C_pBsfB0?O"?.C5pB6B`CFlB6B`CiBB '?2?.CiB$B.C5pB6B`CiBBdCӾ $? $?`CsBBC?vBB`C?vB!Be׾#(?: ?C?vBB`CsBB`C_pBsfB|Ѿ&??#?C?vBB`C_pBsfB.C?vB.BC/!?Q.?.C?vB.B`C_pBsfB.C_pBR#B~޾SG?M)?`ClyBPBC}1}BPB`C}1}B,B߾Ę?~*?C}1}BPB.CE+wBB.C}1}B GBݾ,F?*?`ClyBPB.CE+wBBC}1}BPB=ܾ:?*?`ClyBPBC?vBB.CE+wBB+ھ?G*?`ClyBPB`C?vB!BC?vBBɎ۾_O?[+?C?vBB.C?vB.B.CE+wBBmܾ?v0?`CswBBNԳC]́BB`C]́B1xBپs?V.?NԳC]́BB.CG~BPB.C]́ByB.k߾?..?`CswBB.CG~BPBNԳC]́BB6ྥ?o.?`CswBBC}1}BPB.CG~BPB_?.?`CswBB`C}1}B,BC}1}BPBux%?H,?C}1}BPB.C}1}B GB.CG~BPBľ}?/?#CBdB.CĂBB.CBeBξ?/?`CDBdB.CĂBB#CBdBҾ?.0?`CDBdBNԳC]́BB.CĂBBGܾ?#0?`CDBdB`C]́B1xBNԳC]́BB*׾?#!,?NԳC]́BB.C]́ByB.CĂBBqþW ?-?#CBdB.CBeB.CHBdBt3-?8?.CbB˟B3CcB˟B.CcB2B2-?8?3CcB˟B.CbB˟B.CI#]B#4B2-?}8?3CcB˟B.CI#]B#4B7CcB~B׽%'???7CcB~B.CI#]B#4B7CI#]BB5 W,? *5?.CaiB,kBriCiB,kB.CiB$B`"?i=?riCiB,kB7CdB˟B7CiBFB NLh%?y?riCiB,kB7CiBFB7CkB,kBi-!?8?7CsB6B.C_pBR#B^:C_pB6Bh!?;8?7CsB6B7C?vBՕB.C_pBR#B]Ȝ.%?!.3?7C?vBՕB.C?vB.B.C_pBR#B`gm!?8?^:C_pB6B7C_pBcB7CsB6B/T?5?.C}1}B GB7CrczBB7C}1}BBB"?ʿ3?.CE+wBB7CrczBB.C}1}B GBD"?3?7CrczBB.CE+wBB.C?vB.B ?6?7C?vBՕB7CrczBB.C?vB.B䝾#?r4?.C]́ByB7CǀBPB7C]́BBe&?6?.CG~BPB7CǀBPB.C]́ByBe?6?7CǀBPB.CG~BPB.C}1}B GBWd"?03?7C}1}BB7CǀBPB.C}1}B GBI%?3?.CBeB7C6FBB7CBB𙾍#?h4?.CĂBB7C6FBB.CBeBT#?4?7C6FBB.CĂBB.C]́ByBǜ.%?#.3?7C]́BB7C6FBB.C]́ByBEY,&?B4?7CBdB.CHBdB.CBeBW'?2?7CBB7CBdB.CBeBO4ٽ%?A?^ȵCk]BjB7CI#]BBJCI#]BjB4ٽ}%?FA?^ȵCk]BjB^ȵCcBYB7CI#]BBS.{l'?SW??^ȵCcBYB7CcB~B7CI#]BB3ٽv%?*A?JCI#]BjB^ȵCI#]BB^ȵCk]BjBg,@?WE?7CiBFB^ȵC"_eB˟B^ȵCiBBj%?|@?7CdB˟B^ȵC"_eB˟B7CiBFBAgj%? }@?^ȵC"_eB˟B7CdB˟B7CcB~Bi]?ݹF?^ȵCcBYB^ȵC"_eB˟B7CcB~B C?7C}1}BB^ȵC|BB^ȵC}1}B5?7CBdB^ȵCKBB}gC6BdBӲUk+?Y6?7CBdBCBB^ȵCKBBkX+?6?7CBdB7CBBCBB!Wm,?3(5?CBB^ȵCB7B^ȵCKBB65!515߱H,CwԑBMBH,CB%BCwԑB%Bپ5+<:AH,C BBH,C[B谪BnC B谪BZ-P^!_C B${BnC B谪BH,C[B谪Bj.P*!_C B${BH,C[B谪B!_C5ܔBB@ZCtɾ!_C5ܔBBH,C[B谪BH,C۴BB5!1߱CwԑB%BH,C۴BBH,CwԑBMBp3!1߱CwԑB%B!_C;B%BH,C۴BBk OHz\!_C;B%B!_C5ܔBBH,C۴BBvʾjC9<H,C=BJwBH,CϩBI|BsC=BI|B4ܾr>NnC B谪B!_Ch6B谪B!_C=BBt7־ݚ>*H,C BBnC B谪B!_C=BBԾp>-H,C BB!_C=BBsC=BI|BϾ=H,C BBsC=BI|BH,CϩBI|Bu-PnC B谪B!_C B${B!_Ch6B谪Bi<ލ!_CTrB?9BH,CTrBkBH,C*BGBͽC!_ChBGB!_CTrB?9BH,C*BGB9ʾB9ǼsC=BI|BH,C*BGBH,C=BJwBʾC9sC=BI|B!_CjBI|BH,C*BGBMh9sA !_CjBI|B!_ChBGBH,C*BGBXҾMP@?sC=BI|B!_C=BB!_CjBI|B}N$BH,CB8BH,CP BmޝBCBmޝBv_YRt!_CB`BCBmޝBH,CP BmޝBI_]R!_CB`BH,CP BmޝB!_CB B)DH!_CB BH,CP BmޝBH,CٸB B*dI4 H,CٸB B!_CTrB?9B!_CB BgD<H,CTrBkB!_CTrB?9BH,CٸB Bн601!_CۡBBH,CۡBBH,CBΩBn<*!_CJ;BΩB!_CۡBBH,CBΩBNwBCBmޝBH,CBΩBH,CB8BxNBeCBmޝB!_CKBmޝBH,CBΩBϹOr!_CKBmޝB!_CJ;BΩBH,CBΩBu_]YRCBmޝB!_CB`B!_CKBmޝB`wž`wEHpCwԑB<ʬBpCBBzCwԑBBѾQѾH,CwԑBMBzCwԑBBpCBBѾQѾH,CwԑBMBpCBBH,CB%B=H,CB%BpCBBpC B%B2njbFįH,C BBpC B3BpC5B谪B7m{GFoH,C[B谪BH,C BBpC5B谪BtžHyErzCwԑBBpC5B谪BpCwԑB<ʬB*xž*xEƖzCwԑBBH,C۴BBpC5B谪BdɛǾX߾H,C۴BBH,C[B谪BpC5B谪BѾQѾzCwԑBBH,CwԑBMBH,C۴BB]~nApC=BrBpCBGBC=BGBv,gNCH,C=BJwBC=BGBpCBGB[+OCH,C=BJwBpCBGBH,CϩBI|BE섾WAH,CϩBI|BpCBGBpCBI|BmX9H)pCBI|BH,C BBH,CϩBI|B0Ɍ`FӱpC B3BH,C BBpCBI|B ~u ;#pCTrB/BpCB BbCTrB B~vAC=BGBH,C*BGBH,CTrBkB~AljpC=BrBC=BGBH,CTrBkB~ApC=BrBH,CTrBkBbCTrB B~A/pC=BrBbCTrB BpCB B+MOCC=BGBH,C=BJwBH,C*BGB}6U0H,CB8BpCBcBpCyBmޝBt7ADxH,CP BmޝBH,CB8BpCyBmޝB~uR ;l#bCTrB BpCyBmޝBpCTrB/Bz|u ;<#bCTrB BH,CٸB BpCyBmޝBW>$%JH,CٸB BH,CP BmޝBpCyBmޝB\~oAbCTrB BH,CTrBkBH,CٸB BѶͼ44H,CۡBBpCۡBbBpCBΩB 72H,CBΩBH,CۡBBpCBΩBBFR!pCBΩBH,CB8BH,CBΩB6}6-0pCBcBH,CB8BpCBΩBƾH;eƱC؟BoBƱCXB%B,C؟B%BQ@pCwԑB<ʬBƱCwԑBYBƱC+͏BBƧJ pCBBpCwԑB<ʬBƱC+͏BBƾJ;c,C؟B%BƱC+͏BBƱC؟BoBiƾH;pd,C؟B%BpC B%BƱC+͏BB"KpC B%BpCBBƱC+͏BB{>KDkƱC BTBƱCBI|B$C BI|BCp%vKpC B3B$C BI|BƱCBI|Bn%KTpC B3BƱCBI|BpC5B谪BEPD4pC5B谪BƱCBI|BƱC[B谪B?]P ƱC[B谪BpCwԑB<ʬBpC5B谪B?򉾮@UƱCwԑBYBpCwԑB<ʬBƱC[B谪BB F@@%pC=BrBƱC=BWoBƱCɃBGBFVpCBGBpC=BrBƱCɃBGBADsv$C BI|BƱCɃBGBƱC BTBvBD\v$C BI|BpCBI|BƱCɃBGB F.pCBI|BpCBGBƱCɃBGBp%K$C BI|BpC B3BpCBI|Bgh/:.pCTrB/BƱCTrBџBƱCEB BFпF?'pCB BpCTrB/BƱCEB B'Bǽ'BG/ƱCEB BpC=BrBpCB Bn yI@s=%ƱC=BWoBpC=BrBƱCEB B44pCBcBƱCB}BƱCVFBmޝB$7$71pCyBmޝBpCBcBƱCVFBmޝB2r@2r@Sd(ƱCVFBmޝBpCTrB/BpCyBmޝBg10:.ƱCTrBџBpCTrB/BƱCVFBmޝB=W$BpCۡBbBƱCۡBjəBƱCѠBΩBW=G44pCBΩBpCۡBbBƱCѠBΩB{Z=71ƱCѠBΩBpCBcBpCBΩB{$CƱCB}BpCBcBƱCѠBΩBᔗ-8!ƱC؟BoBC؟BBC7؋B%B>ƱCXB%BƱC؟BoBC7؋B%BHdDMIƱCۡBjəBCۡBBCҰBΩB0>֛"@ƱCѠBΩBƱCۡBjəBCҰBΩB0>b"@CҰBΩBƱCB}BƱCѠBΩB=EKCB7BƱCB}BCҰBΩBgZ.G&`C:kByB`CJB%B̲C:kB%B ]-[-`C؟BB`CXBBC؟BB[?5>a̲C:kB%BC7؋B%BC؟BB4aϷ5 `C:kByB̲C:kB%BC؟BBZ3z%`C:kByBC؟BBC؟BBs1:r)`C:kByBC؟BB`CXBBa8?Zn0m:3CwԑBQB`CwԑBvB`CWB谪BoXR<$CB谪BCwԑBQB`CWB谪Bsc,R>/C؟BB`CWB谪B`C؟BB[ɌT2-.C؟BBCBBB`CWB谪BV:&y&CBBBCB谪B`CWB谪B;8"q!C؟BBC؟BBCBBB5G4G4C BB`C B$BB`CΓBI|B\=)C*OBI|BC BB`CΓBI|B-V?l'`CΓBI|BCwԑBQBC*OBI|B=11`CwԑBvBCwԑBQB`CΓBI|B=<0D9C=BB`C=B3B`C{BGBF3<-C*BGBC=BB`C{BGBQJ'?<@*`C{BGBC BBC*BGB9/58`C B$BBC BB`C{BGB^>*,$;CڗBmޝBCB7BQCBmޝBmj>$ ;QCBmޝBCTrBBBCڗBmޝB]fj>$g;QCBmޝB`CBBCTrBBB >bL`CBB`CTrBMLBCTrBBBf£>oz BCҰBΩBCۡBBCۡBΩBb> KCۡBΩB`CۡBB`CĞBmޝB:>Y JCҰBΩBCۡBΩB`CĞBmޝB;>4Z^HCҰBΩB`CĞBmޝBQCBmޝB\x>=FCҰBΩBQCBmޝBCB7B;H>{PQCBmޝB`CĞBmޝB`CBB?SxK,ߛ)`C:kByB.C:kBDTB.CjB%B>>.&`CJB%B`C:kByB.CjB%BkU&4`C؟BB.C؟B^B.CtBB;, ;,`CXBB`C؟BB.CtBB/'.CtBB`C:kByB`CXBB#X$/.C:kBDTB`C:kByB.CtBB9J#T>`CwԑBvB.CwԑBɜB.CEiB谪B/p~7-?0`CWB谪B`CwԑBvB.CEiB谪Bo~|-0.CEiB谪B`C؟BB`CWB谪BoZ(:.C؟B^B`C؟BB.CEiB谪B~f"D`C B$BB.C B5B.C0BI|By8 \3\3`CΓBI|B`C B$BB.C0BI|By8 \3\3.C0BI|B`CwԑBvB`CΓBI|BH=Mz+A.CwԑBɜB`CwԑBvB.C0BI|B5L=5LM`C=B3B.C=BB.CRBGB8=r09`C{BGB`C=B3B.CRBGB8=q09.CRBGB`C B$BB`C{BGB7PJM.C B5B`C B$BB.CRBGBmg>y'8`CB B`CTrBMLBCTrB Bg>\z'o8CTrB B`C=B3B`CB BUg>z'8CTrB B.CTrBLB`C=B3B>==N.CTrBLB.C=BB`C=B3B>G0+HW.C؛B BCTrB B`CTrBMLB>$1GW.C؛B B`CTrBMLB.CB%B`3>Y' F5@.CB%B`CTrBMLB`CBB2>&3GWCTrB B.C؛B B.CTrBLB>bߝ;`CĞBmޝB`CۡBB\CۡBmޝBU>xX𾩤;\CۡBmޝB`CBB`CĞBmޝB>>_;\CۡBmޝB.CۡBM B`CBB>]VVU.CۡBM B.CB%B`CBB=ګ+)+7C:kB4B7C9BBdC:kBB;Fa*y'bgC6B%B.CjB%B.C:kBDTB; *Bu(7C6BBbgC6B%B.C:kBDTBحn)+7C6BB.C:kBDTBdC:kBB$ګ+)+7C6BBdC:kBB7C9BBφ#D7C؟BCB7CB谪BC؟B谪B i"-0dC:kBB.CtBB.C؟B^B3"ɩ07C:kB4BdC:kBB.C؟B^Bφ5"D7C:kB4B.C؟B^BC؟B谪B͆"7D7C:kB4BC؟B谪B7CB谪B$;//dC:kBB.C:kBDTB.CtBB:*t!!;C؟B谪B.CEiB谪B.CwԑBɜB)t!M;C؟B谪B.CwԑBɜB7C؟BCB>N7C؟BCB.CwԑBɜB7CwԑBB)Ht!x;C؟B谪B.C؟B^B.CEiB谪BY<@ZY.C B5B7C BB7C㫒BI|B)ҽj"D.C0BI|B.C B5B7C㫒BI|BσҽAj"D7C㫒BI|B.CwԑBɜB.C0BI|B9 eV7CwԑBB.CwԑBɜB7C㫒BI|B1>4:3K.CRBGB.C=BBC=BGB1>94KC=BGB.C B5B.CRBGBa1>=85KC=BGB7C=BNB.C B5B b<~/Mb7C=BNB7C BB.C B5B?>K'[7CIBGBC=BGB.C=BB?>L-[7CIBGB.C=BB7CTrBzB$>^nF7CTrBzB.C=BB.CTrBLB?>,[C=BGB7CIBGB7C=BNB> K.C؛B B.CB%BCB B->!KCB B.CTrBLB.C؛B BG>侥KCB B7CBG&B.CTrBLBw3>^7CBG&B7CTrBzB.CTrBLB>c e;[7CB BCB B.CB%B>;[7CB B.CB%B7CۡB%BX?Ib%H7CۡB%B.CB%B.CۡBM B >M?[CB B7CB B7CBG&B6 77C:kB4B^ȵC:kB^B^ȵC2BB`( +7C9BB7C:kB4B^ȵC2BB`( +^ȵC2BB7C6BB7C9BBb2^ȵC6B ,B7C6BB^ȵC2BBWxU Q7C؟BCB^ȵC؟BLPB^ȵCkyB谪B2*iB7CB谪B7C؟BCB^ȵCkyB谪B(>B^ȵCkyB谪B7C:kB4B7CB谪BcP!aK^ȵC:kB^B7C:kB4B^ȵCkyB谪BfNݾM]^ȵC؟BLPB7C؟BCB^ȵCwԑBBʚt^P^ȵCwԑBB7C؟BCB7CwԑBBB=v̾,i7C BB^ȵC BNB^ȵCXXBI|Bc\{X7C㫒BI|B7C BB^ȵCXXBI|B'\yzaX^ȵCXXBI|B7CwԑBB7C㫒BI|B[By̾i^ȵCwԑBB7CwԑBB^ȵCXXBI|B=|o^ȵC BNB7C BB^ȵC=B(Bi>$8\^ȵC=B(B7C BB7C=BNB>1s[7CTrBzB^ȵCTrBB^ȵCBGB޾>+ O7CIBGB7CTrBzB^ȵCBGBR>O^ȵCBGB7C=BNB7CIBGB}z>Ś/k^ȵC=B(B7C=BNB^ȵCBGB.>l^^ȵCTrBB7CTrBzB^ȵCB@Bu?M5I^ȵCB@B7CTrBzB7CBG&B\?[qcA7CB B7CۡB%B3DCۡB B?BVqA3DCۡB B7CBG&B7CB B?VYqA3DCۡB B^ȵCۡBB7CBG&BF ?p9T^ȵCۡBB^ȵCB@B7CBG&BK!KP`H,C:kBBH,C4BBC:kBBbI6 }H,C4BBH,C6B:B!C6B?!BAgI&H,C4BB!C6B?!BC:kBBoΥC:kBB!C6B?!BگC:kB?!BnGI$!C6B?!BC6BUBگC:kB?!B0}}:=C6BUBC:kBUBگC:kB?!B8L/lm?=C6BUBkC6B}BC:kBUBy`=%J>kC6B}BC:kB}BC:kBUBroq`>&>H,CBBH,C:kB xBC:kB}BvoQ`>>H,CBBC:kB}Bz'C6BB/{S==l>z'C6BBC:kB}BkC6B}BBC+ ?+㥾H,C؟B燶BH,C &BcB C؟BcBHU A\H,C &BcBH,CABBįC؟BBjs/o/[8| C؟BcBH,C &BcBįC؟BBCGO=H,CABBH,C:kBBC:kBBBGH,CABBC:kBBįC؟BBo| įC؟BBC:kBB߰C؟BB?ZniPC:kBBگC:kB?!B߰C؟BBz}GU9|=گC:kB?!BC؟B?!B߰C؟BB| =گC:kB?!BC:kBUBC؟B?!BSvJ<>C:kBUBdC؟BUBC؟B?!Bppa>>H,C.B}BH,C؟BBdC؟BUBp?^>>H,C.B}BdC؟BUBC:kB}Baz;C:kB}BdC؟BUBC:kBUBr>/>C:kB}BH,C:kB xBH,C.B}B,,PH,CB%BH,CBNB CwԑBNB%6*CwԑB%BH,CB%B CwԑBNB6D+=+䥾H,CBNBH,C؟B燶B C؟BcBA+@+奾H,CBNB C؟BcB CwԑBNBMkR& CwԑBNB C؟BcB`zCwԑBcB-Gmn C؟BcBįC؟BB`zCwԑBcB{kƾrkįC؟BBmCwԑBB`zCwԑBcBjMEƾ8įC؟BB߰C؟BBmCwԑBB>yg5 :>߰C؟BBCwԑBBmCwԑBB{}U<|=߰C؟BBC؟B?!BCwԑBBx:=.x>C؟B?!BOǯCwԑB?!BCwԑBB60vȦ8=z>C؟B?!BdC؟BUBOǯCwԑB?!BmN><>dC؟BUB>CwԑBUBOǯCwԑB?!BҦeP>">H,C؟BBH,CwԑB1B>CwԑBUBq>)8>dC؟BUBH,C؟BB>CwԑBUB%q6]) CwԑBNB!_C;B%BCwԑB%BEX"!_Cj.BNB!_C;B%B CwԑBNBκE `zCwԑBcB!_Cj.BNB CwԑBNB*Fj̾WA!_C͒BcB!_Cj.BNB`zCwԑBcB'j̾7jmCwԑBB!_C͒BcB`zCwԑBcB| #,!_CEBBC BB!_C B*B~oh>!_CEBBmCwԑBBC BB{<>mCwԑBBCwԑBBC BB9[x[x>CwԑBBOǯCwԑB?!BC BB4ol>䵸>OǯCwԑB?!B(C B?!BC BB]dH>=>H,CBUBH,C BB(C B?!BJdH>=>H,CBUB(C B?!B>CwԑBUB2m><>>CwԑBUB(C B?!BOǯCwԑB?!Be4I>.>>CwԑBUBH,CwԑB1BH,CBUBqr<]>nC=BB!_C B*BC BBkSμ>!_C=B[B!_C B*BnC=BBRZnQQ<5>C BB(C B?!BnC=BBd=>(C B?!BC=B?!BnC=BB N]/> >H,C BBH,C=B=uBC=B?!Bg=.>(C B?!BH,C BBC=B?!BzkSk=`>ACTrBB!_C=B[BnC=BBcɺn>!_CTrBB!_C=B[BACTrBBf_f=>nC=BBC=B?!BACTrBB[G >>C=B?!BCTrB?!BACTrBB S1*>U ?H,C=B=uBH,CTrB&yBCTrB?!BE^ >&`>C=B?!BH,C=B=uBCTrB?!Bbz =>|CBB!_CTrBBACTrBBi]5=b?!_CBtB!_CTrBB|CBB*EJGJ>`?H,C YB?!BH,CBsXB|CBBFJ=0?H,C YB?!B|CBBCTrB?!B\==k>CTrB?!B|CBBACTrBBLQguQ>*} ?CTrB?!BH,CTrB&yBH,C YB?!BGZY1>a>(CۡBB!_CBtB|CBBPW=o?!_CۡBB!_CBtB(CۡBBu(?,tZ>EH!?H,CBsXBH,CۡBBB(CۡBB Kq%>?|CBBH,CBsXB(CۡBB^#%ԾpC:kB>ٶBpC=BcBݰC:kBcBԫ$bpC=BcBpCYBB&QC:kBB!k$3ݾݰC:kBcBpC=BcB&QC:kBBK 'b~C6BBH,C4BBH,C:kBB*/~ 6pC6BpZB~C6BBH,C:kBB?5#pC6BpZBH,C:kBB&QC:kBB!pC6BpZB&QC:kBBpCYBBeI~C6BBH,C6B:BH,C4BB%qo}`>.>H,CBBWC:kBBH,C:kB xB1X޾pC؟BȱBpC BNBC؟BNBG)ot,SݰC:kBcBH,C &BcBH,C؟B燶B o*%_оpC:kB>ٶBݰC:kBcBH,C؟B燶B+#, 㾾pC:kB>ٶBH,C؟B燶BC؟BNBm0pC:kB>ٶBC؟BNBpC BNB!l$ ݾ&QC:kBBH,C &BcBݰC:kBcB3H u`H,CABBH,C &BcB&QC:kBB>Ge {#&QC:kBBH,C:kBBH,CABBSpa>>H,C.B}B:C؟B}BH,C؟BBrC>:>H,C:kB xB:C؟B}BH,C.B}B0rŴ>>H,C:kB xBWC:kBB:C؟B}BSdn>;>WC:kBBBC؟BB:C؟B}Bsq19޾C؟BNBpC B%BpC؟BȱB1l޾C؟BNBH,CBNBpC B%BKEJH,CBNBH,CB%BpC B%Bo8C؟BNBH,C؟B燶BH,CBNBll>nN>mCwԑB}BH,C؟BB:C؟B}BȣemP>>H,CwԑB1BH,C؟BBmCwԑB}Bee> >:C؟B}BBC؟BBmCwԑB}BPY͚>3h>BC؟BBװCwԑBBmCwԑB}BDdoH>A>H,CBUBAC BUBH,C BBe7I>1>H,CwԑB1BAC BUBH,CBUBeq;I> :>H,CwԑB1BmCwԑB}BAC BUB\נ>>mCwԑB}B窰C B}BAC BUBaOk>">pC#-BBpC BB窰C B}BVaO6>i>pC#-BB窰C B}BװCwԑBB\נ>>װCwԑBB窰C B}BmCwԑB}B*dH>A>mC=BUBH,C BBAC BUBTL] /> >H,C=B=uBH,C BBmC=BUBH'՜>  ?pCN-B}BpC=B,BmC=BUB H> ?pCN-B}BmC=BUB窰C B}BY_oC>U>窰C B}BmC=BUBAC BUBaO>>窰C B}BpC BBpCN-B}BZkh>^C>~CTrBUBH,C=B=uBmC=BUBO S0*> ?H,CTrB&yBH,C=B=uB~CTrBUB|4> >f?pC=B,BpCTrBB~CTrBUBNZ> ?mC=BUBpC=B,B~CTrBUBUDJ"IJ>b?H,C YB?!B&QCB?!BH,CBsXBiy;|>@?&QCB?!BpCBUBpCBNBA4A>H?H,C YB?!BpCBUB&QCB?!BE>_| ?H,C YB?!BH,CTrB&yB~CTrBUB<&R>h?~CTrBUBpCTrBBpCBUBHPz>?BCۡB?!BH,CBsXB&QCB?!B5&?ewZ>J!?H,CۡBBBH,CBsXBBCۡB?!Bh->c*?pCBNBpCۡBBBCۡB?!B?o>?&QCB?!BpCBNBBCۡB?!Bp侑l;ƱC:kB6سBƱCBNBgC:kBNBXX?UpC:kB>ٶBgC:kBNBƱCBNBt?pC:kB>ٶBƱCBNBpC=BcB5RupC=BcBƱCBNBƱCʈBcBm) k C6BBƱCʈBcBƱC6B8B4'dD k C6BBpCYBBƱCʈBcBC5+pCYBBpC=BcBƱCʈBcB :*$!k C6BBpC6BpZBpCYBB @gC:kBNBpC BNBpC؟BȱB ݾ@ƱC:kB6سBgC:kBNBpC؟BȱBھ=F@5ƱC:kB6سBpC؟BȱB,C؟B%Be̾@ ƱC:kB6سB,C؟B%BƱCXB%B;X?gC:kBNBpC:kB>ٶBpC BNB/OҾEe,C؟B%BpC؟BȱBpC B%B _O1>>pC#-BB'C BBpC BBH$ڜ>n ?pCN-B}B C=B}BpC=B,BKcO>g>pC BB C=B}BpCN-B}B^Ov>t>pC BB'C BB C=B}B @E>o ?'C BBC=BB C=B}BH"> ?.KCTrB}BpC=B,B C=B}B%1>* >?pCTrBBpC=B,B.KCTrB}B)2>?ƱCؙBBƱCTrBB.KCTrB}B(2n>?ƱCؙBB.KCTrB}BC=BBN%FΚ>:k?C=BB.KCTrB}B C=B}B =>?pCBUBCBUBpCBNB +>>r?pCTrBBCBUBpCBUB9m?pCTrBB.KCTrB}BCBUB4W>Ee?.KCTrB}BCB}BCBUB'g~>'?ƱCTrBBƱCBBCB}B5Y>b?.KCTrB}BƱCTrBBCB}Bɤ:>?5[CۡBUBpCBNBCBUB9- ¡>c*?pCۡBBpCBNB5[CۡBUB&,3> &?ƱCHB}BƱCۡBiB5[CۡBUB/&6>&?ƱCHB}B5[CۡBUBCB}B֫5`\>?CB}B5[CۡBUBCBUB&6><&?CB}BƱCBBƱCHB}B:Ǿ\9f3ƱC:kB6سBC:kBBCWBNBѾ*?ZeƱCBNBƱC:kB6سBCWBNB־9Mi \C6BcBCWBNBC6BoϵB־R9i \C6BcBƱCʈBcBCWBNBwϾ|=hƱCʈBcBƱCBNBCWBNBѾ E5iK\C6BcBƱC6B8BƱCʈBcB9O6C| C7؋B%BƱC:kB6سBƱCXB%B?Ǿ95C:kBBƱC:kB6سBC7؋B%B)2>?ƱCؙBBCTrBBƱCTrBB#k.u>?~CBBƱCTrBBCTrBB2_&>K)?ƱCBBƱCTrBB~CBB> .?ƱCHB}B^4CۡB}BƱCۡBiB|vM>*?^4CۡB}BC/ BBCۡBGB,!D^><&?ƱCHB}BC/ BB^4CۡB}B >%?ƱCHB}B~CBBC/ BBc%͇>(?ƱCHB}BƱCBB~CBB˽K:_C6BNBCWBNBC:kBB˫:v`C6BBC6BNBC:kBB}fF:/@`C6BBC:kBB̲C:kB%B+9`C6BB̲C:kB%B`CJB%B?þS=- C6BNBC6BoϵBCWBNB씶v~5?C/ BB:CۡBBCۡBGB::9~.CjB%B`C6BB`CJB%B,?43 .C6B䧱B`C6BB.CjB%BVJ4bgC6B%B.C6B䧱B.CjB%B5ue>g7>z'C6BBH,C6B%BH,CBB)1ue>7>H,C6B%BWC:kBBH,CBBI1ue>7>H,C6B%BMC6BBWC:kBB g>s>MC6BBC:kBBWC:kBB g>s>MC6BB C6BZ(BC:kBBGXx>O> C6BZ(B8C:kBZ(BC:kBBHv>\M>pCB\BpC:kBfB8C:kBZ(BaHO>S>pCB\B8C:kBZ(BڰC6B\B4}[+>N>ڰC6B\B8C:kBZ(B C6BZ(BFg>>ڰC6B\BpC6B;BpCB\Bk>}>WC:kBBC:kBBBC؟BB*Sa>C*>C:kBBC؟BBBC؟BBM>>pCKBZ(BpC؟BBC؟BBӱM>Ǫ>pCKBZ(BC؟BB8C:kBZ(B=X>I>8C:kBZ(BC؟BBC:kBBL>>8C:kBZ(BpC:kBfBpCKBZ(BK¸>x>pCBBpCwԑB BװCwԑBB&K[>L]>pCBBװCwԑBBC؟BBZax>>C؟BBװCwԑBBBC؟BBBT-*>t!>C؟BBpC؟BBpCBBOaO0>>װCwԑBBpCwԑB BpC#-BBH>S>pCB\BXC:kB\BpC:kBfBq;?m>XC:kB\BƱCBBƱC:kB BA@>!>pCB\BƱCBBXC:kB\B0?0q?c>pCB\B.KC6BBƱCBBFg>>pCB\BpC6B;B.KC6BB9%> >.KC6BBƱC6B؁BƱCBB"M)>>pCKBZ(Bj^C؟BZ(BpC؟BB_;M%>`>j^C؟BZ(BƱCB\BƱC؟BӲBE!>th>pCKBZ(BƱCB\Bj^C؟BZ(B8B?>pCKBZ(BXC:kB\BƱCB\BL>w>pCKBZ(BpC:kBfBXC:kB\B->XC:kB\BƱC:kB BƱCB\BKaĸ>Dz>pCBBTCwԑBBpCwԑB BW<>t>TCwԑBBƱC:BZ(BƱCwԑB4ByID>?pCBBƱC:BZ(BTCwԑBBG;>>pCBBj^C؟BZ(BƱC:BZ(B7TH?>8>pCBBpC؟BBj^C؟BZ(B>q>oi>j^C؟BZ(BƱC؟BӲBƱC:BZ(B5_OR>h>pCwԑB B'C BBpC#-BB`O>>pCwԑB BTCwԑBB'C BB{] ?TCwԑBBC BB'C BB7-vC>?ƱCwԑB4BƱC B BC BBvmB>R?TCwԑBBƱCwԑB4BC BB=0>v?ƱC(BBƱC=B6BC=BB80Z>x?ƱC(BBC=BBC BB&> '>I?C BBC=BB'C BB9V11>?C BBƱC B BƱC(BBV3'>?C=BBƱC=B6BƱCؙBBٍ;R?Ug>ƱCBB9رC:kBBƱC:kB BǑ9">>ƱC6B؁B9رC:kBBƱCBB95+>>ƱC6B؁BѱC6B6B9رC:kBBv)?j> ?ѱC6B6BC:kB6B9رC:kBB>Ed?B?C|cBBC:kB BC:kB6BPZ??C|cBBC:kB6BC6BB9w/*?= ?C6BBC:kB6BѱC6B6Bl??C6BBC6B'BC|cBB؞;>Y[>ƱCB\BC؟B\BƱC؟BӲBqͣ?K ?C؟B\BC☎BBC؟BGBl,;>z3?ƱCB\BC☎BBC؟B\B T?f?ƱCB\B9رC:kBBC☎BB>ƱCB\BƱC:kB B9رC:kBB)1?i?9رC:kBBC:kB6BCu~B6B]s?q ?C☎BB9رC:kBBCu~B6BIP??C:kB6BC:kB BCu~B6BϢ<>2l>ƱC:BZ(BޱCwԑBZ(BƱCwԑB4B>m>e>ƱC؟BӲBޱCwԑBZ(BƱC:BZ(B>l>c>ƱC؟BӲBC؟B\BޱCwԑBZ(B#'?i ?C؟B\BCwԑB\BޱCwԑBZ(B X ?$?C؟BGBCwԑBىBCwԑB\B^$1??C؟B\BC؟BGBCwԑB\B\7 ?>nC BZ(BƱCwԑB4BޱCwԑBZ(BV-:>?ƱC B BƱCwԑB4BnC BZ(B@/?p?CB\BC BλBnC BZ(B6е?-?CB\BnC BZ(BCwԑB\B`- >P?CwԑB\BnC BZ(BޱCwԑBZ(B?`?CwԑB\BCwԑBىBCB\B>0l>4u?ƱC(BB>C=BBƱC=B6Bg/>0?>C=BBCɕBZ(BC=BGBƻ.>E?ƱC(BBCɕBZ(B>C=BB&~(? -?ƱC(BBnC BZ(BCɕBZ(B9^1(>?ƱC(BBƱC B BnC BZ(B->W1?nC BZ(BC BλBCɕBZ(B">^"?CTrBBC+BBCTrBWB,1>/M#?ƱCؙBBC+BBCTrBB}u'C>?ƱCؙBB>C=BBC+BBW3&>?ƱCؙBBƱC=B6B>C=BBA">"?>C=BBC=BGBC+BB $S>Ϩ&?CTrBWBCBtB~CBB%$>1%?CTrBBCTrBWB~CBBD!A>#?~CBBCBtBC/ BBae?h?C:kB B`C BB`C:kBB?h?C|cBB`C BBC:kB BW[3?X7?`C BBC|cBBC6B'B\#5?#5?`C6BIB`C BBC6B'Bl^??C☎BBC؟BBC؟BGB`k-?@,?C؟BB`C?B6B`C؟B fB p??C؟BBC☎BB`C?B6B~r??C☎BBCu~B6B`C?B6Bm4l?ݥ?`C?B6BCu~B6BC:kB B_e?e?`C:kBB`C?B6BC:kB B) ?C`?`CBBC؟BGBC؟BBc ;!?O^?`CBB`CwԑBqBC؟BGB= ??`CwԑBqBCwԑBىBC؟BGBc> h)?~w?C؟BB`C؟B fB`CBBl7??CB\BxAC B\BC BλB,8??xAC B\BCB\BCwԑBىB88?H?xAC B\BCwԑBىB`C BBUG| ?"?`C BBCwԑBىB`CwԑBqB9>L& ?CɕBZ(B C=BZ(BC=BGBlb5X>4 ? C=BZ(B`C~B\B`C=BQoB>$]!?CɕBZ(B`C~B\B C=BZ(B y,>!?CɕBZ(BxAC B\B`C~B\Bqη>!?CɕBZ(BC BλBxAC B\Bmt>!?xAC B\B`C BB`C~B\B{މ>v&?C+BBϲCTrBBCTrBWB&V=>ȟ$?ϲCTrBB`CBZ(B`CTrBBۢ>$?C+BB`CBZ(BϲCTrBB2TC>@V$?C+BB C=BZ(B`CBZ(BYF!SD>d#?C+BBC=BGB C=BZ(Bi>֣!? C=BZ(B`C=BQoB`CBZ(B<>c#?`CHBBCTrBWBϲCTrBBm >#?`CHBB`CB5BCTrBWB??Yt>e2?`CB5BCBtBCTrBWB>#?ϲCTrBB`CTrBB`CHBBt>5?:CۡBBC/ BBCBtBtϐ>Ђ5?:CۡBBCBtB`CۡB,BT ?)?`CۡB,BCBtB`CB5B2ƾ&?&?`C BBeC:kBB`C:kBBiȾG#?!)?eC:kBB.CկBt/B.C:kBBľ:%?(?`C BB.CկBt/BeC:kBB&¾.'?'?`C BBC6Bt/B.CկBt/B}93(?3(?`C BB`C6BIBC6Bt/B˿&%?{*?C6Bt/B.C6BB.CկBt/B7׾4$?/3$?`C?B6BC؟B6B`C؟B fBݾ%?s(?C؟B6B.C_ BB.C؟BBmԾ|#"?0'?`C?B6B.C_ BBC؟B6B+о$?v%?`C?B6BeC:kBB.C_ BB2ƾ&?&?`C?B6B`C:kBBeC:kBB˾ ?_+?eC:kBB.C:kBB.C_ BB"H?/'?`CBBlCwԑBB`CwԑBqBEw?*?lCwԑBB.CB6B.CwԑBB徔?x$)?`CBB.CB6BlCwԑBB6[?(?`CBBC؟B6B.CB6B}޾F?)?`CBB`C؟B fBC؟B6BO?J+?C؟B6B.C؟BB.CB6BKQ?i2?.CxBB`CwԑBqBlCwԑBBJM8?l2?.CxBB.C Bm1B`CwԑBqB.@ ?ϝ,?.C Bm1B`C BB`CwԑBqBQ?i2?lCwԑBB.CwԑBB.CxBBĵ?ҝ/?`C~B\BuC=B\B`C=BQoBݶ?ߛ/?uC=B\B`C~B\B`C BB!?/?uC=B\B`C BB.C=BBee?81?.C=BB`C BB.C Bm1BKf@e?`1?`CBZ(BCTrBZ(B`CTrBB 0o?0?CTrBZ(B.CB\B.CTrBQoB 0.?2f0?`CBZ(B.CB\BCTrBZ(B//?f0?`CBZ(BuC=B\B.CB\Bn?0?`CBZ(B`C=BQoBuC=B\B?̛/?uC=B\B.C=BB.CB\Bt?2?`CHBByCBB`CB5B#X ?t0?yCBB.CBZ(B.CB5B~?;1?`CHBB.CBZ(ByCBB+?T#1?`CHBBCTrBZ(B.CBZ(BRo?0?`CHBB`CTrBBCTrBZ(B9~h?".?CTrBZ(B.CTrBQoB.CBZ(B?A)?.CߠBB`CB5ByCBBÿ?@)?.CߠBB.CۡBWB`CB5BIؾ? 6?.CۡBWB`CۡB,B`CB5Bq?B)?yCBB.CB5B.CߠBBoju*?0?.C:kBB7CBt/B7C:kBIBi*?0?.CկBt/B7CBt/B.C:kBBNh*?0?7CBt/B.CկBt/B.C6BBi]*?>0?7C6BCB7CBt/B.C6BBi!?4?.C؟BB7CBB7C؟BlBMYA&?V1?.C_ BB7CBB.C؟BBsA&?V1?7CBB.C_ BB.C:kBBl"?6?7C:kBIB7CBB.C:kBB?{g2?.CB6BCwԑB6B.CwԑBB2$?f2?CwԑB6B.CB6B.C؟BB?eg2?CwԑB6B.C؟BB7CwԑBLB_)?b(:?7CwԑBLB.C؟BB7C؟BlBZƾ`?J;?.CxBBP[C BB.C Bm1B%CȾ\ ?{4= ;lsCJBq{B7C-3Bq{B^ȵC+DB37uB^"n@J&97C-3Bq{B7CB37uB^ȵC+DB37uB?^ȵCBƦ[B^ȵCBzaBCBzaB#fIJ٬CKBdhB7CBdhB7CBbB"I'3^ȵCKB7gB٬CKBdhB7CBbBAI ;^ȵCKB7gB7CBbBCBzaB*ûI!^ȵCKB7gBCBzaB^ȵCBzaBN{菾v=CKBnB7CBdhB٬CKBdhBE\Do7CBnB7CBdhBv=CKBnB}iBHQv=CKBnB7CKBCRsB7CBnBAxt4u4!_C0BBH,C0B ;BH,C ֣B/uBAxu4u4!_C"B/uB!_C0BBH,C ֣B/uB=c+d=!_CDB-`BH,CDBZSBH,C?B@B(Ã3\6!_C`B@B!_CDB-`BH,C?B@By>3]6H,C?B@B!_C0BB!_C`B@B +o<=H,C0B ;B!_C0BBH,C?B@BR=[WH!_CnyBkBH,CnyB>ҐBH,C/B Ba=,O;!_C˪B B!_CnyBkBH,C/B B=~,;H,C/B B!_CDB-`B!_C˪B BIėIH,CDBZSB!_CDB-`BH,C/B B\=[SH,CnyB>ҐB!_CnyBkBH,C B㪎B|D>>|DH,C B㪎B!_CnyBkB!_C BݍBߩ>¾Q!_CBBH,CBxЌBH,CBS׍BS>߼=G!_CʶBS׍B!_CBBH,CBS׍BT>eyGH,CBS׍B!_C BݍB!_CʶBS׍BCX>sCXH,C B㪎B!_C BݍBH,CBS׍B@>"_uA!_CIBB!_CJB4BدCJBB]@>~^AدCJBB!_CBB!_CIBBVA>^sAدCJBBH,CJBriB!_CBBO>T[H,CJBriBH,CBxЌB!_CBBiq>܄TH,CDBBدCJBB!_CJB4Bp>ۄ5TH,CDBB!_CJB4BH,CKBiBj?]ƳJ?H,CKBiB!_CJB4B!_CKBBq>܄֔TدCJBBH,CDBBH,CJBriBH '?RqQ8!_CJ BnB!_CBEBCBnB '?q+Q8CBnB!_CKBB!_CJ BnB '?qR8CBnBH,CBۉB!_CKBB+?<} JH,CBۉBH,CKBiB!_CKBB=T)>H,C0B ;BpC0BBpCB/uB(=44H,C ֣B/uBH,C0B ;BpCB/uBv>{}DH,CDBZSBpCDB8BpC;ާB@BB>w*4x*gDH,C/B BH,CnyB>ҐB_CnyB Bl]>D_CnyB BH,CDBZSBH,C/B BR]>qD_CnyB BpCnyB BH,CDBZSB\\>T&{PpCnyB BpCDB8BH,CDBZSBv>#yi[pCDB B_CnyB BH,CnyB>ҐB.v>5i[pCDB BH,CnyB>ҐBpC BB6>NHpC BBH,CnyB>ҐBH,C B㪎Bv>! #i[_CnyB BpCDB BpCnyB B>⾷DH,CBS׍BH,CBxЌBCBS׍B9> ⾾DCBS׍BH,C B㪎BH,CBS׍B>ͦDCBS׍BpCBĎBH,C B㪎B@A>b]pCBĎBpC BBH,C B㪎B?7SpCٴBS׍BCBS׍BH,CBxЌB?8SpCٴBS׍BH,CBxЌBpCJBčBh?EݗBpCJBčBH,CBxЌBH,CJBriBĵ?7SCBS׍BpCٴBS׍BpCBĎB)?tMer7H,CDBBH,CKBiB;CKBBv)?Ne"r7;CKBBH,CJBriBH,CDBBc)?NeUq7;CKBBpCKB]BH,CJBriB?LͽKLMpCKB]BpCJBčBH,CJBriBml,? ;]CBB;CKBBH,CKBiB3?'3H,CBۉB]CBBH,CKBiB`,??B*pCKB]B]CBBpCB\B-n,? $ ;;CKBB]CBBpCKB]BaG>SaGpC0BBƱC0B!UBƱCQB/uBG7>'7}=pC;ާB@BpCDB8B,CDB@B>Q}=,CDB@BpC0BBpC;ާB@B>K}=,CDB@BƱCDB:BpC0BBMQ>| OQƱCDB:BƱC0B!UBpC0BB>>ܾVƱC)B@B,CDB@BpCDB8B>]ܾVƱC)B@BpCDB8BƱCnyBwB<4>r>ƱCnyBwBpCDB8BpCnyB B0>ݲܾzV,CDB@BƱC)B@BƱCDB:B30 ?ʾ>pCDB BpC BBTC B BF0 ?ʾ>TC B BpCnyB BpCDB B0 ?gʾ(>TC B BƱC BRBpCnyB BZ>QƱC BRBƱCnyBwBpCnyB B?U(IxCB BTC B BpC BB-?x?pCBĎBxCB BpC BB?=s{BƱC BRBxCB BƱCBwRBd?(ITC B BxCB BƱC BRB]-?C`l3pCٴBS׍BpCJBčBgCJBS׍B81?ͽS6gCJBS׍BƱCJBߐBƱC*سB BO/(? Y79pCٴBS׍BgCJBS׍BƱC*سB B#.?z8pCٴBS׍BƱC*سB BxCB B?ws{BpCٴBS׍BxCB BpCBĎB?߽GxCB BƱC*سB BƱCBwRBp1?V\47CKBS׍BgCJBS׍BpCJBčBP4?5QP4pCKB]BCKBS׍BpCJBčB,@?l<(ƱCJBߐBCKBS׍BƱCKBB8v1?a/7gCJBS׍BCKBS׍BƱCJBߐB5?5<5CBS׍BCKBS׍BpCKB]B+?? 5D*pCB\BCBS׍BpCKB]B)??ֿ='ƱCKBB±CB BƱCB B??ҿ=w'ƱCKBBCKBS׍B±CB B?K?WKL%BƱCQB/uBƱC0B!UB۱C0B/uB!}>YǾK\CpB/uB۱C0B/uBƱC0B!UB>ǾL\CpB/uBƱC0B!UBCDBB>>@CDBBƱC0B!UBƱCDB:B ?ž?ƱC)B@BƱCnyBwBCnyB@B ?žԾ?CnyB@BƱCDB:BƱC)B@B& ?ž?CnyB@BCnyBIBƱCDB:B>]RCnyBIBCDBBƱCDB:B?^J*QC B@BCnyB@BƱCnyBwBs#?`7ƱC BRB*QC B@BƱCnyBwB(?%<*QC B@BCB@BC B-B!4?}ʽ!4ƱC*سB BƱCJBߐBѱCJB B"4?Τʽ[ 4ƱCBwRBƱC*سB BѱCJB B!4?ʽl!4ƱCBwRBѱCJB BCB@BZ@? @(CB@BѱCJB BSCJB@BdQ?ZECB]BSCJB@BCJBBF?Fum!CB@BSCJB@BCB]B4?<4g˱CKB BѱCJB BƱCJBߐB@?cf<(ƱCKBBg˱CKB BƱCJBߐB"@?ۓ<(ѱCJB Bg˱CKB BSCJB@BzG?==SCJB@Bg˱CKB BnCKB@B U?s=K CJBBnCKB@BCKB@!BP?C=SCJB@BnCKB@BCJBB??pؿ=4'g˱CKB BƱCKBBƱCB B#LM?%O=ƱCB BƱCBp}BkHCB@B(LM?N= ƱCB BkHCB@Bg˱CKB BF?>g˱CKB BkHCB@BnCKB@ByW?,>#PCKB@!BkHCB@BCB/BZpS?e> nCKB@BkHCB@BCKB@!BCZ?d`$HCpB/uBCDBBbCDB/uB ?~CRHCnyB/uBbCDB/uBCDBBF'?is5CnyBIBHCnyB/uBCDBB3H,?:%C B/uBHCnyB/uBCnyBIB|2?؇-2C B-B%C B/uBCnyBIBI5?n45(CB/uB%C B/uBC B-Bc_E?:$\ CB]B(CB/uBC B-B)F?=*!CJB/uB(CB/uBCB]BjQ?Z=CJBBCJB/uBCB]B.O?> CKB/uBCJB/uBCJBBU?m=" CKB@!BCKB/uBCJBB R?D> oŲCB/uBCKB/uBCKB@!BU|W?J,>LCB/BoŲCB/uBCKB@!BsWY#7C-3Bq{B7C[3BByCKBBN>)Y CKBq{B7C-3Bq{ByCKBBJrkƾt=7C[3BB7CBv9BϴCKBv9BW!>yCKBB7C[3BBϴCKBv9BeQos>7CBv9B7CKB$ņBϴCKBv9Be i޾1CKBq{ByCKBBUYCBq{Bmt!T=yCKBBlCBBUYCBq{Bqj&5>yCKBBϴCKBv9BlCBBq9D4 >ϴCKBv9BDCBv9BlCBB v?Y׽'>7CKB$ņB7C8BnBCBnB[ v6R׽跂>7CKB$ņBCBnBϴCKBv9BlB@t>ϴCKBv9BCBnBDCBv9BajĽL>7C8BnB7CB‡BCBnBW0S0pg^ȵCBgB^ȵCBv9BTCBv9BNDPUp'ֽ^ȵCBv9B^ȵC~BnBCBnBR44zTCBv9B^ȵCBv9BCBnBjk=^ȵC~BnB^ȵCұBBƵCBB N(A'>CBnB^ȵC~BnBƵCBBUf ~t>^ȵCұBB^ȵCBغBƵCBB..q:^ȵCóBq{B^ȵCŏBB}&CJBBh.`.K;lsCJBq{B^ȵCóBq{B}&CJBBV0U0ng^ȵCŏBB^ȵCBgBTCBv9BV0U0ng^ȵCŏBBTCBv9B}&CJBB}T}&CJBBTCBv9B}&CJBv9BSV垽TCBv9BCBnB}&CJBv9B)fIAؾ=CBnBCBnBƵCBBƵCBBCJBB^ȵCBغB^ȵCJBBCJBBl n{>ƵCBB^ȵCBغBCJBBS8#}&CJBB7C-3Bq{BlsCJBq{BW}#7C[3BB7C-3Bq{B}&CJBBZ5}&CJBv9B7C[3BB}&CJBB7sk4ƾb}t=7CBv9B7C[3BB}&CJBv9BgeP ms>7CBv9BoCKBnB7CKB$ņB eMjs>7CBv9B}&CJBv9BoCKBnB vxG=}&CJBv9BCJBB0`CKBBoCKBnB+aG1>^ȵCJBB^ȵCKBB0`CKBBmhT.1>CJBB^ȵCJBB0`CKBB vH׽>oCKBnB7C8BnB7CKB$ņB>aĽ>7C8BnB\CBB7CB‡Ba Ľ!>7C8BnBoCKBnB\CBBPjUj2>oCKBnB0`CKBB\CBBwS|=>?^ȵCKBB^ȵCB"B\CBBHb{a/>0`CKBB^ȵCKBB\CBB/<=~+H,C ֣B/uB!_CۡBB!_C"B/uBaн621H,CۡBB!_CۡBBH,C ֣B/uBY04?&?!_CBBH,C$B%BH,CB&B~=?M/4?!_CzȸB%BH,C$B%B!_CBB=+=771pCB/uBH,CۡBBH,C ֣B/uB#?ټz3*$?pCۡBbBH,CۡBBpCB/uB+RK??H,CB&BpCzB%BpCBnBHDn8?K*?H,C$B%BpCzB%BH,CB&BF7>'<ƱCQB/uBpCۡBbBpCB/uBE=<EJƱCۡBjəBpCۡBbBƱCQB/uBG'B۱C0B/uBƱCۡBjəBƱCQB/uB>X'6B۱C0B/uBC0B܈BƱCۡBjəBG>-TC0B܈BCۡBBƱCۡBjəB~>hǾ\۱C0B/uBCpB/uBC0B܈B>Y?6?ƱCBjBCnӺB%BCBBW>dR?8K ?ƱCz`B%BCnӺB%BƱCBjBdz>A۾ U`C۾ U`CiE`C0B۾ UCۡBΩB`C$Y`CDB/B`C0B0!`CJBpBCKB/uB`CKBpB)Z?`]>CJB/uBCKB/uB`CJBpBX?s>ͽ`CKBpB8/CBΩB`C⽸BΩB״X?s>`CKBpBCKB/uB8/CBΩBQ^?P>k径CKB/uBoŲCB/uB8/CBΩBTd?m>h`C⽸BΩB8/CBΩB`CB뀜BQ>]Z?޾>`CB1BK;CBB`C:BBFi>'L?v>CBB`C:BBK;CBB2e>*L?o>CBBCnӺB%B`C:BB Ѣ>cY?a>CnӺB%B`CB%B`C:BB?t6`C.C BEBu,CBmޝB.CñBmޝB:P?)> .C BEBɳC BΩBu,CBmޝB'[?= ɳC BΩBCBΩBu,CBmޝB1[?T2>ְ.CñBmޝBu,CBmޝB.CBB\R?Z>V bCJBΩBCBΩB`CB)ØBZ?=o`CJBpBbCJBΩB`CB)ØBY?>vKCBΩBbCJBΩBu,CBmޝBb]?RO>m8u,CBmޝBbCJBΩB_CJBmޝBb?'U>Ծ.CBB_CJBmޝB.CJBhBZ?M>su,CBmޝB_CJBmޝB.CBBQY?[">$hCKBΩBbCJBΩB`CJBpBM\?> `CKBpBhCKBΩB`CJBpB _?E'>bCJBΩBhCKBΩB_CJBmޝBˣb?p>jd;_CJBmޝBhCKBΩBųCKBmޝB1^?xґ>Rо.CJBhB9CKB B.CMB B2^?3ґ>oQо.CJBhB_CJBmޝB9CKB BNf?ct>I_CJBmޝBųCKBmޝB9CKB B=0f?q>t.CMB B9CKB B.CKBB/>`S?>.CKBBCKB%B.CGŷB%BZX?s>hCKBΩB`CKBpB`C⽸BΩBeSd?p>`C⽸BΩB`CB뀜BąCBmޝBQd?u>`C⽸BΩBąCBmޝBhCKBΩBD`?a,>>˾hCKBΩBąCBmޝBųCKBmޝBc?Ld>7ųCKBmޝBąCBmޝB9CKB Bc?{>҅9CKB BąCBmޝBxCB BJPR??>&.CKBB$CBGB.C:BGBOR?>*.CKBB9CKB B$CBGBf?>W;9CKB BxCB B$CBGBD? #?^\.C:BGBQܳCBI|B.CBI|B[??[=$CBGBQܳCBI|B.C:BGB0$?_wC?W%5=.CBI|BCB谪B.C*ƹB谪BA? ?Hv:>QܳCBI|BCB谪B.CBI|BE0? {;?_x>`CB1B.C*ƹB谪BCB谪B1?y;?#|>`CB1B`C:BB.C*ƹB谪B+ ?4K?W>`C:BB.C0BB.C*ƹB谪B2>ĝS?,>CKB%B.CKBB.C0BB>S?L>CKB%B.C0BB`CB%Bho ?T@?T>`CB%B.C0BB`C:BB?<=.C^BmޝB.C0B7BXtC0BmޝB?==XtC0BmޝB.CۡBM B.C^BmޝB?t<=XtC0BmޝB7C0BB.CۡBM BE ?<9T7C0BB7CۡB%B.CۡBM BEy$?JFBԏCDBmޝBXtC0BmޝB.C0B7Br3?_r3.CDBYWBԏCDBmޝB.C0B7B@?o<(7C0BBԏCDBmޝB7CDBSɟBKy$?QFBXtC0BmޝBԏCDBmޝB7C0BBz4?,=z4dyCnyBmޝBԏCDBmޝB.CDBYWB0H?i!c%7CDBSɟBdyCnyBmޝB7CnyBB@?>=(ԏCDBmޝBdyCnyBmޝB7CDBSɟBjF?i>T !VC BmޝBdyCnyBmޝB.CnyBRdBQ?=gM.C BEB!VC BmޝB.CnyBRdBM_F?z,_>7CnyBBܴC B B7CB BUaF?+_> 7CnyBBdyCnyBmޝBܴC B BS?>7 dyCnyBmޝB!VC BmޝBܴC B BQ?*k>b7CB BܴC B B7C B,ѡBP?s)>o!VC BmޝB.C BEB.CñBmޝB[?B2>(.CñBmޝB.CBB۟CB B[?҃2>+.CñBmޝB۟CB B!VC BmޝBO?v>Q!VC BmޝB۟CB BܴC B BPX?։>7C B,ѡB۟CB B7CB@BQ?Ux>ܴC B B۟CB B7C B,ѡBV?nj>X\CJB B۟CB B.CBBȱb?ΰU>4Ծ.CJBhB\CJB B.CBBR?>b7CB@BCJBGB7Cd7CB@B۟CB BCJBGBi_?e>wʾ۟CB B\CJB BCJBGB]?B>b7CDOо\CJB B.CJBhB.CMB B51f?>q.CMB B.CKBBbCKBGB1f?G>q.CMB BbCKBGB\CJB BHY?Q>bAž\CJB BbCKBGBCJBGB[L?..?7CJBB6CKBI|B7CXqBI|BwL?.?7CJBBCJBGB6CKBI|B:h?>* CJBGBbCKBGB6CKBI|B=?%?R57CXqBI|BCKB谪B7C\RB谪Bw|W?y ?Tt׼6CKBI|BCKB谪B7CXqBI|B)?>?q=7C\RB谪B [CKBB7CSBB,=?c%?57>CKB谪B [CKBB7C\RB谪Bq$?8?>>.CKBB7CSBB [CKBBq$?)8?\>.CKBB.CGŷB%B7CSBB?TK?*s%>.CGŷB%B7CjB%B7CSBBOR?>'bCKBGB.CKBB.C:BGBY?K?6CKBI|BbCKBGB.C:BGBoD?g #?n\.CBI|B6CKBI|B.C:BGB>E?<#?żCKB谪B6CKBI|B.CBI|B_4?4?'=.C*ƹB谪BCKB谪B.CBI|B*o2?n2?x,> [CKBBCKB谪B.C*ƹB谪B5'?߃;?;G>.C0BB [CKBB.C*ƹB谪Bvr$?8?Z> [CKBB.C0BB.CKBB.!?hf]FVC0B B3DCۡB B7CۡB%B/3?337C0BBVC0B B7CۡB%B )9?H%=z0^ȵCۡBBVC0B B^ȵC0BB,!?jf^F3DCۡB BVC0B B^ȵCۡBB4?r=4WCCDB BVC0B B7C0BB@?<(7CDBSɟBWCCDB B7C0BBlG?>u^ȵC0BBWCCDB B^ȵCDB,B8?夊=70VC0B BWCCDB B^ȵC0BB>?W&>:V&vCnyB BWCCDB B7CDBSɟBYUI?$ >;&7CnyBBvCnyB B7CDBSɟBgC?xt>M ^ȵCDB,BCnyBGB^ȵCBGBC?Ft>^ȵCDB,BWCCDB BCnyBGBO?5>WCCDB BvCnyB BCnyBGBT?ۄ>s^ȵCBGBCnyBGB^ȵCnyB?B`F?)_>vCnyB B7CnyBB7CB B)Q?k>t_7CB B7C B,ѡB0`C BGBQ?k>_7CB B0`C BGBvCnyB ByK?٣> vCnyB B0`C BGBCnyBGBW?F>F^ȵCnyB?B0`C BGB^ȵC BABS?>CnyBGB0`C BGB^ȵCnyB?BYL?R>, CBGB0`C BGB7C B,ѡB RX?Ӊ>&7CB@B CBGB7C B,ѡBQ?v>e^ȵC BABvCBI|B^ȵCSBI|B:Q?ux>VX^ȵC BAB0`C BGBvCBI|B(X?ߨ>A)ؾ0`C BGB CBGBvCBI|BpQ?>#^ȵCSBI|BõCB谪B^ȵCuB谪B]?>ZvCBI|BõCB谪B^ȵCSBI|B^?g>4^ȵCuB谪BõCB谪B^ȵCBBaR? >q_ CBGB7CB@B7CW\7C _7Cξ CBGB CJBI|BvCBI|B\V? >vCBI|B CJBI|BõCB谪B\R??_õCB谪B CJBI|B"@CJB谪Br>?ȣ&?2^ȵCBB9CJBB^ȵC0BBq>?9&?^ȵCBBõCB谪B9CJBB|W?O ?ut<õCB谪B"@CJB谪B9CJBB(?B@?踂^ȵC0BBCJB%B^ȵCB%B>?&?>9CJBBCJB%B^ȵC0BBtL?,?󟾣 CJBI|B7CJBB7CXqBI|B]R??l_"@CJB谪B CJBI|B7CXqBI|B*=?%?57C\RB谪B"@CJB谪B7CXqBI|B_@?(?<9CJBB"@CJB谪B7C\RB谪B4?4?,e=7CSBB9CJBB7C\RB谪Bn3?m3?_>CJB%B9CJBB7CSBB*&?zr>?ڽ>7CjB%BCJB%B7CSBBNMQ=I?!_CBBBmC0BB!_C0BliBTNP}Q=?!_CۡBBmC0BB!_CBBB UPSO="z?!_CۡBB(CۡBBmC0BB,=zU>7.#?(CۡBBC0BBmC0BB2pn>M9-?H,CۡBBBH,C0B.(BC0BBJ?07W>:e!?(CۡBBH,CۡBBBC0BB7HJDJ>}?נCDBB!_C0BliBmC0BBCw@wb8>a"?!_CDBxB!_C0BliBנCDBBS|.P>R|.?H,C壥BBH,CDBBנCDBB~.L>{.?H,C壥BBנCDBBC0BB>r>>#?C0BBנCDBBmC0BB 1eI>+?C0BBH,C0B.(BH,C壥BB==>j?]CnyBB!_CDBxBנCDBB3#U>8.?!_CnyB|B!_CDBxB]CnyBB$/q>/?H,CDBBH,CnyB˻B]CnyBB/q>/?נCDBBH,CDBB]CnyBB-,>/?!_C/BcBCnC BcB!_C BGB{'>60?CnC BcBH,C٭BBH,C BWB%,q>0?!_C/BcBH,C٭BBCnC BcB)>([/?!_C/BcB]CnyBBH,C٭BB+1'>@+?!_C/BcB!_CnyB|B]CnyBBtc,8>b,?]CnyBBH,CnyB˻BH,C٭BB%> (?GCBcB!_C BGBCnC BcBҴ>5?!_CB`B!_C BGBGCBcB$9>1?H,C BWBH,CBpBGCBcBV#m>Σ+?CnC BcBH,C BWBGCBcB>EO=?!_CDBNBpCJBNB!_CJBԳB q?c3?pCJBNBH,C%BcBH,CJBB5 ?>J4?!_CDBNBH,C%BcBpCJBNB} >3?!_CDBNBGCBcBH,C%BcBRח>1?!_CDBNB!_CB`BGCBcBc >^)?GCBcBH,CBpBH,C%BcBڔ?`-?H,C?C0B?!BH,CۡBBBBCۡB?!B2:qn> :-?H,C0B.(BH,CۡBBBC0B?!B->-?pCۡBBpC0BtBC0B?!B9>/Nb>,?BCۡB?!BpCۡBBC0B?!B)aP>R2?H,C壥BB;qCDBBH,CDBBQB' >{{/?;qCDBBpCB?!BpCDBB/^>hq,?H,C壥BBpCB?!B;qCDBBY)-T>/*?H,C壥BBC0B?!BpCB?!B1 1 J>̀+?H,C壥BBH,C0B.(BC0B?!B+q>+?C0B?!BpC0BtBpCB?!B w&>=.?ڰCnyBBH,CDBB;qCDBBKSޅ>B?H,CnyB˻BH,CDBBڰCnyBBAм>:?pCDBBpCnyBLBڰCnyBBmx&>.?;qCDBBpCDBBڰCnyBB臶>lfI?H,C٭BBQC BBH,C BWB F>v@?QC BBpCbBBpC BeBv >??H,C٭BBpCbBBQC BBa>\??H,C٭BBڰCnyBBpCbBB5m+>=?H,C٭BBH,CnyB˻BڰCnyBBl<>6?ڰCnyBBpCnyBLBpCbBB`>~;?pCa-BBH,C BWBQC BBed>S;?pCa-BBpCB2>BH,C BWB޾6Q>^)F?pCB2>BH,CBpBH,C BWBbc>;?QC BBpC BeBpCa-BB<?#]9?H,CJBBpCBcBpCJB}BG?vB?H,C%BcBpCBcBH,CJBB?B?pCBcBH,C%BcBH,CBpBȾbx?s2?pCB2>BpCBcBH,CBpBs\?>?H,C?aȰCKBNBH,C?aȰCKBNBH,CJBBpCKBJB 읾#?n4?pCKBJBH,CJBBpCJB}Bc3|p/?dr/?H,CKBanBaȰCKBNBpCoBNB2|q/?\q/?H,CKBanBpCoBNBH,C$B%BE*:?8(?H,C$B%BpCoBNBpCzB%B4|kq/?kq/?aȰCKBNBpCKBJBpCoBNB*I>R'?ƱCBUBpCۡBB5[CۡBUB)*i>(?ƱCBUBƱC0BuOBpCۡBB"T>6?ƱC0BuOBpC0BtBpCۡBBt) >Cu)?5[CۡBUBƱCۡBiBƱCBUB>>?pCB?!B[CDB?!BpCDBB{ϗ>>?[CDB?!BpCB?!BpC0BtB>>?[CDB?!BpC0BtBƱCDB7hB٥ >.?ƱCDB7hBpC0BtBƱC0BuOB !>,5?ƱC1CB?!BpCDBB[CDB?!B >-5?ƱC1CB?!BƱCnyBZBpCDBBV;>fE?ƱCnyBZBpCnyBLBpCDBB !>,5?[CDB?!BƱCDB7hBƱC1CB?!B_Ͼ>j;I?pCbBB C BBpC BeBaϾ>7:I? C BBpCbBBpCnyBLB9Ͼ>B?C>?JCBBƱC~ծBBƱCBqB}v?9c??pCa-BBƱC~ծBBJCBB0< ?dA?pCa-BB C BBƱC~ծBBKuɾI@?`ZC?pCa-BBpC BeB C BB;2r?r8? C BBƱC B BƱC~ծBB _a!?>?pCBcBCJBcBpCJB}BX>+?y6?CJBcBƱCBBƱCJBpBbdhS&(?8?pCBcBƱCBBCJBcB|"?:?pCBcBJCBBƱCBBn| ?п:?pCBcBpCB2>BJCBB.(?$4?JCBBƱCBqBƱCBBJP/?2?ƱCBcBpCJB}BCJBcB{\~:?DA&?ƱCBcBƱCKBZBpCJB}B#J+??Ծ)?ƱCKBZBƱC]߸BNBpCKBJBlj h>2=?ƱCBUBȱC0BUBƱC0BuOB*'>{4?ȱC0BUBCɣB}BC0BB3R>L8?ƱCBUBCɣB}BȱC0BUB/w j>K7?ƱCBUB^4CۡB}BCɣB}BDͼ>|1?ƱCBUBƱCۡBiB^4CۡB}Buvv>*?^4CۡB}BCۡBGBCɣB}Bv?Sy0?C*+BUBƱC0BuOBȱC0BUBm?\0?C*+BUBCDBBBƱC0BuOB>E?CDBBBƱCDB7hBƱC0BuOBɬo?ה0?ȱC0BUBC0BBC*+BUB0?lfI?ƱC1CB?!B?4CnyB?!BƱCnyBZB:?eI??4CnyB?!BƱC1CB?!BƱCDB7hB?eI??4CnyB?!BƱCDB7hBCnyBYBվo ?8?CnyBYBƱCDB7hBCDBBB۩+J?n;?CyNB?!BƱCnyBZB?4CnyB?!B۩I?n;?CyNB?!BC B3BƱCnyBZBmm?G?C B3BƱC B BƱCnyBZB!ܩJ?In;??4CnyB?!BCnyBYBCyNB?!B,",?m8?ƱCBqBC BBCBC2Bl6? MA?ƱC~ծBBC BBƱCBqB`l?-GA?C BBƱC~ծBBƱC B BׁK^)?04?C B3BC BBƱC B BWTI@? ?(?ƱCJBpBC\BBCJBoBM4'-?8?ƱCBBC\BBƱCJBpB&-?8?C\BBƱCBBƱCBqBk'%2?2?CBC2BC\BBƱCBqBs=&I?-?ƱCKBZBC*BcBCKBɴB"HU ??S)*?ƱCBcBC*BcBƱCKBZB4?4?C*BcBƱCBcBƱCJBpBV0H@?@(?CJBoBC*BcBƱCJBpBg>\R?:V ?CnӺB%BƱCz`B%BCBNBpyI=\}I?!j?ƱCz`B%BƱC]߸BNBCBNBE>=>?3*?CBNBƱC]߸BNBƱCKBZBXo=I??CKBɴBCBNBƱCKBZB>5ܾ?r>?CɣB}BC0B}BC0BBCоa)?4?C0B}B`C,_BB`C0BB$ ?Y3?CɣB}B`C,_BBC0B}BDOt ?4?CɣB}B:CۡBB`C,_BBu >t5?CɣB}BCۡBGB:CۡBBkc?N@?C*+BUB\CDBUBCDBBBA?Y6?\CDBUB`C-B}B`CDB{BVǶ<?D<9?C*+BUB`C-B}B\CDBUB@?:?C*+BUBC0B}B`C-B}Bl־_i ?9?C*+BUBC0BBC0B}B0D̾Д?t0?C0B}B`C0BB`C-B}Bb!"?3?`CɩBUBCDBBB\CDBUBO "?13?`CɩBUB`CnyBBCDBBBvz ?aHE?`CnyBBCnyBYBCDBBBY"?3?\CDBUB`CDB{B`CɩBUB%5?s2?C B3B`C&B?!B`C BB (=?C?CyNB?!B`C&B?!BC B3B (>?HC?`C&B?!BCyNB?!BCnyBYB\0?)0?`CnyBB`C&B?!BCnyBYB3Bt@=s@?Qc(?C\BB`C)BBCJBoBh4=4?4?`C)BBC\BBCBC2Bq<*??@*?`CB%'B`C)BBCBC2BYCr>WW?>`CKBeB;CKBNB`CGŷBNB]>VD??CKBɴB`CGŷBNB;CKBNBv]>D??CKBɴBC*BcB`CGŷBNB>\R?iV ?C*BcB`C익BcB`CGŷBNB[>??0'?`C익BcBC*BcBCJBoBl=r2J??`CJB>3B`C익BcBCJBoBIr>.UW?%>;CKBNB`CKBeB`CB%BjBr>VW?>;CKBNB`CB%BCBNB^+>*J?Q?CBNB`CB%BCnӺB%Bp]>D?5?;CKBNBCBNBCKBɴBd%?0?`C0BB.CWBB.C0BBeݺX?l7?`C,_BB.CWBB`C0BBöo)4?+?`CDB{B.CB}B.CDBBT!?9?`C-B}B.CB}B`CDB{B#!? 9?.CB}B`C-B}B`C0BB楾@+?@+?.C0BB.CB}B`C0BBCpH??c'?`CnyBB.CݥBUB.CnyBdBe5 1)?:?`CɩBUB.CݥBUB`CnyBBd5F0)?:?.CݥBUB`CɩBUB`CDB{BoL)4?c+?.CDBB.CݥBUB`CDB{B1OF?n!?`C BB.CsB?!B.C BBYw6?g03?`C&B?!B.CsB?!B`C BBw4?@4?.CsB?!B`C&B?!B`CnyBB7K??E`'?.CnyBdB.CsB?!B`CnyBB>L?+6?`CB%'B.CBB.CBSoBan=1>? )?`CNBB.CBB`CB%'B[c=(6?O3?.CBB`CNBB`C BBMF?l!?.C BB.CBB`C BB>W?X>.CJB6B{dzCJBcB.CBcB>D?ۗ?`CJB>3B.CBcB{dzCJBcB>ҲD?2?`CJB>3B`C)BB.CBcB6C>P?*$ ?`C)BB.CMiBB.CBcBp0>OL?8?.CBSoB.CMiBB`CB%'B8(>/F?W+>`CKBeB.CGŷB%BCKB%B~$>2F?$>`CKBeB`CGŷBNB.CGŷB%BpU>W?U>`CGŷBNB.CoQBNB.CGŷB%B5>W?>{dzCJBcB.CJB6B.CoQBNB>>W?r>{dzCJBcB.CoQBNB`C익BcBB>>F?#?`C익BcB.CoQBNB`CGŷBNB>D?ۗ?{dzCJBcB`C익BcB`CJB>3BP'>k0F?n*>CKB%B`CB%B`CKBeB3(?$4?.CWBBuC0BB.C0BB۫F?~?.CDBB7Cf>B}B7CDBmBV7?.?.CB}B7Cf>B}B.CDBB:.?.?.C0BBuC0BB7CҖBB:.?.?.C0BB7CҖBB.CB}BFB?}Q!?.CB}B7CҖBB7Cf>B}B2ZUN??.CnyBdB7CT̪BUB7CnyB)jB'd @?k{(?.CݥBUB7CT̪BUB.CnyBdBT .49?0?7CT̪BUB.CݥBUB.CDBBr>}F?,?7CDBmB7CT̪BUB.CDBB >S? ?.C BB7C&B?!B7C BQ;B=&(F?!?.CsB?!B7C&B?!B.C BB#=~/@?'(?7C&B?!B.CsB?!B.CnyBdB1UN?І?7CnyB)jB7C&B?!B.CnyBdBh>b5V?zN>7CBBCBB7CdBBBq>C0F??.CBSoB7CdBBBCBBq>a1F?>?.CBSoB.CBB7CdBBB-^T>-^T?ú?.CBB7CABB7CdBBB C> C?x?7CABB.CBB.C BB~ >?S? ?7C BQ;B7CABB.C BBn>T?݄>7CJB$BTCJBNB7C1jBNB>4G?>.CJB6B7C1jBNBTCJBNBE> 2G?>.CJB6B.CBcB7C1jBNB>H`V?y>.CBcB7C+BcB7C1jBNB>7V?J>CBB7CBB7C+BcB?>5V?K>CBB7C+BcB.CMiBB>'E?v?.CMiBB7C+BcB.CBcBr>x/F??CBB.CMiBB.CBSoBk>T?S܄>TCJBNB7CJB$B7CjB%Bq>T?ބ>TCJBNB7CjB%B.CoQBNB:U?A?7>.CoQBNB7CjB%B.CGŷB%B2>2G?>TCJBNB.CoQBNB.CJB6BMKȼSH?E?7Cf>B}B.CDB}B7CDBmB)MѼYQ?D2?.CDB}B^ȵC BB^ȵCDB֥BPѼXQ?Q2?.CDB}B7Cf>B}B^ȵC BB&C?c"?7Cf>B}B7CҖBB^ȵC BB>3D[?>7CnyB)jB^ȵCeBUB^ȵCnyB yBL=KM??7CT̪BUB^ȵCeBUB7CnyB)jBzRȼNH?J?7CDBmB.CDB}B^ȵC XB}BCȼ^%H?~?7CDBmB^ȵC XB}B7CT̪BUBia=^`V?U ?7CT̪BUB^ȵC XB}B^ȵCeBUBWѼSQ?9?.CDB}B^ȵCDB֥B^ȵC XB}B,´>:V?;>^ȵC B$_BRC BB^ȵCNBB$N>I?u?7C BQ;B^ȵCNBBRC BBN>aI?Gu?7C BQ;B7C&B?!B^ȵCNBBVx>\?ܣ>7C&B?!B^ȵC,@B?!B^ȵCNBBcb>X;I?J?^ȵC,@B?!B7C&B?!B7CnyB)jB>4F[?'>^ȵCnyB yB^ȵC,@B?!B7CnyB)jBE?O?X>^ȵCBpBkCBcB^ȵCuBcB>C?Z'>7CBB^ȵCuBcBkCBcB>C?)>7CBB7CdBBB^ȵCuBcBI>P?S&>7CdBBB^ȵCBB^ȵCuBcBB>:V?9>RC BB^ȵC B$_B^ȵCBB>:V?C:>RC BB^ȵCBB7CABBh>D?,>7CABB^ȵCBB7CdBBBM>)I?u?RC BB7CABB7C BQ;B$?̊;?kj>7CJB$B^ȵCB%BCJB%B!$?;?mj>7CJB$B7C1jBNB^ȵCB%B?J?>7C1jBNB^ȵCBNB^ȵCB%B#?O?`>kCBcB^ȵCBpB^ȵCBNB$?O?sY>kCBcB^ȵCBNB7C+BcBR?"MA?#>7C+BcB^ȵCBNB7C1jBNB>C?%>kCBcB7C+BcB7CBB$?#;?jj>CJB%B7CjB%B7CJB$B$?^,?:CۡBB`CۡB,B`C,_BB޺?ِ7?.CWBB`C,_BB`CۡB,B}˾ ?_+?.CۡBWB.CWBB`CۡB,B%4?(?uC0BB7C}BB7C0BNBa2?/)?.CWBB7C}BBuC0BB'?/?.CWBBACۡBB7C}BBs|$?s/?.CWBB.CۡBWBACۡBB*?*?ACۡBB7CۡBB7C}BB0"4?(?uC0BB7C0BNB7CҖBBn.;F?`?7C0BNB^ȵCBB^ȵC0BBX6?+?7C}BB^ȵCBB7C0BNB`Rk(1?m(1?^ȵCBB7C}BB7CۡBB`Rk(1?k(1?^ȵCۡBFB^ȵCBB7CۡBB<罯9?#-?^ȵC BB7CҖBB7C0BNBZm!CBVHBC~%BVHB C~%BFAB..N<`CSBGB`C?BVHB\CSBVHB&%%uξ`CB89B`C-B ;B `CB.B`CCBPH(B.C\BPH(BK4@CAB.B`CAB/B`CB.B楾@+@+`C~%BB.C~%BB.CB!B楾@+@+`C=B!B`C~%BB.CB!B>$9.CB!B`CBz&B`C=B!Bɾd2l.CBG"B`CBz&B.CB!Baԝ;{7CdBhBB7CbJBVHBDCdBVHB)5M7CSB8B7CrB ;BeCSB ;B"䡾WQ޾.CSBK^ȵCdBl@B^ȵC:BFABwZCdBFAB6Qt 7CdBhBBwZCdBFAB^ȵC:BFAB6Q6y 7CdBhBB^ȵC:BFAB7CbJBVHBlAG|q7CbJBVHB^ȵC:BFAB^ȵCVBVHB 6Kx7CSB8B^ȵCSBjO8B^ȵCB ;BӻVY 7CrB ;B7CSB8B^ȵCB ;B*14K9wZCdBFAB^ȵCB ;B^ȵCdBl@By13K:wZCdBFAB7CqBFAB^ȵCB ;B%(X7CqBFAB7CrB ;B^ȵCB ;B6Qt wZCdBFAB7CdBhBB7CqBFAB$g=CD"7CB4/B^ȵCBS0B^ȵC(B5BpR'1 )17CuBPH(B7CABE'B6CABPH(B`R>W(1y(16CABPH(B^ȵCAB)B^ȵC4B.B+aR>N(1}(16CABPH(B^ȵC4B.B7CuBPH(B=^@n%7CuBPH(B^ȵC4B.B7CB.BA>b7QK^ȵC4B.B7CB4/B7CB.Bi=CF"^ȵCBS0B7CB4/B^ȵC4B.Bc4>{-RD07C?B!B7CBk!B!CB!B>-%6!CB!B^ȵCB##B^ȵCB{BPH(B'>(*57C?B!B!CB!B^ȵCB{BPH(Bgd>-g.'{27C?B!B^ȵCB{BPH(B6CABPH(BS>o/|27C?B!B6CABPH(B7CABE'B\>R'C96CABPH(B^ȵCB{BPH(B^ȵCAB)B>(.B^ȵCp7B!B!CB!B7CBk!B>&B^ȵCp7B!B7CBk!B^ȵC~%BB荧>8^ȵC~%BB7CBk!B7C~%BB>'B!CB!B^ȵCp7B!B^ȵCB##B@9sZb6CTBVHBC}7B¿NB^CAB¿NBZ```=BCABVHBCTBVHB^CAB¿NB3zQ;=C}7B¿NBCHB(UBCAB(UB&nKbP>^CAB¿NBC}7B¿NBCAB(UBq.5m>CHB(UBCABVBCAB(UBlwXZ >BCABVHB^CAB¿NB!CBVHBYv9ؽv>^CAB¿NBkHCB¿NB!CBVHBUxoq3=f>ChB(UBCBUBkHCB¿NBxo3=8>ChB(UBkHCB¿NBCAB(UBx(ٽݗY>CAB(UBkHCB¿NB^CAB¿NB)um7=>CAB(UBCABVBChB(UB>x4[>x>!CBVHBkHCB¿NBC~%BVHBif>]>kHCB¿NBEeC~%B¿NBC~%BVHB5Z>:>CBUBC~%B{QBEeC~%B¿NBmP><>kHCB¿NBCBUBEeC~%B¿NB,SYcm`CdBŜYB`CB=[BFOCdB=[BmgҾ"ٽ`CB=[B`CBzaB `CuBdhB`CdB8kBHCdBdhB\A8T&Pts`C?BVHB`CB¿NBCSB¿NBU0U0pg\CSBVHB`C?BVHBCSB¿NBTV;he'`CB¿NB`CB(UBCSB(UB==i~+荽CSB¿NB`CB¿NBCSB(UBcQQ`k`CB(UB`CdBŜYBFOCdB=[BQ_k`CB(UBFOCdB=[BCSB(UBi.̾>CSB(UBFOCdB=[BCSB=[Bìix̾+DFOCdB=[B HCdBdhBl2CSBdhBCSBzaBflt3)>`CdB8kB`CSBkBl2CSBdhB vQ׽L>HCdBdhB`CdB8kBl2CSBdhB\= y\CSBVHBCSB¿NBCBVHBM]V]CSB¿NB,CB¿NBCBVHB\kCSB¿NBCSB(UB,CB¿NB)lx5ד=CSB(UB3CB(UB,CB¿NBlg5 ᓽCSB(UBCSB=[B3CB(UB۫xY=CSB=[BȲCB=[B3CB(UB\y-Z=CSB=[BCSBzaBȲCB=[B\y⛽-Z>CSBzaBCBzaBȲCB=[B\y⛽-Z>CSBzaBl2CSBdhBCBzaB)kC~=ƺ>l2CSBdhBHCBdhBCBzaBkN_>>>`CSBkB`CBiBHCBdhBJk`~= >l2CSBdhB`CSBkBHCBdhBta{ノa,CB¿NBCTBVHBCBVHB?;s4T6C}7B¿NBCTBVHB,CB¿NB=r&=3CB(UBC}7B¿NB,CB¿NB@4z_;J=CHB(UBC}7B¿NB3CB(UBՊqn*5_j>CHB(UBȲCAB=[BCABVB7q#5i>CHB(UB3CB(UBȲCAB=[Bf{~q=3CB(UBȲCB=[BȲCAB=[BJz?Z>ȲCB=[BCBzaBȲCAB=[Btk!>>CBzaBCABzaBȲCAB=[BѝXi^>>`C]BdhB`CABfBCABzaBX_>k>`C]BdhBCABzaBHCBdhB9j!>YP>HCBdhBCABzaBCBzaBYG2>>HCBdhB`CBiB`C]BdhBvo7y3=>ChB(UBZCB(UBCBUB.uJ7=u>CABVBZCB(UBChB(UB*um7=4>CABVBȲCAB=[BZCB(UBsr]zGk>\>ȲCAB=[B"CB=[BZCB(UB(L#l>q>`C#BzaB`CB`B"CB=[B)L9g>q>`C#BzaB"CB=[BCABzaB|ygu>մ>CABzaB"CB=[BȲCAB=[B"O>41>CABzaB`CABfB`C#BzaBHf><>BҲC~%B(UBCBUBZCB(UBkZ'>>C~%B{QBCBUBBҲC~%B(UB@4>&q ?`CB=[B`C~%B\[BBҲC~%B(UB@>o ?`CB=[BBҲC~%B(UB"CB=[B\>>"CB=[BBҲC~%B(UBZCB(UBg9Jg9>%>"CB=[B`CB`B`CB=[B(@(N.C'B aB.CBzaBu,C'BzaBO;$k.CBzaB.CBdhBXC'BdhB0u0]u,C'BzaB.CBzaBXC'BdhBYʙwĽ.CBdhB.CBnB$C'BnB@ȑ(C@XC'BdhB.CBdhB$C'BnBukƾe.CBnB.CB37uB+C'B37uBZqR=$C'BnB.CBnB+C'B37uBvavО=.CB37uB.C4Bq{B &C'Bq{B8gUþlNJ>+C'B37uB.CB37uB &C'Bq{B;4(3(J9.CBOQVB.CoB=[BϳCB=[B((.CoB=[B.C'B aBu,C'BzaB6((.CoB=[Bu,C'BzaBϳCB=[B3K WϳCB=[Bu,C'BzaBCBzaB}I}{u,C'BzaBXC'BdhBCBzaB,d,|#XC'BdhBąCBdhBCBzaBZddXC'BdhB$C'BnBąCBdhBmoZ>$C'BnBCBnBąCBdhBoq =$C'BnB+C'B37uBCBnBMuVNG>+C'B37uBJ̳CB37uBCBnBt?V7U>+C'B37uB &C'Bq{BJ̳CB37uB^Dp)z> &C'Bq{BCBq{BJ̳CB37uB2**a.CdBN6IB.CB¿NBҳCdB¿NB5$ߑ.CB¿NB.CEB(UBCdB(UBLq/q/ 2|ҳCdB¿NB.CB¿NBCdB(UBP)SmϳCB=[B`CB=[B`CdBŜYBI=]վ.CBOQVBϳCB=[B`CdBŜYB<>A"V.CBOQVB`CdBŜYBCdB(UB/*Nľ.CBOQVBCdB(UB.CEB(UB~S]aCBzaB`CB=[BϳCB=[BlgҾ(ٽ`CBzaB`CB=[BCBzaB3Uh3Ҿ`BąCBdhB`CBzaBCBzaBiu:`CuBdhB`CBzaBąCBdhBOml3|>`CuBdhB[CdBnB`CdB8kBm 5Ѱ|>`CuBdhBąCBdhB[CdBnBQy:+= >ąCBdhBCBnB[CdBnBTdw*HI>CBnBJ̳CB37uB[CdBnB7oƳ>J̳CB37uBJ̳CdB37uB[CdBnB[d=>.CBq{B.CdB{BJ̳CdB37uBad=>.CBq{BJ̳CdB37uBCBq{Bap'>CBq{BJ̳CdB37uBJ̳CB37uB**5cҳCdB¿NB.CXBVHB.CdBN6IBV|13 ҳCdB¿NB`CB¿NB.CXBVHB.%!7`CB¿NB`C?BVHB.CXBVHBM7 &~CdB(UB`CB¿NBҳCdB¿NBHTi=g'`CB(UB`CB¿NBCdB(UBwQakCdB(UB`CdBŜYB`CB(UBNwkEąCSBnB`CdB8kB[CdBnBlr3&>`CSBkB`CdB8kBąCSBnBo<>[CdBnBJ̳CdB37uBąCSBnBV`8>>J̳CdB37uBCSB37uBąCSBnB X>d>>.CdB{B.CSB3xBCSB37uBcω>̑>J̳CdB37uB.CdB{BCSB37uBsg#MY>N>ڵCBnB`CSBkBąCSBnB+M_>B>`CBiB`CSBkBڵCBnB H>l ?.CzB37uB.CBDtBڵCBnB! Hш>s ?.CzB37uBڵCBnBCSB37uB^P>V>CSB37uBڵCBnBąCSBnBeQߩ>~>CSB37uB.CSB3xB.CzB37uBXa>8>`C]BdhBCABdhB`CABfBY>5>>`CBiBCABdhB`C]BdhBY5>>`CBiBڵCBnBCABdhB6IK>?ڵCBnBCABnBCABdhB#/>?.CBDtB.CABWoBCABnBCtF>n?ڵCBnB.CBDtBCABnB)Lbj>o>`C#BzaBxCBzaB`CB`BO>3>`CABfBxCBzaB`C#BzaBOx>6>`CABfBCABdhBxCBzaBaB*>>CABdhB_CBdhBxCBzaB8??.CxGBnB.CBiB_CBdhBí7?;?.CxGBnB_CBdhBCABnB-A>r4>CABnB_CBdhBCABdhB ?} ?CABnB.CABWoB.CxGBnB@>| ?`CB=[BeC~%B=[B`C~%B\[Bj7J<>)>`CB`BeC~%B=[B`CB=[Bm:J7>#>`CB`BxCBzaBeC~%B=[Bn/س> ?xCBzaB2 C~%BzaBeC~%B=[B.?Cs ?.CBdhB.C~%B6cB2 C~%BzaBh*?r ?.CBdhB2 C~%BzaB_CBdhB-}9l?>_CBdhB2 C~%BzaBxCBzaBV\W?*?_CBdhB.CBiB.CBdhB< g(d׾7C'BgmWB7C]aB=[BC'B=[Bj9$M,ot.C'B aBC'B=[B7C]aB=[BT@$y?,؍.C'B aB7C]aB=[B.CBzaB &( þ.CBzaB7C]aB=[B7CBzaB,=, U۟CBdhB7CBzaB7CBbBc6ϖ菉۟CBdhB.CBdhB7CBzaB.0N}.CBdhB.CBzaB7CBzaB1|<$ T(fCBnB.CBdhB۟CBdhBY2vĽ.CBnB.CBdhB(fCBnBYzOCB37uB.CBnB(fCBnBkƾ̓.CB37uB.CBnBOCB37uBkkƾ0=UYCBq{B.CB37uBOCB37uBvv=.C4Bq{B.CB37uBUYCBq{BZb -77CB޾LB7C~IB¿NBŴCB¿NB90 hS==þŴCB¿NB.CB¿NB.CdBN6IBG ?/ھ7CB޾LBŴCB¿NB.CdBN6IBĄJN?>Sվ7CB޾LB.CdBN6IBDCdBVHB0g>r7CB޾LBDCdBVHB7CbJBVHB"?fECB(UB.CB¿NBŴCB¿NBm) }/Y.CEB(UB.CB¿NBECB(UB\"*(9оECB(UB.CBOQVB.CEB(UBed=b>.CBq{B/CdBq{B.CdB{BX8EE˾DCdBVHB.CdBN6IB.CXBVHB:`Kn>>(fCSBq{B.CdB{B/CdBq{B XAd>>.CSB3xB.CdB{B(fCSBq{BH>e ?.CzB37uBBCB37uB.CBDtBQUߩ>8>.CSB3xBBCB37uB.CzB37uBMQ>g>.CSB3xB(fCSBq{BBCB37uB =?>?(fCSBq{BZִCBq{BBCB37uB;k>=?ôCAB37uB.CBDtBBCB37uB />?.CABWoB.CBDtBôCAB37uBưi5?^?7C&0Bq{B7CABwBôCAB37uBJ8??7C&0Bq{BôCAB37uBZִCBq{Bv^9\>H<?ZִCBq{BôCAB37uBBCB37uBB8?(?.CxGBnBôCBnB.CBiBU?V?ôCBnB7CB37uB7CBpB@ ??.CxGBnB7CB37uBôCBnBO?= ?.CxGBnBôCAB37uB7CB37uB ? ?.CxGBnB.CABWoBôCAB37uBHXX?̩?ôCAB37uB7CABwB7CB37uBܾ8?d ?.C~%B6cB7CBdhB7C~%BShBn#??.CBdhB7CBdhB.C~%B6cBBWAW??.CBiBôCBnB7CCBnBVWV?ˬ?.CBiB7CCBnB.CBdhB'1?7>.CBdhB7CCBnB7CBdhB?r?ôCBnB7CBpB7CCBnBϾ=ދ^ȵC'BMRB^ȵCLB(UB5PC'B(UB'־_C7C'BgmWB5PC'B(UB^ȵCLB(UB&־C7C'BgmWB^ȵCLB(UB7C]aB=[BYݾv?7C]aB=[B^ȵCLB(UB^ȵCB=[B?"CBzaB^ȵCB=[B^ȵCBƦ[BA?CBzaB7CBzaB^ȵCB=[B)律0FN(7CBzaB7C]aB=[B^ȵCB=[B^JܷCBzaB7CBbB7CBzaBBE8$7CB޾LB^ȵCBTIB^ȵCB¿NB<Ħ?MG7C~IB¿NB7CB޾LB^ȵCB¿NBϾ=ԍ5PC'B(UB^ȵCB¿NB^ȵC'BMRBoϾ\=85PC'B(UB7CoB(UB^ȵCB¿NBߩQ7CoB(UB7C~IB¿NB^ȵCB¿NB"'־C5PC'B(UB7C'BgmWB7CoB(UB:yR7^ȵCVBVHB7CB޾LB7CbJBVHBE$^ȵCBTIB7CB޾LB^ȵCVBVHB 7?+?7C&0Bq{B܉CABq{B7CABwBr?r?7CB37uBCB37uB7CBpBϷY-?\=?CB37uB^ȵCIBq{B^ȵCBuB6-?X@?7CB37uB^ȵCIBq{BCB37uBuWwW?,?7CB37uB܉CABq{B^ȵCIBq{BUZ?c?7CB37uB7CABwB܉CABq{B`G?&?7CBdhBC~%BdhB7C~%BShBs X?>C~%BdhB^ȵCH8BnB^ȵC~%BkBsQX?>C~%BdhB7CBdhB^ȵCH8BnBeC?@ ?7CBdhB7CCBnB^ȵCH8BnBo?t?7CBpBCB37uB^ȵCB37uBr? s?7CBpB^ȵCB37uB7CCBnBD᯾I??7CCBnB^ȵCB37uB^ȵCH8BnBȬ-?>9?CB37uB^ȵCBuB^ȵCB37uBC*?2H,CBLBE$CdBBH,CcBB[cL?f >H,CBLB߰CBnBE$CdBBW?v= ߰CBnBנCdBnBE$CdBBSb?>EH,CcBBE$CdBBH,CdBB!H?0 #>+wCSBnBנCdBnB!_CdBB{Y?@?=H!_CSBBІB+wCSBnB!_CdBBSyT?D,>GנCdBnB+wCSBnBE$CdBB6[?>^ԾE$CdBB+wCSBnBگCSBB,R?e>ѾH,CdBBz'CSBS׍BH,CK+BS׍BR?>ҾH,CdBBE$CdBBz'CSBS׍B/c?&I>ucE$CdBBگCSBBz'CSBS׍B]?x>H,CK+BS׍Bz'CSBS׍BH,CSBB_R?">A+wCSBnB!_CSBBІB!_CxBnB'.i?D>Q!_CxBnB!_CBBsCBB.i?>!_CxBnBsCBB+wCSBnBR?Z>Ί˾+wCSBnBsCBBگCSBBXY?>ТگCSBBsCBBz'CSBS׍BM?&?z'CSBS׍BsCBBАCBS׍BN1?.?$iH,CSBBנCB BH,CQB Br1?.?iH,CSBBz'CSBS׍BנCB BM?=;?z'CSBS׍BАCBS׍BנCB B?K?ýH,CQB BHCB@BH,CB@B#6?4J3?<7k=נCB BHCB@BH,CQB BJ??SH?T>!_CBkBH,CB@BHCB@B>?SH?T>!_CBkB!_CAB/uBH,CB@Bv?_Y?_=!_CAB/uBH,C MB/uBH,CB@BzB?2?ssCBB!_CBB!_C7BBG??M߽АCBS׍BsCBB!_C7BBn4?El4?!_C`NBS׍BАCBS׍B!_C7BBO4?~4?aנCB BАCBS׍B!_C`NBS׍Bo4?^4?a!_C}B BנCB B!_C`NBS׍B4?4?di=HCB@BנCB B!_C}B Bn?K?x=!_CB@BHCB@B!_C}B B>?!TH?2T>HCB@B!_CB@B!_CBkB5?5<5ZC'BB]CBBH,CBۉB@?Ci4(H,C'B<ΉBZC'BBH,CBۉB+>?=+I)pCB\BC'BS׍BpCBS׍B >?u=vT)pCB\B]CBBC'BS׍B?K?WKn C'BS׍BGCBB^ѰCBS׍B0Z?C%>pC'BpB^ѰCBS׍BpCBBO?eD>C'BS׍B^ѰCBS׍BpC'BpB4`L?] >GCBBH,CBLBH,CcBB8Pb?>QH,CcBBH,CdBBيCdBS׍B!Pb?>QH,CcBBيCdBS׍BGCBBVL?fz>I GCBBيCdBS׍B^ѰCBS׍B{cL?>OpCBBCdB BpCRrB BaL?G>eTpCBB^ѰCBS׍BCdB B_?ʙ>þ^ѰCBS׍BيCdBS׍BCdB B\?^8>OpCRrB BCdB BpCdBjBR?4>0ҾيCdBS׍BH,CdBBH,CK+BS׍B\??>{H,CK+BS׍BH,CSBBjCSB B~\?&>H,CK+BS׍BjCSB BيCdBS׍B7N?\>EيCdBS׍BjCSB BCdB B???>pCdBjBoCSB@BpCB@B*???pCdBjBCdB BoCSB@BZ??ڽCdB BjCSB BoCSB@B#?(B?!pCB@B^vCSB/uBpCB/uBgF?3!?CY=oCSB@B^vCSB/uBpCB@B,1?}.?](ijCSB BH,CSBBH,CQB Bõ5?2?段oCSB@BjCSB BH,CQB B^4?^4?iH,CB@BoCSB@BH,CQB B4?4?ZF=^vCSB/uBoCSB@BH,CB@BU$?LB?=H,C MB/uB^vCSB/uBH,CB@B>?=U)CBS׍BpCB\BpCBS׍B5 P?=7HpCBS׍BpC'BpBC'B B P?M =&HpCBS׍BC'B BCBS׍BH?C #>>CBS׍BC'B B±CB BݯR?I4>SB ƱCBp}BC'B BƱC'BB]K?r%>;±CB BC'B BƱCBp}BJ?c}>GCB BC'B BpC'BpBqZ?@%>pCBBGCB BpC'BpBDG?Ӻ>ƱC'BBCB@BƱCB@B6FG?к> ƱC'BBC'B BCB@B8\?ԉ>~ܾC'B BGCB BCB@BqV?">K\¾ƱCB@BCB@BƱCBBbL?>PGCB BpCBBpCRrB B\?=>SpCRrB BpCdBjB +CdB@BB\?<9>SpCRrB B +CdB@BGCB BΫF?9> ƾGCB B +CdB@BCB@B:X6??VBƱCBBXCdB/uBƱC$B/uBW6?$?CƱCBBCB@BXCdB/uBS??|9CB@B +CdB@BXCdB/uB??? +CdB@BpCdBjBpCB@BC?c)?a+XCdB/uB +CdB@BpCB@B3?j3?^PpCB/uBXCdB/uBpCB@B:;I?ab>C'B@BkHCB@BƱCBp}BR?J4>C ƱC'BBC'B@BƱCBp}B Q?6>1CB/BkHCB@B~C'B/uBZ?*Ru>kHCB@BC'B@B~C'B/uB[EG?)Ѻ>@C'B@BƱC'BBƱCB@BtV?>?W¾ƱCB@BƱCBB CB/uB2sV?& >W¾ƱCB@B CB/uBC'B@BiI?U>LܾC'B@B CB/uB~C'B/uBdZ6??Q@ CB/uBƱCBBƱC$B/uBQ?.4>oŲCB/uBCB/BC½B/uB;oOo8Ɔ>.C4Bq{B.C'Bp|B &C'Bq{B k{\ >.C'Bp|B.CBUh}BCBq{BuF;> &C'Bq{B.C'Bp|BCBq{BCQjT=|>CBq{B.CBUh}B.CBq{Bݗo٧odž>.C4Bq{B_C'BB.C'Bp|BooƆ>.C4Bq{BUYCBq{B_C'BBc~OZ~;=UYCBq{BlCBB_C'BBu6u^>lCBBDCBv9B_C'BB_oR<鰳>DCBv9BC'Bv9B_C'BBrgܦ=>7CBnB7C'BBC'Bv9Byg=x>7CBnBC'Bv9BCBnBp<>CBnBC'Bv9BDCBv9B`=>CBnB7CB‡B7CBnB&u(u=>a>lCBB.C'Bp|B_C'BBk3\/>.CBUh}B.C'Bp|BlCBBJoBo=v>_C'BBC'Bv9BlCBB c>>C'Bv9BϴCBv9BlCBB%mYe>>7C'BB7CB2mBϴCBv9B-_fab>>C'Bv9B7C'BBϴCBv9B8Yj}+=ȕ>.CBUh}B/CdBq{B.CBq{B,RjlM=>.CBUh}BlCBB/CdBq{B d[Pd[>">lCBB۟CdBB/CdBq{B'kT >R>7CXBv9B7CdB|B۟CdBBkT2 >>7CXBv9B۟CdBBϴCBv9B``>>ϴCBv9B۟CdBBlCBBӻUa>nv>ϴCBv9B7CB2mB7CXBv9BAw`>k\?7CDBB7CSB B(fCSBq{BA>eU?7CDBB(fCSBq{B۟CdBBZSlh>A>۟CdBB(fCSBq{B/CdBq{BQN>>۟CdBB7CdB|B7CDBBq4+>?7CSB B7CB|BZִCBq{B1<> ?(fCSBq{B7CSB BZִCBq{B ?\ ?ZִCBq{B7CB|B7C&0Bq{Bpgc=>7CBnB C'BnB7C'BBm`Ư=>7CB‡B C'BnB7CBnB`=D>7CB‡B\CBB C'BnBPY">y?\CBBsC'BB C'BnBkC^>l?^ȵCB"B^ȵC'BBsC'BB+Qw> ?\CBB^ȵCB"BsC'BBa!#~>}>WCCBnB7C'BB C'BnBmYe>ޛ>7CB2mB7C'BBWCCBnB|Gt˛>VB ?^ȵCvBB^ȵCBbBWCCBnBzGכ>A ?^ȵCvBBWCCBnBsC'BB1Uop>>sC'BBWCCBnB C'BnB5y?Ö>?sC'BB^ȵC'BB^ȵCvBBlT >)>7CXBv9BvCdBv9B7CdB|BrUd>t>7CB2mBvCdBv9B7CXBv9BUF>kt>7CB2mBWCCBnBvCdBv9BB>&?WCCBnBCdBnBvCdBv9B(>?^ȵCBbB^ȵCdB"BCdBnBB>?WCCBnB^ȵCBbBCdBnBAz>6q?7CDBBCSBB7CSB B_N(>q>7CdB|BCSBB7CDBBSN>>6>7CdB|BvCdBv9BCSBB13*0>< ?vCdBv9BCSBv9BCSBB{ ?j?^ȵCBnB^ȵCSBBCSBv9Boy ?N?^ȵCBnBCSBv9BCdBnB|8+>˻?CdBnBCSBv9BvCdBv9B5y|> ?q'?CdBnB^ȵCdB"B^ȵCBnBn4>?܉CBB7CSB BCSBB0+->E?7CB|B7CSB B܉CBBi ?i?^ȵCBv9B^ȵCBB܉CBBi ?i?^ȵCBv9B܉CBBCSBv9BU`1>6 ?CSBv9B܉CBBCSBB8. ??CSBv9B^ȵCSBB^ȵCBv9B?7?܉CABq{B^ȵCBB^ȵCAB}BC8 ??7C&0Bq{B^ȵCBB܉CABq{BQP?$ ?7C&0Bq{B܉CBB^ȵCBB ? ?7C&0Bq{B7CB|B܉CBBmm??܉CBB^ȵCBB^ȵCBBSS??܉CABq{B^ȵCAB}B^ȵCIBq{BR3fE??!_C'BKBH,CBBH,C'B{BX0T-?0?!_CtWBBH,CBB!_C'BKB{T-?<0?H,CBB!_CtWBB!_CBBd.4?5&?H,CB&BH,CBB!_CBB=M?;?!_CBHBH,C"B谪BH,CBEBf^kA?#?!_CB谪BH,C"B谪B!_CBHBs3?s3?H,C"B谪B!_CB谪B!_C'BKB(Q3E?^?H,C'B{BH,C"B谪B!_C'BKB=Ne?>!_CdB BH,CBGBH,CdB=BM&8g?>H,CSBFBܔCSBmޝBH,CEBmޝB>/U?>!_CSBcXBH,CEBmޝBܔCSBmޝB> 2U?>!_CSBcXB!_CB BH,CEBmޝBL:>nIe?>!_CB BH,CmB BH,CEBmޝBq+>S?py ?H,CmB B!_CB B!_CdB B=e?>H,CdB=BH,CmB B!_CdB BA?KdW?-/>H,C MB/uB!_CAB/uBH,C[BΩB~>R]?(>!_CAB/uB!_C'BΩBH,C[BΩBк>8g?>ܔCSBmޝBH,CSBFBH,C[BΩB>8g?>ܔCSBmޝBH,C[BΩB!_CBmޝB>(GT?>!_CBmޝBH,C[BΩB!_C'BΩB>.U?,>ܔCSBmޝB!_CBmޝB!_CSBcXBɼR?E?H,C'B{BpCԽBBpC'B)BSyG???H,CBBpCԽBBH,C'B{Bjj;?<-?pCԽBBH,CBBH,CB&B *qK?f?pCBnBpCԽBBH,CB&B X=uV? ?H,CBEBpCB谪BpCB[§BdEgl?{>pCdBBOCdB BpCB Bc>n]?(>H,CdB=BpCB BOCdB B>]?9>H,CdB=BH,CBGBpCB BUJY>(g?;Q>H,CBGBpCBGBpCB BO>b]?8>pCBGBH,CBGBpCBI|B?`=C`V?U ?H,CBGBH,C:}BI|BpCBI|BL=LM?r?pCBI|BH,C:}BI|BH,CBEBhP=fV? ?pCB[§BpCBI|BH,CBEBr ?UV??U^vCSB/uB LCSBΩBpCB/uB?-M?n>H,CSBFBpCӋBΩB LCSBΩB?M?k>H,CSBFBH,CEBmޝBpCӋBΩB>a?])>H,CEBmޝBpCBmޝBpCӋBΩBs>Pl?{>OCdB BpCdBBpCBmޝB>Wl?R{>OCdB BpCBmޝBH,CmB B 5> 5T?GP>H,CmB BpCBmޝBH,CEBmޝB><]?>OCdB BH,CmB BH,CdB=B*#?A?[> LCSBΩB^vCSB/uBH,C MB/uB"v ?S?r+>H,C[BΩB LCSBΩBH,C MB/uB?M?j> LCSBΩBH,C[BΩBH,CSBFB=_Y?x?pC'B)BƱCԇBBƱC'BB;=RR?8?pCԽBBƱCԇBBpC'B)BYP=wM??ƱCԇBBpCԽBBpCBnB"f?4>ƱCBPBT!CBI|BƱC/BI|Bdk>?Q?Y?pCB[§BƱC/BI|BT!CBI|Bk>Q?`?pCB[§BpCB谪BƱC/BI|B>_?|>pCB谪BƱC{B谪BƱC/BI|B&>P??ƱC{B谪BpCB谪BpC'B)BQ =aY?*u?ƱC'BBƱC{B谪BpC'B)B$???ƱC$B/uBcCdBΩBƱCBΩBFz@?l(?R0XCdB/uBcCdBΩBƱC$B/uB?0~T?ƱCBΩB)HCdBmޝBƱCBmޝB7&?iA?̲=cCdBΩB)HCdBmޝBƱCBΩBik ?IO? {\>pCdBBƱCBmޝB)HCdBmޝBh ?LO?Ij\>pCdBBpCB BƱCBmޝBj>K]?, >pCB BƱCbJB BƱCBmޝB?>_Y?f>ƱCbJB BpCB BƱCgpBGBb>\?{>pCB BpCBGBƱCgpBGB>تf?7>T!CBI|BƱCBPBƱCgpBGB>f?6>T!CBI|BƱCgpBGBpCBI|B濲>AS?>pCBI|BƱCgpBGBpCBGBl>KQ?Z?T!CBI|BpCBI|BpCB[§BB4?4?<%cCdBΩBXCdB/uBpCB/uB &?l$B?BpCBmޝB)HCdBmޝBpCӋBΩBik ?HO? {\>)HCdBmޝBpCBmޝBpCdBB`?>iC½B/uB~C'B/uBC'B:B> b?P^>C'BNB^C'B谪BCnB谪Bs%>R?E?ƱC'BBCnB谪B^C'B谪Bw&>nR?:G?ƱC'BBƱCԇBBCnB谪B\>\?>ƱCԇBBCBBCnB谪BP> P? ?CBBƱCԇBBƱCBjBu>jY?H9?CBBCBBƱCBjBaZC?v?ҤC'B:B>CBΩBCBΩBYC?ow?դC'B:B~C'B/uB>CBΩBZ?C>Z~C'B/uB CB/uB>CBΩBh,?$K8?+CBΩB=KCBmޝBCmBmޝB=N?OY?MG>CBΩB=KCBmޝBCBΩBIR?O?D CmBmޝB=ACB BCB Bm.?:?R==KCBmޝB=ACB BCmBmޝBt?Z?_=CB BHCBGBC)BGB?GPL?<>=ACB BHCBGBCB B>P?P>ƱCBPBC)BGBHCBGB>)P?>ƱCBPBƱC/BI|BC)BGB >[c? \c>ƱC/BI|BCBI|BC)BGB>b?t_>^C'B谪BC'BNBCBI|B6>3b?_>^C'B谪BCBI|BƱC{B谪B7>|Q?>ƱC{B谪BCBI|BƱC/BI|B3$>oR?D?^C'B谪BƱC{B谪BƱC'BBW=?Q%?W=>CBΩB CB/uBƱC$B/uB33?-33?OƱCBΩB>CBΩBƱC$B/uB4?=4?m/=KCBmޝB>CBΩBƱCBΩBz+?=?ƱCBmޝB=KCBmޝBƱCBΩB+?=?==ACB B=KCBmޝBƱCBmޝB9?8N?>ƱCbJB B=ACB BƱCBmޝB?NL?[<>HCBGB=ACB BƱCbJB BV>V? d>ƱCgpBGBHCBGBƱCbJB B>P?>HCBGBƱCgpBGBƱCBPBX`?>C½B/uBC'B:BvղC'BΩB-`?]>C½B/uBvղC'BΩBoŲCB/uBIT?>ձھoŲCB/uBvղC'BΩB8/CBΩBNS?%>H`CB뀜BC'BmޝB`CBmޝB,S?i>`CB뀜B8/CBΩBC'BmޝB.`?>e8/CBΩBvղC'BΩBC'BmޝBE/J??J.`CBmޝB'C'B B`CB Ba?T>t)C'BmޝB'C'B B`CBmޝBK+?'=?w`CB BC'BGB`CBGBL??='C'B BC'BGB`CB By&?O?wxr=`CBGB-C'BI|B`C/nBI|BmP*?:C'BGB-C'BI|B`CBGB% ?1iE?e>C'BNB`C/nBI|B-C'BI|B ?iE?d>C'BNBCnB谪B`C/nBI|B!?S?ˢ{>CnB谪B`CzB谪B`C/nBI|B>Z?N>K;CBB`CB1B`CzB谪B>Z?t>K;CBB`CzB谪BCBB>G?>CBB`CzB谪BCnB谪Bf>.)L?s>K;CBBCBBCBBZC?Iv?ѤvղC'BΩBC'B:BCBΩBzG?}?u肾C'BmޝBvղC'BΩBCBΩB~5?/?d#CmBmޝBC'BmޝBCBΩB7?1?X'C'B BC'BmޝBCmBmޝB܂3?{[6?4CB B'C'B BCmBmޝBoK3?-#6?j=C'BGB'C'B BCB BT)?s >?=C)BGBC'BGBCB B+(?Җ=?߁>-C'BI|BC'BGBC)BGBl?NK?K>CBI|B-C'BI|BC)BGB ?OiE?e>-C'BI|BCBI|BC'BNBS?J>.ąCBmޝB`CB뀜B`CBmޝBh[?R >vxCB BąCBmޝB`CBmޝB_K?=[?,`CB BxCB B`CBmޝBK??oq%$CBGBxCB B`CB B8V6?~3?`CBGB$CBGB`CB B?A6?i3?H6=QܳCBI|B$CBGB`CBGB4?x4?cCB谪BQܳCBI|B`C/nBI|B ?>?mb>`CzB谪BCB谪B`C/nBI|BE/?|;?rw>CB谪B`CzB谪B`CB1Bhyʾsi_`C[BdB`CѳB BgC[B Bоa_f`CBMB`C[BdBgC[B Bk 4d<ٲC,B B`C,BBڗCB B о~>ndW`C,BB<ٲC,B B`CB BG·ʾg.CBֲB.C((B BCB B %I^pCB B`CѳB B`C[BdB %̉pCB B`C[BdB.CBֲBh6s.CBֲB`C[BdB.C[BB; ; ;{.C[BB`C[BdB.CBB|۽u,z.CBB`C[BdB`CBMBݽ=nb}.CBB`CBMB.C,B~B4~=q~.C,B~B`CBMB`C,BB >Bk.C,B~B`C,BB`CB Bʻ(>c.CB B.C,B~B`CB B&j=C̾Q'j.C((B B.CBֲBCB Bu='gKu7CB BCB B.CBֲBu=^tu7CB B.CBֲB7C[BKB=Ndt7C[BKB.CBֲB.C[BBC=s~7C[BKB.C[BB7CBBV; >; ?{7CBB.C[BB.CBB2 >k:>>y7CBB.CBB7C,BSBZh>(=6x7C,BSB.CBB.C,B~BP>>^7C,BSB.C,B~B.CB B>? I07C'B B7C,BSB.CB B# ?hN7CB B7C[BKBNC[B Ba?f C{TORCB BNC[B B7C[BKB{"?vD7CBBORCB B7C[BKB!??'>BC,B BORCB B7CBBMt3?d>q37C,BSBC,B B7CBBj? ?DhC,B B7C,BSB7C'B B%gDʾc-ƱCZBZ+BƱCB.BCZB.BDvU ƱCB.BƱCοB5BYCZB5B_Qj ;[/CZB.BƱCB.BYCZB5B }}<ƱCοB5BƱCYB ;BCZB ;Baiv悾ȸ=YCZB5BƱCοB5BCZB ;Bkwxg>ƱCYB ;BƱCZBƱCB ;BƱCB:BCB5BUw=2Zw>ƱCB ;BCB5BCZB ;Bc~0n~þ=CZB ;BCB5BYCZB5BT6x/4=h>CZB ;BƱCZBCB.BC[B.BdC[BPH(BmA>us>ƱCͣB5BƱC[B4BC[B.Bm,A>r>ƱCͣB5BC[B.BCB5B!\~RL=CB5BC[B.BCB.B}sE>s>CB5BƱCB:BƱCͣB5B@2C2B2ƱCBnBƱC-BuB+CBuBU UGƱC-BuBƱC[BYBqnC[B!B UUGƱC-BuBqnC[B!B+CBuBzk@kƾ+CBuBqnC[B!BaCB!B8oC^m?qnC[B!BdC[BPH(BaCB!Bz >>dC[BPH(BCBPH(BaCB!B{ > >= >dC[BPH(BC[B.BCBPH(BY7hid>:d>C[B.BıCB.BCBPH(B*P0>^>ƱC[B4BƱCBe.BıCB.Bu8g#>4>C[B.BƱC[B4BıCB.B1G>1ƱCBnB+CBuBƱC!BuB3lJ> ƱC,B BƱC!BuB+CBuB+lJ>+ƱC,B B+CBuBC,B!B\3{>XcC,B!B+CBuBaCB!Bu$gJ>c->ƱCnBPH(BƱC,BF$BC,B!B&g@>_->ƱCnBPH(BC,B!BCBPH(Bj1>->CBPH(BC,B!BaCB!BUDU8>>CBPH(BıCB.BƱCB.B`:o>1->ƱCnBPH(BCBPH(BƱCB.BVnJ>_>ıCB.BƱCBe.BƱCB.BS$?{ƱC,B BC,B!BƱCRB!BW?d!>C,B!BƱC,BF$BƱCRB!BzZCZBEBBCB!B!CZB!B]" kCB!BC~%BE%BrXC~%BPH(B2a"JjCB!BrXC~%BPH(B!CZB!B,Q0.6!CZB!BrXC~%BPH(Bn۱CZBPH(B7&gEBʾa-ƱCZBZ+BC~%B.BƱCB.B&gAʾ%[-ƱCZBZ+Bn۱CZBPH(BC~%B.B`PY5n۱CZBPH(BrXC~%BPH(BC~%B.Bze8ɾ(9IC~%B5BƱCB.BC~%B.BNv ƱCοB5BƱCB.BC~%B5B*wBMb99رC~%B ;BƱCοB5BC~%B5Bp}q<ƱCYB ;BƱCοB5B9رC~%B ;B@kwug>ƱCYB ;BCZBFABƱCZBƱCYB ;B9رC~%B ;BCZBFAB8]m?=GC=9رC~%B ;B C~%BFABCZBFABΜzF;= K> C~%BFABC~%BVHBCZBFABjvM>>C~%BVHB;CZBVHBCZBFAB;6CBBC BuB6ECBuB;bgӾ !CZB!BƱCB!BƱCB8 B'ɾ%CZBEBB!CZB!BƱCB8 B3YCZBEBBƱCB8 B6ECBuBDH|iCZBEBB6ECBuBC BuB*Ujun۱CZBPH(BƱCB!B!CZB!BPehѼLƱCE'BPH(BƱCB!Bn۱CZBPH(B7i+ܽ?/n۱CZBPH(BƱCZBZ+BƱCE'BPH(B1Vw}=Rw>ƱCB ;BѱCB ;BƱCB:B7x&=צh>ƱCZBƱCZB>CZBFAB>CBFABѱCB ;B'>o>r>CBVHBCB,FB>CBFAB>h>9r>CBVHB>CBFAB;CZBVHBaBޯ>}Ԩ>;CZBVHB>CBFABCZBFAB.?;.C[BBCBB6ECBuB(R3C[BuBC[BB6ECBuB)J| g6ECBuBƱC[BYBC[BuB)[D W#1ƱCB8 BƱC[BYB6ECBuBmTA>{>ƱCͣB5B2ȱC[B5BƱC[B4BsE>6s>ƱCB:B2ȱC[B5BƱCͣB5BsE>s>ƱCB:BѱCB ;B2ȱC[B5BGXP>y>ѱCB ;B](C[B ;B2ȱC[B5BA4> ?CBFABC[B?B](C[B ;BnB4> ?CBFAB](C[B ;B>CBFABS>>>CBFAB](C[B ;BѱCB ;BX=q> >>CBFABCB,FBCBFAB@,R77C[BuBƱC-BuBƱCBnB?,}7]7C[BuBƱCBnBC[BB*\-8}9C[BBƱCBnBCBjB(xQm_ (C[BuBƱC[BYBƱC-BuBZD>I~>.CB5BƱC[B4B2ȱC[B5B1PC>>ƱCBe.BƱC[B4B.CB5B!??C B ;BCB8B.CB5B$D? ?C B ;B.CB5B](C[B ;B)S*>!>](C[B ;B.CB5B2ȱC[B5B"x{?2>](C[B ;BC[B?BC B ;B5FL>-ƱC!BuBC,BuBC,B'BX5 D>A.ƱC!BuBC,B'BƱCBnBC,;=N:ƱCBnBC,B'BCBjBlH>vƱC!BuBƱC,B BC,BuB&g@>,[->ƱCnBPH(Bn۱C,BPH(BƱC,BF$B`o>->ƱCB.Bn۱C,BPH(BƱCnBPH(B]Mr>>;C,B.Bn۱C,BPH(BƱCB.Bz? ?;C,B.BCIB5BC,B1B,[@?ƱCB.BCIB5B;C,B.B[+Z(??>ƱCB.B.CB5BCIB5BuJC>>ƱCB.BƱCBe.B.CB5B;y? ?.CB5BCB8BCIB5B`M.֭>!&C7aBāBC,B'BC,BuB?+T>$B+=UC7aBuBC7aBāBC,BuBS"?{ƱCRB!BC,BuBƱC,B BSd!?{ƱCRB!B1C7aB!BC,BuB2c >1C7aB!B=UC7aBuBC,BuBW%?.!>ƱC,BF$B1C7aB!BƱCRB!B+W?N!>ƱC,BF$Bn۱C,BPH(B1C7aB!BtL#?ke>n۱C,BPH(BkC7aBPH(B1C7aB!BD2i.?>C5B.BC7aB )BkC7aBPH(B`/0?0>C5B.BkC7aBPH(B;C,B.BC| ?N>;C,B.BkC7aBPH(Bn۱C,BPH(BӤ? ?;C,B.BC,B1BC5B.B?C7aBāB=UC7aBuBC?[BuB33?=UC7aBuB1C7aB!BCKB!B3ܳ3?C?[BuB=UC7aBuBCKB!BX1u1?G>1C7aB!BkC7aBPH(BC~BPH(Bي1ي1?sG>CKB!B1C7aB!BC~BPH(Bd0a1?ν>kC7aBPH(BC7aB )BC~BPH(BILە!`CZBB`CYBuB>CZBuB E{j}C~%B!BCB!BCZBEBBˌ`C~%BBC~%B!BCZBEBB|w `C~%BBCZBEBB>CZBuBI/ !`C~%BB>CZBuB`CYBuB\ &C~%B!BC~%BE%BCB!BK(>CZBuBC BuBCBBČD(>CZBuBCBB`CZBBѾѾQ`CZBBCBB`CBBy y &>CZBuBCZBEBBC BuB>Kj>m>CBVHBCBVHBCB,FBwʾbj_`CѳB BC[BBgC[B B1xʾ蜒i_`CѳB B`CBBC[BBپТGY`CBBCBBC[BBD4ܖ>: ?CBFABoŲC[BFABC[B?Bk?x- ?oŲC[BFAB`CnABVHB`C[BIGB->h?CBFAB`CnABVHBoŲC[BFAB-!?KU?CBFABCBVHB`CnABVHB=>>CBFABCB,FBCBVHBJ1΀<\jgC[B BCBjBڗCB BξUE dC[BBCBjBgC[B B2??C B ;BMCB ;BCB8B,?>MCB ;B`C;1BFAB`CB?B ~?>C B ;B`C;1BFABMCB ;B?>C B ;BoŲC[BFAB`C;1BFAB}"Ry?/>C B ;BC[B?BoŲC[BFABhh? ?oŲC[BFAB`C[BIGB`C;1BFABȓ U>aڗCB BC,B'B<ٲC,B B;>@kCBjBC,B'BڗCB B[: ??CIB5BvC,B5BC,B1BH ,?߄?vC,B5B`C*B ;B`C,B7BS .+??CIB5B`C*B ;BvC,B5Bv?d ?CIB5BMCB ;B`C*B ;Bx<?W ?CIB5BCB8BMCB ;B*j?>MCB ;B`CB?B`C*B ;B4=߾'p>P<ٲC,B B`C7aBB`CB Bg׾>US<ٲC,B BC,B'B`C7aBB 뾿>ǂIC,B'BC7aBāB`C7aBB޾6?_ ?C5B.BSC7aB.BC7aB )Bܤu89?K?SC7aB.B`C&B5B`C7aB/B`49??C5B.B`C&B5BSC7aB.Bjf"??C5B.BvC,B5B`C&B5Bhg"?B?C5B.BC,B1BvC,B5B ,?*?vC,B5B`C,B7B`C&B5B6þX'?RX'`C7aBBC7aBāBC?[BuBm᱾1?3!`CBuB`C7aBBC?[BuBᾤa?])`CBuBC?[BuB`CmB!Bk`?_C?[BuBCKB!B`CmB!B|;[?>`CmB!BCKB!B`CBPH(B_ؾY_?KE{>CKB!BC~BPH(B`CBPH(B߾6? ?C7aB )BSC7aB.B`CEB.BZ޾O6? ?C7aB )B`CEB.BC~BPH(B\ĘG?λ>C~BPH(B`CEB.B`CBPH(BuM+9??SC7aB.B`C7aB/B`CEB.BNC$ !P`CZBB.CZBB.CIhBuBR#9$#2`CYBuB`CZBB.CIhBuBR8$#2.CIhBuB`C~%BB`CYBuBvt'E.C~%BB`C~%BB.CIhBuBGʾg.C((B B`CBBCB BGʸʾzg.C((B B.CZBB`CBBR..`.CZBB`CZBB`CBBY %pCB B`CBB`CѳB BO0x*?$?`CnABVHB:C[BVHB`C[BIGB2~A??`C;1BFABTCBFAB`CB?B㲄CJ?5?TCBFAB.CBVHB.CBҵBBnAJ? 6?`C;1BFAB.CBVHBTCBFAB&_0?)?`C;1BFAB:C[BVHB.CBVHBր0??`C;1BFAB`C[BIGB:C[BVHB1ҽ mV?[ ?`C,B7B.CYB ;B.C,B~8BJ?Y?`C*B ;B.CYB ;B`C,B7B"~A?܋?`CB?BTCBFAB.C>BFAB~eA??`CB?B.C>BFAB`C*B ;B:rS? ?`C*B ;B.C>BFAB.CYB ;B@>=J?<?TCBFAB.CBҵBB.C>BFABӡڻq;>=}^`CB B.C7aBB.CB BB<>h`C7aBB.C7aBB`CB BM?9?`C7aB/B.CfB5B.C7aBh/BM?9?`C&B5B.CfB5B`C7aB/B)~fL?FM?.CfB5B`C&B5B`C,B7B6ҽ?kV?O^ ?.C,B~8B.CfB5B`C,B7B>1C֕B!B.CBPH(B.C֕B/Z"B3=t?>1C֕B!B`CmB!B.CBPH(B<`CmB!B`CBPH(B.CBPH(B' ܼ' \??.CBPH(B`CBPH(B.CbB.BLpdW? ?`CBPH(B`CEB.B.CbB.BaM?H?.CbB.B`CEB.B`C7aB/B&M???.C7aBh/B.CbB.B`C7aB/B#] y? i.C֕B:!B1C֕B!B.CB!B@=t?G>1C֕B!B.C֕B/Z"B.CB!B@W=U BW.CZBB7CZBtB7CBuB"<ڴfT.CIhBuB.CZBB7CBuB<-qfT7CBuB.C~%BB.CIhBuBp}< p}W7C~%BB.C~%BB7CBuB8'j=Q̾'jCB B.CZBB.C((B B/j=̾&jCB B7CBjB.CZBB$j=̾*'j7CBjB7CZBtB.CZBB v=lsuCB B7CB B7CBjB=4Z??7CBJABCBFAB7CBFABM=9QP??.CBҵBB7CBFABCBFABI=UP?qz?.CBҵBB.CBVHB7CBFAB\.C,B~8B7C*B ;B7C,Bٓ6B>NT?e?.CYB ;B7C*B ;B.C,B~8Br=Z?h?CBFAB7CBJAB7C*B ;B=Z?_?CBFAB7C*B ;B.C>BFAB>:rS? ?.C>BFAB7C*B ;B.CYB ;BQ=OP??CBFAB.C>BFAB.CBҵBBk>e?hI0.CB B7C7aBB7C'B B>f>_D.C7aBB7C7aBB.CB B >T?֊>7C7aB+BpC7aB.B7CyB.Btp>.F??.C7aBh/B7CyB.BpC7aB.Bp>1F?-?.C7aBh/B.CfB5B7CyB.B^T>^T??.CfB5B7CB5B7CyB.B@R>@R?"?7CB5B.CfB5B.C,B~8Ba9>Y?">7C,Bٓ6B7CB5B.C,B~8B>j/?7C7aBB.C7aBB.CBuB >&u)?&u)7C4BuB7C7aBB.CBuB>C6Y?K`6C֕B!B.CBuB.C֕B:!BI#>3Y?K`6C֕B!B7CB!B.CBuB> _?.H'7CB!B7C4BuB.CBuB]>U?ɭ>.C֕B/Z"B7CB!B`6C֕B!BU]>U?[>.C֕B/Z"B.CBPH(B7CB!B[ >ml?=.CBPH(B7ChBPH(B7CB!B>T?>pC7aB.B7C7aB+B7ChBPH(BF >T?6>pC7aB.B7ChBPH(B.CbB.B*>ǪP?>.CbB.B7ChBPH(B.CBPH(B)q>]-F?ϐ?pC7aB.B.CbB.B.C7aBh/B)>(1Y?aK`6C֕B!B.C֕B:!B.CB!Bd>U?^>`6C֕B!B.CB!B.C֕B/Z"Bg*>*B7CBuB7CZBtBŵCZBuB'>.BŵCZBuB7C~%BB7CBuB9>NYBŵCZBuB^ȵCZBB7C~%BBx8>߾LQ^ȵCZBB^ȵC~%BB7C~%BB>!枾 T^ȵC8kBuBŵCZBuB7CZBtB>+T^ȵC8kBuB7CZBtB^ȵCB0Bj> K^ȵCB0B7CZBtB7CBjB>gTŵCZBuB^ȵC8kBuB^ȵCZBB ?XhNNC[B B7CBjB7CB B  ?~hNNC[B B^ȵC[BB7CBjB?GT^ȵC[BB^ȵCB0B7CBjB >=V??>^ȵC[B`>HBĵC[BVHB^ȵCBVHBs$?x=yC^ȵC[BBORCB B^ȵCB*'Bc?f B{TNC[B BORCB B^ȵC[BB>3R?>7CBJAB^ȵCpBFAB^ȵCB- N?X>7CBFAB^ȵCpBFAB7CBJAB>V?Z>ĵC[BVHB^ȵC[B`>HB^ȵCpBFAB]>vV?>ĵC[BVHB^ȵCpBFAB7CBVHBeF>N?>7CBVHB^ȵCpBFAB7CBFAB1?{>=,^ȵCB*'BC,B B^ȵC,BהBH"?sX)>2AORCB BC,B B^ȵCB*'B^>N?>^ȵC,BJ:/B+C,B5B^ȵCB5B+>BG?`>7C,Bٓ6B^ȵCB5B+C,B5B +>AG? d>7C,Bٓ6B7C*B ;B^ȵCB5B>O?Vl>7C*B ;B^ȵC$B ;B^ȵCB5B]:>`9J? %>^ȵC$B ;B7C*B ;B7CBJAB>WR?L>^ȵCB-7C7aB+B^ȵCBPH(BIC7aBPH(Bܪ?3?8>7C7aB+B7CyB.B^ȵCBPH(B ?C?e>7CyB.B^ȵCLB.B^ȵCBPH(Bh>0N?^>+C,B5B^ȵC,BJ:/B^ȵCLB.B_>AN?ؤ>+C,B5B^ȵCLB.B7CB5Bt<?V^9?X>7CB5B^ȵCLB.B7CyB.B<,>AG?b>+C,B5B7CB5B7C,Bٓ6B??0C7aBuB7C7aBB7C4BuB2?!2?&`C7aB!B0C7aBuB7C4BuB(F*?);? 7CB!B`C7aB!B7C4BuBwm+?)=?A=IC7aBPH(B`C7aB!B7CB!BV$?B?=7ChBPH(BIC7aBPH(B7CB!By?e3?V7>IC7aBPH(B7ChBPH(B7C7aB+BCJy>?CtB¿NBCZBRLB;CZBVHB EJ>S?CtB¿NB;CZBVHBEeC~%B¿NBJ8gNJ>>EeC~%B¿NB;CZBVHBC~%BVHBR >>EeC~%B¿NBC~%B{QBCtB¿NB=l>>;CZBVHBCZBRLBCBVHBFJ>?CtB¿NBCZB¿NBCZBRLBRw>>C~%B{QBCZB¿NBCtB¿NBMR>p>C~%B{QBBҲC~%B(UBCZB¿NBW3>N ?BҲC~%B(UB\CZB(UBCZB¿NB]{ ? ?`C~%B\[B`CZB^QUB\CZB(UB|616>k(?BҲC~%B(UB`C~%B\[B\CZB(UB)/?G?CBVHB`CB¿NB`CBNB3{>r?CBVHB`CB¿NBCBVHB, ?O?CBVHBCZB¿NB`CB¿NBK=&>=>CBVHBCZBRLBCZB¿NBA0*0?]>CZB¿NB\CZB(UB`CYmB(UB-}+,??`CB¿NBCZB¿NB`CYmB(UB>>?N ?\CZB(UB`CZB^QUB`CYmB(UBu!]?`?CBVHB`CBNB`CnABVHBJh'?)>CZB=[B`C~%B\[BeC~%B=[BaV ??`CZB^QUB`C~%B\[BCZB=[B!3?p?.CBzaB.CZB\BCZB=[Bg-],?k?.CBzaBCZB=[B2 C~%BzaBW#\?$*?2 C~%BzaBCZB=[BeC~%B=[Bib?t ?2 C~%BzaB.C~%B6cB.CBzaBR/?$?`CB¿NBhcCB¿NB`CBNB#r+5?ٶ ?hcCB¿NB.C!B(UB.CBN TBYN!?G?hcCB¿NB`CB¿NB.C!B(UB \?!?`CB¿NB`CYmB(UB.C!B(UB$?2?`CZB^QUBCZB=[B.CГB=[B"??`CZB^QUB.CГB=[B`CYmB(UB '?)?`CYmB(UB.CГB=[B.C!B(UB')?u?CZB=[B.CZB\B.CГB=[BFȾwzLB*9L?,?.CB¿NB7CB¿NB.C[BDKB I?Y?.CBN TBaCB(UB7CB(UB/ I?u?.CBN TB7CB(UB.CB¿NB㞽:S?V?.CB¿NB7CB(UB7CB¿NBEnS?k ?aCB(UB7CBUB7CB(UBLLB7CBVHB.C[BDKB' Ifc?>7CZBv_B^ȵC{BzaB^ȵCZBF_BJ `U?L ?7CBzaB^ȵC{BzaB7CZBv_B`G??7C~%BShBC~%BdhB^ȵCBdhB`G??7C~%BShB^ȵCBdhB7CBzaB9ʦa^?->7CBzaB^ȵCBdhB^ȵC{BzaB[s4X?>C~%BdhB^ȵC~%BkB^ȵCBdhB>^?>^ȵCBJSB~S?F ?7CBUB^ȵC.B(UB~S? ?7CBUB7CB=[B^ȵC.B(UBmh)=ga?M>7CB=[B^ȵCzB=[B^ȵC.B(UB"d =U?%Z ?^ȵCzB=[B7CB=[B7CZBv_B ' fc?>^ȵCZBF_B^ȵCzB=[B7CZBv_B:>bM?û?7C[B>LB^ȵCBVHBĵC[BVHB,>M??7C[B>LB7CB¿NB^ȵCBVHBA>mX?>7CB¿NB^ȵCXB¿NB^ȵCBVHBy>]^?5>~^?>~#RN? ?7CB(UB^ȵCXB¿NB7CB¿NB>S? ?~M??ĵC[BVHB7CBVHB7C[B>LBϾ9g6/CA B/C.A˟BCA˟B&c-Q/C.A˟B/C'^AjBCAjBTѾ.|ieCA˟B/C.A˟BCAjB'`BYC]AmCC射ACոCACàjO>آCAmCC]AmCոCAC-If2>C射ACCACոCAC/qG%ʹCuA B%ʹCe.tAԞCCf~A Bľ-GlE_E9=%ʹCvAmC%ʹCxACC]AmC_ e+U >C]AmC%ʹCxACC射AC3cOT8>'CAaCCACC射ACJi8>'CAaCC射AC%ʹCK|AaC Up=%ʹCK|AaCC射AC%ʹCxAC%"E>%ʹCK|AaC%ʹC㜀A< CSCA< CrJ8>'CAaC%ʹCK|AaCSCA< Cw!*$9e@>%ʹC㜀A< C%ʹCA C䜹CA C2CR6_>SCA< C%ʹC㜀A< C䜹CA C3teMCmA BMC6lAԞC?ܹCqsAԞC52tLQsCqsA BMCmA B?ܹCqsAԞC͏nPMC6lAԞCMCjA#9CCqsA#9CJ1dt1bCqsA< C386Y,m=c4CqsAaCMCUkAaC>bCqsA< CFI0=MCnA< CMCzrA C_CqsA Cki.Q=>bCqsA< CMCnA< C_CqsA Cˆt!Q?ܹCqsAԞC%ʹCuA BsCqsA BCu sNQH%ʹCe.tAԞC%ʹCuA B?ܹCqsAԞCUPsL#;bCqsA< C%ʹCK|AaCc4CqsAaCzL~>%ʹC㜀A< C%ʹCK|AaC>bCqsA< C="M=_CqsA C%ʹC㜀A< C>bCqsA< Ce>!s@QG>%ʹCA C%ʹC㜀A< C_CqsA C%ʹCA C%ʹCA C䜹CA CTG\>MCzrA CMCqsA# C_CqsA Czb#9<`>%ʹCA CCAOq C%ʹCA C` j?\a>_CqsA CCAOq C%ʹCA CfN*E:U+>_CqsA CMC-4xAOq CCAOq CE'_CqsA CMCqsA# CMC-4xAOq CX5M/!&>MC-4xAOq CMCB~A CJ$CA Cl(j8/^>CAOq CMC-4xAOq CJ$CA CsA! )>MCB~A CMC{AC)aCAC3M.TU>J$CA CMCB~A C)aCACuMC{ACMCeA=@C͉CA=@CmB">)aCACMC{AC͉CA=@CpLY$>MCeA=@CMCA6C͉CA=@CZL#>HźCqsAOq CMCqsA# CMCzrA Cu7xHz'>HźCqsAOq CMCzrA CtdCAdAOq CL#SZ=tdCAdAOq CMCzrA CtdC+aA C܂&p]Ay=tdCAdAOq CtdCfA CCqsA C I2;>HźCqsAOq CtdCAdAOq CCqsA C̀4X4t=tdCfA CtdC]iACCqsACr%@j=CqsA CtdCfA CCqsAC7Bu&&g%=tdC]iACtdCRkA=@C,CqsA=@C4I4I=CqsACtdC]iAC,CqsA=@C LVzKrS5CqsACtdC7kAC*1CqsAtCT]RPtdC^JiAtCtdCeA+CX$CqsA+C%X4X*1CqsAtCtdC^JiAtCX$CqsA+Ce4߾ĽtdCeA+CtdC_A{C.CqsA{CC]gBRX$CqsA+CtdCeA+C.CqsA{C $BY}1>HźCqsAOq CMC-4xAOq CMCqsA# C!\CG>CqsA CMC-4xAOq CHźCqsAOq C/-G5&A+>MCB~A CMC-4xAOq CCqsA C0Y6k?>CqsACMCB~A CCqsA C8:)]1>MC{ACMCB~A CCqsACMCeA=@CMC{AC,CqsA=@CsJ3R>MCeA=@CCACMCA6CF>F?>MCeA=@C,CqsA=@CCAC+S<o =,CqsA=@CS5CqsACCACTmM S5CqsAC*1CqsAtCCACZZo/=*1CqsAtCCAtCCAC9Z"^:Z*1CqsAtCX$CqsA+CCAtC!4e]Dm.=X$CqsA+CCA+CCAtCe1,TYX$CqsA+C.CqsA{CCA+CXlľɘ<.CqsA{CºCA{CCA+CWG2><1C$'@AC1C?A+C.C$'@A+C߁P` eQ1C?A+C1Cq6A{CyC$'@A{ChGF.C$'@A+C1C?A+CyC$'@A{C< -U <1CWRA C1CRAOq C:ڻCYAOq CE2L_>==ƻCYA C1CWRA C:ڻCYAOq CjN<1CRAOq C1CbSA CCYA C U)B=:ڻCYAOq C1CRAOq CCYA C#AD.1CbSA C1CSACCYAC:N[<CYA C1CbSA CCYAC 17-<1CSAC1CaQA=@CCYA=@C#Dk>gCYAC1CSACCYA=@C>|(5ѽ1CaQA=@C1CgMACڻCYAC167ңyCYA=@C1CaQA=@CڻCYACLFRy@z1CgMAC1CFGAtCCYAtC>tZ(`}ڻCYAC1CgMACCYAtCbE691CFGAtC1C$'@AC.C$'@A+C$(E91CFGAtC.C$'@A+CCYAtCQyCYAtC.C$'@A+CJCYA+CNbM.C$'@A+CyC$'@A{CJCYA+C`CX)+yC$'@A{C~CYA{CJCYA+CA[ԿG=:ڻCYAOq CtdC+aA CƻCYA C̑O=tdCAdAOq CtdC+aA C:ڻCYAOq CtdC_ACtdC*oA C!]CqsA Cuz>;CqsACtdC_AC!]CqsA Cwu]QQ>tdC*oA CtdCqsAm C!]CqsA CKluľ.CqsA{CCqsACCºCA{C`p~᯾Ǔ<CqsACCƺCACCºCA{Chp篾G[<CqsACCCqsACƺCACC<t=CqsAC\ԺCACƺCACCsq=CqsAC"CqsAixC\ԺCACut="CqsAixCCAixC\ԺCACNun?j="CqsAixC;CqsACCAixCZv`Ns7>;CqsACCACCAixCzw.OZX >;CqsAC!]CqsA CCACzw-X /O>!]CqsA C;CA CCACKivN;e>tdCqsAm CtdCA "C;CA C=w0 S>!]CqsA CtdCqsAm C;CA Ci[41C-&A*C1Cm"AC3C-&AC d ߾Aҽ1Cm"AC1CbAixC( C-&AixC^K=3C-&AC1Cm"AC( C-&AixCxln1CbAixC1C\ACRC-&ACHe߾V'T( C-&AixC1CbAixCRC-&ACaqT2ݬ1C\AC1CbDA C5C-&A C=m ԴC-&A#CC$'@A#CֻC$'@AWG"C~zA*2=1C-&AR%C1C}(A{%CkC$'@A{%Cyz[22=1C-&AR%CkC$'@A{%CC-&A#CyxMKuM >C-&A#CkC$'@A{%CC$'@A#CW+2yC$'@A{CֻC$'@ACC~CYA{C c9龮iֻC$'@ACClCYACC~CYA{C6g ־ptdCYAC@C$'@ACtdCWAC*g־MtdCYAClCYACC@C$'@AC.3bNlCYACCֻC$'@ACC@C$'@ACPhr־#GC$'@AixCtdCWAC@C$'@ACmmuֻC$'@AWG"CCYAWG"CCYA CxgK0>ֻC$'@AWG"CC$'@A#CCYAWG"C+xE]#4>C$'@A#CһCYA#CCYAWG"Cnz``f >C$'@A#CkC$'@A{%CһCYA#C4z 뽞5>kC$'@A{%CTCYA{%CһCYA#CJaIP!lCYACCtdC_A{C~CYA{Cجe߾?tdC@[ACCtdC_A{ClCYACC4eo߾lCYACCtdCYACtdC@[ACC0vEn=GqCYACtdC_ACtdCYAμC/u9=CYA CtdC_ACGqCYACwNY*>tdC*oA CtdC_ACCYA COt RR>tdC*oA CCqsAWG"CtdCqsAm CBt]VR>tdC*oA CCYA CCqsAWG"Cx,D(>CYA CCYAWG"CCqsAWG"CEx|,C4>CYAWG"CһCYA#CCqsAWG"C[w0KY>һCYA#C CqsA#CCqsAWG"C9y%&5>һCYA#CTCYA{%C CqsA#Cxmܴ b>TCYA{%CCqsA{%C CqsA#C?w_ XT>kCAWG"CtdCqsAm CCqsAWG"CPu#o>tdCA "CtdCqsAm CkCAWG"Cwެ %"Y>CqsAWG"C CqsA#CkCAWG"Cṳ$f> CqsA#CݤCA#CkCAWG"C-xe.b> CqsA#CCqsA{%CݤCA#C.w3_M>CqsA{%CZۻCA{%CݤCA#C+Fxu030>1C}(A{%C1C$'@A&CkC$'@A{%Czz@:>1C$'@A&C1C[CAF'C CYAF'Cb{ù}2>1C$'@A&C CYAF'CkC$'@A{%C@y$HJ>kC$'@A{%C CYAF'CTCYA{%Czs2:>1C[CAF'C1CYA'C CYAF'Czyŵ5J>TCYA{%C CYAF'CCqsA{%C=y(_> CYAF'CCqsAF'CCqsA{%Cy!DUg>1CYA'C1CqsA (CCqsAF'CJ{/#:> CYAF'C1CYA'CCqsAF'Cy|5t_>CqsA{%CCqsAF'CZۻCA{%C1w!>CqsAF'CCAF'CZۻCA{%Chw)p<}>1CqsA (C1CA(CCAF'CXyg>CqsAF'C1CqsA (CCAF'C" u)8u)^ȵClABClA'iBCAdB. u)2u)^ȵCAdB^ȵClABCAdBؙe"CV6^ȵCyA|BCyAIBCAt/By))^ȵC ^At/B^ȵCyA|BCAt/Byy))CAt/B^ȵClAB^ȵC ^At/BRμB1ClA'iB^ȵClABCAt/B݅(B^ȵCbLAD'BCbLA- BClAB7܉9^ȵCsAB^ȵCbLAD'BClABx}9ClAB^ȵCyA|B^ȵCsAB%o?CyAIB^ȵCyA|BClABzH^ȵCABCABCDAA6By)D^ȵCdA6B^ȵCABCDAA6BޘڢDCDAA6B^ȵCbLAD'B^ȵCdA6BLFCbLA- B^ȵCbLAD'BCDAA6BaB**bCԹABbC6AdBCԹAdB𲠾D>&zR1bClAOBbCkAt/B\ClAt/B1`**CԹAdBCAdBClA'iBak*y*bCԹABCԹAdBClA'iBh^=&S1bCԹABClA'iB\ClAt/B;=&SS1bCԹAB\ClAt/BbCkAt/BSpZȘ0/@3t0`C/AdB%ʹCAdB%ʹCuACBAp3=0MC/A(B`C/AdB%ʹCuACBG14.MC/A(B%ʹCuACB7MCuAt/BoJ:4.MC/A(B7MCuAt/BMCAt/BM]+67MCuAt/B%ʹCwAt/B%ʹCԹAB)M+&67MCuAt/B%ʹCԹABMCuABBj#AMCuAB%ʹCԹABMCԹA'Bh|O,57MCuAt/B%ʹCuACB%ʹCwAt/BLp" gS%ʹClAsBMClA[BMCABROM%ʹC&AB%ʹClAsBMCABg{MMCAB%ʹCԹAB%ʹC&AB+y< QMCԹA'B%ʹCԹABMCABXGh[%ʹCyA fBMCyABMCA6BR0 ӡV%ʹCw!A6B%ʹCyA fBMCA6B VMCA6B%ʹClAsB%ʹCw!A6B|ZMClA[B%ʹClAsBMCA6B+!,:,dMCyAB%ʹCyA fBMCbLA~B+!,:,dMCbLA~B%ʹCyA fB%ʹCbLAB}7ؾf%ʹCAKBMCA#BMC4AB?Zؾmf%ʹC AB%ʹCAKBMC4AB;OؾfMC4AB%ʹCbLAB%ʹC AB9ؾfMCbLA~B%ʹCbLABMC4AB|3i3MC/A(BtdC/ATBtdCAdBw6Z0MC-IAdBMC/A(BtdCAdBtʽ!42!4MCuABtdCuAhBtdC|At/Bwʽ"4o 4MCAt/BMCuABtdC|At/B#ͽ681tdC|At/BMC/A(BMCAt/BH3C3tdC/ATBMC/A(BtdC|At/B/ GtdCԹABtdC4ABCԹABGtdC4ABMCԹA'BCԹABeGtdC4ABtdCuAhBMCԹA'B$ڽ<$$͉BtdCuAhBMCuABMCԹA'BNួrVJSCԹABMCABMClA[B 㞽V6SCԹABMClA[BtdCԹAB2DW #CWtdCԹABMClA[BtdClABួVSCԹABMCԹA'BMCAB ߼ _MCyABtdCyAwBtdCA6BSךW[MCA6BMCyABtdCA6BR[tdCA6BMClA[BMCA6Bd^XN^tdClABMClA[BtdCA6B[sX?rctdCyAwBMCyABtdCbLAVXB+dtdCbLAVXBMCyABMCbLA~BR f_޾3fMCA#BtdCABtdCABJ پgMC4ABMCA#BtdCAB^J> پgtdCABMCbLA~BMC4AB,޾0ftdCbLAVXBMCbLA~BtdCABa|4O4tdC/ATB1C/A7]B1CAdBa-44tdCAdBtdC/ATB1CAdB@6sj3@6tdCuAhB1CuAk5B1C At/B!B404tdC|At/BtdCuAhB1C At/BBv441C At/BtdC/ATBtdC|At/BƴcN3(61C/A7]BtdC/ATB1C At/BLLtdCԹAB1CԹAB1CABsT,HtdC4ABtdCԹAB1CABsu/H1CABtdCuAhBtdC4ABL0hL1CuAk5BtdCuAhB1CAB Vq V1CԹABtdCԹAB1ClAlBN|׼ N|W1ClAlBtdCԹABtdClAB߼ _tdCyAwB1CyAB1C>>A6B߼ _tdCA6BtdCyAwB1C>>A6B ߼ _1C>>A6BtdClABtdCA6BK ߼K _1ClAlBtdClAB1C>>A6BFiʍ$rc1CyABtdCyAwB1CbLA>B?rX?rc1CbLA>BtdCyAwBtdCbLAVXB+侺dtdCAB1CAaB1C.ABGj q߾CftdCABtdCAB1C.ABj [߾Bf1C.ABtdCbLAVXBtdCAB**d1CbLA>BtdCbLAVXB1C.ABxXHJC]ABCA,kBC]A,kB7p\]zCA,kBCA˟BEhC]A˟B*\M\xC]A,kBCA,kBEhC]A˟B Uy=C/ASBCABC/AB*]L^ȵC/A>BC/ABCAB%L^ȵC/A>BCAB^ȵCY0A6BW8!L^ȵCY0A6BCABC䛕A6BhXNJC]A,kBC䛕A6BC]ABXNJC]A,kB^ȵCA,kBC䛕A6B%W"P^ȵCA,kB^ȵCY0A6BC䛕A6Bw\gxEhC]A˟B^ȵCA,kBC]A,kB1>Gx\*p^ȵCK9A˟B^ȵCA,kBEhC]A˟BOa-\7=wC]AjB^ȵCK9A˟BEhC]A˟BP +BWh=^ȵC.TAjB^ȵCK9A˟BwC]AjB{VMO=C]A.YB^ȵC.TAjBwC]AjB V =C]A.YBC A B^ȵC.TAjB@HxP>C A B^ȵCA B^ȵC.TAjB]p͙̾34^ȵCuAVBCuA+BC'APB'zξ4^ȵC{APB^ȵCuAVBC'APB*ݾGAC/ABC'APBC/ASB˔߾ފ@$C/AB^ȵC/ABC'APB\wݾA^ȵC/AB^ȵC{APBC'APBmRB^ȵC/AB /&!^ȵCԹAфBCԹABCjAB"@/m^ȵCAB^ȵCԹAфBCjABNOǾo7CjAB^ȵCuAVB^ȵCABl̾3CuA+B^ȵCuAVBCjAB"0CAdB^ȵCԹAфB^ȵCAdB菻~03CԹAB^ȵCԹAфBCAdBg;cTRƾbC]A]BbCriA6B߶C]A6B ھ]aȅRC]AB߶C]A6BbCriA6Bھa{RC]ABbCriA6BCA,kBσܾ`jXCA,kBbCriA6BbCRA,kBEmྔdѽbCRA,kBbCڊA˟BCA,kB]UaCA,kBbCڊA˟BCA˟BxWa2;bCڊA˟BbCAjBCA˟BO_6BMCAPBEEyOߙ %ʹCAPB%ʹC]A@lBMCAPBab徬hCABMCAPBMCABv";a9f徬hCAB%ʹChTABMCAPBOgZJ%ʹChTAB%ʹCAPBMCAPBgw)#jFܸhCAB%ʹCA$B%ʹChTABnFPdD31%ʹC/A8-B`C/AdBMC-IAdB_QB%ʹC/A8-BMC-IAdB%ʹCZABIB%ʹC]A@lBMCsAB9HP4D2`C/AdB%ʹC/A8-B%ʹCAdBy罁GtdC]ATBtdC CABYC]AB3&RNpMC]A>BYC]ABtdC CABSSR MC]A>BtdC CABMCAPB$TI MCAPBtdC CABtdCeȊAPBcwb%tdCeȊAPBMCABMCAPBatdCABMCABtdCeȊAPBW⽱JCYC]ABtdCAdBtdC]ATBC㽓JYC]ABMCsABtdCAdBj;lF2MCsABMC-IAdBtdCAdB$、T| YC]ABMC]A>BMCsABFl= tdC]ATB1C]A.B1CfABzo@H{MtdC CABtdC]ATB1CfAB2W 1CfAB1CAPBtdC CABK\9U tdC CAB1CAPBtdCeȊAPBnjctr꾜1CAPBtdCABtdCeȊAPBsjcs꾜1CArtBtdCAB1CAPB}fJC A BCDAԞC^ȵCA BPGAI>^ȵCA BCDAԞC^ȵCPџAԞCv kCxp>C/A#9C^ȵC/AKC^ȵCPџAԞC3@u>C/A#9C^ȵCPџAԞCCDdA#9CD F7R>CDdA#9C^ȵCPџAԞCCDAԞC_*)^6_>CDdA#9CCRAsCdC/AsC(?&&>C/A#9CCDdA#9CdC/AsC2(3މ>CRAsCC/ACdC/AsC4(@Wu>C/A#9C^ȵCA#9C^ȵC/AKC) ?&>dC/AsC^ȵCA#9CC/A#9C(\0ە>^ȵCAsC^ȵCA#9CdC/AsC%-\>^ȵCAsCCuAmC^ȵCuA%Cy%-Z>dC/AsCCuAmC^ȵCAsCL5$'V>dC/AsCCqAmCCuAmCJ5$ V>dC/AsCC/ACCqAmC)<.V_>CqAmCCEACdCuACէ1Z!E>CuAmCCqAmCdCuAC8/ĸ>CEACCuACdCuAC4 >>CuAmC^ȵCAmC^ȵCuA%CK1$->^ȵCAmC]ϵCԹAC^ȵCԹAGC6Y1!K>^ȵCAmCCuAmC]ϵCԹAC%?6 >CuAmCdCuAC]ϵCԹAC?E_A>CuACCAaCCCԹAaC@E'=>CuACCCԹAaCdCuAC~ <*>dCuACCCԹAaC]ϵCԹACJB6h5>CAaCCԹA CCCԹAaC2>B>]ϵCԹAC^ȵC~AC^ȵCԹAGC 0;A>^ȵC~AC]ϵClAaC^ȵClA+Cm>;`>^ȵC~AC]ϵCԹAC]ϵClAaCyG->]ϵCԹACCCԹAaC]ϵClAaCqP¾x>CԹA CC̽A< CkSClA< C_OCþh>CԹA CkSClA< CCCԹAaC;Bܾ >CCԹAaCkSClA< C]ϵClAaCKR7>C̽A< CClA  CkSClA< CZI?]ϵClAaC^ȵCAaC^ȵClA+CFEI ?^ȵCAaCy CyA< C^ȵCyAĂ C D]p+ ?^ȵCAaC]ϵClAaCy CyA< C}=N?]ϵClAaCkSClA< Cy CyA< CvR+3?ClA  CC2A CCyA CRTDz>ClA  CCyA CkSClA< C4=NYp?kSClA< CCyA Cy CyA< CKzX>?ԵCbLA< C^ȵCyAĂ Cy CyA< CBJls?^ȵCbLAc C^ȵCyAĂ CԵCbLA< C\R _9<?y CyA< CCyA CԵCbLA< C}L6?CyA C6jCbLA CԵCbLA< C2GNٽ|?ԵCbLA< C^ȵC A< C^ȵCbLAc C Eֽ6!?^ȵC A< C_CA C^ȵCAd C Eֽ6!?^ȵC A< CԵCbLA< C_CA C$eN/%+?ԵCbLA< C6jCbLA C_CA C 0T=bCA BbC+pAԞCӶC]AԞC%ݦVT >C]A BbCA BӶC]AԞCwuI" >bC+pAԞCbCA#9CeC]A#9C -iR20>ӶC]AԞCbC+pAԞCeC]A#9C A7>bCA#9CbC宒AsCUC]AsC[(H.A>eC]A#9CbCA#9CUC]AsCe sQAsE>bC宒AsCbC]A(CUC]AsCqW>ӶC]AԞCC A BC]A BMPN->CDAԞCC A BӶC]AԞCO5>eC]A#9CCDAԞCӶC]AԞCALtGQR>CDdA#9CCDAԞCeC]A#9C,(HL.A>UC]AsCCDdA#9CeC]A#9C?#k>CRAsCCDdA#9CUC]AsC!3U9>CRAsC C/AmCC/ACF=>UC]AsC C/AmCCRAsC-w5wL>UC]AsCbC2AmC C/AmCe(Ǹ9LO>UC]AsCbC]A(CbC2AmC]Q6PM)Qq>bC2AmCbCFÚACC/AC>)Q1Wُ> C/AmCbC2AmCC/AC?2Q2&?g>bCFÚACbC/A2CC/AC. *{> C/AmCCqAmCC/ACPV/\+Ô>C/ACCqAmC C/AmCR8\>CEACCqAmCC/AC4G6>CEACͶCuAaCCuAC45>C/ACͶCuAaCCEACC@4>C/ACbCɠAaCͶCuAaC@17>C/ACbC/A2CbCɠAaC.`C b>bCɠAaCbCA< CF4CuA< CO7=)5>ͶCuAaCbCɠAaCF4CuA< C?=>bCA< CbCuA CF4CuA< C+sAws>ͶCuAaCCAaCCuACh>>CAaCFCԹA< CCԹA C>rq>CAaCͶCuAaCFCԹA< CpQHO>ͶCuAaCF4CuA< CFCԹA< CRJ=>bCuA CbCA C*CԹA CSJbCuA C*CԹA CF4CuA< CCe>F4CuA< C*CԹA CFCԹA< CK˾T>FCԹA< CC̽A< CCԹA CF%ƾU7>C̽A< CҶClA CClA  CFCƾ7>C̽A< CFCԹA< CҶClA C!QPʍ>FCԹA< C*CԹA CҶClA CXO0;tK?ҶClA CC2A CClA  C%^g=eCAԞCbCA BCA Bc@Y=bC+pAԞCbCA BeCAԞC{bY=/CAkCbC+pAԞCeCAԞCVgYӾ=/CAkC/CNlA#9CbC+pAԞCBU>/CNlA#9CbCA#9CbC+pAԞC- U<=/CNlA#9C/CoJAsCbCA#9CʗJ2'@>bCA#9C/CoJAsCbC宒AsCD5EmI>[C]AmCbC]A(CbC宒AsC6DCeK>[C]AmCbC宒AsC/CAmC0Lp>/CAmCbC宒AsC/CoJAsCf&//CAmC/C?AC'ܷC]AC5CqR>[C]AmC/CAmC'ܷC]AC@0{0HRc>/C?AC/CGߒAaC'C]AaC$5T:Xs>'ܷC]AC/C?AC'C]AaC.t.Z>/CGߒAaC/C]AfC'C]AaC*Z##=DS>[C]AmCbC2AmCbC]A(Ck#_=Z>'ܷC]ACbC2AmC[C]AmC-1}>bCFÚACbC2AmC'ܷC]AC,,Bݞ>bCFÚACjC/AaCbC/A2C).a>bCFÚAC'ܷC]ACjC/AaC5N'">'ܷC]AC'C]AaCjC/AaC=,KaɊ>/C]AfC/CtA< CBɷC/A< C{;87>/C]AfCBɷC/A< C'C]AaC$2p$q>'C]AaCBɷC/A< CjC/AaC?pb>/CtA< C/CA C$(C/A Cj9g>BɷC/A< C/CtA< C$(C/A C=d:>jC/AaCbCɠAaCbC/A2Ce:r>BɷC/A< CbCɠAaCjC/AaCcAH 5 >bCA< CbCɠAaCBɷC/A< C?v>bCA< CCuA CbCuA C= -#>bCA< CBɷC/A< CCuA CFDQ>BɷC/A< C$(C/A CCuA C TJ:p>CuA CbCA CbCuA CN\=HCA#9C/CNlA#9C/CAkCyA]3o=RuCAsC/CNlA#9CHCA#9CV4=/CoJAsC/CNlA#9CRuCAsC3VH=آCAmC/CoJAsCRuCAsCoM!>/CAmC/CoJAsCآCAmCgMP>ոCAC/CAmCآCAmCkEq;>/C?AC/CAmCոCAC+3E7>CAC/C?ACոCAC5DD>CACC6AaC/C?ACĺ#R;Iq>C6AaC/CGߒAaC/C?AC=)2K>zC]A< C/C]AfC/CGߒAaC..k>zC]A< C/CGߒAaCC8A< CN$<&WQ>C8A< C/CGߒAaCC6AaCq5Н'>C8A< CCQ@A CϸC]A C--->zC]A< CC8A< CϸC]A C4%Zs>zC]A< C/CtA< C/C]AfCf4%Ms>ϸC]A C/CtA< CzC]A< C62;"^>/CA C/CtA< CϸC]A C|F|F>'CAaCC6AaCCACFi>>SCA< CC6AaC'CAaC#=6AR>C8A< CC6AaCSCA< C#䜹CA CC8A< CSCA< CL+0.>CQ@A CC8A< C䜹CA CNYj0?C2A CCyA6 CCyA CN ?CyA6 CCbLAP C6jCbLA CnSe ?CyA CCyA6 C6jCbLA CL<?CbLAP CCAe C_CA C sP'|=?6jCbLA CCbLAP C_CA CG>bCA CbCԹA C*CԹA CJS>bCԹA CbCBAOq C5MClAOq CQӨe>bCԹA C5MClAOq C*CԹA C^:Noð>*CԹA C5MClAOq CҶClA CO>bCBAOq CbClAU C5MClAOq C]LYn2 ?C2A CCyAOq CCyA6 C/LU ?C2A CҶClA CCyAOq C8Vܜ[MI?ҶClA C5MClAOq CCyAOq Cv R*P2?bClAU CbCyAtTCCyAOq CUZe?5MClAOq CbClAU CCyAOq CvSdؽU?oCbLAOq CCyA6 CCyAOq CL'?CbLAP CCyA6 CoCbLAOq CWT"ҽ! ?bCyAtTCbCbLACoCbLAOq C8MUHڽs ?CyAOq CbCyAtTCoCbLAOq CO ?CAOq CCbLAP CoCbLAOq CJҵ?CAe CCbLAP CCAOq CO/<?bCbLACbCACCAOq CͽU ?oCbLAOq CbCbLACCAOq Cv=>/CA C/C/Aa C$(C/A C]IkK>/C/Aa C/C)AOq C^ CuAOq CZI-HR>/C/Aa C^ CuAOq C$(C/A CaCE>$(C/A C^ CuAOq CCuA C RFZ>>/C)AOq C/CuAC^ CuAOq CM1E>bCA C:CԹAOq CbCԹA CzFOI>bCA CCuA C:CԹAOq CJtOҾO>CuA C^ CuAOq C:CԹAOq CGR9þ>/CuAC/CA CPCԹA C'QUMžٞ>/CuACPCԹA C^ CuAOq C (LfDϾd >^ CuAOq CPCԹA C:CԹAOq C(Oۿ:>/CA C/CԹAmCPCԹA CxP>:CԹAOq CbCBAOq CbCԹA CM=>bCBAOq C˷ClA CbClAU CM>bCBAOq C:CԹAOq C˷ClA CUUY>:CԹAOq CPCԹA C˷ClA C$RБ>/CԹAmC/ClA\C˷ClA CVU)?V>PCԹA C/CԹAmC˷ClA C"$VƋ7%?CyA CbClAU C˷ClA ChPyS ?bCyAtTCbClAU CCyA C!Y)?/ClA\C/CAC#CyACY8)?/ClA\C#CyAC˷ClA CS)5j<?˷ClA C#CyACCyA CBU *1 ?/CAC/CyAC#CyACT#ẽj ?%CbLA CbCyAtTCCyA CaNh\?bCbLACbCyAtTC%CbLA ClV꼽\ ?CyA C#CyAC%CbLA CRlfb?#CyACCbLAC%CbLA CL/V)gw ?/CyAC/CbLACCbLACV2k2 ?#CyAC/CyACCbLACO=+?7CA CbCbLAC%CbLA C@LY< T?bCACbCbLAC7CA CST=?%CbLA CCbLAC7CA C N=?CbLACT(CAC7CA C@P=Y?/CbLAC/CA$CT(CACUC=H ?CbLAC/CbLACT(CAC3«%x>CQ@A CC]A CϸC]A Cz=H>/CA CC/AOq C/C/Aa C:<>ϸC]A CC/AOq C/CA CBN6>ϸC]A CCAOq CC/AOq C>@>ϸC]A CC]A CCAOq CwHJܧ>CAOq CCqA C C/A Cq?ߔߵ>C/AOq CCAOq C C/A CF_.>CqA CC/Ah[C C/A C]IK>C/AOq C/C)AOq C/C/Aa CRF'=>/C)AOq CuCuA C/CuACRF9V=>/C)AOq CC/AOq CuCuA C5ME뾞>C/AOq C C/A CuCuA C<T?޾(>C/Ah[CClAC[ظCuAC]Qd>C/Ah[C[ظCuAC C/A CLX$> C/A C[ظCuACuCuA CPھ>ClACCuA?C[ظCuACP}ƾa>uCuA C/CA C/CuACN޿L>>/CA CfCԹAC/CԹAmCnNþ*>/CA CuCuA CfCԹAC$Y"`*>uCuA C[ظCuACfCԹACS[ 7>CuA?CC屷A=@CCԹA=@C[~>CuA?CCԹA=@C[ظCuACVys>[ظCuACCԹA=@CfCԹAC*[Y!8~>C屷A=@CCԹAsCCԹA=@CZvW3Z>GClAC/CԹAmCfCԹACM,-?/ClA\C/CԹAmCGClACs[q>fCԹACCԹA=@CGClACCXzM>CԹA=@CClA=@CGClAC!\I!>CԹAsCClA:CClA=@Ca7W2>CԹA=@CCԹAsCClA=@CQUG$?GClAC/CAC/ClA\C1AUV,f ?/CACCyA=@C/CyAC}T˕o ?/CACGClACCyA=@C&[&ѽ?GClACClA=@CCyA=@C`G[v?ClA:CCyAv_CCyA=@CR_Խ9>ClA=@CClA:CCyA=@CQVWܰ!o ?1CbLA=@C/CyACCyA=@CQO)w?/CbLAC/CyAC1CbLA=@C1Ti= ?CyAv_CCbLADC1CbLA=@C/[b?CyA=@CCyAv_C1CbLA=@CZO=I?pCA=@C/CbLAC1CbLA=@C GP=P?/CA$C/CbLACpCA=@CsP==!?CbLADCCA?CpCA=@C\T`=u ?1CbLA=@CCbLADCpCA=@C ?,=,z>CQ@A C(C]AOq CC]A C8)Ƶ.>䜹CA C(C]AOq CCQ@A CYX: %n>䜹CA C%ʹCAOq C(C]AOq C7m'n>䜹CA C%ʹCA C%ʹCAOq CF1nj>%ʹCAOq C%ʹCAA C{C]A Cl7w"C>(C]AOq C%ʹCAOq C{C]A C "KC ~>%ʹCAA C%ʹCACs¹C]ACLD>{C]A C%ʹCAA Cs¹C]ACJ Ń>%ʹCAC%ʹC]ACCs¹C]AC7c&>(C]AOq CCAOq CC]A C9FE3>{C]A CCAOq C(C]AOq CcD} #>CqA CCAOq C{C]A CD#>y>CqA CDIC/ACC/Ah[CR1C >CqA C{C]A CDIC/ACVS|Hm>{C]A Cs¹C]ACDIC/ACAY'龚ʼn>%ʹC]ACC%ʹC^A=@CC/A=@C@X0,d>%ʹC]ACCC/A=@Cs¹C]ACdQe7>s¹C]ACC/A=@CDIC/ACnZiη>%ʹC^A=@C%ʹC/ACCC/A=@CNUh龵>DIC/ACClACC/Ah[CtMv>ClAC=CuA=@CCuA?C4LH澮>ClACDIC/AC=CuA=@C@o^꿾<>DIC/ACC/A=@C=CuA=@C i1>~>%ʹC/ACC%ʹCcACCuACeg~7>%ʹC/ACCCuACC/A=@CN_ܟ>C/A=@CCuAC=CuA=@COm̏y>%ʹCcAC%ʹC=AtCǹCuAtCvf|>CuAC%ʹCcACǹCuAtClm35s>%ʹC=AtC%ʹCuACǹCuAtCYTѢ`>=CuA=@CC屷A=@CCuA?C~[">C屷A=@CxRCԹACCԹAsCZӔ>C屷A=@C=CuA=@CxRCԹACljmҧ>=CuA=@CCuACxRCԹAC\!mpƖ>CuACǹCuAtCxRCԹAC%'lHE ,>ǹCuAtCҜCԹAtCxRCԹACnOD>%ʹCuAC%ʹCԹAKCҜCԹAtCs|Kx>ǹCuAtC%ʹCuACҜCԹAtCd->1ClACCԹAsCxRCԹAC*Z`MDe>ClA:CCԹAsC1ClACm>xRCԹACҜCԹAtC1ClAC\h߁>ҜCԹAtCClAtC1ClACo o>%ʹCԹAKC%ʹClAjCClAtCrO'>ҜCԹAtC%ʹCԹAKCClAtC^Yf>"CyACClA:C1ClACY9`N?CyAv_CClA:C"CyACph'O>1ClACClAtC"CyACzaLUClAtCCyAtC"CyACgb=@>%ʹClAjC%ʹCyA7mCCyAtC!oʹ<7>ClAtC%ʹClAjCCyAtC3TZ>=$?-CbLACCyAv_C"CyACzV=p ?CbLADCCyAv_C-CbLAC*QaD=O>"CyACCyAtC-CbLAC`8\=?CyAtCCbLAtC-CbLAC^&>>%ʹCyA7mC%ʹCbLACCbLAtCyIgÍ=dZ>CyAtC%ʹCyA7mCCbLAtC zTx>P ?PCACCbLADC-CbLACzqJ =?CA?CCbLADCPCAC}Mm>{ ?%ʹCu AtC%ʹCA=CPCACPOP2Y>b ?%ʹCu AtCPCACCbLAtCXZ&>l>CbLAtCPCAC-CbLACZDe>Ы>CbLAtC%ʹCbLAC%ʹCu AtCڅ2,|uu>CAOq C%ʹCAOq C%ʹCA C2J$CA C%ʹCAOq CCAOq CO:ź#{}>%ʹCAA C%ʹCAOq CJ$CA C?;t$^>)aCAC%ʹCAA CJ$CA CbBV>%ʹCAC%ʹCAA C)aCACFg{>%ʹCAC;C]A=@C%ʹC]ACCCiF>%ʹCAC)aCAC;C]A=@CxUO')>)aCAC͉CA=@C;C]A=@C y]z_>MCA6CMC{~AC5C]AC֍\nQ >MCA6C5C]AC͉CA=@CT"\ٵ<>͉CA=@C5C]AC;C]A=@Ch=ҾVmg=MC{~ACMC)AAtC[UC]AtC!G]Bsu>5C]ACMC{~AC[UC]AtC lʿ[h=MC)AAtCMC3A+ChC]A+C^hI>Ҿp =[UC]AtCMC)AAtChC]A+Cq\2)=MC3A+CMC"ύA{CJxC]A{C͹l=hC]A+CMC3A+CJxC]A{CoTX>;C]A=@C%ʹC^A=@C%ʹC]ACC^W>%ʹC^A=@C ҹC/AC%ʹC/ACCUЁ>%ʹC^A=@C;C]A=@C ҹC/ACpat۾ZMH>;C]A=@C5C]AC ҹC/ACudݾ >5C]AC[UC]AtC ҹC/ACh%/q>[UC]AtC4C/AtC ҹC/ACInIƎ=[UC]AtChC]A+C4C/AtCq!>hC]A+Ce)C/A+C4C/AtClsxGn=hC]A+CJxC]A{Ce)C/A+C)v{$t=JxC]A{CCC/A{Ce)C/A+CcE躾4.> ҹC/AC%ʹCcAC%ʹC/ACCPf In>4C/AtC%ʹCcAC ҹC/ACl~>%ʹC=AtC%ʹCcAC4C/AtC8nNs>%ʹC=AtC=CuA+C%ʹCuACwm Rs>%ʹC=AtC4C/AtC=CuA+Cv$CYځ$>4C/AtCe)C/A+C=CuA+CxfZw=e)C/A+CCC/A{C=CuA+Cx!8>CC/A{Ch"CuA{C=CuA+Cu=`{>CԹA+C%ʹCuAC=CuA+C;Ymn@M->%ʹCԹAKC%ʹCuACCԹA+C y) 9>=CuA+Ch"CuA{CCԹA+CwEcrx>h"CuA{CCԹA{CCԹA+C6r݄\j>ܹClA+C%ʹCԹAKCCԹA+C5m >%ʹClAjC%ʹCԹAKCܹClA+CAxKӰx>CԹA+CCԹA{CܹClA+Cq!y=3>CԹA{C!ClA{CܹClA+C>l`=a>>CyA+C%ʹClAjCܹClA+C$ue_=P>%ʹCyA7mC%ʹClAjCCyA+CܹClA+C!ClA{CCyA+CWj >>!ClA{CDCyA{CCyA+CRb9>6>CbLA+C%ʹCyA7mCCyA+CRZ>k?%ʹCbLAC%ʹCyA7mCCbLA+CNi5>?>>CyA+CDCyA{CCbLA+C1u[=>>DCyA{CㄺCbLA{CCbLA+CEGz>?%ʹCu AtC޹CAtC%ʹCA=CN>?%ʹCbLAC޹CAtC%ʹCu AtC,Us z>8>%ʹCbLACCbLA+C޹CAtCM$>d?CbLA+CdCA+C޹CAtCW)PJ>V>MCmA{CMCAZCdCA+CsQ>>MCmA{CdCA+CㄺCbLA{CEYYC>C>ㄺCbLA{CdCA+CCbLA+C9aWE >CACMC{~ACMCA6CK7Y! <.=CAtCMC{~ACCAC=d侐{=MC)AAtCMC{~ACCAtCsd>H.=CA+CMC)AAtCCAtC?j3̾Qw=MC3A+CMC)AAtCCA+Cݢj֊̾<ºCA{CMC3A+CCA+C?xoJU4=MC"ύA{CMC3A+CºCA{C>L+>>MCmA{C޺CA{CMCAZCtKB=MC"ύA{CMCACCC]ACC1q6G=JxC]A{CMC"ύA{CC]ACCPrޒ>MCACCMC]A!3CC]ACCrwm7}=JxC]A{CC]ACCCC/A{CXy9. >C]ACCo`C/ACCCC/A{C\y5(>MC]A!3CMCE_AC}C/ACxy6? >MC]A!3C}C/ACC]ACC?ya|9d>C]ACC}C/ACo`C/ACCpv23J>MCE_ACMC/AC}C/AC}Oz" >CC/A{Co`C/ACCh"CuA{C=zk6,>o`C/ACCECuACCh"CuA{C[{'7>o`C/ACC}C/ACECuACCdz^H>}C/ACnCuACECuACC`w#9}>MC/ACMCuA&CnCuACU,ztsL>}C/ACMC/ACnCuAC{z78->h"CuA{CECuACCCԹA{C x~p>ECuACCECԹACCCԹA{C{H>ECuACCnCuACECԹACCz>˘nCuACrCԹACECԹACCj$tl=k&>MCuA&CMCԹACrCԹACawI<(}>nCuACMCuA&CrCԹACOxڃ=.p>CԹA{CECԹACC!ClA{C_u=q>ECԹACC[ClACC!ClA{Cd@q3>|>MCDACMClASC[ClACC q=7>M>MCDAC[ClACCrCԹACx= Z>rCԹAC[ClACCECԹACCpR7> >rCԹACMCԹACMCDACs1&>U>!ClA{C[ClACCDCyA{Cj.l>e>[ClACCiCyACCDCyA{CGmt>Q6>MClASCMCyAwCiCyACCK3nWp>/>[ClACCMClASCiCyACCI`=e>qs>MCACCMCbLA<CㄺCbLA{C`L^>m>MCACCㄺCbLA{CiCyACCf5V>>iCyACCㄺCbLA{CDCyA{Cog:'>El>iCyACCMCyAwCMCACCk]>^>ㄺCbLA{CMCbLA<CMCmA{Cѩow,W<ƺCACCMC"ύA{CºCA{C]sIJ=MCACCMC"ύA{CƺCACC{Orqr >MCACCC]ACMC]A!3CqpJb >MCACCƺCACCC]ACxl=ƺCACC\ԺCACC]ACwk΢=\ԺCACCAixCC]AC\x3%>CAixCźC]AixCC]AC8w_23g8>CAixCCACźC]AixCwh4T>CACC]ACźC]AixCw_9xO>CAC;CA CC]AC wr>;CA C $C]A CC]ACQx7؊j`g>tdCA "CtdCAAWG"CL]C]AWG"Cxۊ&mg>tdCA "CL]C]AWG"C;CA C uxÈ>;CA CL]C]AWG"C $C]A CrЎ.>tdCAAWG"CtdC]AKs"CL]C]AWG"C y=J>C]ACMCE_ACMC]A!3Cu?W>MCE_ACШC/AixCMC/ACuh;7T>MCE_ACC]ACШC/AixCzr +&>C]ACźC]AixCШC/AixCTw/ T>źC]AixCC]ACШC/AixCvL:>C]AC ޺C/ACШC/AixCSwh /s>C]AC $C]A C ޺C/AC4Wu6i> $C]A CC/A C ޺C/ACTvaU7[{> $C]A CL]C]AWG"CC/A Cvu8>L]C]AWG"C>XC/AWG"CC/A C q#>tdC]AKs"CtdC/A"C>XC/AWG"COZsݿ|>L]C]AWG"CtdC]AKs"C>XC/AWG"C/yüu[>ϣCuAixCMC/ACШC/AixC wY+j>MCuA&CMC/ACϣCuAixCwEU>ШC/AixC ޺C/ACϣCuAixC>v> ޺C/AC ޺CuACϣCuAixCuT> ޺C/ACC/A C ޺CuACtn<_>C/A CCuA C ޺CuACph=ѫ>tdCiߪAWG"CtdCuA9"CCuA CȊpq=Jѫ>tdCiߪAWG"CCuA C>XC/AWG"CBu n<>>XC/AWG"CCuA CC/A C3pSr=Pɫ>>XC/AWG"CtdC/A"CtdCiߪAWG"CFv2=H>CԹAixCMCuA&CϣCuAixCs:iw=a>MCԹACMCuA&CCԹAixCuuW=C>ϣCuAixC ޺CuACCԹAixCb@tK=> ޺CuACCԹACCԹAixC֛sҳ=Ζ> ޺CuACCuA CCԹACԥqy}=ޟ>CuA C4CԹA CCԹAC1nf=î>tdCuA9"CtdCԹA!C4CԹA C-o=:>CuA CtdCuA9"C4CԹA CfnC>>MCDACClACMClASCgnC>ݞ>MCԹACClACMCDAC*o+?>p>MCԹACCԹAixCClACsX>-k>CԹAixCӺClAixCClACvrL>z>CԹAixCCԹACӺClAixCnN6>&S>CԹAC.ClACӺClAixC_h\n>>tdCVA CtdClA[ C.ClACioUc>>tdCVA C.ClAC4CԹA C(op6>:9>4CԹA C.ClACCԹAC0YjId>v>4CԹA CtdCԹA!CtdCVA C8kh~>tƜ>ѺCyACMClASCClACk>>MCyAwCMClASCѺCyACin 4>|>ClACӺClAixCѺCyACf>>ӺClAixC.CyAixCѺCyACNg`>J`>ӺClAixC.ClAC.CyAixCg>y>.ClAC[\CyAC.CyAixCb|H>*>tdClA[ CtdCyA;C[\CyACN6d >>.ClACtdClA[ C[\CyAC/n\cr>)>MCACC޺CbLACCMCbLA<Cc7>2>MCyAwC޺CbLACCMCACCwd.>#1>MCyAwCѺCyAC޺CbLACC[>>ѺCyACQ.CbLAC޺CbLACCWY>;]>tdCAixCtdCbLA CQ.CbLACSO]H>I>tdCAixCQ.CbLAC.CyAixC.^S>9M>.CyAixCQ.CbLACѺCyAC]_>@>.CyAixC[\CyACtdCACV^Ay>yc>tdCAixC.CyAixCtdCAC[:>>[\CyACtdCyA;CtdCACX>>MCbLA<C޺CA{CMCmA{CX>>MCbLA<C޺CbLACC޺CA{CMT>>޺CbLACCJCACC޺CA{CbLj=>غ>tdC[ACtdCA1CJCACC:NP>Ÿ>tdC[ACJCACCQ.CbLACr`V>ݻ>Q.CbLACJCACC޺CbLACCSE>t>Q.CbLACtdCbLA CtdC[ACxsBr>kCAWG"CtdCAAWG"CtdCA "Crf)'>tdCAAWG"CC]A#CtdC]AKs"C۶r ߞ>tdCAAWG"CkCAWG"CC]A#CvuΈ>kCAWG"CݤCA#CC]A#C\ws,Ge>ݤCA#CZۻCA{%CC]A#CrufRn;FΏ>ZۻCA{%C!ܻC]A{%CC]A#CFks;9>C/A#CtdC]AKs"CC]A#Ch q,>tdC/A"CtdC]AKs"CC/A#Cwu;͏>C]A#C!ܻC]A{%CC/A#Csg}=q`>!ܻC]A{%CC/A{%CC/A#Co=;>tdCiߪAWG"CgCuAWG"CtdCuA9"Co=pq>tdC/A"CgCuAWG"CtdCiߪAWG"CtdC/A"CC/A#CgCuAWG"CopC=G>C/A#CCuA#CgCuAWG"C3sz=>C/A#CC/A{%CCuA#Cypm=o>C/A{%CoCuA{%CCuA#Cm=>&CԹAWG"CtdCuA9"CgCuAWG"CYl =>tdCԹA!CtdCuA9"C&CԹAWG"CUnNk=np>gCuAWG"CCuA#C&CԹAWG"CkQW>%>CuA#CһCԹA#C&CԹAWG"CkoI~>u>CuA#CoCuA{%CһCԹA#Cbl.>:>oCuA{%C3CԹA{%CһCԹA#Cfx>ɪ>tdCVA C:gClA CtdClA[ C(fx>D>tdCԹA!C:gClA CtdCVA CEDgas>@>tdCԹA!C&CԹAWG"C:gClA CJQg~s> u>&CԹAWG"C#ClAWG"C:gClA C0pgs>0͵>&CԹAWG"CһCԹA#C#ClAWG"CQgj[_>ֶ>һCԹA#CClA#C#ClAWG"CIg|s>#>1CQA{%C1ClA'$CClA#CgZm>>1CQA{%CClA#C3CԹA{%Czj"_>>3CԹA{%CClA#CһCԹA#C`>Ty>cCyA CtdClA[ C:gClA Cz.`>bк>tdCyA;CtdClA[ CcCyA C'az1>1 >:gClA C#ClAWG"CcCyA C&e>uĨ>#ClAWG"CCyAWG"CcCyA C_3i>h>1C_pA#C1CyA7K#CCyAWG"C`3>t>1C_pA#CCyAWG"CClA#C#e>֨>ClA#CCyAWG"C#ClAWG"C&Ba+>[ر>ClA#C1ClA'$C1C_pA#CNdT߶>]>tdCAixC7zCbLAixCtdCbLA CIT>cU>tdCAC7zCbLAixCtdCAixC1X>|>ĻCbLAC7zCbLAixCtdCACRd>!ڿ>tdCyA;CĻCbLACtdCACU>>tdCyA;CcCyA CĻCbLACW7>Y>cCyA C;CbLA CĻCbLAC)X_>>1CM>AWG"C1CbLA ;!C;CbLA C[1>>1CM>AWG"C;CbLA CCyAWG"CY3>`>CyAWG"C;CbLA CcCyA CGXp>i[>CyAWG"C1CyA7K#C1CM>AWG"CoGm>>tdC[ACCACtdCA1CLn?}>tdCbLA CCACtdC[AC3Ln?>tdCbLA C7zCbLAixCCAC5Ia?H_>7zCbLAixCCAixCCACiE~ ?ke>1C AC1CAeCCAixC}G ?>1C ACCAixCĻCbLACI}L?ٷ>ĻCbLACCAixC7zCbLAixC$2M?ܤ>ĻCbLAC;CbLA C1CA C$H} ?+3>1C ACĻCbLAC1CA C"N?>;CbLA C1CbLA ;!C1CA CD1wo;!>ZۻCA{%CCAF'C!ܻC]A{%C u-<#>CAF'C^C]AF'C!ܻC]A{%Crkv=>1CA(C1C]AR'C^C]AF'C"wMv<}>CAF'C1CA(C^C]AF'C=u֏=>!ܻC]A{%C^C]AF'CC/A{%Cs=>^C]AF'Cf%C/AF'CC/A{%Cs=>1C]AR'C1C/A/e'Cf%C/AF'C v&=W>^C]AF'C1C]AR'Cf%C/AF'CSqq=>1C8AF'C1CuA&CoCuA{%CTq=}>1C8AF'CoCuA{%Cf%C/AF'C3rx=; >f%C/AF'CoCuA{%CC/A{%CKrg=g>f%C/AF'C1C/A/e'C1C8AF'Cil~S>ѳ>1CuA&C1CԹA%C3CԹA{%C=o()0>ʀ>oCuA{%C1CuA&C3CԹA{%C`hKQn>1>3CԹA{%C1CԹA%C1CQA{%CI1vPCAB^ȵCABCYAӤB1 :4KCYAӤB^ȵCAB^ȵCYAVXB$zg0T^ȵCaB0BCaBBCtiAB%6~ Q^ȵCAB^ȵCaB0BCtiABx6v~ QCtiAB^ȵCYAVXB^ȵCAB9a{SCYAӤB^ȵCYAVXBCtiAB0nT MX^ȵC( BE#BC( B BChB\BdVKnU^ȵC  B\B^ȵC( BE#BChB\BSqpUChB\B^ȵCaB0B^ȵC  B\B!&WCaBB^ȵCaB0BChB\B$ bC( B B^ȵC( BE#BCe4BB2n]Ce4BB^ȵC( BE#B^ȵCe4BHBkǾk^ȵCB\BCBBC0\BZ(B l߾hCf^ȵCBZ(B^ȵCB\BC0\BZ(BЊ G߾rCfC0\BZ(B^ȵCe4BHB^ȵCBZ(B~ƾBkCe4BB^ȵCe4BHBC0\BZ(BIrclrCBB^ȵCB\BCBsBO(IpCBsB^ȵCB\B^ȵCBsB_=sCBsB^ȵCBsBCp#B/Bl[t޲QtCp#B/B^ȵCBsB^ȵCp#BB]pv^ȵC\)BcBC\)BcBC'BBKchu^ȵC'BB^ȵC\)BcBC'BBKhuC'BB^ȵCp#BB^ȵC'BBrvϚ3ivCp#B/B^ȵCp#BBC'BB.0jXbCYA#BbCAB2CYAB00XbCABCYAӤB2CYAB00+XbCABbCAaBCYAӤBR!RbCAaBCABCYAӤB,KyT2CYABCtiABCaBB,yT2CYABCaBBbCYA#B˲JXbCYA#BCaBBbCaB Bť,.~zT2CYABCYAӤBCtiABccNaC( B BbC( BVBbCB\BBs YChB\BC( B BbCB\BCY YbCB\BCaBBChB\B|_bCaB BCaBBbCB\BA?w̾ibC( BVBC( B BbCe4BBS1SdbCe4BBC( B BCe4BBo<óDoCBBbCB\BbCaXBZ(Bvl&ǾkC0\BZ(BCBBbCaXBZ(BSrl[ǾkbCaXBZ(BCe4BBC0\BZ(B4Ʊ4obCe4BBCe4BBbCaXBZ(B;p<#pbCB\BCBBbCBsB q}rbCBsBCBBCBsBֶiubCBsBCBsBbCp#BԠB"<^"sbCp#BԠBCBsBCp#B/BXuBB*?ZݵCaB< CCB CCaB C< =*?^ȵC%A< CCB CZݵCaB< C?>b$?^ȵC%A< CmCYA CCB COBd=#?^ȵC%A< C^ȵCYAQM CmCYA CJ=/5O>gK3?C( B< C^ȵCaB CZݵCaB< Cx+/G>N7?^ȵC( B C^ȵCaB CC( B< C3t>9+?CaB CC( B? CC( B< C 9mZ>I;(?ZݵCaB< CCaB CC( B< C+)7>M4?6jCe4B< C^ȵC( B CC( B< C'K>-6?^ȵCe4Bm C^ȵC( B C6jCe4B< Cu-J>t-?C( B? CCe4BP C6jCe4B< C102ue>j*?C( B< CC( B? C6jCe4B< C2}4>>=?^ȵC#BaCCBaC^ȵCBaC!S$>5?CBaCCB< CCB C!j>4?^ȵC#BaCCB< CCBaCM8>3?^ȵC#BaC6jCe4B< CCB< C+g$:>3?^ȵC#BaC^ȵCe4Bm C6jCe4B< C|(6>|(?6jCe4B< CCe4BP CCB< C*B>:?dCBaC^ȵCBaCCBaC\2>E?^ȵCB־C^ȵCBaCdCBaC!>:?CB CCBCdCBaC/x>N5?CBaCCB CdCBaC >k@?CTHBaC^ȵCB־CdCBaCa >Lm@?CTHBaCCp#BC^ȵCB־CU>-J?Cp#BC^ȵCp#BCC^ȵCB־C{>9?dCBaCCBCCTHBaC>^P?^ȵC#BCwZC\)BC^ȵC\)BaC U>DL?wZC\)BC^ȵC#BC^ȵCp#BCCIr>qL?wZC\)BC^ȵCp#BCCC\)BNC`>!E?C\)BNC^ȵCp#BCCCp#BClY7{#>RI.?CB CCaB CCaB C3jz>+?z߶C( B CCaB CCaB C1^w>-?C( B? CCaB Cz߶C( B Ca->Լ)?>Ce4B CC( B? Cz߶C( B C<)A>1?Ce4BP CC( B? C>Ce4B C &>ڹ5?CB< CݶCB< CCB C9">J-?ݶCB< CbC B CbCB~5 C =$2>1,?CB< CbC B CݶCB< C">+?CB< C>Ce4B CbC B C$k־>+?CB< CCe4BP C>Ce4B CPv> 2?bCB< CCB CݶCB< C.l>-3?bCB< CbCB8 CCB C~ >h9?bCB8 CCBCCB C̈́HG>e*?ݶCB< CbCB~5 CbCB< CA>wKC?CTHBaCCp#BaCCp#BC g>Nl>?Cp#BaCCBCbCp#B"D C{Q>4?bCp#B"D CCBCbCB8 C=d>??bCr'BaCCp#BCCp#BaC}>+@?bCr'BaCbC\)BrUCCp#BCږ;>k0F?bC\)BrUCC\)BNCCp#BCM> >:?Cp#BaCbCp#B"D CbCr'BaC_y>.?bC B CCB CbCB~5 C8S^>4?bCB< CeCB< CbCB8 C>,?eCB< C/CB C/CB CE>-?bCB< C/CB CeCB< C>,,?bCB< CCB C/CB C G!>t+?bCB< CbCB~5 CCB C҆_>w0?=Cp#B< CbCB8 CeCB< CO >-?/CB C/Cp#B݃ C=Cp#B< Cd>3T)?eCB< C/CB C=Cp#B< C1>[D?bCr'BaC:C\)BaCbC\)BrUCA?8?:C\)BaC/C,$B< C/C\)B` C->8?bCr'BaC/C,$B< C:C\)BaCq>Lm7?bCr'BaC=Cp#B< C/C,$B< C K>u7?bCr'BaCbCp#B"D C=Cp#B< C @?-+?=Cp#B< C/Cp#B݃ C/C,$B< C&^>?/?/CB C[KCB C/CB C6nGo?'?C-#B C/CB C[KCB C@,E?ܡ)?C-#B CCp#Bm C/CB CD *>.?Cp#Bm C/Cp#B݃ C/CB Ce?p8?/C,$B< CָC\)B< C/C\)B` C!?}1?ָC\)B< C/C,$B< C/Cp#B݃ Cf3>?/?ָC\)B< C/Cp#B݃ CC\)BBt Cz ?'?C\)BBt C/Cp#B݃ CCp#Bm CQk,?0?C-#B CCp#B CCp#Bm C?R(?%ʹC(B CCp#Bm CCp#B C}z?%U*?%ʹC(B C%ʹC\)BA CCp#Bm Cf?9x-?%ʹC\)BA CC\)BBt CCp#Bm CkԾ?0?%ʹC(B CEC\)B C%ʹC\)BA CDEq=k!?CAe CCYA7 CmCYA CL_=^?_CA CCAe CmCYA CC> > ?mCYA CCYA7 CCB CJ=?CYAOq CCAe CCAOq CEn=t!?CYA7 CCAe CCYAOq CnK;=#?bCACbCYAw>CCYAOq CN =?CAOq CbCACCYAOq C?k$>aq$?CYA7 CCaB CCB CC< >C ?CYA7 CCYAOq CCaB CRV%?CYAOq CLCaBOq CCaB C=AUf>?bCYAw>CbCaB CLCaBOq C@HV>0?CYAOq CbCYAw>CLCaBOq C= 4]>|'?bC^BOq CbC( B Cz߶C( B CG%3w>'?bC^BOq Cz߶C( B CLCaBOq C9>ط#?LCaBOq Cz߶C( B CCaB C=0>?LCaBOq CbCaB CbC^BOq C.F^>&?bC( B CbCe4B" C>Ce4B Cn1 >%?z߶C( B CbC( B C>Ce4B C-)3E>!?>Ce4B CbCe4B" CbC B CUJ/ >?>CYA CbCAC7CA C8EK=X?bCYAw>CbCAC>CYA CFߙ.>I3?/CAAC/CYAEC>CYA CFӓ.>2?/CAAC>CYA CT(CACL >C?T(CAC>CYA C7CA C;M.4>ȋ?T(CAC/CA$C/CAAC2B'h>aN?CaB CbCYAw>C>CYA CA-f>?bCaB CbCYAw>CCaB CC$n>}?/CYAEC/CaB CCaB CXeDڝk>G?>CYA C/CYAECCaB C1>l)?bC^BOq CC( BOq CbC( B C8:#>G?C( BOq C/CB C/C( B"Ch<$>U?bC^BOq C/CB CC( BOq C*A<[>?bC^BOq CCaB C/CB C=Z>A?bC^BOq CbCaB CCaB C> >x?CaB C/CaB C/CB C-A>?%?N Ce4BOq CbC( B CC( BOq Ck~* >}*?bCe4B" CbC( B CN Ce4BOq CAp1e>?/C( B"C/Ce4B CN Ce4BOq C6½>17?C( BOq C/C( B"CN Ce4BOq CUq&H> r&?CB C/C BOq C/CB C5r&lF>q&?bC B C/C BOq CCB C,%G}>5,%?bC B CN Ce4BOq C/C BOq C,%|>=,%?bC B CbCe4B" CN Ce4BOq C->>*}?N Ce4BOq C/Ce4B C/C BOq CV"߃>tW"?CB C/CB C/CB C%D31>Z?/CAACMVCYAC/CYAECK}7>?/CA$CMVCYAC/CAACsME8>j?/CA$CpCA=@CMVCYACIHU>7?pCA=@C+CYA=@CMVCYACGSd>^?CA?CCYAlbC+CYA=@C27L^Y>q?pCA=@CCA?C+CYA=@CFAT>o?CaBC/CYAECMVCYAC==x>n ?/CaB C/CYAECCaBCj?>?CeA=@CCaBΚCCaBC@>?CeA=@CCaBC+CYA=@CE@>E?+CYA=@CCaBCMVCYAC$(D>i"?+CYA=@CCYAlbCCeA=@C81y>i#?/CB CMC( B C/C( B"C4>I ?MC( B CC BCC( BC 6/}>l?/CB CC BCMC( B C59>g?/CB CCaBCC BCQ8O$>?/CB C/CaB CCaBCo@;vr>?CaBCCaBΚCC BCi-qO> ?¸Ce4B C/C( B"CMC( B C/(/ >?/Ce4B C/C( B"C¸Ce4B C-s4>r?C( BCCe4BC¸Ce4B C1>qF?MC( B CC( BC¸Ce4B C!B>5)?/C BOq CgCBOq C/CB Cj>&A>#?gCBOq CCvB CCB^C|*M>T?/C BOq CCvB CgCBOq CF'>|?/C BOq C¸Ce4B CCvB C?V+>3?/C BOq C/Ce4B C¸Ce4B Cl(S>?¸Ce4B CCe4BCCvB C;>w'?[KCB CCBOq CCB Cƪ>Qy(?/CB CCBOq C[KCB C%>F&?/CB CgCBOq CCBOq Cײ>c%?/CB C/CB CgCBOq Ct!>?gCBOq CCB^CCBOq CUY?!?[KCB CCB CC-#B CaEpRy>?uCYACCA?CPCACCk>h[?CYAlbCCA?CuCYACE[>#?%ʹCA=C%ʹCYAjtCuCYACrL> ?PCAC%ʹCA=CuCYACb;=>?CeA=@CLBCaB=@CCaBΚC~< >?LBCaB=@C%ʹC-BC%ʹCaBRCs>j>ݦ?CeA=@C%ʹC-BCLBCaB=@CLj>nY>)?CeA=@CuCYAC%ʹC-BC@?f~>(?CeA=@CCYAlbCuCYAC?uCYAC%ʹCYAjtC%ʹC-BCJ2F>>:?C BCC( BCC( BC6>> ?CaBΚCC( BCC BCĕ6z>?CaBΚCLBCaB=@CC( BC:3>?LBCaB=@C1C( B=@CC( BC+4^>D?%ʹCaBRC%ʹC( B{C1C( B=@CW7>5>?LBCaB=@C%ʹCaBRC1C( B=@C,7>G?CCe4BCC( BCC( BC^(g> ?Ce4BCC( BCCCe4BCtK+g>E?%ʹC B=@C%ʹCe4BHCCCe4BCg)>?%ʹC B=@CCCe4BC1C( B=@CI.Ș>'?1C( B=@CCCe4BCC( BC<;.y>?1C( B=@C%ʹC( B{C%ʹC B=@CZEă>$?CvB CzXCB CCB^CO > ?zXCB C%ʹCBC%ʹCBCt!x\>?CvB C%ʹCBCzXCB C!>?CvB CCCe4BC%ʹCBC#e>A??CvB CCe4BCCCe4BCn$.?!?CCe4BC%ʹCe4BHC%ʹCBC>,P-?CBOq C1CBOq CCB C &6?!?1CBOq C%ʹC3{B C%ʹCBC$_?"?CBOq C%ʹC3{B C1CBOq C?.l ?CBOq CzXCB C%ʹC3{B Cg??ߕ?CBOq CCB^CzXCB C~| ?8?zXCB C%ʹCBC%ʹC3{B Ct ?P&?Cp#B C%ʹC!BOq C%ʹCp#B C ?R&?C-#B C%ʹC!BOq CCp#B C&? > ?6&?C-#B C1CBOq C%ʹC!BOq C*@ > ?&?C-#B CCB C1CBOq C|r|?-?1CBOq C%ʹCBC%ʹC!BOq CJn?<?Cp#B C%ʹCp#B C%ʹC(B CMDD>y?-CYAtC%ʹCA=C޹CAtCiAӗ>~?%ʹCYAjtC%ʹCA=C-CYAtC5A > ?MC>IA+CMCYAјC-CYAtCC\>g ?MC>IA+C-CYAtCdCA+C5L>k?dCA+C-CYAtC޹CAtC7Nڸ>[9>dCA+CMCAZCMC>IA+C'5 a>*?%ʹC-BCUCaBC%ʹCaBRCV9NЮ> ?%ʹCYAjtCUCaBC%ʹC-BCA>>l?%ʹCYAjtC-CYAtCUCaBCrK8K>?-CYAtCsCaBtCUCaBCV6k> k?MCYAјCMCaB{CsCaBtCjU@U> ?-CYAtCMCYAјCsCaBtC0.+>? jC( BC%ʹCaBRCUCaBC][, >$?%ʹC( B{C%ʹCaBRC jC( BCx'>1?MC BtCMC( B=C jC( BCIK,%>߀?MC BtC jC( BCsCaBtCQ2E>?sCaBtC jC( BCUCaBCI0>?sCaBtCMCaB{CMC BtCl# w>\?%ʹC B=@COBCe4B=@C%ʹCe4BHC#)r>~?OBCe4B=@CMC BCMCe4BCҘ&O>ư?%ʹC B=@CMC BCOBCe4B=@C ]$g>ݺ?%ʹC B=@C jC( BCMC BC:&'m>׍?%ʹC B=@C%ʹC( B{C jC( BCX$>*? jC( BCMC( B=CMC BCX?ݤ?%ʹCBC-(CBC%ʹCBC" ]??-(CBCMCiB=@CMCBCC^(?c?%ʹCBCMCiB=@C-(CBCph?)?%ʹCBCOBCe4B=@CMCiB=@CMn]?9?%ʹCBC%ʹCe4BHCOBCe4B=@Cń+?f?OBCe4B=@CMCe4BCMCiB=@C[c?LC#?%ʹC3{B CCB C%ʹCBC ?;?CB CMCJBCMCB C ?<?%ʹC3{B CMCJBCCB C5s ?;?%ʹC3{B C-(CBCMCJBCh$ ?;?%ʹC3{B C%ʹCBC-(CBC6n??-(CBCMCBCCMCJBC?w,?%ʹC!BOq C Cp#BOq C%ʹCp#B CPdW?eA? Cp#BOq CMCĹ B CMCp#BvYCG`?%?%ʹC!BOq CMCĹ B C Cp#BOq C??%ʹC!BOq CCB CMCĹ B C ?6?%ʹC!BOq C%ʹCBCCB ChqO?Qg?CB CMCB CMCĹ B CB!?!?EC\)B CMCF&BOq CMC\)B C-#?Z-!?%ʹC(B CMCF&BOq CEC\)B C>? 6#?%ʹC(B C Cp#BOq CMCF&BOq C#]g?#?%ʹC(B C%ʹCp#B C Cp#BOq C&?o? Cp#BOq CMCp#BvYCMCF&BOq Cf: >?MC>IA+CźCYA+CMCYAјCC.>?MCAZCźCYA+CMC>IA+CMvI>;>MCAZC޺CA{CźCYA+C@= >?޺CA{CUCYA{CźCYA+CI5v>?DCCaB+CMCYAјCźCYA+CF1T> v?MCaB{CMCYAјCDCCaB+C,p/=>W ?tdC=GA{CtdCaBbCDCCaB+C1> ?tdC=GA{CDCCaB+CUCYA{Cs; >u?UCYA{CDCCaB+CźCYA+CX$>x?MC BtCe)C( BtCMC( B=C#??e)C( BtCtdCB+CtdC( BC)>BR?MC BtCtdCB+Ce)C( BtC G(#?v?MC BtCDCCaB+CtdCB+C+>m?MC BtCMCaB{CDCCaB+C+n??DCCaB+CtdCaBbCtdCB+C"+.>"?MC BCP Ce4BCMCe4BC y?;?P Ce4BCtdC BtCtdCe4ByCy(!>?MC BCtdC BtCP Ce4BC?s?MC BCe)C( BtCtdC BtC!*>?MC BCMC( B=Ce)C( BtCT "Ԕ?P?e)C( BtCtdC( BCtdC BtCp?M ?MCiB=@CBCB=@CMCBCCXX??BCB=@CtdC4BCtdCBe Cne ??MCiB=@CtdC4BCBCB=@C;4' ??MCiB=@CP Ce4BCtdC4BC??MCiB=@CMCe4BCP Ce4BC_U"?u?P Ce4BCtdCe4ByCtdC4BC ?B#?MCJBCCBCMCB Cm]g ?w?CBCtdCB=@CtdCBTCd?P?MCJBCtdCB=@CCBCK/?@?MCJBCBCB=@CtdCB=@C; %?#?MCJBCMCBCCBCB=@CP2 [R? ?BCB=@CtdCBe CtdCB=@CL!?2?MCĹ B C Cp#B CMCp#BvYCI"?`? Cp#B CtdC)yBCtdCp#BCf$? ?MCĹ B CtdC)yBC Cp#B Cf!?_'?MCĹ B CCBCtdC)yBC#-r#??MCĹ B CMCB CCBC %?'c?CBCtdCBTCtdC)yBC_Ӿ$?$?MCF&BOq C3C\)BOq CMC\)B Cܾ8/?I?3C\)BOq CtdC>M%B CtdC\)Bb Cj߾1.??MCF&BOq CtdC>M%B C3C\)BOq C徦f*??MCF&BOq C Cp#B CtdC>M%B CpWE(??MCF&BOq CMCp#BvYC Cp#B C8/Z.?Q? Cp#B CtdCp#BCtdC>M%B Cl&?2?tdC=GA{CCaB{CtdCaBbC%?oy?tdCB+CC( B+CtdC( BCk ??C( B+C1C]B{C1C( B C~"I?*`?tdCB+C1C]B{CC( B+C _5 ?M ?tdCB+CCaB{C1C]B{C3*#~??tdCB+CtdCaBbCCaB{C? ?tdC BtCACe4BtCtdCe4ByC??ACe4BtC1C B+C1Ce4B C$ ?]?tdC BtC1C B+CACe4BtCL{??tdC BtCC( B+C1C B+CY?D?tdC BtCtdC( BCC( B+COgT?` ?C( B+C1C( B C1C B+C ?&A ?tdC4BCCBCtdCBe CA?U?CBC1C7BtC1CBeC@SJ?~?tdC4BC1C7BtCCBCg J??tdC4BCACe4BtC1C7BtC H??tdC4BCtdCe4ByCACe4BtCC ?H?ACe4BtC1Ce4B C1C7BtC"? ?tdCB=@CTCB=@CtdCBTC?_x?TCB=@C1CBC1CB:C7#?4?tdCB=@C1CBCTCB=@C@ 9!?$?tdCB=@CCBC1CBC&%?c?tdCB=@CtdCBe CCBCo%#??CBC1CBeC1CBCܾ|'?T?tdC)yBCM%Cp#BCtdCp#BCj޾1?ڽ?M%Cp#BC1CcB=@C1Cp#BCn/??tdC)yBC1CcB=@CM%Cp#BC,z*?Kz?tdC)yBCTCB=@C1CcB=@Ct8'??tdC)yBCtdCBTCTCB=@Ci/?QS ?TCB=@C1CB:C1CcB=@CžoD3??tdC\)Bb C1C^(B C1C\)BCfƾF2??tdC>M%B C1C^(B CtdC\)Bb CCKվ1.??tdCp#BCM%Cp#BC1C,#BCOо13?u?tdCp#BC1C,#BCtdC>M%B C ʾ~6?S?tdC>M%B C1C,#BC1C^(B C۾#4??M%Cp#BC1Cp#BC1C,#BC>Ɓ>tdCACCtdCYAQCUCYA{C@?W>|>tdCACCUCYA{CJCACCIa>W>JCACCUCYA{C޺CA{CGS?>JCACCtdCA1CtdCACC9=?>UCYA{CtdCYAQCtdC=GA{Ct7?>tdCACCۻCYACCtdCYAQCG:g]?>ۻCYACC1C%AC1CYAC$]?Ԋ ?>tdCACC1C%ACۻCYACCʹ=?z>tdCACCCAC1C%AC %Cg? =>tdCACCtdCA1CCACk=?0>CACCAixC1CAixC@J!?v >1C%ACCAC1CAixC }=?>CAixC1CAeC1CAixCv(?>CaB{C1CK-BCC1CaBRC|1h ?1>tdC=GA{C1CK-BCCCaB{C^.?B>tdC=GA{CۻCYACC1CK-BCCaV5?>tdC=GA{CtdCYAQCۻCYACCH5?>ۻCYACC1CYAC1CK-BCCv(Z?>CaB{C1CaBRC1C]B{CZq^ȵC=BBC=BiBCY;BB+zYLq^ȵCZ9oC:BBC=BRB%ʹC8BB~3̽)2̾^i%ʹC=B]BC=BRB%ʹCR~CBXB?RҾ4Uh%ʹCR~CBXBC=BRBCR~CBGBGF`4\CIBR*B%ʹCIBB%ʹC GB}BY׽jo`C}HB}BCIBR*B%ʹC GB}BW׽"`%ʹC GB}BCR~CBGBC}HB}Bk\%ʹCR~CBXBCR~CBGB%ʹC GB}B?oQ%ʹCIBBCIBR*B%ʹCPPBB}. 0S%ʹCPPBBCIBR*BCPPBBX;aGC VBB%ʹC VBuB%ʹCPBUB43DOCaRBUBC VBB%ʹCPBUB1EO%ʹCPBUBCPPBBCaRBUBw .!iI%ʹCPPBBCPPBB%ʹCPBUBno:?CI#]BSgB%ʹCI#]BfB%ʹCXB?!BQVruHCz3[B?!BCI#]BSgB%ʹCXB?!BQXUtH%ʹCXB?!BC VBBCz3[B?!Bt5Ʈ B%ʹC VBuBC VBB%ʹCXB?!BtoMC׫6BBMCQ5BBdC׫6BBLP/ZndC׫6BB%ʹC8BB%ʹC=B]B6P2ZndC׫6BB%ʹC=B]BMC׫6BB`=a~iMC׫6BB%ʹC=B]BMC=BQBW;AɾfMC=BQB%ʹC=B]BMCR~CBBW;AɾfMCR~CBB%ʹC=B]B%ʹCR~CBXBY1bGZ%ʹCIBBMCIB<BMCDB}BX1aGZ%ʹC GB}B%ʹCIBBMCDB}BY1>c(GZMCDB}B%ʹCR~CBXB%ʹC GB}BY1dFZMCR~CBB%ʹCR~CBXBMCDB}B{_4 \$NMCPPB`4#NMCNBUBMCIB<B%ʹCPPBB ) nPMCIB<B%ʹCIBB%ʹCPPBBMD/{TCHoCPPBUB%ʹCPBUB%ʹC VBuB;/WTcDHoCPPBUB%ʹC VBuBMCPPBhep)=hMC׫6BBtdC׫6BBtdCV1BBoILy;mMCQ5BBMC׫6BBtdCV1BBg[gtdC׫6BBMC׫6BBtdC=BBg\gtdC=BBMC׫6BBMC=BQB2Ӊvܾv\tdCR~CB6BtdC6@B}B;CR~CB}BԉCܾ{\tdC6@B}BMCR~CBB;CR~CB}BӉ0ܾi\tdC6@B}BtdC=BBMCR~CBBd ȾɝdtdC=BBMC=BQBMCR~CBBZ\U;CR~CB}BMCDB}BMCIB<Bյ\U;CR~CB}BMCIB<BtdCR~CB6B6QtdCR~CB6BMCIB<BtdCIB%B _"U;CR~CB}BMCR~CBBMCDB}BHnXmGMCPPBtdCPPBSBMCPPB .LjtdCB0BtBMCB0B$BtdCV1BBxwŃe1Cl-BBtdCB0BtBCB0BB{e1Cl-BB1C\)ByBtdCB0BtBdig di1C\)ByBtdC\)B0FBtdCB0BtBn04fCB0BBtdCB0BtBtdCV1BBN'?Y%@?^ȵC^VB B׵C VB B^ȵC VBBgPS+?=?CqWB B^ȵC VBB׵C VB BhlX+?=?CqWB BCI#]BtB^ȵC VBBboX+?=?CI#]BtB^ȵCI#]BB^ȵC VBBP)v,?;?CI#]BtBbCdMXB BbCI#]BrB!,8+? J?C+BC^ȵC\)BaCwZC\)BC3/>K?C+BCCB0ByC^ȵC\)BaCjT׾m>ռS?CB0ByC^ȵCB0BܨC^ȵC\)BaCß>F?wZC\)BCC\)BNCC+BC뻾>RKT?^ȵC2BmCUsC׫6BmC^ȵC׫6BlC5>R?UsC׫6BmC^ȵC2BmC^ȵCB0BܨC~J>R?UsC׫6BmC^ȵCB0BܨCC׫6BC?mξ(>J?C׫6BC^ȵCB0BܨCCB0ByC/岾1?EJ?C8i7BmC^ȵC׫6BlCUsC׫6BmC3_>J?C8i7BmCC=BpC^ȵC׫6BlCݜ>R?C=BpC^ȵC=BC^ȵC׫6BlC?}G?UsC׫6BmCC׫6BCC8i7BmC> t ?YPJ?^ȵCR~CBCCABsCCR~CBzaCY?P?^ȵC=BsCCABsC^ȵCR~CBC}K?M?CABsC^ȵC=BsC^ȵC=BCI? E?C=BpCCABsC^ȵC=BCH9?aF?^ȵCIBCCSIB#9CCIBJCCY? L?^ȵC/GB#9CCSIB#9C^ȵCIBCE?J?CSIB#9C^ȵC/GB#9C^ȵCR~CBChk?&C?CR~CBzaCCSIB#9C^ȵCR~CBC[Ϝ!?3#C?^ȵCIOBԞCYCPPBԞC^ȵCPPBUhCXf!?M%C?YCPPBԞC^ȵCIOBԞC^ȵCIBC9Z!?#%C?YCPPBԞC^ȵCIBCCPPBDC1&?=?CPPBDC^ȵCIBCCIBJC0?8?׵C VB BCPBԞCC VBa\Bj\ /?%o9?^ȵC^VB BCPBԞC׵C VB B Y3(?!>?^ȵC^VB BYCPPBԞCCPBԞCS&?>?^ȵC^VB B^ȵCPPBUhCYCPPBԞC޶ /?7?YCPPBԞCCPPBDCCPBԞCnZ+?=?׵C VB BC VBa\BCqWB B}޾C>pM?C+BCCB0BCCB0ByCW>!%H?CB0BCC+BCC\)BNCh>CRI?CB0BCC\)BNCbCB0BW\C >q??bCB0BW\CC\)BNCbC\)BrUC\mԾA>qC?bCO32BCCB0ByCCB0BCHmԾ@>C?bCO32BCbC׫6BOCCB0ByC¾Gl>c%M?bC׫6BOCC׫6BCCB0ByC}ھC?~??CB0BCbCB0BW\CbCO32BC+&"+? I?C=BpCbCס;BmCbC=B.C2c?}L?C8i7BmCbCס;BmCC=BpCVî?oH?bCס;BmCC8i7BmCC׫6BCОcy ?=B?bC׫6BOCbCס;BmCC׫6BCk?[ I?CABsC}@CR~CBsCCR~CBzaCYl?G?}@CR~CBsCCABsCC=BpCkz?D-G?}@CR~CBsCC=BpCbCR~CBCb:?L??bCR~CBCC=BpCbC=B.CQB?uE?CSIB#9C˶CIB#9CCIBJCM5#?j>?˶CIB#9CbCCBsCbCIBC}K[|B!???CSIB#9CbCCBsC˶CIB#9CЊs?81A?CSIB#9C}@CR~CBsCbCCBsC)W?rB?CSIB#9CCR~CBzaC}@CR~CBsC:K$?9?}@CR~CBsCbCR~CBCbCCBsC?P.?[4?bCo2KB#9CCIBJC˶CIB#9C`?d.?H4?bCo2KB#9CbCPPBCCIBJCM\_/'?6??bCPPBCCPPBDCCIBJCfA!Y0?)3?˶CIB#9CbCIBCbCo2KB#9CPP4?P4?C VBa\BbCQBԞCbC VBBrn/?8?CPBԞCbCQBԞCC VBa\Brn/?8?bCQBԞCCPBԞCCPPBDC>s3?s3?bCPPBCbCQBԞCCPPBDC#:+?7M)=z=?/C-BaC/CB0B6ACbC\)BrUCB\ܾ> E?/CB0B6ACbCB0BW\CbC\)BrUC lo?P7?:C\)BaC/C\)B` C/C-BaCS8?G?bCO32BC$C׫6BCbC׫6BOCþ?C?$C׫6BCbCO32BCbCB0BW\Cþ ?hC?$C׫6BCbCB0BW\C/C׫6BCѾx ? BmCbC=B.CkC=BmC=q?}+>?/C3>BmC/CR~CBBmCF&/?҅5?bCIBC/C{FBsC/CIBC g_"?9=?bCCBsC/C{FBsCbCIBCOcpn%?:?/C{FBsCbCCBsCbCR~CBCVtV.?@1?/CR~CB^?B?/C-BaC-CB0BaC/CB0B6ACq^վ?rc6?-CB0BaCCY*B< CCB0B) Cvjq ?6?/C-BaCCY*B< C-CB0BaCE> ?6?/C-BaCָC\)B< CCY*B< Co?Q7?/C-BaC/C\)B` CָC\)B< CP~?(?ָC\)B< CC\)BBt CCY*B< CȾ?I8?C2BaC/CB0B6AC-CB0BaCɾ*?8?C2BaCC׫6BiC/CB0B6AC'<- ???C׫6BiC/C׫6BC/CB0B6ACоBmCCiABmC/CR~CBBmC/C=BC>$*?0?C=ByCCiABmC/C=BC=8@6?2q-?/CIBCCHBsCCIB{UC#QE.?'4?/C{FBsCCHBsC/CIBCRЪ/?2?CHBsC/C{FBsC/CR~CB?x@)?CPPBEC%ʹCoNB#9C%ʹCPPBjC}Խ6?1?C,MB#9C%ʹCoNB#9CCPPBECxٽ-e;?F,?%ʹCoNB#9CC,MB#9CCIB{UC9P??&?%ʹCIBC%ʹCoNB#9CCIB{UCK$y_4?4?C VBB%ʹCTBԞC%ʹC VBCU 7?1?CxTBԞC%ʹCTBԞCC VBB-Yh:?.?%ʹCTBԞCCxTBԞCCPPBECҭ&@?Y'?%ʹCPPBjC%ʹCTBԞCCPPBEC疉s7?1?%ʹCIZB BCkHZB BC VBB*w6?:B3?%ʹC VBC%ʹCIZB BC VBB#I?)6?%ʹC/B< CVCB0B< C%ʹCB0B Cbp¾%?>)?VCB0B< CMCp,B CMCB0B CKy¾%?e@)?%ʹC/B< CMCp,B CVCB0B< Cξ?W,?%ʹC/B< CEC\)B CMCp,B Cξ?W,?%ʹC/B< C%ʹC\)BA CEC\)B C ܏[#?_7?%ʹCi6BaCιC׫6BaC%ʹC׫6BC׸v.?CG+?ιC׫6BaCMC3B< CMC׫6BR C,-?+?%ʹCi6BaCMC3B< CιC׫6BaCk#?0?%ʹCi6BaCVCB0B< CMC3B< COK#?Z0?%ʹCi6BaC%ʹCB0B CVCB0B< Cl/?!?VCB0B< CMCB0B CMC3B< C4-*?51?MCR99BaC%ʹC׫6BCιC׫6BaC" |2?(?MCR99BaCMC=BC%ʹC׫6BCNp,?3?MC=BC%ʹC=BC%ʹC׫6BCs3?&?ιC׫6BaCMC׫6BR CMCR99BaC3)/ 5?;!/?%ʹCSCBmC CR~CBmC%ʹCR~CBbCYc8;?'? CR~CBmCMC)?BCMCR~CBUCd5q?\A)?%ʹCoNB#9CMCvOB#9C%ʹCPPBjCC??&?%ʹCIBC:CIBsCMC^JBsCJEʡ??&?%ʹCIBCMC^JBsC%ʹCoNB#9CYD?Z1"?%ʹCoNB#9CMC^JBsCMCvOB#9Cg+]B?>#?:CIBsCMCIBCMC^JBsCi9?A0?%ʹC VBCMC?&UBԞCMC VB4Cq4?4?%ʹCTBԞCMC?&UBԞC%ʹC VBCo?Z@?Z'?MC?&UBԞC%ʹCTBԞC%ʹCPPBjC]7A?F &?MCPPBCMC?&UBԞC%ʹCPPBjC;V6?a|3?MC8/[B B%ʹCIZB B%ʹC VBC*gu:?.?MC VB4CMC8/[B B%ʹC VBCma'?+?MCp,B CZ`CB0B CMCB0B Crn4?3%?MC׫6BR CtdC5B< CtdC׫6B C:(.?c*?MC3B< CtdC5B< CMC׫6BR Cݰo-?=&?MCB0B CZ`CB0B CtdCTS0B C­1?B1#?MCB0B CtdCTS0B CMC3B< Cci6? ?MC3B< CtdCTS0B CtdC5B< C(PQ>?4"?MC=BCtdC^\;BaCtdC=B!C*q*4?*?MCR99BaCtdC^\;BaCMC=BCDsu6?K(?tdC^\;BaCMCR99BaCMC׫6BR Ci =??tdC׫6B CtdC^\;BaCMC׫6BR C C?se!?MCR~CBUCtdC@BCtdCR~CBu)C&+J5C?H$?tdCJBsCMC^JBsCMCIBChK?d?tdCIBCtdCJBsCMCIBC?!?tdC׫6B CC׫6B< C1C7B< C7eM??޲?tdC׫6B C1C7B< CtdC^\;BaC#'?F??tdC^\;BaC1C7B< C1C?)?1CbZB BtdCIZB BtdC VBB/CmM=.k@?\(?1C VBC1CbZB BtdC VBB/C(޾T*?Ճ?EC\)B CMC\)B CMCp,B C,ƾ`2? ?Z`CB0B CtdCk*BOq CtdCB0BB C¾2?d?MCp,B CtdCk*BOq CZ`CB0B CՏξ",?Y?MCp,B C3C\)BOq CtdCk*BOq C#˾u-?q_?MCp,B CMC\)B C3C\)BOq CI׾g3?7?3C\)BOq CtdC\)Bb CtdCk*BOq Cm:??Z`CB0B CtdCB0BB CtdCTS0B C>򠾠+%ʹC}1}BB%ʹCSzB%BD>C}1}B%By%W-%ʹC]́B~B%ʹC ǀBBPC]́BB[y%^-D>C}1}B%BCK~B%BC]́BBFy%-%ʹC}1}BBD>C}1}B%BC]́BBo my%Z-%ʹC}1}BBC]́BBPC]́BBlYy%-%ʹC}1}BBPC]́BB%ʹC ǀBBڭx3s9%ʹCBCB%ʹCb~B谪BCB谪B 7(3PC]́BBC.BBCBīB8(y3%ʹC]́B~BPC]́BBCBīBܭs9%ʹC]́B~BCBīBCB谪B٭t9%ʹC]́B~BCB谪B%ʹCb~B谪B8){3PC]́BBC]́BBC.BB@ ACB谪BCbyB谪BC6BiB~ ACB谪BC6BiB%ʹCBCB|̰^8 C%ʹCBCBC6BiB%ʹC6BB/% ACB谪BCBīBCbyB谪Bt'F'%ʹC}1}BBMC}1}B:BMC;wB%BҾ&K)%ʹCSzB%B%ʹC}1}BBMC;wB%Bx s.%ʹC]́B~BMC]́B*BMC}BBľj#c +%ʹC ǀBB%ʹC]́B~BMC}BBľ%# +MC}BB%ʹC}1}BB%ʹC ǀBBGȾl27-MC}1}B:B%ʹC}1}BBMC}BBо@/%ʹCBCBMCB\BMCXB谪B'2ɾh&M5%ʹCb~B谪B%ʹCBCBMCXB谪Bg0ɾ%LO5MCXB谪B%ʹC]́B~B%ʹCb~B谪Bw¾)2MC]́B*B%ʹC]́B~BMCXB谪B:b -7MC6B5BMC--BI|BC6BI|Bc ?,7MC--BI|B%ʹC6BBC6BI|Ba {.7MC--BI|BMCB\B%ʹC6BB[޾?;MCB\B%ʹCBCB%ʹC6BBEjԾn) OtdC?vB4BtdC9sB%BaC?vB%Bs߾""tdC}1}B BtdCݾ ,1C_pBzB`C_pB%BtdC?vB4B^SL-&1C_pBzBtdC?vB4B&ԻC?vBB\'Y,k1C_pBzB&ԻC?vBB1CtBBפ$"1C}1}BAVB1C3zB谪B˻C}1}B谪B2"2"&ԻC?vBBtdC )vûC]́BI|BtdC=BI|BtdCBۥB= )bw1C]́B5BûC]́BI|BtdCBۥB(K j$1C]́B5BtdCBۥBc޻CBGB'K +k$1C]́B5Bc޻CBGB1C4BGBw> )VwûC]́BI|BtdC]́BШBtdC=BI|B,O,c޻CBGBtdC3BGBtdC6BBD4,c޻CBGBtdC6BB1CB3BS`XF81CB3BtdC6BB1C6B3B,c޻CBGBtdCBۥBtdC3BGB;SCcB1BCK#cB?!B{CcB?!B۰}:SCK#cB?!B^ȵCcBB{CcB?!BZK7SCK#cB?!BCI#]BBB^ȵCcBBnCTY_CI#]BBB^ȵCI#]BŨB^ȵCcBBPބpqT{CcB?!B^ȵCbfB?!B^ȵCiBeBT܄%pcT{CcB?!B^ȵCiBeBCcB1B+9LCcB1B^ȵCiBeBCiBBw݄oOT{CcB?!B^ȵCcBB^ȵCbfB?!Bt@^ȵC_pBeٽBC_pB_rBClBB6 G^ȵCP(pBB^ȵC_pBeٽBClBB.{ GClBB^ȵCiBeB^ȵCP(pBB'BCiBB^ȵCiBeBClBB5C?vB'BC}dtBBC?vBB5C}dtBB^ȵC?vBvKBC?vBB'W5C}dtBBC_pB_rB^ȵC?vBvKBj m=C_pB_rB^ȵC_pBeٽB^ȵC?vBvKBǾ1(e%C}1}B`xBC#{BcB&C}1}BcBeޱ3!1C?vBB^ȵC xBB^ȵC}1}BcB౾3!-1C?vB'BC?vBB^ȵC}1}BcB2ƾ&'&C?vB'B^ȵC}1}BcB&C}1}BcBv3ƾ&&C?vB'B&C}1}BcBC#{BcBcޱ3!1C?vBB^ȵC?vBvKB^ȵC xBB#O0C]́BBCBNBC]́BNBI̾,&C}1}BcB^ȵCD~BcB^ȵC]́BBOþ,!C}1}B`xB&C}1}BcB^ȵC]́BBG+$C}1}B`xB^ȵC]́BBC]́BNBIf*'C}1}B`xBC]́BNBCBNB2ƾ&.&&C}1}BcB^ȵC}1}BcB^ȵCD~BcB]ͼ1CC]́BNB^ȵCmBNB^ȵCBUiBF1C]́BBC]́BNB^ȵCBUiB9޸1ҤC]́BB^ȵCBUiBCB%B31s C]́BBCB%BC`B%B6FQ/z!C]́BNB^ȵC]́BB^ȵCmBNBbg2CB%B^ȵCBUiB^ȵCHB%BvQOCcB1BbCcB BbC_D`B?!B>WhTCK#cB?!BCcB1BbC_D`B?!BahsTbC_D`B?!BCI#]BBBCK#cB?!BQQ| QQbCI#]B(BCI#]BBBbC_D`B?!B5 GEbCiBBbCXiBB6~BNB8߱o14!CBNBC]́BBbC>~BNB:۫o+*)bC>~BNBC}1}B`xBCBNBۭrC*rC*bC}1}BfմBC}1}B`xBbC>~BNBBc3"bC-B%BC]́BBC`B%B䨾U.&bC]́BBC]́BBbC-B%B‡;xEbCcB B/CcB|B/C&]B?!B=XG 0QbC_D`B?!BbCcB B/C&]B?!BXzG $0Q/C&]B?!BbCI#]B(BbC_D`B?!BQHQH/CI#]BZBbCI#]B(B/C&]B?!B'@bCiBB/CiB_rB/Cp-fBBȏrFbCXiBBbCiBB/Cp-fBBÏZn F/Cp-fBBbCcB BbCXiBBcޅ/B/CcB|BbCcB B/Cp-fBB2Ԧ\ $21/C_pB}B/CzmBBJC_pBBԦ $1/CzmBBbC_pBBJC_pBB3Ԧ $q1/CzmBB/CiB_rBbC_pBBx/>{;/CiB_rBbCiBBbC_pBBg&./C?vBoB/C̅tBcBC?vBcB%0JC_pBBbCwpBBbC?vB3BJ%0/C_pB}BJC_pBBbC?vB3BYj<&./C_pB}BbC?vB3BC?vBcBfǬ&./C_pB}BC?vBcB/C̅tBcBN̨%0JC_pBBbC_pBBbCwpBB[n**/C}1}B;B/C" {BNBC}1}BNB#)2t,C?vBcBbCwBcBbC}1}BfմBg&)Mt,/C?vBoBC?vBcBbC}1}BfմBê*ê*/C?vBoBbC}1}BfմBC}1}BNB*{*/C?vBoBC}1}BNB/C" {BNB,)r,C?vBcBbC?vB3BbCwBcB:@:@.&C}1}BNBbC>~BNBbC]́BBIv.j'/C}1}B;BC}1}BNBbC]́BB-롾- -R*/C}1}B;BbC]́BBC]́B%B9c,b,/C}1}B;BC]́B%B/CB%B**C}1}BNBbC}1}BfմBbC>~BNB,0'C]́B%BbC]́BBbC-B%BNZACcBeٽBC>\cBBCcBBLlRqBGl`CI#]B?!B/C&]B?!B/CcB|BlUqAGCI#]BSgBl`CI#]B?!B/CcB|BC섾WACI#]BSgB/CcB|BCcBB񄾀WACI#]BSgBCcBBC>\cBBZl?sr@Gl`CI#]B?!B/CI#]BZB/C&]B?!Bޅ6BCcBB/Cp-fBB/CiB_rBޅBCcBB/CiB_rBCcBeٽB 6CcBeٽB/CiB_rBCiBZ B)ޅ4BCcBB/CcB|B/Cp-fBB;{;(K-/C_pB}BC_pB`BCСjBB6a%2/CzmBB/C_pB}BCСjBB`%2CСjBB/CiB_rB/CzmBB`z)g/CiBZ B/CiB_rBCСjBB ݣ' -/C?vBoBC?vBfմBC?qBcBU&./C̅tBcB/C?vBoBC?qBcBX&.C?qBcB/C_pB}B/C̅tBcB9=(_-C_pB`B/C_pB}BC?qBcB**/C}1}B;BC}1}BǠBCwBNBW*ܪ*/C" {BNB/C}1}B;BCwBNBê**CwBNB/C?vBoB/C" {BNB**C?vBfմB/C?vBoBCwBNB7*f*CK~B%B/C}1}B;B/CB%BP>d&P>.C}1}BǠB/C}1}B;BCK~B%Bq"6CcBeٽB%ʹCcBB%ʹCt`BBܯ@C>\cBBCcBeٽB%ʹCt`BBЉӬ@%ʹCt`BBCI#]BSgBC>\cBBh%+:%ʹCI#]BfBCI#]BSgB%ʹCt`BB%Զ0%ʹCiBB%ʹCrgBBp)CiBB]e%0%ʹCrgBBCiBZ Bp)CiBB:%;0%ʹCrgBB%ʹCcBBCiBZ B*5!=8%ʹCcBBCcBeٽBCiBZ Bʪ*ʪ*%ʹC_pBVB%ʹC]nBcB|3C_pBcBZ9(B.p)CiBBCСjBBC_pB`Bm](QB.%ʹCiBBp)CiBBC_pB`B**%ʹCiBBC_pB`B|3C_pBcB**%ʹCiBB|3C_pBcB%ʹC]nBcB\(@.p)CiBBCiBZ BCСjBB 7u)7u)%ʹC?vBr!B%ʹCmtBNBX+%ʹC?vBr!BC}1}BǠBD>C}1}B%B՘(>+%ʹC?vBr!BD>C}1}B%B%ʹCSzB%B' u)u)XC}1}B%BC}1}BǠBCK~B%BIr*s)E1%ʹCcBBMCcB>BMC]BB$8%ʹCt`BB%ʹCcBBMC]BB[c$,8MC]BB%ʹCI#]BfB%ʹCt`BB|Dwd+3MCI#]BLB%ʹCI#]BfBMC]BB9-)c(%ʹCiBBMCiBBMCʙdBBڔÆ'2%ʹCrgBB%ʹCiBBMCʙdBBڔ[' 2MCʙdBB%ʹCcBB%ʹCrgBB\--MCcB>B%ʹCcBBMCʙdBBÅ-h%%ʹC_pBVBMC_pBBMCjBcB[*ت*%ʹC]nBcB%ʹC_pBVBMCjBcBê**MCjBcB%ʹCiBB%ʹC]nBcB@C-d(MCiBB%ʹCiBBMCjBcBX>)^'%ʹC?vBr!BMC?vBTBMC pBNB((%ʹCmtBNB%ʹC?vBr!BMC pBNBԩ((MC pBNB%ʹC_pBVB%ʹCmtBNB-k%MC_pBB%ʹC_pBVBMC pBNBӾH&K)MC;wB%B%ʹC?vBr!B%ʹCSzB%B")'MC?vBTB%ʹC?vBr!BMC;wB%BBA@.0&tdCcB–BtdC,eaBBںCcBBt'0[̺CI#]BBMC]BBMCcB>B'0tdCI#]BؼB[̺CI#]BBMCcB>B̪~*Ϊ*tdCI#]BؼBMCcB>BںCcBB&**tdCI#]BؼBںCcBBtdC,eaBBxO'q0[̺CI#]BBMCI#]BLBMC]BB01>"tdCiB.BtdCzgBcB$̺CiBcB -ݣ'ںCcBBMCʙdBBMCiBB`Y,('tdCcB–BںCcBBMCiBB^-E&tdCcB–BMCiBB$̺CiBcB-y%tdCcB–B$̺CiBcBtdCzgBcB**ںCcBBMCcB>BMCʙdBBI/StdC_pBeBtdCjmBNBC_pBNB |-x%$̺CiBcBMCjBcBMC_pBB7[N-p$tdCiB.B$̺CiBcBMC_pBB 㺾-"tdCiB.BMC_pBBC_pBNBeq. tdCiB.BC_pBNBtdCjmBNBѱ*k, '$̺CiBcBMCiBBMCjBcB칾)S'C_pBNBMC pBNBMC?vBTBƾ_(,$tdC_pBeBC_pBNBMC?vBTBM̾(@*g!tdC_pBeBMC?vBTBaC?vB%Bw*׾!, tdC_pBeBaC?vB%BtdC9sB%BqJ,<$C_pBNBMC_pBBMC pBNBOо9&\$aC?vB%BMC?vBTBMC;wB%BD.k#tdCcB–B1CcBηB1C^BBY -w%tdC,eaBBtdCcB–B1C^BBa[**1C^BBtdCI#]BؼBtdC,eaBBb **1CI#]B1BtdCI#]BؼB1C^BBȾ2q1CiBa8B1CLiBNB)CiBNBþ8-] tdCiB.B)CiBNB1CLiBNBþ-|W tdCiB.B1CLiBNBtdCzgBcBͼ 1UCtdCzgBcB1CLiBNB1CdBcBķ,y$1CdBcBtdCcB–BtdCzgBcB@ﵾ,.ާ#1CcBηBtdCcB–B1CdBcBVľ/`)CiBNBtdCjmBNBtdC_pBeBL˾I^0;1CiBa8B)CiBNBtdC_pBeB]ξo 1]r1CiBa8BtdC_pBeB`C_pB%B%־*>0u1CiBa8B`C_pB%B1CQoB%Bþk-Y )CiBNBtdCiB.BtdCjmBNBҾE,v`C_pB%BtdC_pBeBtdC9sB%B½V$?B?^ȵCcBYBC1^BjBCcBKBخr>&? rA?^ȵCk]BjBC1^BjB^ȵCcBYB׮j=&?sA?C1^BjB^ȵCk]BjB^ȵCI#]BB $?B?CI#]BtBC1^BjB^ȵCI#]BBBǽ?BG?^ȵCiBBC`fB˟BCiB]2B!@ǽ?WBG?^ȵC"_eB˟BC`fB˟B^ȵCiBBAǽz?!AG?C`fB˟B^ȵC"_eB˟B^ȵCcBYB@AǽU?@AG?CcBKBC`fB˟B^ȵCcBYBFk?9H?^ȵC_pB1BCnB,kBC_pB@Bnb ?KgE?^ȵCYmB,kBCnB,kB^ȵC_pB1B+pd ?WfE?CnB,kB^ȵCYmB,kB^ȵCiBBȽ ?H?CiB]2BCnB,kB^ȵCiBBaO!?vC?^ȵC?vB|BC[vB6BC?vB B #?VB?^ȵCuB6BC[vB6B^ȵC?vB|B|#?B?C[vB6B^ȵCuB6B^ȵC_pB1B2S"?C?C_pB@BC[vB6B^ȵC_pB1BE_#? B?^ȵC|BBLC}1}BB^ȵC}1}B?C]́BmBbC6~BBbC]́B+BN+?=?Ch}BBbC6~BBC]́BmBP+?(=?bC6~BBCh}BBC}1}BGUB ű)??>?bC}1}BBbC6~BBC}1}BGUB-k'?W??CBBbCBPBbCB Bͽn +?)?bC6~BB/C&BBbC]́B+B:*?>?/C&BBbC6~BBbC}1}BBN?$?C?/C}1}BB/C&BBbC}1}BBMG&?}A?bCB B/CXBPB/CB_B樛Z(?@?bCBPB/CXBPBbCB BL(?\@?/CXBPBbCBPBbC]́B+B@n&?dA?/C]́B!B/CXBPBbC]́B+BeY+)?xX>?bC6BpB/CBB/C6BBg>+??/CB_B/CBBbCB B+)?߉>?/CcBfBCt!aBjBCcBB'???/C;I`BjBCt!aBjB/CcBfB '???Ct!aBjB/C;I`BjB/CI#]B5BX)?X>?CI#]BBCt!aBjB/CI#]B5B]9$?'C?/CiBhBCChB˟BCiBW Bv^"?D?/CgB˟BCChB˟B/CiBhB"?ZD?CChB˟B/CgB˟B/CcBfB]$?B?CcBBCChB˟B/CcBfBԧ$?C?/C_pBy1BCm1pB,kBC_pBWB6o?H?/C5oB,kBCm1pB,kB/C_pBy1B4(m?H?Cm1pB,kB/C5oB,kB/CiBhBk^%$?(C?CiBW BCm1pB,kB/CiBhBA3$?vC?C_pBWBC?vBB/C_pBy1BA5$?vC?C?vBB/C?vB}B/C_pBy1BEüG %?EC?/C}1}BBCwB6BC}1}B%B .#? E?/CrwB6BCwB6B/C}1}BB m1#? E?CwB6B/CrwB6B/C?vB}B$?C?C?vBBCwB6B/C?vB}B\ü, %?\C?/C]́B!BCcBBC]́B:B[ü %?C?/C&BBCcBB/C]́B!B$üI %?gC?CcBB/C&BB/C}1}BB*üg %?*C?C}1}B%BCcBB/C}1}BB$?ʈC?/CB_BCw~BPBCBYBmF&?B?/CXBPBCw~BPB/CB_BGL&?FB?Cw~BPB/CXBPB/C]́B!Bü~ %?C?C]́B:BCw~BPB/C]́B!BMH)*? ??/C6BBCE,BBC6B{BeQ'(*?Y??/CBBCE,BB/C6BBQ(*? ??CE,BB/CBB/CB_BLQ(*?8??CBYBCE,BB/CB_B.)?>?CcBB%ʹC4aBjB%ʹCcB BPo)?ִ>?Ct!aBjB%ʹC4aBjBCcBB)?^>?%ʹC4aBjBCt!aBjBCI#]BB0)?$>?%ʹCI#]BB%ʹC4aBjBCI#]BB(G**? ??CiBW B%ʹC iB˟B%ʹCiB2Bv~($?W}C?CChB˟B%ʹC iB˟BCiBW B}(/$?x~C?%ʹC iB˟BCChB˟BCcBBl)?ϴ>?%ʹCcB B%ʹC iB˟BCcBB@h(?m@?C_pBWB%ʹCUPpB,kB%ʹC_pBdBF%?RC?Cm1pB,kB%ʹCUPpB,kBC_pBWBF%?C?%ʹCUPpB,kBCm1pB,kBCiBW BeGy(?@?%ʹCiB2B%ʹCUPpB,kBCiBW B@ѐ(?l@?%ʹC_pBdB%ʹC?vBBC_pBWBCC?%ʹC;BBCcBBC}1}B%B+B?MC3pB,kBtdC1oB,kBMC_pBWBd=W)?>>?tdC1oB,kBMC3pB,kBMCiB2B  =;j-???tdC_pBBMC?vB}BMC_pBWB =((?.@?[SC?vB6BMC}1}BBMCmiwB6BM0=)(?-@?[SC?vB6BtdC?vB$0BMC}1}BB#=((?.@?tdC?vB$0BtdC}1}BbBMC}1}BB!=)(?-@?[SC?vB6BMCmiwB6BMC?vB}B=)?8>?MC]́BBtdCv ~BBtdC]́B?tdC}1}BbBtdCv ~BBMC}1}BBW=U)?3 >?MCBBtdC BPBtdCB_B~=1&?dA?MC%BPBtdC BPBMCBBk=2&?cA?tdC BPBMC%BPBMC]́BB븦=)?S>?tdC]́BG*?,&,?2:?tdCiBW B1CgB˟B1CiBKB=t'?`??tdChB˟B1CgB˟BtdCiBW B=t'?`??1CgB˟BtdChB˟BtdCcBbBn=,?n;?1CcBsB1CgB˟BtdCcBbB=iS)?!>?tdC_pBB1CnB,kB1C_pBnB8=w{,?5;?tdC1oB,kB1CnB,kBtdC_pBBt9={,?;?1CnB,kBtdC1oB,kBtdCiBW B\>(?n=?1CiBKB1CnB,kBtdCiBW B_?=*?*?'׋*?(χ*?,?.?e6?1C]́BB*C]́BPB1CƁBPB_>(?^=?UC}1}BBtdC]́B(?=?1C}1}BBtdC]́B".?6?1C}1}BB*C]́BPBtdC]́B!.?6?1C}1}BB1CƁBPB*C]́BPBF]>(?M=?UC}1}BBtdCv ~BBtdC}1}BbB 0>'?N´'?Qx)?:?1C]́BB1CB7BtdCB_B0>'?O5+?6?tdC6BB1C7MBB1C6BB<>&(?r:?tdC02BB1C7MBBtdC6BB<>(?s:?1C7MBBtdC02BBtdCB_B7>=,?7?1CB7B1C7MBBtdCB_B<040\/CBB/C䆞B/uB'CB/uB3$3$׾/CۡBB/C:B BǷCۡB B0i4ؖ1sP/C:B B/C䊟B@BCۡB@B9.39.3LǷCۡB B/C:B BCۡB@B2E/U^/C䊟B@B/CBB'CB/uB 2 K/E^/C䊟B@B'CB/uBCۡB@B}TCۡB@B'CB/uBCۡB/uB 72CBL BCB BqCB B,".6TCB BCxB@BnCB@BߞCLaqCB BCB BnCB@B%?+:ah/CBBnCB@BCxB@Bj%+:h/CBBCxB@B/C䆞B/uB 'R8pq/C䆞B/uBCxB@BC4B/uB*^vCۡBBC4!BS׍B!\CۡBS׍B`8+qCB B/C:B B/CۡBB>[8PCBL BqCB B/CۡBBJM8wCBL B/CۡBB!\CۡBS׍Bt&8CBL B!\CۡBS׍BC4!BS׍BS-CLanCB@B/C:B BqCB B2){; /C䊟B@B/C:B BnCB@B-'_8 jnCB@B/CBB/C䊟B@BBȾķN%ʹCTrB&B%ʹCB@B!CTrB@BxEFxž%ʹCB@B%ʹCB/uBCTrB/uBLվ,\̖!CTrB@B%ʹCB@BCTrB/uB iG6CBL B%ʹCBB%ʹCߜB B{WLI CB BCBL B%ʹCߜB BFȾߵN!CTrB@B%ʹCߜB B%ʹCTrB&Bf@Ⱦ>N!CTrB@BCxB@B%ʹCߜB B~^arCxB@BCB B%ʹCߜB BJվH-\˖CTrB/uBCxB@B!CTrB@Bp,iNtC4B/uBCxB@BCTrB/uB97 /,CۡBB%ʹCۡBH B%ʹCg:BS׍BzR;j&C4!BS׍BCۡBB%ʹCg:BS׍BhSNr %ʹCg:BS׍BCBL BC4!BS׍BLhG`%ʹCBBCBL B%ʹCg:BS׍B WP>%ʹCTrB&BMCTrB@’BMCykB@B1A\L>%ʹCB@B%ʹCTrB&BMCykB@B6Qx MCykB@BMCDB/uB%ʹCB@Bߨ(X))ؾ%ʹCB@BMCDB/uB%ʹCB/uBƼX&H}%ʹCBBMCBDBMCB BM;%ʹCߜB B%ʹCBBMCB B `GMCB B%ʹCTrB&B%ʹCߜB B YP;MCTrB@’B%ʹCTrB&BMCB B_S4/MCBDBtdCB]BtdC:B B#C=*BG(MCB BMCBDBtdC:B B#=Q4CtdC:B BMCTrB@’BMCB BD=E'#tdCTrBBMCTrB@’BtdC:B BW[>0(0MCۡBwBtdCۡBBtdC4!BS׍BsS>|2q/MC-BS׍BMCۡBwBtdC4!BS׍BҔg>C4jtdC4!BS׍BMCBDBMC-BS׍B =>S4"/tdCB]BMCBDBtdC4!BS׍B,=$~BtdC=BҖB1C=BNHB1CB/uB=7D4"tdCB/uBtdC=BҖB1CB/uBA?o>,4K+tdCTrBB1CTrB{B1CsEB@BX>@tdC^B@BtdCTrBB1CsEB@B`X>@r1CsEB@BtdC=BҖBtdC^B@Bx=p4p41C=BNHBtdC=BҖB1CsEB@B#>p-p-tdCB]B1CBB1CSB Bh>0>*tdC:B BtdCB]B1CSB B>,<1CSB BtdCTrBBtdC:B Bi.4@+1CTrB{BtdCTrBB1CSB Bm>$}m/tdCۡBB1CۡBDB1CbBS׍B>**tdC4!BS׍BtdCۡBB1CbBS׍BA>n'-ļ'1CbBS׍BtdCB]BtdC4!BS׍Bؖ>P'y21CBBtdCB]B1CbBS׍B{F9HC:kBCBCӊB谪BCFC:kB谪BLBQ4C6BB^ȵC2BB^ȵC:kB^BPP4C6BBC6BB^ȵC:kB^B祉K9HC6BB^ȵC:kB^BCFC:kB谪B@8HC6BBCFC:kB谪BCӊB谪BM[tP4C6BB^ȵC6B ,B^ȵC2BBWGOCFC:kB谪B^ȵCkyB谪B^ȵC؟BLPB[x$OCFC:kB谪B^ȵC؟BLPBC:kBCBnCTY_C:kBCB^ȵC؟BLPBC؟BɜBX?OCFC:kB谪B^ȵC:kB^B^ȵCkyB谪BqOsmC؟BɜB^ȵC؟BLPBCwԑBBddCwԑBB^ȵC؟BLPB^ȵCwԑBBI= v^ȵC BNBC BBCBI|BW7̾5jCBI|B^ȵCwԑBB^ȵCXXBI|Bkv$kvCwԑBB^ȵCwԑBBCBI|B=% '|C BB^ȵC BNBC=BR5B>s0fC=BR5B^ȵC BNB^ȵC=B(BC?8(R^ȵCBGB^ȵCTrBBڵCTrBGB A?&DRڵCTrBGB^ȵC=B(B^ȵCBGBYF?I%+RڵCTrBGBCTrBB^ȵC=B(Bw>B6rCTrBBC=BR5B^ȵC=B(Bz? 2$WCBGBڵCTrBGB^ȵCTrBBs4?5FPD^ȵCB@BCBGB^ȵCTrBB7>?yGCTrBBCBGBCBΥB}?5$|WڵCTrBGBCBGBCTrBB0?yG0CۡBGBCBGB^ȵCB@B-?罥9^ȵCۡBB0CۡBGB^ȵCB@B/?<::CBΥB0CۡBGBCۡBB0?yGCBGB0CۡBGBCBΥBnat\jSC:kBCBbC:kBiBbC`B谪BʂZs&HCӊB谪BC:kBCBbC`B谪B˂-toHbC`B谪BC6BBCӊB谪B@C4ObC6BjBC6BBbC`B谪BlspOebC:kBiBC:kBCBbC؟BBB羒`bC؟BBC:kBCBC؟BɜBڬsbCwԑBBbCBI|BYCwԑBI|B} ~sbCBI|BCwԑBBYCwԑBI|B󽏮~sbCBI|BbC؟BBCwԑBBUH$InbC؟BBC؟BɜBCwԑBB]|~uYCwԑBI|BCBI|BC BBg~NuYCwԑBI|BC BBbCwԑBBYhzktKWhzbCwԑBBC BBbC BnuBnuYCwԑBI|BCwԑBBCBI|BmxnmxbC BnuBC BBbC=BhB}=R}bC=BhBC BBC=BR5BKs|=>Ks|bC=BhBC=BR5BbCTrBBbN>b9*wbCTrBBC=BR5BCTrBB>R'>__CBI|BbCÄBI|BbCTrBB>>I'>A __CBI|BbCTrBBCBΥB[>2ӷvCBΥBbCTrBBCTrBB>U'>T_bCÄBI|B_CBI|BbCBBz>.=ia >CۡBI|B_CBI|BCBΥBq ? VoVCۡBB >CۡBI|BCBΥBu ?怺='$UbCBB >CۡBI|BbCۡBtܧB(Q>*ܜ=lva_CBI|B >CۡBI|BbCBB)&&QjC6B谪BbC`B谪BbC:kBiB'&5QjC6B谪BbC:kBiB/C6BbjB!ZBZ/C6BbjBbC:kBiB/C:kBɜBy''QjC6B谪BbC6BjBbC`B谪BKeKe/C؟BBB/CBI|B"C؟BI|Bee/CBI|BbC؟BB"C؟BI|Bewe/CBI|B/C:kBɜBbC؟BBee/C:kBɜBbC:kBiBbC؟BBCnn"C؟BI|BbCBI|BbCwԑBBʧnʧn"C؟BI|BbCwԑBB/C؟BBB=/6j/C؟BBBbCwԑBB/CwԑBR5B6n;n"C؟BI|BbC؟BBbCBI|B!ƆHoo/CwԑBR5BbCwԑBB/C B*hBY B$n/C B*hBbCwԑBBbC BnuB#؊q/C B*hBbC BnuB/C=BB3;zjj/C=BBbC BnuBbC=BhB.3̾L1̽]i/C=BBbC=BhB/CTrBէB%>O/CTrBէBbC=BhBbCTrBBPJ;/C䆞B/uB/CT)BΩBCBΩB44a'CB/uB/C䆞B/uBCBΩBهcE ˻/CT)BΩB/C/BmޝB4CBmޝB7K%0<CBΩB/CT)BΩB4CBmޝBwb龵$=/C/BmޝB/CB1cB4CBmޝB20e>e4bCÄBI|BNdCBI|B/CBZB2>4bCÄBI|B/CBZBbCTrBBL>PbCTrBB/CBZB/CTrBէB,2ބ>߫4bCÄBI|BbCBBNdCBI|B TYx'CB/uBCBΩBCۡB/uBwbx܍=CBΩBCۡBΩBCۡB/uBqcWi<CBΩB4CBmޝBCۡBΩB@mX1>4CBmޝBzԷCۡBmޝBCۡBΩB9wOYh=/CB1cB/CB BCۡB B^wXh=/CB1cBCۡB B4CBmޝBBkf\>4CBmޝBCۡB BzԷCۡBmޝB~ABOeCۡB B/CB Bi!CۡBGBL0306/CtBGB/CBZBNdCBI|B%<3e;6/CtBGBNdCBI|Bi!CۡBGB F =Ȝ i!CۡBGBNdCBI|B{CۡBI|B: 3+=~5NdCBI|BbCۡBtܧB{CۡBI|Bn63Z=t5bCBBbCۡBtܧBNdCBI|Bns]UC6BiB/C6BbjBC:kBBnj~VVC:kBB/C6BbjB/C:kBɜB7;v}[/C؟BBBC؟BBC?BI|B$\d{a/CBI|B/C؟BBBC?BI|B#Hb1aC?BI|B/C:kBɜB/CBI|BΑ^о/^C:kBB/C:kBɜBC?BI|BQ;q}[C؟BB/C؟BBBCwԑB0BYBX$oZCwԑB0B/C؟BBB/CwԑBR5BTqľZ8C B;ڢBC8YBGBXC BGB*T7pľ8C8YBGB/C B*hBXC BGBToľ98C8YBGBCwԑB0B/C B*hB^^CwԑB0B/CwԑBR5B/C B*hBoATMC=B͟BCtB B ظC=B BX *N-CtB BC B;ڢBXC BGBhRO*CtB BXC BGB ظC=B BwX9b ظC=B BXC BGBP^C=BGBV2%W2XC BGB/C=BBP^C=BGBBǽNBG/C B*hB/C=BBXC BGB--]CTrBBCQBΩBݴCTrBΩBI?!+QCQBΩBCGBmޝBCTrBmޝBf2f2lݴCTrBΩBCQBΩBCTrBmޝB8xCGBmޝBC=B͟B ظC=B B}8rQCGBmޝB ظC=B BCTrBmޝB8gZؾACTrBmޝB ظC=B BwCTrB Bw)Lgr ظC=B BP^C=BGBwCTrB BOwؽBYhP^C=BGBGCTrBGBwCTrB Bz4\蝽{4P^C=BGB/CTrBէBGCTrBGBz4Ᵹz4/C=BB/CTrBէBP^C=BGB - .pXݴCTrBΩBC4B/uBCTrBB`Bw<ݴCTrBΩB/CT)BΩBC4B/uB[L+=Vh/CT)BΩB/C䆞B/uBC4B/uBCH'U8/CTrBmޝB/CT)BΩBݴCTrBΩBcT˻/C/BmޝB/CT)BΩBCTrBmޝBNvb܎")=/C/BmޝB4CB B/CB1cBvb'=/C/BmޝBCTrBmޝB4CB BrH0BCTrBmޝBwCTrB B4CB Blmlϛp^wCTrB BGCTrBGB4CB B~W,GCTrBGB4CBGB4CB Br4yu4GCTrBGB/CBZB4CBGB4xe4/CTrBէB/CBZBGCTrBGBOw&Xh=4CB B/CB B/CB1cB?yvi4CBGB/CB B4CB Bv~'^eUħnC B BCtB BC=B͟B+8%ʹC BBnC B BC=B͟B-j4."7%ʹC BBC=B͟B5C=BmޝB_!_!%ʹC BB5C=BmޝB%ʹCyBmޝB{ { nC B BC B;ڢBCtB B > C=BΩBCQBΩBCTrBB UA%ʹC=B˙BC=BΩBCTrBB0 0Bٱ%ʹC=B˙BCTrBBCTrB/uBzBԾ%ʹC=B˙BCTrB/uB%ʹCB/uB2=a5C=BmޝBCQBΩBC=BΩB?ߗ!QCGBmޝBCQBΩB5C=BmޝB8;5C=BmޝBC=B͟BCGBmޝBJCTrB/uBCTrBBC4B/uB\HC;MC:kBڣBMC#ŊBGBmC:kBGBワ?C6BI|B%ʹC~BI|B%ʹC:kB5BW?MC6B5BC6BI|B%ʹC:kB5B&GrGN;MC6B5B%ʹC:kB5BmC:kBGBvKF ;MC6B5BmC:kBGBMC#ŊBGB{ᄉ?C6BI|B%ʹC6BB%ʹC~BI|B,پAmC:kBGB%ʹCfBGB%ʹC؟B'B64پAmC:kBGB%ʹC؟B'BMC:kBڣBV7MC:kBڣB%ʹC؟B'BMC؟B̡B3پ AmC:kBGB%ʹC:kB5B%ʹCfBGBQ&MCwԑBKBMCՍB B?CwԑB BQi&MCՍB B%ʹCwԑBB?CwԑB B~Q&MCՍB BMC؟B̡B%ʹCwԑBB[V7MC؟B̡B%ʹC؟B'B%ʹCwԑBBS%~ MC B›BMCABmޝB C BmޝB#d?CwԑB B%ʹC+B B%ʹC BB E1JMCwԑBKB?CwԑB B%ʹC BB"{,MCwԑBKB%ʹC BB C BmޝB[\55MCwԑBKB C BmޝBMCABmޝBo&?CwԑB B%ʹCwԑBB%ʹC+B Bž/? %ʹC=B˙BMC=B~BMCLBΩBiILܾ%ʹC×BΩB%ʹC=B˙BMCLBΩBS%~ C BmޝBMCLBΩBMC B›BZ S%~ C BmޝB%ʹCyBmޝBMCLBΩB)AGPd%ʹCyBmޝB%ʹC×BΩBMCLBΩB , C BmޝB%ʹC BB%ʹCyBmޝByTdMCDB/uB%ʹC=B˙B%ʹCB/uBHžZ? MC=B~B%ʹC=B˙BMCDB/uB-V5{&C6BGBMC#ŊBGBMC:kBڣBT5{&C6BGBMC:kBڣBtdC6BB_6T5tdC6BBMC:kBڣBtdC:kB6sB_QT5{&C6BGBMC6B5BMC#ŊBGBرu B6tdC؟BeBtdCVB BFպC؟B BЄA6tdCVB BMC؟B̡BFպC؟B BfA6tdCVB BtdC:kB6sBMC؟B̡BʄA6tdC:kB6sBMC:kBڣBMC؟B̡Bg$ 9tdCwԑBS1BtdCؐBmޝB"CwԑBmޝB8B-FպC؟B BMCՍB BMCwԑBKB@ϭ}-tdC؟BeBFպC؟B BMCwԑBKBi~$m9tdC؟BeBMCwԑBKB"CwԑBmޝBƍ$9tdC؟BeB"CwԑBmޝBtdCؐBmޝBA-FպC؟B BMC؟B̡BMCՍB B'U0tdC B,#BtdC{BΩB-C BΩB|."CwԑBmޝBMCABmޝBMC B›Bξڅ-|[tdCwԑBS1B"CwԑBmޝBMC B›B's*tdCwԑBS1BMC B›B-C BΩBh' 0tdCwԑBS1B-C BΩBtdC{BΩB׾V3$3$"CwԑBmޝBMCwԑBKBMCABmޝB̰C78 -C BΩBMCLBΩBMC=B~B83B5tdC B,#B-C BΩBMC=B~B g%e8j-tdC B,#BMC=B~BC=B/uBt3t3tdC B,#BC=B/uBtdCB/uB=y8d-C BΩBMC B›BMCLBΩB MC=B/uBMC=B~BMCDB/uB?'Ͼ;I1C:kBB1CtB BC:kB B*Ͼ;I1CtB BtdC:kB6sBC:kB B&Ͼ6I1CtB B1C6B3BtdC:kB6sB^dd61C6B3BtdC6BBtdC:kB6sB @C:kB BtdCVB BtdC؟BeBk@C:kB BtdC؟BeB1C:kBBO5Ծ5T1C:kBBtdC؟BeB1C؟BB侳 @C:kB BtdC:kB6sBtdCVB B2 _kTtdCwԑBS1B1CwԑB<B1CBmޝBCEtdCؐBmޝBtdCwԑBS1B1CBmޝBVE1CBmޝBtdC؟BeBtdCؐBmޝBl11PN1C؟BBtdC؟BeB1CBmޝBWh uX UtdC B,#B1C BB1CNBΩBѽ/mT8tdC{BΩBtdC B,#B1CNBΩBѽX/V81CNBΩBtdCwԑBS1BtdC{BΩBqk+M1CwԑB<BtdCwԑBS1B1CNBΩB]=D4D41CB/uBtdC B,#BtdCB/uBB1$xC1C BBtdC B,#B1CB/uBc>_?>MCۡBtBᓺCۡB}BMC(աB}B9>Y?>MC(աB}BCۡBBMCȇBB>Y?>ᓺCۡB}BCۡBBMC(աB}B7>e?5I>tdCۡB)BCۡBUBtdCaBUBH>Pb?^>MCۡBtBtdCaBUBCۡBUBP>Mb?g>MCۡBtBMC(աB}BtdCaBUB&:>1\?2R>MC(աB}BtdCGB}BtdCaBUB>adW?>tdCGB}BMC(աB}BtdCxBB5>4W?ڮ>MC(աB}BMCȇBBtdCxBB|>VU?=U>1CBBڈCBB1C_BB>B7d?a >1CۡB5BCۡB?!B1C[B?!B>Nk?N}N>tdCۡB)B1C[B?!BCۡB?!B%>k?vN>tdCۡB)BtdCaBUB1C[B?!Bw>>;E`?*>tdCaBUB1CBUB1C[B?!B>^?>1CBUBtdCaBUB1CӞB}B>^?>tdCaBUBtdCGB}B1CӞB}Bг>RU?]>ڈCBB1CBB1CӞB}Bu> VU?QW>ڈCBB1CӞB}BtdCxBBAA>gY?㦷>tdCxBB1CӞB}BtdCGB}Bĉ0'?,O=M?+A?CTrB=BCB\B^ȵCTrBcB??"'?^ȵCۡBFBCBZ(BCۡB5EB]R/}/?'5?^ȵCGBZ(BCBZ(B^ȵCۡBFBR/~/?<'5?CBZ(B^ȵCGBZ(B^ȵCB@B=j1?1?CB:BCBZ(B^ȵCB@B 2(?S=?C:kBBbCJ'BdBbC:kBCB 9(?;S=?CzBdBbCJ'BdBC:kBB5սT)?!>?C؟BOBbCBt/BbC؟BhBj#?SB?C+Bt/BbCBt/BC؟BOBj#? TB?bCBt/BC+Bt/BC:kBB (?R=?bC:kBCBbCBt/BC:kBB@?H?CwԑB3tBbCٻBBbCwԑBB 7?H?C$(BBbCٻBBCwԑB3tB}!?H?bCٻBBC$(BBC؟BOBC?݁H?bC؟BhBbCٻBBC؟BOB Y?ˁH?bCwԑBBbC B}fBCwԑB3tB?HL?bC B}fBC B BCwԑB3tB++??:L?C=BBbCޕB6BbC=BB -?ИM?C!iB6BbCޕB6BC=BBG)?GM?bCޕB6BC!iB6BC B B?L?bC B}fBbCޕB6BC B B̲{N?EZI?CTrB=BbCwBBbCTrB}BF?J?CBBbCwBBCTrB=Ba+E?J?bCwBBCBBC=BB㖽 -?/I?bC=BBbCwBBC=BB?bC:kBCB/CwBdB/C:kB&B?bCJ'BdB/CwBdBbC:kBCBVZ)?iY>?bC؟BhB/C3Bt/B/C؟BIBoX΅)?X>?bCBt/B/C3Bt/BbC؟BhBY)?W>?/C3Bt/BbCBt/BbC:kBCBWˆ)?W>?/C:kB&B/C3Bt/BbC:kBCBr{vQ?$XI?bCٻBB:CwԑBBbCwԑBB{}N?{ZI?:CwԑBBbCٻBBbC؟BhB{N?vZI?:CwԑBBbC؟BhB/CwԑB'BCĽp"?BD?/CwԑB'BbC؟BhB/C؟BIBw!?UF?/C BBbCwԑBB:CwԑBBw3#!?QF?/C BB/C BBbCwԑBB^1R?̘I?/C BBbC B}fBbCwԑBBGw!?WF?:CwԑBB/CwԑB'B/C BBQ?5H?bC=BB/C~B6B/C=BBռӋ?8L?bCޕB6B/C~B6BbC=BBkռ ??L?/C~B6BbCޕB6BbC B}fB on?H?/C BB/C~B6BbC B}fBGr=&?A?bCTrB}B/CBB/CTrB=B =t?I?bCwBB/CBBbCTrB}BҚ=/?ԡI?/CBBbCwBBbC=BB &?'B?/C=BB/CBBbC=BB= ;?C5,?bCBB/CZB\B/CB2B=N/?y8?bCsB\B/CZB\BbCBB=,?o;?/CZB\BbCsB\BbCTrB}BZc=SO3?_(6?/CTrB=B/CZB\BbCTrB}B"]7>K??bCۡBB/CGBZ(B/CۡBYBC >˹E?5?bC[BZ(B/CGBZ(BbCۡBB>5?wA0?/CGBZ(BbC[BZ(BbCBB\ =k֟C?;?/CB2BCƜB\BCB2 BL>:?+?/CZB\BCƜB\B/CB2BI>'2?4?CƜB\B/CZB\B/CTrB=B(=3?43?CTrB°BCƜB\B/CTrB=Bǥ>bW?% >CۡBrBBǸCۡBBC BBJ>zG?~?/CۡBYBC BBBǸCۡBB>A{G?}?/CۡBYB/CGBZ(BC BB2g>M?wI ?/CGBZ(BC`BZ(BC BBP>t9?mJ(?C`BZ(B/CGBZ(B/CB2BI2>C??CB2 BC`BZ(B/CB2Bd(?Ar@?%ʹC!͑BBCwԑB'B%ʹC؟BvB(=D&?[B?%ʹC؟BvBCwԑB'BC؟BBYrC=M$?goC?CwԑBBC BOsBC BBhC=$?oC?CwԑBB%ʹCwԑBlBC BOsB=,?c9;?%ʹCwԑBlB%ʹC BBC BOsBnC=?$?qC?CwԑBBC BBCwԑB'Bt>>t0?8A3?C=BB%ʹCCB6B%ʹC=BB\=%?$@?CҕB6B%ʹCCB6BC=BB=%?y@?%ʹCCB6BCҕB6BC BOsB;=2?s5?%ʹC BB%ʹCCB6BC BOsBX>;?|?%ʹCTrB5UBXƹCTrB\B%ʹCkB\B:]>tv-?w-?CTrB°B%ʹCkB\BXƹCTrB\B9s>['?V2?CTrB°BCpqBB%ʹCkB\BvV>t|9?(?CpqBB%ʹC;BB%ʹCkB\ByF>+?67?%ʹC;BBCpqBBC=BB=>1?1?%ʹC=BB%ʹC;BBC=BB> H?. ?%ʹCBQBgoCBZ(B%ʹC~BZ(BP>u%+nw-?v-?XƹCTrB\BCƜB\BCTrB°B{>GS?Nf>CۡBrB%ʹCGBB%ʹCۡB'B>S?)_>C BB%ʹCGBBCۡBrB#>q H?~ ?goCBZ(B%ʹCBQB%ʹCGBB> H? ?goCBZ(B%ʹCGBBC`BZ(B䈢> H? ?C`BZ(B%ʹCGBBC BB>~=??goCBZ(BC`BZ(BCB2 B]*=h,?;?%ʹC:kBBMCNBdBMC:kB7]B;=)? >?%ʹCݨBdBMCNBdB%ʹC:kBB^==+?I<=?%ʹC؟BvBMCҍBt/BMC؟BuB =-?̼;?%ʹC)Bt/BMCҍBt/B%ʹC؟BvBש=-?;?MCҍBt/B%ʹC)Bt/B%ʹC:kBBRq=X+?=?MC:kB7]BMCҍBt/B%ʹC:kBBˇ>T2?V2?%ʹCwԑBlBMCBBMCwԑB@B]&>ؾ&?>?%ʹC!͑BBMCBB%ʹCwԑBlBB>|&?>?MCBB%ʹC!͑BB%ʹC؟BvBu=y4?y4?MC؟BuBMCBB%ʹC؟BvBaZ>7?)?MC BBC B6BMC*OB6B__R>(1?(1?MC*OB6BC B6B%ʹC BB_R>u(1?u(1?MC*OB6B%ʹC BBMCwԑB@BҚ">P+?9?MCwԑB@B%ʹC BB%ʹCwԑBlBf>8?ռ!?MC=BsBGC=BBMCCBBWS>/?k|2?C B6B%ʹC=BB%ʹCCB6Bld>~/?O1?MC BB%ʹC=BBC B6B>3?[)?MC BBGC=BB%ʹC=BB U>4?G&?MC BBMCCBBGC=BBS>/?2?C B6B%ʹCCB6B%ʹC BB8Ң>A@?L?%ʹCTrB5UBMCB\BMCTrBlBTW>$;??%ʹCkB\BMCB\B%ʹCTrB5UBe>J8?b!?GC=BBMC=BsBMCB\Bi>8? !?GC=BBMCB\B%ʹC;BB;Ø> 5?$?%ʹC;BBMCB\B%ʹCkB\BR>(|.?(|.?GC=BB%ʹC;BB%ʹC=BB̽>WC?:?%ʹCBQBMCBZ(BMCBB̽>XC?;?%ʹC~BZ(BMCBZ(B%ʹCBQB>8??MCBZ(B%ʹC~BZ(B%ʹCTrB5UB|Ѣ>@??MCTrBlBMCBZ(B%ʹCTrB5UB>2O?:>%ʹCۡB'BMCȇBBCۡBB>^O?02>%ʹCۡB'B%ʹCGBBMCȇBB!>]M?p@>%ʹCGBBMC.BBMCȇBB&ͽ>C?m?MC.BB%ʹCGBB%ʹCBQB>C?5?MCBBMC.BB%ʹCBQB >qy-? 9?MC:kB7]BtdCBdBtdC:kBZB>` ,?:?MCNBdBtdCBdBMC:kB7]BG> 1?1?MC؟BuBtdC Bt/BtdC؟BB.>c)?3:?MCҍBt/BtdC Bt/BMC؟BuB;.>zc)?:?tdC Bt/BMCҍBt/BMC:kB7]B>r3?r3?tdC:kBZBtdC Bt/BMC:kB7]B[>7?x)?MCwԑB@BtdC3BBtdCwԑB6BRG>ۊ1?ۊ1?MCBBtdC3BBMCwԑB@BQG>ڊ1?ڊ1?tdC3BBMCBBMC؟BuBdG>1? 1?tdC؟BBtdC3BBMC؟BuB?>:?~ ?MC BBtdCA(B6BtdC BB͂>35?'?MC*OB6BtdCA(B6BMC BB3|>sq/?sq/?tdCA(B6BMC*OB6BMCwԑB@B[>7?x)?tdCwԑB6BtdCA(B6BMCwԑB@B>*;?<?MC=BsBtdCyBBtdC=BųB4>7?n ?MCCBBtdCyBBMC=BsB算>23?%?tdCyBBMCCBBMC BB>9:?a ?tdC BBtdCyBBMC BB > C??tdCTrBdB#!CTrBZ(BtdCBZ(Ba>`z>?&9?MCB\BtdC;B\BtdCBZ(BZ>5?;?d?tdC=BųBtdC;B\BMC=BsB>L?->tdCBz C??#!CTrBZ(BMCBBMCBZ(Bz> C?&?tdCTrBdBMCBB#!CTrBZ(Bc+>C??tdCTrBdB꠺CBBMCBB > C??tdCTrBdBtdCBB꠺CBB>*L?>꠺CBBtdCBzML?e)>꠺CBBtdCxBBMC.BB,>-L?>MC.BBtdCxBBMCȇBB&>tC??꠺CBBMC.BBMCBBA`>-?g3?tdC:kBZB1CYBdB1C:kBB.Q>e+?6?tdCBdB1CYBdBtdC:kBZBjy>#5?)?tdC؟BB1CBt/B1C؟BiaB\>0?,0?tdC Bt/B1CBt/BtdC؟BB\>e0?e0?1CBt/BtdC Bt/BtdC:kBZB\>d0?d0?1C:kBB1CBt/BtdC:kBZBi> =??1CwԑBLB-CwԑB6B1CΑB6B >O3?;%?tdCwԑB6B1CΑB6B-CwԑB6BȮ>3?T%?tdCwԑB6BtdC3BB1CΑB6B>j9?p="?tdC3BB1CBB1CΑB6B:>.?-.?1CBBtdC3BBtdC؟BByjy>"5?)?1C؟BiaB1CBBtdC؟BB?i><=? ?1C BoB!ܻC BB1ChBB->8?<?-CwԑB6BtdC BBtdCA(B6Bd> :?I?1CwԑBLBtdC BB-CwԑB6B|>:?7?1CwԑBLB!ܻC BBtdC BB >:??1CwԑBLB1ChBB!ܻC BB(>3?H%?-CwԑB6BtdCA(B6BtdCwԑB6B9&>9&>?Y?1C=BBC=B\B1CB\B >:??!ܻC BBtdC=BųBtdCyBB$>A:?4?1C BoBtdC=BųB!ܻC BBO>@B;?a?1C BoBC=B\BtdC=BųBȰ>Ȱ;??1C BoB1CB\BC=B\B,>=6?6?!ܻC BBtdCyBBtdC BBm>YG?7>1CTrB6B.CTrBB1CkBB H>GA??tdCTrBdB1CkBB.CTrBBoQ>@A??tdCTrBdBtdCBZ(B1CkBB*x>*xE?Ɩ?tdCBZ(B1CbQBZ(B1CkBB#>O(>?l?C=B\B1C=BB1CbQBZ(B&>&>?E?C=B\B1CbQBZ(BtdC;B\B&>&>?D?tdC;B\B1CbQBZ(BtdCBZ(B:>:9?~?C=B\BtdC;B\BtdC=BųB >yJ?:>.CTrBBtdCBzZJ?>1CTrB6BtdCBzcJ?M>1CTrB6BڈCBBtdCBzJ?2>1CTrB6B1C_BBڈCBBS>]?A??.CTrBBtdCBBtdCTrBdB-">M?B>ڈCBBtdCxBBtdCBz?/CwBdBbCJ'BdBbC6BpBX)?W>?/C6BB/CwBdBbC6BpBQ(*? ??CŊBdB/CwBdB/C6BBHv(*???C6B{BCŊBdB/C6BB`*?MCNBdB%ʹCݨBdB%ʹC6B֑Bj=;-?;?MC6BQBMCNBdB%ʹC6B֑B>*,?#:?tdCBdBMCNBdBMC6BQB=<-?O9?tdC6BBtdCBdBMC6BQB.Q>Ue+?6?1CYBdBtdCBdBtdC6BBJ>˜.?:4?1C6BB1CYBdBtdC6BBB3r0Rz>1CBEB1C+BVHBCBVHBZG@ؾCBzBC&Bq{BH{CBq{B({0F(徆CJB;ioBCiB37uB۵CJB37uB} F=H{CBq{B^ȵCóBq{B^ȵCJBuBGξCBzBH{CBq{B^ȵCJBuB.EGʾCBzB^ȵCJBuB۵CJB37uBdAG)྆CBzB۵CJB37uBCiB37uBȉYXm߾^ȵCKB7gBCKBbBCѶBdhB"~[k;^ȵCcBdhB^ȵCKB7gBCѶBdhBŸgLZzӾCѶBdhBC+DBnB^ȵCcBdhBjZ5^ȵCcBdhBC+DBnB^ȵC0BnBx%b2Fx%۵CJB37uBC+DBnBCJB;ioB"3F#۵CJB37uB^ȵC+DB37uBC+DBnB\|LY|^ȵC+DB37uB^ȵC0BnBC+DBnB{i\M۵CJB37uB^ȵCJBuB^ȵC+DB37uBE9H1CBXBClB=[B͵CB=[B*OrPf2^ȵCBƦ[B͵CB=[BClB=[B~IiPjB^ȵCBƦ[BClB=[B^ȵCBzaB$|R&F^ȵCBzaBClB=[BCxBzaBБ2^PоCxBzaB^ȵCKB7gB^ȵCBzaB<\X߾CKBbB^ȵCKB7gBCxBzaB×5JZCBzBbCBTwBbC[Bq{B57SC&Bq{BCBzBbC[Bq{BK63Y&bCJBlBbCփBnBdŶCJBnBKe6Y^CJB;ioBdŶCJBnBbCփBnBK3YX$CJB;ioBbCփBnBCiB37uB]m*SCiB37uBbCփBnBbCB37uBs-XybCB37uBCBzBCiB37uB`—oJYbCBTwBCBzBbCB37uBU[U bCKBϙaBbC+BzaB3 CKBzaBb+龆CKBbB3 CKBzaBbC+BzaB.b8龆CKBbBbC+BzaBCѶBdhB9'>w]r&CѶBdhBbC+BzaBbCA^BdhBVK^4Y"dŶCJBnBbCA^BdhBbCJBlBK.3Y$dŶCJBnBC+DBnBbCA^BdhBfdmݾC+DBnBCѶBdhBbCA^BdhBSK4YdŶCJBnBCJB;ioBC+DBnB>G9K?CBXBbCB]XBbCcFB=[B7OLClB=[BCBXBbCcFB=[B] `U 3 CKBzaBbCcFB=[BbCKBϙaB5_U 3 CKBzaBCxBzaBbCcFB=[B7#(oZCxBzaBClB=[BbCcFB=[Be:bd3 CKBzaBCKBbBCxBzaBwѽAMbCBTwB/CBM/CB5TK bC+BzaBbCKBϙaBCKBzaB>ȹR CKBzaB/CKBcB/CBdhB>R CKBzaB/CBdhBbC+BzaB6'=^/bC+BzaB/CBdhBbCA^BdhB&=r];/CBdhBbCJBlBbCA^BdhBuqwTB/CJBlBbCJBlB/CBdhBo~>&9$bCB]XB/CBZB/C0-B=[B/._>`FPbCcFB=[BbCB]XB/C0-B=[B;>4T>M bCKBϙaB/CBzaBCKBzaB¢>9TzE bCKBϙaBbCcFB=[B/CBzaB]>fDbCcFB=[B/C0-B=[B/CBzaB>R CKBzaB/CBzaB/CKBcBV<F8h!/CBD2/CJBlBCJB\ nBCдBnBr=Se /C^]BnB/CJBlBCдBnB=GCдBnBCBB37uB/C^]BnBw&?/CKBcBCKB1fBCkBdhBh>dNS /CBdhB/CKBcBCkBdhB#h>tN: CkBdhB/CJBlB/CBdhBi>DCJB\ nB/CJBlBCkBdhB> /U/C0-B=[B/CBZBSCB=[B9>*"SCB=[BCB^BCtBzaB>*2"SCB=[BCtBzaB/C0-B=[Bg>!@/C0-B=[BCtBzaB/CBzaB1>[I0FCtBzaB/CKBcB/CBzaBi>?CKB1fB/CKBcBCtBzaBHB>3tN0CB#vB%ʹCBwB%ʹCBq{B=E1 CBq{BCB#vB%ʹCBq{Bx >i:xCдBnBCJB\ nB"CJBnBi[>3C.("CJBnB%ʹCJB{VqB%ʹCu6B37uB[>C.("CJBnB%ʹCu6B37uBCдBnBg>C3hCдBnB%ʹCu6B37uBCBB37uBe>AzP%ʹCu6B37uBCB#vBCBB37uBB>F3L0%ʹCBwBCB#vB%ʹCu6B37uBeW>2dCkBdhBCKB1fBTCKBdhB;>%^#TCKBdhB%ʹCKBjB%ʹCoQBnB>0%E^#CkBdhBTCKBdhB%ʹCoQBnB0 >a:yCkBdhB%ʹCoQBnB"CJBnB >F:sCkBdhB"CJBnBCJB\ nB)]>A.v("CJBnB%ʹCoQBnB%ʹCJB{VqBg ?rCtBzaBCB^BjCBzaBPM ?jCBzaB%ʹCBdB%ʹCQBdhBS?YCtBzaBjCBzaB%ʹCQBdhB}>Z/TCtBzaB%ʹCQBdhBTCKBdhBW>2CtBzaBTCKBdhBCKB1fB.A>'TCKBdhB%ʹCQBdhB%ʹCKBjBѢ>%^#%ʹCBq{B%ʹCBwBȀCBq{B8?G%ʹCu6B37uB%ʹCJB{VqBSCJB37uBy?Z%$SCJB37uBMCJB wBMC/Bq{B>;5+%ʹCu6B37uBSCJB37uBMC/Bq{BG>&2b*%ʹCu6B37uBMC/Bq{BȀCBq{B=>P%]#%ʹCu6B37uBȀCBq{B%ʹCBwB͐ ?z%ʹCoQBnB%ʹCKBjBSCKBnBE?X[nSCKBnBMCKBpBMC* B37uB} ?OC%ʹCoQBnBSCKBnBMC* B37uBf ?X:U%ʹCoQBnBMC* B37uBSCJB37uB9?%ʹCoQBnBSCJB37uB%ʹCJB{VqB ?SCJB37uBMC* B37uBMCJB wBб?6T%ʹCQBdhB%ʹCBdB&?CBdhB)$?C&?CBdhBMCBnkBMCBnB?[_ %ʹCQBdhB&?CBdhBMCBnB^2?j%ʹCQBdhBMCBnBSCKBnB?m%ʹCQBdhBSCKBnB%ʹCKBjB'k?mP԰!SCKBnBMCBnBMCKBpB1!?IMC/Bq{BMCJB wB"CJBq{B"?KrEMC* B37uBMCKBpB"CKB37uB=?G"CKB37uBtdCKBkxBtdCBq{BZ1?8wMC* B37uB"CKB37uBtdCBq{B-?-޾bMC* B37uBtdCBq{B"CJBq{B`?66MC* B37uB"CJBq{BMCJB wBJ,$?.BMCBnBMCBnkBCBnB-F?H CBnBtdCBsBtdC|B37uBj,?HMCBnBCBnBtdC|B37uB!6?DMCBnBtdC|B37uB"CKB37uBg? MCBnB"CKB37uBMCKBpBzH?:(r"CKB37uBtdC|B37uBtdCKBkxBn=?OtdCBq{BtdCKBkxB+CKBq{B5, 3&=1C+BVHB1CBJNBCBVHBF?ئ tdC|B37uBtdCBsB肻CB37uBH?qtdCKBkxBtdC|B37uB肻CB37uBsH?tstdCKBkxB肻CB37uB+CKBq{Bxp?_D坾+CKBq{B肻CB37uB9ƻCBq{B3\^ &%CnyBMBCᠪBS׍BwCnyBS׍BoG)=CᠪBS׍BCB BNCnyB Ba^/˦=wCnyBS׍BCᠪBS׍BNCnyB BhjkvM>CB BCnyBّBNCnyB B?+A+祾C BrBCMBv9B{}C Bv9B|.|.PCMBv9BCT BnBX-C BnB{.\}.O{}C Bv9BCMBv9BX-C BnBQQgCT BnBCwBBC BB4:4yX-C BnBCT BnBC BB=TeZCwBBCnyBMBwCnyBS׍BHTWg(CwBBwCnyBS׍BC BBoLh=C BBwCnyBS׍B#*C BS׍B%nT=wCnyBS׍BNCnyB B#*C BS׍BrCE>NCnyB B`C B B#*C BS׍Bpa->CnyBّBC BB`C B BMuNGV>NCnyB BCnyBّB`C B BPT4sžC&Bq{BC_ۯBBCBBHΧH{CBq{BC&Bq{BCBBU0U0sg{}C Bv9B^ȵCBv9B^ȵCBgB'V0͡C BrB{}C Bv9B^ȵCBgBu*2򄾆C BrB^ȵCBgBCBBH8}7}C BrBCBBC_ۯBBc|.c|.HPX-C BnB^ȵCBv9B{}C Bv9B\DPDp'ֽ^ȵC~BnB^ȵCBv9BX-C BnBJP1C BB^ȵC~BnBX-C BnBk+8=^ȵCұBB^ȵC~BnBC BBIf3/t>^ȵCұBBCCBS׍B^ȵCBغBMfwpt>^ȵCұBBC BBCCBS׍B\y-Z؛=C BB#*C BS׍BCCBS׍BrS>#*C BS׍B`C B BCCBS׍BDoDk>`C B BFCB BCCBS׍BkL>C BBCBBFCB Bwr>`C B BC BBFCB B HMѧCBB^ȵCóBq{BH{CBq{B<;^ȵCŏBB^ȵCóBq{BCBB! =yCBB^ȵCBgB^ȵCŏBBt>4ݵCJBS׍B^ȵCBغBCCBS׍BObw>^ȵCJBB^ȵCBغB4ݵCJBS׍BZnNP>CCBS׍BFCB B4ݵCJBS׍B}MfD>FCB B@CJB B4ݵCJBS׍BFcC=^>CBBCJBB@CJB Bk>FCB BCBB@CJB B Bk]>-͵CKBS׍B^ȵCJBB4ݵCJBS׍B~"a%>^ȵCKBB^ȵCJBB-͵CKBS׍BeF>4ݵCJBS׍B@CJB B-͵CKBS׍BW-n=* ?@CJB BPCKB B-͵CKBS׍BQ*> ?CJBBCKBABPCKB BbBݍ=>@CJB BCJBBPCKB B`̹=>CBS׍B^ȵCKBB-͵CKBS׍BxS=g?^ȵCB"B^ȵCKBBCBS׍B_V6`=2V ?-͵CKBS׍BPCKB BCBS׍BMB&>k?PCKB BGzCB BCBS׍B?\>1!?CKBABCBBGzCB BsQ`?*>t ?PCKB BCKBABGzCB BbK[bC0BqBbC4B B=C0B B_2aHVbC4B BbCB@B0C0B@B:6T>T=C0B BbC4B B0C0B@B)k#ƾ2@`=bCB@BbC B/uBnGC0B/uBa.=0C0B@BbCB@BnGC0B/uBo""߾bCDB-BbCקBBnGCDBB1=AbCקBBbCХBS׍BxCDBS׍B`,e,7nGCDBBbCקBBxCDBS׍BuC-T|bCХBS׍BbC0BqB=C0B BvC|bCХBS׍B=C0B BxCDBS׍B0,dw,xCDBS׍B=C0B B=׶CDB Bdd=C0B B0C0B@B=׶CDB B`Dpz)=0C0B@BDCDB@B=׶CDB BHo>?=0C0B@BnGC0B/uBDCDB@B3rj5>nGC0B/uB CDB/uBDCDB@B7'YᾮbCnyB1NBbC BnB;CnyBnB>"0"߾bC BnBbCDB-BnGCDBB!X'R㾮bC BnBnGCDBB;CnyBnBA8Vw;CnyBnBnGCDBBCnyBB44\0$%CnyBMBxCDBS׍BCᠪBS׍BS2\nE3%CnyBMBCnyBBxCDBS׍B(:(괨CnyBBnGCDBBxCDBS׍B:b^,æ=׶CDB BCᠪBS׍BxCDBS׍Bf~o*u)=CB BCᠪBS׍B=׶CDB B>j{M>CB B/CnyB@BCnyBّBj|&|M>CB B=׶CDB B/CnyB@B9xDCDB@B CDB/uB/CnyB@Bݫs)#> CDB/uBCnyB/uB/CnyB@BUxžUxErbC B^BbCABB/,C BB[Ҿ[R˾C BrB/,C BBbCABBҾR˾C BrBbCABBCMBv9B><񾆕CMBv9BbCABBbCZ3Bv9B6K'HX;CnyBnBbCZ3Bv9BbCnyB1NB7:'X;CnyBnBCT BnBbCZ3Bv9B-tK򞾆CT BnBCMBv9BbCZ3Bv9B'&;14zCnyBBCT BnB;CnyBnBQ6 hCwBBCT BnBCnyBBTm̺CnyBBCnyBMBCwBBxgٽCY>C B@BCnyBّB/CnyB@Bvp_-k>C BBCnyBّBC B@BtKս>/CnyB@BCnyB/uBC B@BYmn'?nF>CnyB/uBC B/uBC B@B2yžwE/,C BBbC[Bq{BbC B^B xž xE/,C BBC_ۯBBbC[Bq{ByTe辆C_ۯBBC&Bq{BbC[Bq{B[Ҿ[R˾/,C BBC BrBC_ۯBBQt"t>CB@BC BBC B@B8k &>CBBC BBCB@BZmns?nF>C B@BC B/uBCB@BWh4.=! >C B/uBCB/uBCB@BYxkuok=>\CJB@BCBBCB@BEcdzC=vb>CJBBCBB\CJB@B7hlh=>CB@BCB/uB\CJB@B^% >c>CB/uBCJB/uB\CJB@B^P>>qڶCKB@BCJBB\CJB@BυQ΢*>[ ?CKBABCJBBqڶCKB@BK’><?bC:B/uBbCKBkBqڶCKB@B'KZ>?bC:B/uBqڶCKB@BCJB/uB\|?N>>CJB/uBqڶCKB@B\CJB@BNJk+>P?`'CB@BCKBABqڶCKB@BC ?\>#3!?CBBCKBAB`'CB@B.2>>?bCKBkBbCBTB`'CB@BcJ*>mR?qڶCKB@BbCKBkB`'CB@B /C0BaB/C}֤BBs C0BB!ݶj]/C}֤BB/COYBS׍BC0BS׍B^&s C0BB/C}֤BBC0BS׍BK~8]ǷCۡB BbC4B BbC0BqB́0/CۡBBǷCۡB BbC0BqB7%/CۡBBbC0BqBC0BS׍BFR&<!Jھ/CۡBBC0BS׍B/COYBS׍BQ ?*CۡB@BbC4B BǷCۡB B3aCRbCB@BbC4B BCۡB@Bb2CۡB/uBbCB@BCۡB@B4kDƾ:`=bC B/uBbCB@BCۡB/uB(t/CDBņB/CZBnBCDBnB&vs C0BBbCקBBbCDB-B] Vr /C0BaBs C0BBbCDB-Bt[Z /C0BaBbCDB-BCDBnB4О' H/C0BaBCDBnB/CZBnBd&辋C0BS׍BbCקBBs C0BB#=B·bCХBS׍BbCקBBC0BS׍BuC-T|C0BS׍BbC0BqBbCХBS׍B7Yb4/CnyBB/CeBv9B,CnyBv9B>p5yCDBnBbC BnBbCnyB1NB g4< /CDBņBCDBnBbCnyB1NB23;}/CDBņBbCnyB1NB,CnyBv9BE2f/CDBņB,CnyBv9B/CeBv9Biz4(CDBnBbCDB-BbC BnB^qCbC B^B/C Bt~B/C@BBl ObCABBbC B^B/C@BBY42,CnyBv9B/C@BB/CnyBBXw4 ,CnyBv9BbCZ3Bv9B/C@BBmJvPbCZ3Bv9BbCABB/C@BBJξ!nBؠ,CnyBv9BbCnyB1NBbCZ3Bv9B Sz /CίBq{BbC B^BbC[Bq{B^ qC׾/C Bt~BbC B^B/CίBq{BKr>~?bC:B/uBHdCKB/uBbCKBkB@> ?׷CB/uBbCKBkBHdCKB/uBv2<>?bCBTBbCKBkB׷CB/uBB9'9'/C0BaBC0BBCBBʾ}/7Z/C}֤BB/C0BaBCBB龄*,x!\CۡBS׍BCBBCۡBB'"'X!\CۡBS׍B/COYBS׍BCBBAԾ7G/COYBS׍B/C}֤BBCBBخ6!\CۡBS׍B/CۡBB/COYBS׍B,,/CDBņBCDBYBC0BnBIVر5/CZBnB/CDBņBC0BnB(sp4 C0BnB/C0BaB/CZBnBB8'8'C0BB/C0BaBC0BnB?;4B-j6/CnyBBCnyBKBCsBv9BvLw<!/CeBv9B/CnyBBCsBv9B+Mt ;R#CsBv9B/CDBņB/CeBv9B\.(u0CDBYB/CDBņBCsBv9B9=z+/C Bt~BC B2}BCeBBiFB\/C@BB/C Bt~BCeBB;@%CeBB/CnyBB/C@BB.0*R2Q2CnyBKB/CnyBBCeBB EHYoCBq{B/C Bt~B/CίBq{B7=r}+C B2}B/C Bt~BCBq{Bk'a2a2C0BB%ʹC0B@·B%ʹC;BBk'a2a2CBBC0BB%ʹC;BB0M< '%ʹC;BBCۡBBCBB9t7O/,%ʹCۡBH BCۡBB%ʹC;BB@Խv* !JvC%ʹCDBBMCDBsBMC:BnBx=+M+5=%ʹCLzBnB%ʹCDBBMC:BnBK=N+=MC:BnB%ʹC0B@·B%ʹCLzBnBS}=i"DMC0B.B%ʹC0B@·BMC:BnB8_G>1`G%ʹCnyB*2BMCnyBQBMCߩBv9B">w"/*A%ʹCBv9B%ʹCnyB*2BMCߩBv9B">"*AMCߩBv9B%ʹCDBB%ʹCBv9Bu >N2eIMCDBsB%ʹCDBBMCߩBv9Bz$><NA%ʹC Ba~BMC BڗBMCBBrא>' "3%ʹCֺBB%ʹC Ba~BMCBBא>5'w!3MCBB%ʹCnyB*2B%ʹCֺBB|H>_wHMCnyBQB%ʹCnyB*2BMCBB,D>$$ȀCBq{B%ʹC Ba~B%ʹCBq{B%@>$$ȀCBq{BMCB|B%ʹC Ba~B8>m=MCB|BMC BڗB%ʹC Ba~B7>C6ȀCBq{BMC/Bq{BMCB|Bfo>':MC0B.BtdC0B[BtdCBB,>r)4MC~]BBMC0B.BtdCBB/>*]3tdCBBMCۡBwBMC~]BBtj>j"=tdCۡBBMCۡBwBtdCBBGk>>MCDBsBtdCDB͆BtdC{BnB>͎;MC:BnBMCDBsBtdC{BnB>nj;tdC{BnBMC0B.BMC:BnB>ʓy?tdC0B[BMC0B.BtdC{BnB><_4CnyBv9BMCDBsBMCߩBv9Bq>ߤ{<_4CnyBv9BtdCnyBBMCDBsB$ >3AGtdCnyBBtdCDB͆BMCDBsB8>cT5MCBBMC BڗBC BB>j?C BBtdC BbBtdCbBv9BH>m?MCBBC BBtdCbBv9B'\>@@/(?MCBBtdCbBv9B_4CnyBv9B;'>w&>MCBB_4CnyBv9BMCnyBQB}:>D(c8J_4CnyBv9BtdCbBv9BtdCnyBB>޾@tdC BBC BBMC BڗBQ>޾ε@tdC BBMC BڗBtdCB׀B?t9%tdCB׀BMC BڗBMCB|B>޾@C BBtdC BBtdC BbB?s"CJBq{BMCB|BMC/Bq{B.?Af"CJBq{BtdCJBNA~BMCB|B]?TV2tdCJBNA~BtdCB׀BMCB|B~4?x "CJBq{BtdCBq{BtdCJBNA~B;9>$ 1tdCBBtdC0B[B C0BBY7>(# 1 C0BBtdCۡBBtdCBB:>#f1 C0BB1C0BBBtdCۡBB><1C0BBB1CۡBDBtdCۡBBa>B 9.tdC{BnBtdCDB͆B4CDBnB(?7{64CDBnB1CDBB1CBB.>ktiP6tdC{BnB4CDBnB1CBB> 5tdC{BnB1CBB C0BB> /5tdC{BnB C0BBtdC0B[B'X>e{> C0BB1CBB1C0BBB@??پ,<1C+BnB4CDBnBtdCDB͆B>?پi.<1C+BnBtdCDB͆B1CnyB4ABL??.1CnyB4ABtdCDB͆BtdCnyBB??پ,<4CDBnB1C+BnB1CDBBC#?ȾT")tdCbBv9BtdC BbBaɻC Bv9B#?AȾ)aɻC Bv9BtdCnyBBtdCbBv9B#?_ȾX!)aɻC Bv9B1C B\ͅBtdCnyBB<)?(:1C B\ͅB1CnyB4ABtdCnyBB '?e 'tdC BBtdCB׀BoCBB'?6'tdC BbBtdC BBoCBB$?þ8)tdC BbBoCBBaɻC Bv9BK6?r3 aɻC Bv9BoCBB/#CBv9B*B?Dy<1C B\ͅB/#CBv9B1CBいBre*?-/aɻC Bv9B/#CBv9B1C B\ͅB-?]-ûCJBBoCBBtdCB׀B ??yCtdCJBNA~BûCJBBtdCB׀BO?51CsBv9BûCJBB1CJBNBO?M5к1CsBv9B/#CBv9BûCJBB{=8?|5!/#CBv9BoCBBûCJBBZE?/,</#CBv9B1CsBv9B1CBいB4?澲 tdCJBNA~BtdCBq{B+CKBq{B4?]Z tdCJBNA~B+CKBq{BûCJBBk?uNûCJBB+CKBq{BCKBB{j?/;1CJBNBCKBB1CKB]BɜO?`5ûCJBBCKBB1CJBNBDZn?oRP+CKBq{B9ƻCBq{BCKBBz? ,z^ZCKBB9ƻCBq{BCBBh?>˾1CKB]B,CBv9B1CBv9Bxh?>˾1CKB]BCKBB,CBv9B4iv?TvCKBBCBB,CBv9B1+u?r >~81CBv9B,CBv9B1CBいB?qO?>Y>1CBeBCB/uB1CnӺB/uBR.?=<:C0BGB0CۡBGB^ȵCۡBBm(9?CI%=Z{0^ȵC0BBC0BGB^ȵCۡBB@=?z>/(CۡBBC0BGBC0BqB˘.?=V<:0CۡBGBC0BGBCۡBB5?qWA>r-CDBGBC0BGB^ȵC0BB#hG?W>O^ȵCDB,BCDBGB^ȵC0BB3?7)> C0BqBtmCDBI|BCBI|B3?)> C0BqBC0BGBtmCDBI|BO?x\>k C0BGBCDBGBtmCDBI|B`F?->/1CBI|BtmCDBI|BCDBpBC?t>+ CDBGB^ȵCDB,B^ȵCBGBKT?ڄ>Uq^ȵCBGB^ȵCnyB?BQCnyBI|BT?>s^ȵCBGBQCnyBI|BCDBGBy"J?>wCDBGBQCnyBI|BtmCDBI|BD?>CDBpBNCnyB谪BCg"B谪B҉D?>CDBpBtmCDBI|BNCnyB谪B U?>dtmCDBI|BQCnyBI|BNCnyB谪B S?%>KCg"B谪BNCnyB谪BCnyBBSbеC BI|BQCnyBI|B^ȵCnyB?BW?S>s[^ȵC BABbеC BI|B^ȵCnyB?ByV?M>QCnyBI|BbеC BI|BNCnyB谪BW?%> ʾNCnyB谪BbеC BI|B0C B谪BRSN?e>CnyBBpC BBCBBON?n>rCnyBBNCnyB谪BpC BBxza?LJ>댾NCnyB谪B0C B谪BpC BB_4Y?q!>ҠKCBBpC BBC BZBrQ?}>{mbеC BI|B^ȵC BAB^ȵCSBI|BW?㗼>ʾ0C B谪BbеC BI|B^ȵCSBI|BzmQ?ۆ>E^ȵCuB谪B0C B谪B^ȵCSBI|B^?X> 4^ȵCuB谪B^ȵCBB;CBB^?q>4^ȵCuB谪B;CBB0C B谪BvP??BI0C B谪B;CBBpC BB5B?= ?.5C BZBCB%BC>B%B1B?= ?n5C BZBpC BBCB%B)dW? ?!pC BB;CBBCB%Br>?&?c;CBB^ȵCBB^ȵC0BBj@?x(? jCB%B;CBB^ȵC0BB4?4?Vu^ȵCB%BCB%B^ȵC0BBkuiľR>bC B/uBbC0B.BnGC0B/uB?>qMжC0BI|B >CۡBI|BCۡBB@B=?#>(C0BqBжC0BI|BCۡBB&?3>&bCۡBtܧBжC0BI|BbC0BéB?>nrM >CۡBI|BжC0BI|BbCۡBtܧB+9wsSX;>bC0B.BbChBΩB:CDBΩB8wTX>bC0B.B:CDBΩBnGC0B/uB[&q'S>nGC0B/uB:CDBΩB CDB/uBjyM >bChBΩBbCDB2UB:CDBΩB33?)>7 жC0BI|BC0BqBCBI|BbF?+>P/CBI|BCDBpBCDB谪B`F?/>/жC0BI|BCBI|BCDB谪B4?\?)5жC0BI|BCDB谪BbC.B谪B5?[?F5жC0BI|BbC.B谪BbC0BéB9?a?bC.B谪BCDB谪BbCDBƈB=xI>7Y> CDB/uB:CDBΩBCnyB/uB6skSsƛ>:CDBΩBg7CnyBΩBCnyB/uBqnuM>bCDB2UBbCnyBdBg7CnyBΩB:CDBΩBbCDB2UBg7CnyBΩBD?Ү>CDB谪BCDBpBCg"B谪BS?>/FCg"B谪BCnyBBDCnyBBS?>ECDB谪BCg"B谪BDCnyBB??r CDB谪BDCnyBBbCƋBB'?'? s CDB谪BbCƋBBbCDBƈB-?%-?6]bCƋBB:CnyB%BbC'٪B%B-?-?j\DCnyBB:CnyB%BbCƋBB6ssț>CnyB/uBg7CnyBΩBC B/uBCk=~>g7CnyBΩBnGC BΩBC B/uBgW=XA>bCnyBdBbC BRBnGC BΩB;mk=й>g7CnyBΩBbCnyBdBnGC BΩBRN?6>LDCnyBBCnyBBCBBi5Y?Z>QKCBBC BZBC B%BV3Y?$>KCBBC B%BDCnyBBB?O?c@DCnyBBC B%B:CnyB%Ba=>bCBΩBbCBbBCB/uBa=>bCBΩBCB/uBnGC BΩBk0=>nGC BΩBCB/uBC B/uB[Hg>>nGC BΩBbC BRBbCBΩB B?˭ ?5C B%BC BZBC>B%B>Ou>`?bCBbBbCJB,BCJB/uB._a >h>CB/uBbCBbBCJB/uBLS>?CJB/uBbCJB,BbC:B/uBwiuľ>bC B/uB}gC0BΩBbC0B.Bviľ>bC B/uBCۡB/uB}gC0BΩBMpq2=CۡB/uBCۡBΩB}gC0BΩB`nࣾ2>CۡBΩBzԷCۡBmޝB}gC0BΩB,o~~>zԷCۡBmޝBC0BmޝB}gC0BΩBxNq2Z8b>zԷCۡBmޝBCۡB BC0BmޝB`p\ %/>CۡB BLC0B BC0BmޝBQy9+= >CۡB Bi!CۡBGBLC0B Bp 4=>i!CۡBGB+C0BGBLC0B B4%3?Z=/C3BI|B/C0B¤B+C0BGB}2R5?=/C3BI|B+C0BGB{CۡBI|BѻF=Y!{CۡBI|B+C0BGBi!CۡBGBo|2HQ5?{CۡBI|B/C0B5B/C3BI|BH:;F?{CۡBI|BbCۡBtܧB/C0B5B=?ZbCۡBtܧBbC0BéB/C0B5B$9wSXs>}gC0BΩBbChBΩBbC0B.BjtM[>bChBΩBCDBmޝBbCDB2UBjezM>bChBΩB}gC0BΩBCDBmޝB vG׽x>}gC0BΩBC0BmޝBCDBmޝBqӽŞ>C0BmޝBLC0B BCDBmޝB :n2Y>LC0B B׷CDB BCDBmޝBmg\g=V>/CCBGB/CDBLB׷CDB B9ngAg=>/CCBGB׷CDB B+C0BGBp4>+C0BGB׷CDB BLC0B Bt|C|=ߣ>+C0BGB/C0B¤B/CCBGB=Y"?b D/C0B5BbC0BéBbC.B谪BrΜ>p?Cx/Cl#B谪B/C0B5BbC.B谪B?o?sYCDBBbC.B谪BbCDBƈBa ??haYCDBB/CDBBbC.B谪B>_?7ʾ/CDBB/Cl#B谪BbC.B谪BC&?eX4?/CDBBCDB%B/CB%BB&?Y4?YCDBBCDB%B/CDBBo/ij>CnyBmޝBbCDB2UBCDBmޝBsnbxF>bCnyBdBbCDB2UBCnyBmޝB)tnI>CDBmޝB׷CDB BCnyBmޝBhyh=>׷CDB BCnyB BCnyBmޝBeY(>5?/CDBLB/CnyBBCnyB Bmgvg=A>׷CDB B/CDBLBCnyB B??1JYCDBBbCDBƈBbCƋBBB&?GY4?pCDB%BYCDBBbCƋBBB&?Y4?ĈbC'٪B%BCDB%BbCƋBBol>%>dC BmޝBbCnyBdBCnyBmޝBg =7>bC BRBbCnyBdBdC BmޝBIg>C>CnyBmޝBCnyB BdC BmޝB]:B>>CnyB BbC B BdC BmޝBxO ]>] ?/CnyBB/C B\ȡBbC B BpTX+K=>q?CnyB B/CnyBBbC B Ba}=>bCBΩBHdCBΩBbCBbBNg >އ>bC BRBHdCBΩBbCBΩBJgR>O>bC BRBdC BmޝBHdCBΩB4ZZ>A>dC BmޝB׷CBmޝBHdCBΩB H> ?/CٯB B/CBPߟB׷CBmޝBR H>ֆ ?/CٯB B׷CBmޝBbC B Bp\\>ǐ>bC B B׷CBmޝBdC BmޝB]IP>D?bC B B/C B\ȡB/CٯB B[>>0CJBΩBbCBbBHdCBΩB4Osu>_?bCJB,BbCBbB0CJBΩB Auڴ> ?/CҴBmޝB/CJB̲B0CJBΩBEA[> ?/CҴBmޝB0CJBΩB׷CBmޝBXA>>׷CBmޝB0CJBΩBHdCBΩBD|>I?׷CBmޝB/CBPߟB/CҴBmޝBLCK>g}?bCJB,BHdCKB/uBbC:B/uBLQ>n?bCJB,B0CJBΩBHdCKB/uB#@*}>g?0CJBΩB&CKBΩBHdCKB/uBs%*_>wF ?/CJB̲B/CKBvB&CKBΩBrAʥ>.T?0CJBΩB/CJB̲B&CKBΩB4>?/C@BΩB/CB՘B׷CB/uB>?/C@BΩB׷CB/uB&CKBΩB:>g ?&CKBΩB׷CB/uBHdCKB/uB??&CKBΩB/CKBvB/C@BΩB'33?L=/C3BI|BKC0BI|B/C0B¤B'33?L/C3BI|B/C0B5BKC0BI|B7hgMug=[ >/CCBGB7CDBGB/CDBLBs|a|=t>/C0B¤B7CDBGB/CCBGBr||=6>/C0B¤BKC0BI|B7CDBGB[Y Ω>>KC0BI|B8CDBI|B7CDBGBk:X>/C0B5B8CDBI|BKC0BI|B4T04$?>/C0B5BCf>B谪B8CDBI|B16?a/C0B5B/Cl#B谪BCf>B谪BQ+++?>CDBB8CDBI|BCf>B谪B-h3?NB`>Cf>B谪B/Cl#B谪BC=BB+K:Ie?Ͼ/Cl#B谪B/CDBBC=BBRKaz?Cg?P/CDBB/CB%BCO$B%B1d_+>\T>P^CnyBGB/CDBLB7CDBGBY.(>4?/CnyBB/CDBLBP^CnyBGB/cUa*>>7CDBGB8CDBI|BP^CnyBGBkH0> ?8CDBI|B\CnyBI|BP^CnyBGB1>U ?CDBBCnyB֧B\CnyBI|BZYϩ>=>8CDBI|BCDBB\CnyBI|BHUhG}>D>8C BGB/CnyBBP^CnyBGB{tO]>lc ?/C B\ȡB/CnyBB8C BGB3x>?CyBI|BC BB8C BGBg3>"?CyBI|B8C BGB\CnyBI|B*LUs> ?\CnyBI|B8C BGBP^CnyBGB;>&?\CnyBI|BCnyB֧BCyBI|B H> ?/CٯB BdCB B/CBPߟB,2>C?dCB BCRBGBCBBAf=>>?/CٯB BCRBGBdCB Br;:>c ?/CٯB B8C BGBCRBGBGYI>I?/CٯB B/C B\ȡB8C BGB/+>P?8C BGBC BBCRBGB @ >" ?/CҴBmޝB7CJBmޝB/CJB̲BMD~>qK?/CBPߟB7CJBmޝB/CҴBmޝBoDs~>OK?/CBPߟBdCB B7CJBmޝBr49G>)?dCB B޸CJB B7CJBmޝBG &>G ?CBBCJBیB޸CJB B^,2>vT?dCB BCBB޸CJB B_r4>ԛ?ĸCKBmޝB/CJB̲B7CJBmޝBr%_> G ?/CKBvB/CJB̲BĸCKBmޝBw!?%?CB BCKBоBĸCKBmޝBʱ??CB BĸCKBmޝB޸CJB BK/>l?޸CJB BĸCKBmޝB7CJBmޝBб??޸CJB BCJBیBCB BQK ?(?/C@BΩB¸CBΩB/CB՘BB ?;?¸CBΩBCL,BmޝBCBlBsz?G?/C@BΩBCL,BmޝB¸CBΩB\?2?/C@BΩBĸCKBmޝBCL,BmޝB#b??/C@BΩB/CKBvBĸCKBmޝBr?r?ĸCKBmޝBCKBоBCL,BmޝBK+0+?c>Cf>B谪BCDB谪BCDBB080?\>C=BBCDB谪BCf>B谪BfI?҆}>jXCDBBCDB谪BC=BBE<^9?>jXCDBB%ʹC㊧B%B%ʹCDBB^<]9?>jXCDBBC=BB%ʹC㊧B%B}?LCnyB谪BCDBBCDB谪B1Ȕ> ?CnyB֧BCDBBCnyB谪BfMk? ?%ʹCƋBB%ʹCnyBīBCnyB谪Bm,?9 ?%ʹCƋBBCnyB谪BjXCDBBnFl? í>jXCDBBCnyB谪BCDB谪B^;7_9? >jXCDBB%ʹCDBB%ʹCƋBB{3>y?CyBI|BQC BI|BC BB_!>v_!?QC BI|B%ʹCNլB谪B%ʹC B]BJe4Yf>?CyBI|B%ʹCNլB谪BQC BI|Br-> ?CyBI|BCnyB谪B%ʹCNլB谪B;5>?CyBI|BCnyB֧BCnyB谪Bl' >a?CnyB谪B%ʹCnyBīB%ʹCNլB谪B 0>U?CRBGBCBGBCBBF>@b#?CBGB%ʹCKBI|B%ʹCBLB^e&>L'?CRBGB%ʹCKBI|BCBGBZ _>"?CRBGBQC BI|B%ʹCKBI|Bf/U>Q?CRBGBC BBQC BI|B_!>~_!?QC BI|B%ʹC B]B%ʹCKBI|Bh@?8?%ʹCBGBCBBCBGBhch ?O?%ʹCBGB%ʹCJBBCBBz~ )>J-?%ʹCJBBCJBیBCBBo"U ?*O?CBGB%ʹCBLB%ʹCBGBH¾49??CKBоB%ʹCB B%ʹCKBڠB_辗 ?+?CB B%ʹCB BCKBоBC辅 ?+?%ʹCB BCB BCJBیBW??%ʹCJBB%ʹCB BCJBیB8c0L??CBlB%ʹCBmޝB%ʹCBBj{/?B'?CL,BmޝB%ʹCBmޝBCBlB^+?+?%ʹCBmޝBCL,BmޝBCKBоB">¾=9?s?%ʹCKBڠB%ʹCBmޝBCKBоBTg׾\D?.>%ʹC㊧B%B#CDB%B%ʹCDBBf"?` ?%ʹCƋBBPCnyBB%ʹCnyBīB ??PCnyBBMCKB%BMCnyBaB\ ??%ʹCƋBBMCKB%BPCnyBBf׾D?,>%ʹCƋBB#CDB%BMCKB%Be׾eD?,>%ʹCƋBB%ʹCDBB#CDB%B-# T>X/?%ʹCNլB谪B6C B谪B%ʹC B]B*?N!?6C B谪BMC5BBMC B:ޫBq?\?%ʹCNլB谪BMC5BB6C B谪B (??%ʹCNլB谪BPCnyBBMC5BB>"?%ʹCNլB谪B%ʹCnyBīBPCnyBB(?$?PCnyBBMCnyBaBMC5BBXپ~??,b/?%ʹCKBI|B%ʹC B]B6C B谪Bu?)7#?6C B谪BMC B:ޫBMCB谪B V&?G4?%ʹCBGBCJBGB%ʹCJBB`υ7?Rs#?CJBGBMCPBI|BMCJB3}Br|3?_%?%ʹCBGBMCPBI|BCJBGBvHX"?3F.?%ʹCBGBFCBI|BMCPBI|BJȾ?8-?%ʹCBGB%ʹCBLBFCBI|B<'?<'?FCBI|BMCBBMCPBI|B@aF?af?%ʹCB BCKB B%ʹCKBڠBRI?xp?CKB BMC*BGBMCKBBN'I?q?%ʹCB BMC*BGBCKB BPT|.?T|.?%ʹCB BCJBGBMC*BGBPS|.?S|.?%ʹCB B%ʹCJBBCJBGB`77?r#?CJBGBMCJB3}BMC*BGBc?)?MCPBI|BtdC BI|BMCJB3}BAxu4?u4?tdC BI|BMCPBI|BMCBBf)x~C?!?tdCBvBtdC BI|BMCBBL>ZZ?>tdCKBOQB3CKB BtdC޷B BU;>G?1?MCKBBtdC޷B B3CKB BuU;>0G??MCKBBMC*BGBtdC޷B Bѻ=ݦV? ?MC*BGBtdC6ѵBGBtdC޷B B=>?-)?tdC6ѵBGBMC*BGBMCJB3}B({[?>tdCBoeBOCBΩBtdCz`BΩB>sR?>MCBBtdCz`BΩBOCBΩB>MR?ǹ>MCBBMCɹBmޝBtdCz`BΩB>$Y?>MCɹBmޝBtdCBmޝBtdCz`BΩB L>Z? >3CKB BtdCKBOQBtdCBmޝBL>ěZ?>3CKB BtdCBmޝBMCAB Bs>fN?s?MCAB BtdCBmޝBMCɹBmޝBeV;>G??3CKB BMCAB BMCKBBt-`y9?s+?tdCB%BCnyB%BtdCnyB8zBNL?H?tdCBvB1CjhB谪B1CBB7a>vC?!?tdCuB谪B1CjhB谪BtdCBvBm=|6?x0?1CjhB谪BtdCuB谪BtdC B& B66V?BK>1CJB_BCJBGB1CMBGB`>{EJ?1 ?tdCJBVB1CMBGBCJBGBX`>3FJ?A ?tdCJBVBtdC BI|B1CMBGB{"o>nT? ?tdC BI|B1C@?{?1CL?-H?1CBB1C S?I>1CKBBBkCKBmޝB1CcBmޝB9>VK?>tdCKBOQB1CcBmޝBkCKBmޝBq>݁K?>tdCKBOQBtdC޷B B1CcBmޝBO>5T?5>tdC޷B B1CkB B1CcBmޝB>/6V?OK>CJBGB1CJB_B1CkB B >5V?K>CJBGB1CkB BtdC6ѵBGBC>fI?m?tdC6ѵBGB1CkB BtdC޷B Ba>DJ? ?CJBGBtdC6ѵBGBtdCJBVB|s?H?>tdCBoeB1CnӺB/uBCB/uBu?~H?>tdCBoeBtdCz`BΩB1CnӺB/uBX>N?>tdCz`BΩB1C;yBΩB1CnӺB/uB8>JS?~E>kCKBmޝB1CKBBB1C;yBΩB$>S?oE>kCKBmޝB1C;yBΩBtdCBmޝB>8H?>tdCBmޝB1C;yBΩBtdCz`BΩB>K?1>kCKBmޝBtdCBmޝBtdCKBOQBߍ={b? >CDBp3BCDB}BCB}B=P??^ȵCDB֥BCB}BCDB}Be=`P??^ȵCDB֥B^ȵC BBCB}B' ܼ' \??^ȵC BBC0BBCB}B1J>.c?d>CnyB BRCnyB?!BCCB?!Bu>ПS?>^ȵCnyB yBCCB?!BRCnyB?!B>9S?>^ȵCnyB yB^ȵCeBUBCCB?!B^<>g?D>^ȵCeBUBCBUBCCB?!B=jb?^>CDB}BCDBp3BCBUBߍ=b?>CDB}BCBUB^ȵC XB}BW,>yT??^ȵC XB}BCBUB^ȵCeBUBÜ=P?P?CDB}B^ȵC XB}B^ȵCDB֥B/w?(BD?w>C BB{C BcBCZBcB?`?HQ?k>CZBcBC BBCsBB,?Xh>?8>{C BcBC BBCZBcB>˫F?z>^ȵC B$_BCsBBC BB݋>F?>^ȵC B$_B^ȵCNBBCsBB>=Y?>^ȵCNBBCLBBCsBBoI>.c?Tc>RCnyB?!BCnyB BCLBBI> /c?Bc>RCnyB?!BCLBB^ȵC,@B?!B>!O?l>^ȵC,@B?!BCLBB^ȵCNBB>]S?>RCnyB?!B^ȵC,@B?!B^ȵCnyB yB/?в:?<ԼC>B%BеCBNBCeBNB2C?!?[>CB%BеCBNBC>B%Bp?@?|>{C BcB^ȵCBpB^ȵCuBcB5*?tl:?46*>C BB^ȵCBpB{C BcBR$?;?'g>C BBеCBNB^ȵCBpB2-?j8?C>C BBCeBNBеCBNB%?]i>?8>C BB{C BcB^ȵCuBcB?MfI?>^ȵCBBC BB^ȵCuBcB:> F?>C BB^ȵCBB^ȵC B$_B}3?}3?n>еCBNBCB%B^ȵCB%Bt-?~9?" >^ȵCBNBеCBNB^ȵCB%BMA*?5?{n>еCBNB^ȵCBNB^ȵCBpB[k>;d?O>CDBp3BbCJB}BbCDBOBs^>^?>CB}BbCJB}BCDBp3B\>\?[>bCJB}BCB}BbCҖBB">QY? ?CB}BC0BBbCҖBB'1?(1?)`RbC'٪B%B:CnyB%BbCnyB6B9?8N?>bCnyBBECnyBBbC&BBf> ]?8&>bC&BB=CnyBBbC8BB?8J?a>ECnyBB=CnyBBbC&BBZ>u[U?]>CnyB BbC8BB=CnyBB[>ZU?0>CnyB BCCB?!BbC8BBo>e?Ke>CCB?!BbCB?!BbC8BB>a?w*>bCB?!BCCB?!BbC̱BUBF*>a?>CCB?!BCBUBbC̱BUBX>nZ?iC>bC̱BUBCBUBCDBp3B&k>bCDBOBbC̱BUBCDBp3BM(1?(1?`RbCnyB6B\C BNBbC̫BNBL(1?(1?`RbCnyB6B:CnyB%B\C BNBL?~?:CnyB%BC B%B\C BNB.3?X.3?>C BBbC̫BNB\C BNB2.3?'.3?*>C BBCZBcBbC̫BNB$?C?}=CZBcBbCNBcBbC̫BNBU;?S7N?>ECnyBBbCnyBBbCNBcB8?G9N? >ECnyBBbCNBcBCsBBUf!?'J??2W>CsBBbCNBcBCZBcB?J?a>=CnyBBECnyBBCsBBK>5V?>CLBB=CnyBBCsBB4\>ZU?I>=CnyBBCLBBCnyB B] E?P+#?\C BNBC B%BC>B%BV4?V4?aͼCeBNB\C BNBC>B%B;.3?;.3?>\C BNBCeBNBC BB(>Y\?>/C0B.BBɷC0BB/CBBz)?Q8?YO/CB%BCDB%B/CDBpB>>T`?ص=/CDBSBCDB?!B/C B?!Bb >o[c?[c>/C B?!BОCDBUB/C=BUBp>YIZ?4@>CDB?!BОCDBUB/C B?!BO>X?_>bCDBOB/C=BUBОCDBUBO>aX?Ӊ>bCDBOBbCJB}B/C=BUBc>.c?I>bCJB}B/C B}B/C=BUB>\?! >BɷC0BB/C0B.B/C B}Bs>n\?>BɷC0BB/C B}BbCҖBB>MV?i>bCҖBB/C B}BbCJB}B;!+?ƅ6?UXbC'٪B%BbCnyB6BxCnyBNB>)?7?,YCDB%BbC'٪B%BxCnyBNBw+?6?5OCDB%BxCnyBNB/Cq˨BNBT)?O8?[OCDB%B/Cq˨BNB/CDBpB#?D?D/Cq˨BNB:pCnyBcB/CBcB/?:?bC&BBbC8BB/CqBB/>ʵ`?=CDB?!B/CDBSB/CqBBQ>K`?=CDB?!B/CqBBbCB?!Bu| ?Q?Q>bCB?!B/CqBBbC8BB>SIZ?@@>ОCDBUBCDB?!BbCB?!Bv>j_?>bC̱BUBОCDBUBbCB?!BM>X?>ОCDBUBbC̱BUBbCDBOB!+?Z6?ؾXxCnyBNBbCnyB6BbC̫BNB/?:?(<:pCnyBcBxCnyBNBbC̫BNB-#? E?=bCNBcB:pCnyBcBbC̫BNB"?-C?~=:pCnyBcBbCNBcBbCnyBBy>Pa?+>C0BB˸C0B}BCؼB}Bf>cW?+>/C0B.BCؼB}B˸C0B}B>/cW?M>/C0B.B/CBBCؼB}B[>]?>/CBBCUBBCؼB}Bz>X?skCDBNB/CB%B/CDBpB >ߴX?skCDBNBCBNB/CB%B7li>x?B:=CBNBCO$B%B/CB%B?TT?A=CBNBuCDBcBC`צBcB>8_?߶kCDBNBuCDBcBCBNBX ?UU?d =C`צBcBcCDBBC鰦BB?=T?xG=uCDBcBcCDBBC`צBcBA?ߋ]?%CCDBBCDBB ?OAU?=cCDBB>CCDBBC鰦BB>+W\?b=/CDBSBCDBB>CCDBB>W\?W=/CDBSB/C B?!BCDBBD>a?=/C B?!BC'WB?!BCDBB|>|_?>C'WB?!B/C B?!BCʥBUB >[c? \c>/C B?!B/C=BUBCʥBUB~>8a?)>˸C0B}BC0BBCʥBUB>,a?)>˸C0B}BCʥBUB/C B}B>]?G>/C B}BCʥBUB/C=BUB>>eW?>˸C0B}B/C B}B/C0B.B'>X?skCDBNB/CDBpB/Cq˨BNB> _?}ݶuCDBcBkCDBNB/Cq˨BNBo?5T?'6T/CBcBuCDBcB/Cq˨BNB\?>T?G=cCDBBuCDBcB/CBcBC ?U?U=/Cq˨BBcCDBB/CBcB ?QAU?=>CCDBBcCDBB/Cq˨BB >\\?=/CqBB>CCDBB/Cq˨BB^>Y\?}[=>CCDBB/CqBB/CDBSB`>_?}ߧ=%ʹC0BbB~C0BB%ʹC"BBt>܆`?#<%ʹC"BBįC0BB%ʹC}֤BB`>`?-<~C0BBįC0BB%ʹC"BBL>Ld?<%ʹC}֤BByC0B?!B%ʹCؼB?!B}>w`?$f=įC0BByC0B?!B%ʹC}֤BBl>~&d?<>%ʹCؼB?!B\C0BUB%ʹCSb?i>yC0B?!B\C0BUB%ʹCؼB?!B>I\?L>C0BB%ʹC\?>C0BBCؼB}B%ʹC(c?;>CؼB}B%ʹCUB}B%ʹCJ[?K>%ʹCUB}BCؼB}B%ʹCrBB>H[?T>CؼB}BCUBB%ʹCrBB\\i?/>%ʹC㊧B%BCO$B%B%ʹC#BNBN>*w?]9=CO$B%BCBNB%ʹC#BNBm}>n?L>%ʹC#BNBCBNB%ʹC=BcBG>d?і+=CBNBC`צBcB%ʹC=BcB>_?=~C0BB%ʹC0BbB%ʹC=BcB>_?=~C0BB%ʹC=BcBC鰦BBJ>d?]+=C鰦BB%ʹC=BcBC`צBcBʑ>`?<įC0BB~C0BBC鰦BB>`?v`?h=yC0B?!BįC0BBCDBBj>jd?)Ď=C'WB?!ByC0B?!BCDBBʇ>zb?>\C0BUByC0B?!BC'WB?!Bߑ>c?>CʥBUB\C0BUBC'WB?!B>\?>\C0BUBCʥBUBC0BBy[= [?J?MC0BxB}C0BcBMC BcBZ~=d~?ož=%ʹC0BbBMC BcB}C0BcBu\~=c~?uǾ=%ʹC0BbB%ʹC"BBMC BcB9b>Nq?1>%ʹC"BBMC/BBMC BcBg>.iv?>MC/BB%ʹC"BBMCBB>p?<%ʹC"BB%ʹC}֤BBMCBB>Co?D=MCBB%ʹC}֤BBMCIB?!BB;>i?!<%ʹC}֤BB%ʹCؼB?!BMCIB?!Bv5>4f?H>MCIB?!B%ʹCؼB?!BMCȢBUBv5>4f?H>%ʹCؼB?!B%ʹC_?>ᓺCۡB}BMCۡBtBMCȢBUBh>_?>ᓺCۡB}BMCȢBUB%ʹCUB}B>aa?~>%ʹCUB}BMCȢBUB%ʹCϋY?>CۡBBᓺCۡB}B%ʹCUB}B>>Y?>%ʹCrBBCۡBB%ʹCUB}BTξ%ʹC㊧B%B%ʹC#BNBMCBNBD\=[??}C0BcBMC0BxBMCBNB{[=B[?o?}C0BcBMCBNB%ʹC=BcBoo?ņ>%ʹC=BcBMCBNB%ʹC#BNBMe~=c~?;=}C0BcB%ʹC=BcB%ʹC0BbBξC0BcBtdCBBtdC0BoBN _a?g>C0BcBMC BcBtdCBBϸ=*iv?>MC BcBMC/BBtdCBB׶=Gr?>tdCBBMC/BBtdCբBB6>kt?>MC/BBMCBBtdCբBB1>nNq?:b>tdCբBBMCBBtdCDB?!B0>n?=MCBBMCIB?!BtdCDB?!B:>e?)9I>CۡBUBtdCۡB)BtdCDB?!B8>e?7I>CۡBUBtdCDB?!BMCȢBUBr>,m?)<>MCȢBUBtdCDB?!BMCIB?!BA>{Pb?g_>CۡBUBMCȢBUBMCۡBtBPw8?x ?MCDBBtdC1BNBtdCDB7B;ÙHD?W?MCBNBtdC1BNBMCDBBimGZ?U?MC0BxBC0BcBtdCBcBU^)Z?M?MC0BxBtdCBcBMCBNBHC0BcBtdC0BoBtdCBcBna`?? ?tdCB%BMCKB%BMCDBBH8??tdCDB7BtdCB%BMCDBBͻ2N?+?tdC0BoB1C9ɣBB1C0BBqtdCBB1C9ɣBBtdC0BoB1C9ɣBBtdCBB1CDBBg^>lm?.ϛ>tdCBBtdCբBB1CDBB>9d?>CۡB?!B1CۡB5B1CDBB*>8d?>CۡB?!B1CDBBtdCDB?!B\c>r?c>tdCDB?!B1CDBBtdCբBB闩>k?zN>CۡB?!BtdCDB?!BtdCۡB)BM(@M(@?./"?tdC1BNBwCDBNBtdCDB7B7::?)?wCDBNB1C BcB1CDBB::?x)?wCDBNBtdC1BNB1C BcB.avC?2!?tdC1BNBtdCBcB1C BcBf`?>1C BcBtdCBcBtdC0BoBɻ)O??1C0BB1C BcBtdC0BoBX5BB? ?CnyB%B1CBNB1CnyBWPB}5PB? ?tdCB%B1CBNBCnyB%B.@.@?E'"?tdCB%BwCDBNB1CBNB$@U/@?'"?tdCB%BtdCDB7BwCDBNB::?[)?wCDBNB1CDBB1CBNB5 B? ?CnyB%B1CnyBWPB1CNB%B\PrO?7?^ȵC0BBCBBC0BPByG?k?^ȵCBBCBB^ȵC0BBz읽z4?z4?CBB^ȵCBB^ȵCۡBFB8??#'?CۡB5EBCBB^ȵCۡBFB&ȼ&H?}?C0BB^ȵC BB^ȵC0BBPO?7?C0BPBC0BB^ȵC0BBv5>5T?0C ?C0BPBbCJ|BBbC0BDB#=#N??CBBbCJ|BBC0BPBϿ=??z'?bCJ|BBCBBCۡB5EB[=G?O?bCۡBBbCJ|BBCۡB5EB!>M?5?bCҖBBC0BBC0BPBP5>5T? C ?bC0BDBbCҖBBC0BPBVt>fN?Vt?bC0BDB/CBBBɷC0BB"t>gN?s?bC0BDBbCJ|BB/CBBd>V?/>bCJ|BB/CPBB/CBBFP>D?64?/CPBBbCJ|BBbCۡBB_7>cJ??/CۡBYB/CPBBbCۡBBzs>4gN?zs?BɷC0BBbCҖBBbC0BDB媍>5W?>BǸCۡBBCۡBrBCUBB;>FW?->BǸCۡBBCUBB/CPBB; >OQ?(>/CPBBCUBB/CBB>yG?~?BǸCۡBB/CPBB/CۡBYB>S?h>%ʹCrBBCUBBCۡBrB$>TS?q>%ʹCۡB'B%ʹCrBBCۡBrBѾ>lO?>>CۡBB%ʹCrBB%ʹCۡB'B-D<&?8*^ȵCdBl@BCdBMABC:BFABVSNn^ȵC:BFAB^ȵCdBl@BC:BFABC=%C:BFABC BVHB^ȵC:BFABm)9L+^ȵC:BFABC BVHB^ȵCVBVHB12>7m,^ȵCSBjO8BCSBs9BCB ;B&=Ip^ȵCB ;B^ȵCSBjO8BCB ;B,=LVCB ;B^ȵCdBl@B^ȵCB ;BG<1#?<*CdBMAB^ȵCdBl@BCB ;BM2>F,F,^ȵCBS0BCB_@3BClB5Bxz>)?*M^ȵC(B5B^ȵCBS0BClB5B=>DClB5B^ȵCSBjO8B^ȵC(B5BB.2>p7j,CSBs9B^ȵCSBjO8BClB5Brs>A:$|L,^ȵCAB)BCAB$-BCB.B'>_O)O)^ȵC4B.B^ȵCAB)BCB.B6 >L6&CB.B^ȵCBS0B^ȵC4B.B>'/CB_@3B^ȵCBS0BCB.B|A?BB+$^ȵCB{BPH(B^ȵCB##B~CBPH(BA?s*$~CBPH(B^ȵCAB)B^ȵCB{BPH(BD?0H~CBPH(BCBG(B^ȵCAB)B8>tBCBG(BCAB$-B^ȵCAB)B? #^ȵCp7B!B^ȵC~%BB=-C~%B!Bx!? ̾)=-C~%B!BC~%B$BCgBPH(B?}1.^ȵCp7B!B=-C~%B!BCgBPH(B7?vྻB0^ȵCp7B!BCgBPH(B~CBPH(B?@,^ȵCp7B!B~CBPH(B^ȵCB##BH?9M/~CBPH(BCgBPH(BCBG(B>O5D!C:BFABCdBMABʶCdBFAB>'f0ʶCdBFABbCdBDBbCBVHB>) e/ʶCdBFABbCBVHBC:BFABJ>?!C:BFABbCBVHBC BVHB>e%tCB ;BCSBs9B1ֶCSB ;B4>|+1ֶCSB ;BbCSBի>BbC"eBFABf>qh*CB ;B1ֶCSB ;BbC"eBFABjѼ>/` CB ;BbC"eBFABʶCdBFAB>75G!CB ;BʶCdBFABCdBMAB>1M8ʶCdBFABbC"eBFABbCdBDB_ ?  ClB5BCB_@3BնCB5BK?`նCB5BbCBd)9BbC)B ;Bo?bt^`ClB5BնCB5BbC)B ;BȊ?HHClB5BbC)B ;B1ֶCSB ;B>h%ClB5B1ֶCSB ;BCSBs9B$ >7y*1ֶCSB ;BbC)B ;BbCSBի>B?$CB.BCAB$-B6ǶCAB.Ba?$}6ǶCAB.BbCAB3BbCB5B.?f`CB.B6ǶCAB.BbCB5B>? |,CB.BbCB5BնCB5B?S$CB.BնCB5BCB_@3B4?N" նCB5BbCB5BbCBd)9Bu&?2ƾ&ACB.B6ǶCAB.BCAB$-B+?*JҾB4CBG(BACB.BCAB$-B[E?Ϡ bCAB3BACB.BbCB4(0BA*?t,ʾD"6ǶCAB.BACB.BbCAB3B5(?)ǾEd%CgBPH(BC~%B$BC~%BPH(B(5H?&q C~%BPH(BbC~%B3,BbCWB.Bjs3?;վ:BCgBPH(BC~%BPH(BbCWB.B8?#CgBPH(BbCWB.BACB.B,?̾CgBPH(BACB.BCBG(BF?&xACB.BbCWB.BbCB4(0B=?$bCBVHBbCdBDBvCdBVHBt?*sbC"eBFABbCSBի>BʷCSBFABP3?Ծ|ʷCSBFAB/CSBüEB/CBVHB3?ˣjbC"eBFABʷCSBFAB/CBVHB9T&?L?־Lw"bC"eBFAB/CBVHBvCdBVHBds?RbC"eBFABvCdBVHBbCdBDBQ?bC)B ;BbCBd)9BCB ;Bc,B4?Cо((ʷCSBFAB/C BFAB/CSBüEB,?SbbCB5BbCAB3BCAB5B3?\6bCBd)9BbCB5BCAB5B5? \4bCBd)9BCAB5BCB ;B`F?I/}/CB ;BCAB5BbCAB ;Bʗ[?'Qi/CB )ABbCAB ;B/CAB\=BsA?h CB ;BbCAB ;B/CB )ABT3?y䀾*zԷCB5BCAB5BbCAB3BZE?Ϡ bCB4(0BzԷCB5BbCAB3BL?LSCAB5BzԷCB5BbCAB ;BYh?ˈ˾bCAB ;BzԷCB5B;.CB ;Bzs?#؟q/CAB\=B;.CB ;B/CB;BCa?bCAB ;B;.CB ;B/CAB\=B05H?&h bCWB.BbC~%B3,BC~%B.BF?%bCB4(0BbCWB.BC~%B.BF?T%bCB4(0BC~%B.BzԷCB5B>i?P;v̾zԷCB5BC~%B.BC~%B5BDi?T;v̾zԷCB5BC~%B5B;.CB ;BUw?=)Vw;.CB ;BC~%B5BC~%B ;B|?=/CB;BC~%B ;B/C~%B@B?is?=ߗ;.CB ;BC~%B ;B/CB;BM3?Ծ/CBVHB/CSBüEBtCSBVHB)DSѸCABVHBXnCBFAB8CBVHB1k?O>]4C~%BFABXnCBFAB/CB;B|?=/C~%B@B4C~%BFAB/CB;BI&q?w>;RXnCBFAB4C~%BFAB8CBVHBg?7>8CBVHB4C~%BFAB;C~%BVHB+[H?tdCBt9BtdC2B ;BVCB ;Bv]*b(=tdC2B ;BtdCB>BVCB ;B{, ͂tdCdBl-BtdCB.BFCdB.BJ[xtdCB.BtdCB5BCdB5BID[8FCdB.BtdCB.BCdB5B]>BtdCB5BtdCBt9BVCB ;B2]뾻;BtdCB5BVCB ;BCdB5BSvJ<CdB5BVCB ;BTCdB ;Blz찱>tdCB>BtdCdBABTCdB ;B 6t]Y` >VCB ;BtdCB>BTCdB ;Buj(stdCSBӺ&BtdCtgBPH(B2CSBPH(B)7ٜtdCtgBPH(BtdCdBl-BFCdB.B)8tdCtgBPH(BFCdB.B2CSBPH(B`RHU2CSBPH(BFCdB.BٺCSB.Bb]8MOFCdB.BCdB5BٺCSB.B*x;iQx=CdB5BCSB5BٺCSB.B!yݍi<CdB5BTCdB ;BCSB5Bkwo>TCdB ;BTCSB ;BCSB5B 5`c>:>tdCdBABtdCSB?BTCSB ;BBoƳ>TCdB ;BtdCdBABTCSB ;Bs^rtdCB!BtdCB!BjLCB!B tdCB!BtdCSBӺ&B2CSBPH(Bf2tdCB!B2CSBPH(BjLCB!BJxþ 4jLCB!B2CSBPH(BeϺCBPH(B_VbϾ2CSBPH(BٺCSB.BeϺCBPH(BgC}CIٺCSB.B^CB.BeϺCBPH(B/}}}=ٺCSB.BCSB5B^CB.B`x:=pi>CSB5BtCB5B^CB.B*wb9=gM>CSB5BTCSB ;BtCB5B dU>>TCSB ;BjLCB ;BtCB5BcP>Ȳ?tdCSB?BtdCBA]:>TCSB ;BtdCSB?BjLCB ;B0\50tdCABBtdCB!BjLCB!BR0\R0M CAB!BtdCABBjLCB!B97SsjLCB!BeϺCBPH(BM CAB!BohLeϺCBPH(B^CABPH(BM CAB!Bs~;;eϺCBPH(B^CB.B^CABPH(Bx+>+>^CB.BCAB.B^CABPH(BuP)>yf>^CB.BtCB5BCAB.B fǏ>ʊ>tCB5B/CAB5BCAB.B}S\>bf>tdCWtB ;BtdCAB 8B/CAB5BSL>Zf>tdCWtB ;B/CAB5BjLCB ;BAE`[*>>>jLCB ;B/CAB5BtCB5BvK>B?jLCB ;BtdCBAk^CABPH(BtCBPH(B CB!Buyf>P)>^CABPH(BCAB.BtCBPH(B f⊬>Ǐ>CAB.B/CB.BtCBPH(BQ>W>tdCccB5BtdCB1B/CB.BEQH>(>tdCccB5B/CB.B/CAB5B)bǟ>>/CAB5B/CB.BCAB.BM >>/CAB5BtdCAB 8BtdCccB5Bɻ/u>/tdC~%BA!BtdCB5B CB!BE">VC~%B!BtdC~%BA!B CB!Bn> CB!BtCBPH(BVC~%B!Bg7>tCBPH(BOC~%BPH(BVC~%B!BvK|>Ÿ>tdC LB.BtdC~%B&)BOC~%BPH(BKXz>ĸ>tdC LB.BOC~%BPH(B/CB.B _>e>/CB.BOC~%BPH(BtCBPH(B I > >/CB.BtdCB1BtdC LB.B.""F㾜1C'B,4B1CFB5Bd&C'B5B>c,b,91CFB5B1CnB ;BnɻC'B ;Bd,`,L;d&C'B5B1CFB5BnɻC'B ;BLJ(%1CnB ;B1C 4BFABgC'BFAB404anɻC'B ;B1CnB ;BgC'BFABQHA~T1C 4BFAB1CBEBCBVHBSH>T1C 4BFABCBVHBgC'BFAB(Rj;/=gC'BFABCBVHBûC'BVHBt1CB4T,B1CFB.B|CB.B`""㾜1CFB.B1C'B,4Bd&C'B5B"~"㾜1CFB.Bd&C'B5B|CB.B>u:u|CB.Bd&C'B5B肻CB5B,[G?tdCBt9BnɻC'B ;BtdC2B ;B,[?tdCBt9B肻CB5BnɻC'B ;B7<`5肻CB5Bd&C'B5BnɻC'B ;Bv]*(=tdC2B ;BrCBFABtdCB>Bw]'\'=tdC2B ;BnɻC'B ;BrCBFABoq 喽nɻC'B ;BgC'BFABrCBFABqG?g5=gC'BFABûC'BVHBrCBFAB5uϢ;>ûC'BVHB`CBVHBrCBFABu;1CdBa%B1CmBPH(B߻CdBPH(B%,S |CB.BtdCB.BtdCdBl-Bf{?1CB4T,B|CB.BtdCdBl-BH'rF1CB4T,BtdCdBl-B߻CdBPH(Bq1CB4T,B߻CdBPH(B1CmBPH(BFu:ؕu肻CB5BtdCB.B|CB.B"K[辁xtdCB5BtdCB.B肻CB5Bk]G뾲9B肻CB5BtdCBt9BtdCB5B;}a=s>CiCdBFABtdCB>BrCBFAB l}R>tdCdBABtdCB>BCiCdBFAB*wb9O>rCBFAB`CBVHBCiCdBFABJg> >`CBVHB9ƻCdBVHBCiCdBFAB4]&2$1CSB B1C(B!B CSB!Bs)u߻CdBPH(BtdCtgBPH(BtdCSBӺ&Bt*Yt1CdBa%B߻CdBPH(BtdCSBӺ&B4J(2$1CdBa%BtdCSBӺ&B CSB!Bx5'$1CdBa%B CSB!B1C(B!B)9Q߻CdBPH(BtdCdBl-BtdCtgBPH(BK,m:>I>QCSBFABtdCdBABCiCdBFAB6`-`>J5>tdCSB?BtdCdBABQCSBFAB0fkG>5>CiCdBFAB9ƻCdBVHBQCSBFABYHUF}>F>9ƻCdBVHB!CSBVHBQCSBFAB M CSB!BtdCB!BtdCB!B K CSB!BtdCB!B1CSB B%쾤پ2G1CSB BtdCB!B1CB@PB>. K CSB!BtdCSBӺ&BtdCB!BUX1>>ϻCBFABtdCSB?BQCSBFABP >?tdCBA ?1CRBVHB1CBEFBϻCBFAB\D> ?1CRBVHBϻCBFAB!CSBVHBS2!>T>!CSBVHBϻCBFABQCSBFABq 2 H1CABB1CBuBCABuBK @ H1CBuBtdCABBCABuBI gQ H1CBuB1CB@PBtdCABBp݄T1CB@PBtdCB!BtdCABB/S>ti>tdCWtB ;BŸCAB ;BtdCAB 8BG5e>I?ŸCAB ;B1C,BFAB1CAB AB @>;?tdCWtB ;B1C,BFABŸCAB ;B@>J>O?tdCWtB ;BϻCBFAB1C,BFABKԷ>?tdCWtB ;BtdCBA?ϻCBFAB1CBEFB1C,BFABk NN1CB0B1CABBCABuB{+Kp:߻CBuB1CB0BCABuB{+Ky:CABuBtdCB5B߻CBuBR&RtdCABBtdCB5BCABuBNQi>>tdCccB5B$CB5BtdCB1BM>>tdCAB 8B$CB5BtdCccB5BM=>>tdCAB 8BŸCAB ;B$CB5Bo:>A?ŸCAB ;B/#CB ;B$CB5BS-7>FV?1CAB AB1CBo;B/#CB ;B1>ڌ?ŸCAB ;B1CAB AB/#CB ;Bx-,xL6tdCB5BtdC~%BA!B߻CBuB9K8y>ø>tdC LB.BC~%B.BtdC~%B&)Bh=2^ ?Ȅ>C~%B.B1C B5B1C~%B4B=>R>tdC LB.B1C B5BC~%B.B+7?>tdC LB.B$CB5B1C B5B I >W >tdC LB.BtdCB1B$CB5B;"<"?>$CB5B/#CB ;B1C*B ;B y0f ?>1C B5B$CB5B1C*B ;B``??/#CB ;B1CBo;B1C*B ;BFBZ^ȵC'BMRBC'B=JPBCB(UBo2J>^ȵCLB(UB^ȵC'BMRBCB(UB8H͵CB=[BCB(UBCBXB >H͵CB=[B^ȵCB=[BCB(UBuRN8 ^ȵCB=[B^ȵCLB(UBCB(UBCzP(͵CB=[B^ȵCBƦ[B^ȵCB=[BBx$^ȵCBTIBCBHBCnUB¿NBq%Kt^ȵCB¿NB^ȵCBTIBCnUB¿NB&MolCnUB¿NB^ȵC'BMRB^ȵCB¿NBF\B^C'B=JPB^ȵC'BMRBCnUB¿NBMMC BVHB^ȵCBTIB^ȵCVBVHB`B!k$CBHB^ȵCBTIBC BVHB$^:gU? ?^ȵCBuBCBq{BCBkxB yC?(?^ȵCIBq{BCBq{B^ȵCBuBPj?5>^ȵC~%BkBCexBnBC~%BkB"S^?l>^ȵCH8BnBCexBnB^ȵC~%BkBe?f>CexBnB^ȵCH8BnBCB37uBFQEQ?,| ?^ȵCH8BnB^ȵCB37uBCB37uBHH??CB37uB^ȵCB37uB^ȵCBuB:%^fU? ?CBkxBCB37uB^ȵCBuBW=m=+C'B=JPBbC'BCPBbCB(UB'Fm!CB(UBC'B=JPBbCB(UBOibCB(UBCBXBCB(UB>G9K?bCB]XBCBXBbCB(UB:->i2i2CBHBbCB0JBbC\B¿NB\=(CѪ$CnUB¿NBCBHBbC\B¿NB6=&F!bC\B¿NBC'B=JPBCnUB¿NBW=Sn=+bC'BCPBC'B=JPBbC\B¿NBJ>?!bCBVHBCBHBC BVHB61>-06bCB0JBCBHBbCBVHBf=r`?g>CBkxBbCBq{BbCBwBR=Z?+?CBq{BbCBq{BCBkxB/d>#7h?e>bC~%BhfB.#C~%BdhBbC&BdhB5f>`?2>C~%BkBbC&BdhB.#C~%BdhBg>`?>C~%BkBCexBnBbC&BdhB%j>%j?.>CexBnBbC=BnBbC&BdhBN=h>N=h?o>bC=BnBCexBnBbCjB37uB>&d?l>CexBnBCB37uBbCjB37uBn>X? ?bCjB37uBCB37uBCBkxB=`?>bCBwBbCjB37uBCBkxBu>+F+bC'BCPB/C'BSB/C B(UB>5$bCB(UBbC'BCPB/C B(UB->;sAJ/C B(UBbCB]XBbCB(UB~>+9$/CBZBbCB]XB/C B(UBb>Au.bCB0JB/CBNB/C/B¿NB+>&&bC\B¿NBbCB0JB/C/B¿NB>{-7/C/B¿NBbC'BCPBbC\B¿NB> a4/C'BSBbC'BCPB/C/B¿NB?H$vCdBVHBbCB0JBbCBVHB2?##vCdBVHB/CdBIBbCB0JB>C?/CdBIB/CBNBbCB0JBv?)̾e,vCdBVHB/CBVHB/CdBIBm>7g?2>/CBOfqBECB37uB/CPB37uBκ>0TX?w>bCBwB/CPB37uBECB37uB̺>5TX?f>bCBwBbCBq{B/CPB37uBp>b?8d>bCBq{B/CBq{B/CPB37uB&/?.5?g>/C~%ByPB;C~%B(UB/CB(UB?2O?V=/CB(UB?C~%B=[B/CQB=[BP0?;e6?;t >;C~%B(UB?C~%B=[B/CB(UB͹?[W?=/CQB=[B C~%BzaB/CBzaBfy?,M?x$>?C~%B=[B C~%BzaB/CQB=[B?|$Q?>>bC~%BhfB/CBzaB C~%BzaB}?#Q?@>bC~%BhfBbC&BdhB/CBzaBgU>Y_?nC>bC&BdhB/C+BdhB/CBzaBp>^?^>/C+BdhBbC&BdhB/C]BnBֶ>a?x>bC&BdhBbC=BnB/C]BnBj>8g?G>ECB37uB/CBOfqB/C]BnB>#8g?>ECB37uB/C]BnBbCjB37uBq4> _?;>bCjB37uB/C]BnBbC=BnBy>bTX?>ECB37uBbCjB37uBbCBwBY>"X"/C B(UB/C'BSBnC'B(UB>"Y"nC'B(UBC'B'7XBCB=[BR>"`"/C B(UBnC'B(UBCB=[B>u/AQ/C B(UBCB=[BSCB=[B>݅/+R/C B(UBSCB=[B/CBZB>*l"SCB=[BCB=[BCB^BjD ?I /C/B¿NB/CBNBHCB¿NB?x*HCB¿NBCBSBCDB(UB? V&/C/B¿NBHCB¿NBCDB(UB? &/C/B¿NBCDB(UBnC'B(UB>w<*/C/B¿NBnC'B(UB/C'BSB>4u5nC'B(UBCDB(UBC'B'7XBَ?r3ȸCdB¿NBHCB¿NB/CBNB$?7DӾ/$/CdBIBȸCdB¿NB/CBNBF4?<#CBSBȸCdB¿NBCdBPBʎ?`3HCB¿NBȸCdB¿NBCBSBw??otCSBVHBCSB/MBC%/CBVHBCKBl=?\tCSBVHBθCBVHBCSB/MBq?pU=4CB4>KBѸCABVHBCABELBrd?er侂θCBVHBѸCABVHBCB4>KBt>V?߭>CAB yBCABq{BC5Bq{B`?׸>ȗCABELBCB¿NBCB¿NB`?U>ΕCABELBѸCABVHBCB¿NBƙ6ѸCABVHB8CBVHBCB¿NBY??s*CB¿NBѸCB(UBCXB(UBBk?2>CB¿NBѸCB(UBCB¿NBHrB?%?}CXB(UBϸCB=[BCB=[B?\???J/<ѸCB(UBϸCB=[BCXB(UBN1-?:aCBdhBn[CBnBCBdhB?[$Q??>/CBOfqBC\BnBn[CBnB?$Q?A>/CBOfqB/CPB37uBC\BnBM>_Y?f>/CPB37uBCB37uBC\BnB>V?>CABq{BCAB yBCB37uB>V?>CABq{BCB37uB/CBq{Bv>O?>/CBq{BCB37uB/CPB37uB3d?W=>g+8CBVHB;C~%BVHBCB¿NBFV?t ?CB¿NB;C~%BVHB;C~%B¿NBc8?2-?>/C~%ByPB/CB(UBѸCB(UBѼ8?3-?N%>/C~%ByPBѸCB(UB;C~%B¿NBȒU?<( ?z;C~%B¿NBѸCB(UBCB¿NBm:?/?t;ϸCB=[BѸCB(UB/CB(UB*0?18?U=/CQB=[BϸCB=[B/CB(UB+-0?8?=gCBzaBϸCB=[B/CQB=[BT)?d >?=/CBzaBgCBzaB/CQB=[B>)?>?o=CBdhBgCBzaB/CBzaBL?I?0>/C+BdhBCBdhB/CBzaB4?КI?-4>n[CBnBCBdhB/C+BdhBh?m^T?]T>/C]BnBn[CBnB/C+BdhBa?$Q?_?>n[CBnB/C]BnB/CBOfqB?uCB=[BC'B'7XB`hC'B=[BUn?Ļ t`hC'B=[B%ʹC'B^B%ʹCBzaBϢ?Ϣ!CB=[B`hC'B=[B%ʹCBzaB?nCB=[B%ʹCBzaBjCBzaB5 ?rCB=[BjCBzaBCB^Bg? %~jCBzaB%ʹCBzaB%ʹCBdB^!?_!CDB(UBCBSB.CB(UB2.?n Ծ&.CB(UB%ʹCBZB%ʹC6B=[BM&?%[CDB(UB.CB(UB%ʹC6B=[Bo^+? оCDB(UB%ʹC6B=[B`hC'B=[B_!?W_!CDB(UB`hC'B=[BC'B'7XB*?ϾY`hC'B=[B%ʹC6B=[B%ʹC'B^B-?[h-CdB(UB.CB(UBCBSB4?J#CdBPBCdB(UBCBSBdK?sS/%ʹCBZBCdB(UB%ʹCdBKXB6?T".CB(UBCdB(UB%ʹCBZB{??=CCB4>KB5CB¿NBCSB/MB Q?뽼<CSB¿NB5CB¿NBHCSB(UB,^i?W8=1̾HCSB(UB5CB¿NB׎CB(UB;n?b>b=%ʹCSBvWB׎CB(UB%ʹCBQZBc?:l=HCSB(UB׎CB(UB%ʹCSBvWB.c?E=K/<CAB¿NB5CB¿NBCB4>KB`q?rU=6CABELB<CAB¿NBCB4>KB2h?I>Ȉ˾5CB¿NB<CAB¿NB׎CB(UBl?M>-l׎CB(UB<CAB¿NBKCAB(UBl\?>Sf%ʹCBQZBgxCAB=[B%ʹCB=[B/k\?p>o%ʹCBQZB׎CB(UBgxCAB=[B&n?*I>cP׎CB(UBKCAB(UBgxCAB=[B:S?m?=%ʹCB=[BnCABzaB%ʹC!BzaBH8g?>PgxCAB=[BnCABzaB%ʹCB=[BC?$?F%ʹC!BzaBCABdhB%ʹC_BdhBtW?0 ?`fCABnB7CAB37uB%ʹC!BnB6?:?ӗ>CAB yB%ʹCB37uB7CAB37uB?:?З>CAB yBC5Bq{B%ʹCB37uBN^?(H?C5Bq{B%ʹCBq{B%ʹCB37uB`?E>R<CAB¿NBCABELBCB¿NBe?>teKCAB(UB<CAB¿NBCB¿NBY?e?*CXB(UBKCAB(UBCB¿NBTX?q?BK=gxCAB=[BKCAB(UBCXB(UBSF?#!?vCB=[BgxCAB=[BCXB(UBRF?"!? wnCABzaBgxCAB=[BCB=[B7?2?]7CAB37uBfCABnBC\BnBP!?O??+K>CB37uB7CAB37uBC\BnBO?:?ӗ>7CAB37uBCB37uBCAB yBk? %ʹCBzaB%ʹC'B^B(C'BzaBB?Ծz(C'BzaBMC'B?gBMCLBdhB )?e%ʹCBzaB(C'BzaBMCLBdhB@5?ƾ%ʹCBzaBMCLBdhB&?CBdhB?LwQc%ʹCBzaB&?CBdhB%ʹCBdB/?IS&?CBdhBMCLBdhBMCBnkBQ.?` Ծ%ʹC6B=[B%ʹCBZBdCB=[BI*?Ͼ%ʹC'B^B%ʹC6B=[BdCB=[B*?Ͼw%ʹC'B^BdCB=[B(C'BzaBD?4SX(C'BzaBdCB=[B |CBzaB`?mZ"پMC'B?gB |CBzaBMCBucBJ?X(C'BzaB |CBzaBMC'B?gB N0dCB=[ByCdB=[B |CBzaBc?c |CBzaByCdB=[BBCdBzaBpn?_BCdBzaB CSB=[BXCSBzaBd?x>_岾MCdBcBICSBdhBMCoBdhBCd?>iᲾMCdBcBBCdBzaBICSBdhBAts?ə6>VBCdBzaBXCSBzaBICSBdhBg+r?dc>@MCoBdhBICSBdhBMCSB,jBWt_?t_>0u߾عCB=[B CSB=[B%ʹCSBvWBH7%ʹCBQZBعCB=[B%ʹCSBvWBsdi?di>b CSB=[BعCB=[BXCSBzaBvdi?H >diXCSBzaBعCB=[B CBzaBRh?s>')wXCSBzaB CBzaBICSBdhB&d?>7ICSBdhB CBzaB+CBdhB1W??MCSB,jB+CBnBMC^BnBW??AMCSB,jBICSBdhB+CBnBJef?1>ICSBdhB+CBdhB+CBnB&I?hx?*MC^BnBCB37uBMCB37uBX?bb?a=+CBnBCB37uBMC^BnBt8?sb/?_8=MCB37uB޹CBq{BMCBq{BmD?mv?KCi>CB37uB޹CBq{BMCB37uBEk\?>iعCB=[B%ʹCBQZB%ʹCB=[Bb?>!b CBzaBعCB=[B%ʹCB=[BS??=%ʹC!BzaB CBzaB%ʹCB=[BU?^?+CBdhB CBzaB%ʹC!BzaBD?#?D%ʹC_BdhB+CBdhB%ʹC!BzaB+E?G#?+CBnB+CBdhB%ʹC_BdhB!9?b0?iT=%ʹC!BnB+CBnB%ʹC_BdhB9?W0?*Cg=CB37uB+CBnB%ʹC!BnB4?04?Z=%ʹCB37uBCB37uB%ʹC!BnB((1?(1?``R>޹CBq{BCB37uB%ʹCB37uBt(1?t(1?_R>%ʹCBq{B޹CBq{B%ʹCB37uBB?<ԾqMCLBdhBMC'B?gBWC'BdhB/?EPMCBnkBMCLBdhBWC'BdhBU/?FQMCBnkBWC'BdhBCBnBU?UAGCBnBWC'BdhB[,C'BnB j?p|̾tdCBsB[,C'BnBtdC'BrBP?1P CBnB[,C'BnBtdCBsB R?D mߺCBdhBWC'BdhBMC'B?gB`?mپMCBucBmߺCBdhBMC'B?gB[V?HWC'BdhBmߺCBdhB[,C'BnBmn?4nD[,C'BnBmߺCBdhB/CBnBg?F9>ʾtdC'BrBbCB37uBtdC{B37uBgg?G>9ʾtdC'BrB[,C'BnBbCB37uBSx?qx_Tx[,C'BnB/CBnBbCB37uBiz?v,>9tdC{B37uBbCB37uBtdCBǝuB2e?=٣޾eϺCdBdhBmߺCBdhBMCBucBqn?_r/CBnBeϺCdBdhBCdBnBr?AT>r/CBnBCdBnBbCB37uBq?E8> bCB37uBCdBnBCdB37uBi?>tdCBǝuB"CdBq{BtdCBq{B9i?!>tdCBǝuBbCB37uB"CdBq{B6s?ƛ>lSsbCB37uBCdB37uB"CdBq{BEd?z>b۲eϺCdBdhBMCdBcBMCoBdhB-r?Z>8MCoBdhBMCSB,jB#CSBnB+-r?Y>8MCoBdhB#CSBnBeϺCdBdhBe?3>DeeϺCdBdhB#CSBnBCdBnBCdBnB#CSBnBCdB37uB e?ؤ>CdB37uB#CSBnB*CSB37uBs_f?+>zfCdB37uB*CSB37uB"CdBq{BW??="CdBq{B*CSB37uBCSBq{BW??!#CSBnBMCSB,jBMC^BnBX?a?a*CSB37uB#CSBnBMC^BnBwI?v?*MCB37uB*CSB37uBMC^BnB?H?0?}=CSBq{B*CSB37uBMCB37uB8?\b/??8=MCBq{BCSBq{BMCB37uB^ v'Gb=1CBJNB1CB¿NBC'B¿NB v赂I=1CBJNBC'B¿NBCBVHB^cƾ]>CBVHBC'B¿NBûC'BVHBn>}K>1CB¿NB1C'BCTBC'B¿NBzT?TAC'B37uB肻CB37uBtdCBsBj?0s|̾tdC'BrBC'B37uBtdCBsB6s?kSsƛ肻CB37uBC'B37uB9ƻCBq{B9x?}S=ûC'BVHBC'B¿NB`CBVHB,m3>C'B¿NBCB¿NB`CBVHBnF=1>1C'BCTB1CB(SBCB¿NBzpvޝ>C'B¿NB1C'BCTBCB¿NBg?eI>ʾC'B37uBtdC'BrBtdC{B37uBgz?7,>(ktdC{B37uBtdCBǝuB|CBq{B3hz?),>qjtdC{B37uB|CBq{BC'B37uBvep?8>]aC'B37uB|CBq{B2C'Bq{B70kkH>>`CBVHBCB¿NB9ƻCdBVHB^^>>CB¿NB0CdB¿NB9ƻCdBVHBW>>1CB(SB1CdBNB0CdB¿NBBdidi>y >CB¿NB1CB(SB0CdB¿NBi?>$|CBq{BtdCBǝuBtdCBq{BKf>!?1C-B¿NB1CSBJB!CSBVHB#1K=>?1C-B¿NB!CSBVHB0CdB¿NB\נ>>0CdB¿NB!CSBVHB9ƻCdBVHBS>>0CdB¿NB1CdBNB1C-B¿NBJeI>?!CSBVHB1CSBJB1CRBVHBM>/ ?&C'BS׍B^ȵCB"BCBS׍BiC^>?^ȵC'BB^ȵCB"B&C'BS׍B33{$> ?CaB BC'BȏB&C'BS׍B3&> ?CaB B&C'BS׍BGzCB B}I{>}?GzCB B&C'BS׍BCBS׍B~7C>?GzCB BCBBCaB BrG؛>#N ?^ȵCvBBӵCBB^ȵCBbBU,;>@$?ӵCBBC BS׍BCBЍBa2{>л)?^ȵCvBBC BS׍BӵCBB-<>y!?^ȵCvBB&C'BS׍BC BS׍B x?闕>ڔ?^ȵCvBB^ȵC'BB&C'BS׍BT05>?&C'BS׍BC'BȏBC BS׍B5N=>_>cCdBB^ȵCBbBӵCBB (>?^ȵCdB"B^ȵCBbBcCdBBpu> ?CBЍBCdBriBcCdBB'%R=>#h?ӵCBBCBЍBcCdBB֛z ??^ȵCBnBm]CSBnB^ȵCSBBV?rW?m]CSBnBCBBCSBxNBd~I ?:?^ȵCBnBCBBm]CSBnBE?{?^ȵCBnBcCdBBCBBv-@ ?1)?^ȵCBnB^ȵCdB"BcCdBBxV?W?cCdBBCdBriBCBB F?}"?^ȵCBv9BwCBv9B^ȵCBB#4&?= ?wCBv9BCf3BnBCBuB ? ?^ȵCBv9BCf3BnBwCBv9B??^ȵCBv9Bm]CSBnBCf3BnB5, ?x?^ȵCBv9B^ȵCSBBm]CSBnBr?r?m]CSBnBCSBxNBCf3BnBQ>??^ȵCAB}BCBBCABvB9ξ%?d%?^ȵCBBCBB^ȵCAB}B)?E?^ȵCBBwCBv9BCBv9B?a?^ȵCBBCBv9B^ȵCBB-t߾2?>?^ȵCBBCBv9BCBB:&?9 ?wCBv9BCBuBCBv9B Q||.?#|.?CBq{B^ȵCIBq{B^ȵCAB}BU>? ?CABvBCBq{B^ȵCAB}B3&> ?CaB BݶC'B BC'BȏB&M>1 $?ݶC'B BbCB@BbC'B(B&W2Ĭ>S"?CaB BbCB@BݶC'B B-H>\?CaB B`'CB@BbCB@B}7>m?CaB BCBB`'CB@Bp/{O>?`'CB@BbCBTBbCB@B >,?C BS׍BSCBS׍BCBЍBD>[%?SCBS׍BbC'lB BbCBǫB" p>-?C BS׍BbC'lB BSCBS׍B>(?C BS׍BݶC'B BbC'lB B0>?C BS׍BC'BȏBݶC'B B& ==>?ݶC'B BbC'B(BbC'lB B^g $?^?bCBS׍BCBЍBSCBS׍BN 4?~M?bCBS׍BbCdBBCBЍB™T,?=5?bCdBBCdBriBCBЍBK/ D?:?SCBS׍BbCBǫBbCBS׍B`5=?q2?CSBxNBbC3BBbCSB BjžO$?j)?CBBbC3BBCSBxNBž^O$?)?bC3BBCBBCdBriBѾ)?!?bCdBBbC3BBCdBriB9PU M?$+?CBuBbC"gBnBbCBӅB czC?G?CBBCBv9BbC"Bv9B4@?z"?bC"Bv9BCBv9BCBuBE:P( M?^+?bCBӅBbC"Bv9BCBuB}=J?T?bCBq{BCBq{BCABvBw,*X??bCABBbCBq{BCABvBh R>@o(?bCB@B1C'B@BbC'B(BK,`??1C'B@B/CQ*B/uB/C'B8.BtD&> ?bCB@B/CQ*B/uB1C'B@B?1?bCB@B׷CB/uB/CQ*B/uBq/ N>?bCB@BbCBTB׷CB/uB/վl ?8?bC'lB BDCB BbCBǫB;Y1?U?DCB B/C΢B@B/CBĒB ֥??bC'lB B/C΢B@BDCB Be ??'?bC'lB B1C'B@B/C΢B@BU]E>!?bC'lB BbC'B(B1C'B@Br ??1C'B@B/C'B8.B/C΢B@B.b/0?/?+?bCBS׍BCdBS׍BbCdBBUT??bC"gBnB/C?fBB/CBnBp eL??CSBB/CSB漊B/C?fBB> Ua?`>bCABB/C5BB/CABzB>9W?|y?bC׵BB/C5BBbCABB >^?/C5BBbC׵BB/CtBv9BNDW=FCW? ?bC׵BBbC"Bv9B/CtBv9BW%Q=R$Q? ?/CtBv9BbC"Bv9BbCBӅB;e\?5?/CBȅB/CtBv9BbCBӅBa>S?B]?/CBq{BbCBq{BbCABB>Ua?1_>/CABzB/CBq{BbCABB?8?/CQ*B/uBظC'B/uB/C'B8.B*>O?ܵ?/CBĒBCoB@BCBPB(>(>?9#?/C΢B@BCoB@B/CBĒB奾hA+?W@+?/C'B8.BظC'B/uBCB/uB楾A+?@+?/C'B8.BCB/uB/C΢B@B`G`G??/C΢B@BCB/uBCoB@Bml;|T?p?/CdBBCB BCdB B| D?`"?/CdB BCB B/CdBBl>A?n&?CB B/CdB B/CBĒB,=O??CBPBCB B/CBĒB ">PY??CSBBzICSBBCaBBd>L??/CSB漊BCaBBzICSBB>L??/CSB漊B/C BS׍BCaBBQLZ=QLZ??/C BS׍BCPBS׍BCaBBD=D?E#?CPBS׍B/C BS׍B/CdBBj;K}T?p?CdB BCPBS׍B/CdBB`)>J?`?Y>CB BCBv9BCftBv9B݄>kT?u>/CBȅBCftBv9BCBv9Bڄ>T?[o>/CBȅB/CBnBCftBv9B.jh>ʾZ?@>/CBnBCBnBCftBv9B">cQY??zICSBBCSBBCBnB">PY?e?zICSBBCBnB/C?fBBz\>_O?bk ?/C?fBBCBnB/CBnB>L? ?zICSBB/C?fBB/CSB漊BN>N?N>/CABzBC5Bq{BCABq{BO>dN?P>/CABzB/C5BBC5Bq{BzZ>3]?Z>/C5BBC>BBC5Bq{BM>H`??>CBv9BCB BC>BB+>0E`?>>CBv9BC>BB/CtBv9Bo>đS?ug>/CtBv9BC>BB/C5BB܄>WT?s>CBv9B/CtBv9B/CBȅBN>N?N>CABq{B/CBq{B/CABzB>X[?>CBPB%ʹCB@B%ʹCBAB=; P?3F?CoB@B%ʹCB@BCBPBg/= Y?C?%ʹCB@BCoB@B%ʹCB/uBGK?K??CoB@BCB/uB%ʹCB/uBǛ>žX?҅>%ʹCdBBS~CdBS׍B%ʹCgBS׍BZ>RK?L?CdB B%ʹCgBS׍BS~CdBS׍B[>K?"?CdB BCB B%ʹCgBS׍B|e>W?>CB B%ʹCB B%ʹCgBS׍BxmY>L??%ʹCB BCB BCBPBo>X[?>%ʹCBAB%ʹCB BCBPBG>P?Y>%ʹCSBFB좹CSBnB%ʹCBnB>$:H?>CSBB%ʹCBnB좹CSBnB>48H?>CSBBCaBB%ʹCBnBE>TS?ҧ>CaBB%ʹCXBB%ʹCBnB#Ǜ>+X?Ȅ>S~CdBS׍B%ʹCdBB%ʹCXBB[ɛ>X?5>S~CdBS׍B%ʹCXBBCPBS׍Bø>K?z>CPBS׍B%ʹCXBBCaBB[>K?,?S~CdBS׍BCPBS׍BCdB BI ?VL?|>%ʹCBa}B1CBB%ʹCBB?aF?<>CB B%ʹCBB1CBBΨ?$F?fR>CB BCftBv9B%ʹCBB>C`O?&>CftBv9B%ʹCUBv9B%ʹCBBZ> P?.>좹CSBnB%ʹCSBFB%ʹCUBv9BT>P?0>좹CSBnB%ʹCUBv9BCBnBg>F?>CBnB%ʹCUBv9BCftBv9B>9H?>좹CSBnBCBnBCSBBG ?FXL?z>1CBB%ʹCBa}B%ʹCBq{BJ ?MVL?|>1CBB%ʹCBq{BC>BBK?D?S>C>BB%ʹCBq{BC5Bq{BM?F?=>1CBBC>BBCB BdR>`?>MC'B5B #C'B/uBMC)HB/uBW>rV?:>MCBBMCB BMC#cB B>nRN?.>%ʹCBABMC#cB BMCB Be> RN?3>%ʹCBAB%ʹCB@BMC#cB B(>6S]?}>%ʹCB@BMCyB@BMC#cB BR>R`?> #C'B/uBMC'B5BMCyB@BYR>`?> #C'B/uBMCyB@B%ʹCB/uB5>PQ?\>%ʹCB/uBMCyB@B%ʹCB@B?mH?7>MCdBnpB ?CdBBMC.1BBk@?ZC??t>%ʹCdBBMC.1BB ?CdBB@?YC?u>%ʹCdBB%ʹCgBS׍BMC.1BB>TR? >%ʹCgBS׍BMCBS׍BMC.1BBS>2tV? >MCB BMCBBMCBS׍B-X>rV? >MCB BMCBS׍B%ʹCB B)>AG?d>%ʹCB BMCBS׍B%ʹCgBS׍Bu>*RN?>MCB B%ʹCB B%ʹCBAB?:?`F(?KC>MCSBv}BBmCSBBMCBB>&?S:?##]>MCBBCSBv9BMCxBv9B[6?$?>BmCSBBCSBv9BMCBBW ?o4?N)>%ʹCSBFBMCxBv9BCSBv9B ?p4?q'>%ʹCSBFB%ʹCBnBMCxBv9B "?D?|І>%ʹCBnBMCaBnBMCxBv9B?H?6> ?CdBBMCdBnpBMCaBnB?2H?7> ?CdBBMCaBnB%ʹCXBB?c%ʹCXBBMCaBnB%ʹCBnB@?:ZC?t> ?CdBB%ʹCXBB%ʹCdBBe+?i3?Dw>BmCSBB%ʹCBa}B%ʹCBB3?/0?<>MCSBv}B%ʹCBa}BBmCSBB2?\g-?at>MCSBv}B޹CBq{B%ʹCBa}BEY6?3-?V6>MCSBv}BMCBq{B޹CBq{B*?*3?Ӽ>CSBv9BBmCSBB%ʹCBBs#? 7?`>%ʹCUBv9BCSBv9B%ʹCBB@ ?o4?5)>CSBv9B%ʹCUBv9B%ʹCSBFB/?/?q>޹CBq{B%ʹCBq{B%ʹCBa}B8>b|W?~ߚ>tdC'BɒB%C'B@BtdC.B@B>N?B>MC'B5BtdC.B@B%C'B@B>N?g>MC'B5BMC)HB/uBtdC.B@BT>%[?>MC)HB/uBtdC$B/uBtdC.B@B/*?33?~>tdCB!B5CBBtdC7BB^?,G?H%B>tdC7BBCBS׍BtdCoBS׍B*?g3?(>5CBBCBS׍BtdC7BB?">?甲>MCBBtdCoBS׍BCBS׍B?\~>?ܙ>MCBBMC#cB BtdCoBS׍B2?O?Z>MC#cB BtdCnUB BtdCoBS׍B>{W?>%C'B@BtdC'BɒBtdCnUB Bt>N|W?>%C'B@BtdCnUB BMCyB@BXs?H?T>MCyB@BtdCnUB BMC#cB B>3N?>%C'B@BMCyB@BMC'B5B?`?D>?gtdCBq{BCdBBtdCK&BBj?0>lj<"CdBq{BCdBBtdCBq{BjO??g=tdCK&BBCdBv9BtdCBv9B]?f>!;&>CdBBCdBv9BtdCK&BB;'4?&4?46=tdCBv9BCdBnBtdCVBnB9H??>CdBv9BCdBnBtdCBv9B%?3?>5CBBMCdBnpBMC.1BBI,?y1?>tdCB!BMCdBnpB5CBB+?<0?V>tdCB!BCdBnBMCdBnpB/?/?q>tdCB!BtdCVBnBCdBnB#8(?y6?}#{>CBS׍B5CBBMC.1BBa?rA?,>MCBS׍BCBS׍BMC.1BB?%>? >CBS׍BMCBS׍BMCBB]>?#?>>MCSBv}BMCBBCdBBC>? #?>>MCSBv}BCdBBCSBq{BuY??B+YCdBv9BCdBBMCBB-1?,1?:Q>MCxBv9BCdBv9BMCBB/?/?q>CdBnBCdBv9BMCxBv9B/? /?8q>MCaBnBCdBnBMCxBv9Bx-?v-?C[>CdBnBMCaBnBMCdBnpBZY6?-?V6>CSBq{BMCBq{BMCSBv}Bf\y?؛=w2Z9ƻCBq{B2C'Bq{BCBB@z?> CBB2C'Bq{B ӻC'BBs?N>CBB ӻC'BB,CBv9B6s?h>,CBv9B ӻC'BBC'Bv9Be?M>ks1CBいB C'BnB1CWBnBLe?7J>cs1CBいB,CBv9B C'BnB6s?h>,CBv9BC'Bv9B C'BnBYT??n1CWBnBC'BB1CWBBzk?>lk= C'BnBC'BB1CWBnB4?4?Մ=1CWBBԻC'BS׍B1CABS׍BTQ? ?/>C'BBԻC'BS׍B1CWBB!?JC? >1CABS׍BהC'B B1CڭB B0?0?t\>ԻC'BS׍BהC'B B1CABS׍B]?>?p>tdC'BɒB1CڭB BהC'B B\?>?->tdC'BɒBtdC.B@B1CڭB Bl?wK?K>tdC.B@B1CB@B1CڭB BE?#O?Z>CB/uB1CBeB1CB@B?O?Y>CB/uB1CB@BtdC$B/uB ?miE?e>tdC$B/uB1CB@BtdC.B@B6t?^>k` 2C'Bq{B|CBq{B ӻC'BBGr?E> ӻC'BB|CBq{BCBBq?8>U ӻC'BBCBBC'Bv9Bf_f?,>zf0C'Bv9BCBv9B C'BnBR?? R= C'BnBCBv9BCBnB\2?k,?ru>tdCB!BtdC7BBC'BB:2?,?jzu>tdCB!BC'BBCBnBR??sR=CBnBC'BB C'BnB$5? 0?*>ԻC'BS׍BC'BBtdC7BB0?3?.>tdCoBS׍BԻC'BS׍BtdC7BBp/?/:2?Z>הC'B BԻC'BS׍BtdCoBS׍B?>? >tdCnUB BהC'B BtdCoBS׍Bn\?v>?>הC'B BtdCnUB BtdC'BɒBvi?y>CCBB|CBq{BtdCBq{B>`?H>CgtdCK&BBCBBtdCBq{B-`?>`CBnBtdCVBnBtdCB!B 5\? 5?׷CB/uB/CB՘B/CQ*B/uByA6??ظC'B/uBCt:BΩBC'B:ǗBξt+0?ω?/CQ*B/uBCt:BΩBظC'B/uBh?f&?/CQ*B/uB¸CBΩBCt:BΩB~) ? (?/CQ*B/uB/CB՘B¸CBΩBw ??¸CBΩBCBlBCt:BΩB<6?s?ظC'B/uBC'B:ǗBCB/uB;U?Ze ?C'B:ǗB%ʹCBΩB%ʹC'B4B'??$?Ct:BΩB%ʹCBΩBC'B:ǗB' 7?p.?%ʹCBΩBCt:BΩBCBlB3c3L??%ʹCBB%ʹCBΩBCBlB'B$ B?&?%ʹCB/uBCB/uBC'B:ǗBW3U?` ?%ʹC'B4B%ʹCB/uBC'B:ǗBD>M R? ?%ʹC'B4BMC)HB/uB #C'B/uBD>R?q ?%ʹC'B4B%ʹCBΩBMC)HB/uB=a?>%ʹCBΩBMC5BΩBMC)HB/uB==P?w?MC5BΩB%ʹCBΩB%ʹCBBg<]??MCBBMC5BΩB%ʹCBBED> R? ? #C'B/uB%ʹCB/uB%ʹC'B4B4>~[?>OCBΩBtdCBoeBtdC$B/uB䝤>}[?>OCBΩBtdC$B/uBMC5BΩB>R?j>MC5BΩBtdC$B/uBMC)HB/uBz>R?->OCBΩBMC5BΩBMCBBr?H?>CB/uBtdC$B/uBtdCBoeBO?WgԾ])C:B!B=-C~%B!B^ȵC~%BBO?kԾb)C:B!B^ȵC~%BBCZBs Bo?I5CZBs B^ȵC~%BB^ȵCZBBi ?*վm(=-C~%B!BC:B!BC~%B$Bq.?l;P.^ȵC8kBuB^ȵCB0BCBuB.?u0 /CBuB^ȵCZBB^ȵC8kBuB1?nY,CBuBCBB^ȵCZBB8#?~rACBBCZBs B^ȵCZBB2?j'ܕ2CC[BuBCBuB^ȵCB0BI2?k'w2^ȵC[BBCC[BuB^ȵCB0BˆO?Ck+CBBCC[BuBC[BBP5?)/CBuBCC[BuBCBBz?C?lн>C[Bj?BdC[BFABC^ȵC[B`>HBC^ȵC[B`>HB^ȵCBVHBCN?QF>^ȵCBVHBCBVHBC)vC[BB0CBuBCB& BEO?n=OCC[BuB0CBuBC[BB!?UpCBC0BUCB5BCB5B?ϿC?p>CB5B׵CB ;BC6B ;B+?и4?qʽ>UCB5B׵CB ;BCB5BP??A?T>dC[BFAB^ȵCB-C[Bj?B^ȵCB-C[Bj?B׵CB ;B^ȵCB-C[Bj?BC6B ;B׵CB ;Bo??A?S>dC[BFAB^ȵCpBFAB^ȵC[B`>HB)@0?H0>-C,BuB0CBuB^ȵCB*'B1?~>A,^ȵC,BהBC,BuB^ȵCB*'B}@G?:(>j澆CB& B3C,B!BCWuB!BBG?)> b澆CB& B0CBuB3C,B!Ba?n֨>ޯ0CBuBC,BuB3C,B!BeA?Y#?=CWuB!B#*C,BPH(BC/BPH(B^?>g6'=3C,B!B#*C,BPH(BCWuB!B*-?I~3?^>C/BPH(BеC,B.BC1B.B9?F?>#*C,BPH(BеC,B.BC/BPH(B?^t9?ۭ>UCB5B^ȵC,BJ:/B^ȵCB5BJ(*?+2?ֆ>CBC0B^ȵC,BJ:/BUCB5Bu&?1?;'>CBC0BеC,B.B^ȵC,BJ:/B_-?{2?j>CBC0BC1B.BеC,B.B?7?B>׵CB ;BUCB5B^ȵCB5B ?>?%>^ȵC$B ;B׵CB ;B^ȵCB5BG ?в=?>׵CB ;B^ȵC$B ;B^ȵCB-еC,B.B#*C,BPH(B^ȵCBPH(B)?l/?Y>^ȵCLB.BеC,B.B^ȵCBPH(BT(? D.?i>еC,B.B^ȵCLB.B^ȵC,BJ:/Bk%?bξ%C:B!BCZBs BCZB!B&?Sо$C~%B$BC:B!BCZB!B&?8Rо $C~%B$BCZB!BC~%BPH(BI?f C~%BPH(BCZB!B:DCZBPH(Bri?P :6žbC~%B3,B:DCZBPH(BbCZBЉ*BI?j C~%BPH(B:DCZBPH(BbC~%B3,Br3?b\s3qڶCB!BCZB!BCZBs B&6? 9q0CBBqڶCB!BCZBs BN?2=#CZB!BqڶCB!B:DCZBPH(B`?3}ɒ:DCZBPH(BqڶCB!BJCBPH(BNy?$b =ibCZBЉ*BJCBPH(BbCB|+Bk?Cƾ:DCZBPH(BJCBPH(BbCZBЉ*B$L?ϻ?6>bCB1?BRCBFABbC6BFAB=)? x.?>bC6BFABCBVHBbCBVHB??' ?>RCBFABCBVHBbC6BFAB7?17<2=׶C[B!BqڶCB!BCBBO?Tk(C[BB=׶C[B!BCBB`?^j`tJCBPH(B=׶C[B!B C[BPH(B \l?N>t]bCB|+B34C[B.BbC~B.B[l?>3]bCB|+BJCBPH(B34C[B.By?%J>`JCBPH(B C[BPH(B34C[B.Bgd?U>7bC~B.B`'C[B5BbCB5Bq?&>`q=34C[B.B`'C[B5BbC~B.BpD?9T?E$>bCB5B=׶C[B ;BbCB ;B(X?*>ި>`'C[B5B=׶C[B ;BbCB5B"!?2?I>RCBFABC[Bj?BCbCB1?BC[Bj?BRCBFAB+?h*?i*>bCB1?B=׶C[B ;BC[Bj?B:CD?.v?r>bCB1?BbCB ;B=׶C[B ;B"?,k3?7>CBVHBRCBFABCCBVHBCBVHBC'CB!B=׶C[B!BC[BBq6[?E>Y}CB& B'CB!BC[BBBk?ޑ\><=׶C[B!B'CB!B C[BPH(BBk?n>\ C[BPH(B'CB!B=׶CBPH(Bo?q|>R C[BPH(B=׶CBPH(B34C[B.B&+M?B?g+M>34C[B.B=׶CBPH(BCB.B2?_-?j>CBC0BCB5B`'C[B5B]2?_-?j>CBC0B`'C[B5BCB.BM$Q? ?,Q=CB.B`'C[B5B34C[B.B`1?+?M>=׶C[B ;B`'C[B5BCB5B-?-?]>C6B ;B=׶C[B ;BCB5B@+?;A+?>=׶C[B ;BC6B ;BC[Bj?BYAG?&>bi'CB!BCB& BCWuB!B^Z?>L=׶CBPH(B'CB!BCWuB!BhA?X#?<C/BPH(B=׶CBPH(BCWuB!B.@?&"?+/@>CB.B=׶CBPH(BC/BPH(B0?0?Z>C1B.BCB.BC/BPH(BU0?U0?qg>CB.BC1B.BCBC0Bf$Q?,Q ǚCZB.BC~%B.BbC~%B3,Bʼi?R 8žbCZBЉ*BǚCZB.BbC~%B3,B7'j?0j̾C~%B.BǚCZB.BC~%B5BPv? >ـgC~%B5BǚCZB.BʷCZB5Bv?Nh >vC~%B5BʷCZB5BC~%B ;Bīs?YJ>[JC~%B ;BʷCZB5BڷCZB ;Bi?>/C~%B@BڷCZBFAB/CrQBFABi?>A/C~%B@BC~%B ;BڷCZBFABXt?>C~%B ;BڷCZB ;BڷCZBFAB Y??\O/CrQBFABպCZBVHB/CKmBVHB+h?$>b>ڷCZBFABպCZBVHB/CrQBFABui?N>4ľzCB.BǚCZB.BbCZBЉ*By?\ =ȂibCB|+BzCB.BbCZBЉ*Biv?y>$gǚCZB.BzCB.BʷCZB5Bmt?!>TʷCZB5BzCB.BCB5B^t?!O>xʷCZB5BCB5BڷCZB ;B h?>~]=ڷCZB ;BCB5B}CB ;BS?x ?Wu+>bCB1?BbC6BFABڷCZBFABVS?x ?n+>bCB1?BڷCZBFAB}CB ;B-i?`Q>}CB ;BڷCZBFABڷCZB ;B9T?E ?:>պCZBVHBڷCZBFABbC6BFAB8,?8,?+[>bCBVHBպCZBVHBbC6BFAB]l?i{>%]zCB.BbCB|+BbC~B.B 'q?5ƥ>ߴCB5BzCB.BbC~B.B2d?6>5bCB5BCB5BbC~B.Bjd?i>=}CB ;BCB5BbCB5BD?T?޲$>bCB ;B}CB ;BbCB5BBD?v?3s>}CB ;BbCB ;BbCB1?Bi?>齤4C~%BFAB/C~%B@B/CrQBFAB9nj?->;C~%BVHB4C~%BFAB/CrQBFAB)Y?Ѱ?=Y/CKmBVHB;C~%BVHB/CrQBFAB+/#?tdC~%BA!BVC~%B!BtdC*kB!BL?_̼VC~%B!BOC~%BPH(BtdCBPH(BE4#? tdC*kB!BVC~%B!BtdCBPH(B@i? >OC~%BPH(BtdC~%B&)BtdCBPH(B? 1C~%BzNBC~%BuB1C,9BuB4!X?_1CZB( BtdC*kB!BCZB!B &\?~1C,9BuBtdC*kB!B1CZB( B%?R1C,9BuBtdC~%BA!BtdC*kB!B ~ ?E뾜1C,9BuBC~%BuBtdC~%BA!B1E1#?tdCBPH(BCZB!BtdC*kB!B^L?|CZBPH(BCZB!BtdCBPH(B%Ik ?>|CZBPH(B1CJB.B1CZB+Bm8 ~ ?l>tdCBPH(B1CJB.B|CZBPH(B-L(?>tdCBPH(BC~%B.B1CJB.B@2g?|>tdCBPH(BtdC~%B&)BC~%B.B%3l ?U>C~%B.B1C~%B4B1CJB.BSgh?" 1CZB( BCZB!B1C B!Bz4z4?,靽CZB!B|CZBPH(B1CzBPH(Bz4o{4?R락1C B!BCZB!B1CzBPH(BE#E#?>|CZBPH(B1CZB+B1CzBPH(B7V>f?>^ȵCZBF_BC,BzaBCZBg\B^5>_?>^ȵC{BzaBC,BzaB^ȵCZBF_B`=>~i?a>C,BzaB^ȵC{BzaBCjBdhB(6'=^?>^ȵC{BzaB^ȵCBdhBCjBdhBy5'=^?$>CjBdhB^ȵCBdhB^ȵC~%BkBPj?1>C~%BkBCjBdhB^ȵC~%BkB>P?r>CBMBUsCB¿NBC6HB¿NB >L?N>^ȵCBJSBC6HB¿NBUsCB¿NB>XL?>^ȵCBJSB^ȵC.B(UBC6HB¿NB>7W?>^ȵC.B(UBCB(UBC6HB¿NB7>d\?O>CB(UB^ȵC.B(UBCB=[B)؁>Z?Z>^ȵC.B(UB^ȵCzB=[BCB=[BW>\?>CB=[B^ȵCzB=[B^ȵCZBF_BV>f?W>CZBg\BCB=[B^ȵCZBF_B>P?t>UsCB¿NBCBMBCBVHB>xP?t>UsCB¿NBCBVHB^ȵCXB¿NBP>l)F?c>^ȵCXB¿NBCBVHB^ȵCBVHB3>L?>UsCB¿NB^ȵCXB¿NB^ȵCBJSB ?VEJ?b>bCZBPBiCZB(UBbC_B(UBE>HU?G}>bC_B(UBkCZB=[BbCB=[BV ?h8I?ջ>iCZB(UBkCZB=[BbC_B(UB>N?>CZBg\BbCB=[BkCZB=[B>N?蘮>CZBg\BC,BzaBbCB=[BQ>:g?IY>C,BzaBbCjBzaBbCB=[BIb>7h?c>.#C~%BdhBbC~%BhfBbCjBzaBc>m7h?&d>.#C~%BdhBbCjBzaBCjBdhB|Z>7]?Z>CjBdhBbCjBzaBC,BzaBe>`?ʅ>.#C~%BdhBCjBdhBC~%BkB;(?-?<>CBMBbCBVHBCBVHBI;(?̩-?:>CBMBC6HB¿NBbCBVHBi?{B?Hs>C6HB¿NBbCHB¿NBbCBVHB ?GJ?`>iCZB(UBbCZBPBbCHB¿NB ?EJ?a>iCZB(UBbCHB¿NBCB(UB?;?9>CB(UBbCHB¿NBC6HB¿NBV ?8I?b>kCZB=[BiCZB(UBCB(UB{>}P?[>CB=[BkCZB=[BCB(UBn>N?>kCZB=[BCB=[BCZBg\Bt;(?1-?S<>CBVHBCBVHBCBMBǹ:?| /?mպCZBVHBzCZB¿NB/CKmBVHB&?M7?>;C~%B(UBbCZBPBbC_B(UB3?1?)I!>/C~%ByPBbCZBPB;C~%B(UB;#1?-?~>/C~%ByPBzCZB¿NBbCZBPB8?j2-?H>/C~%ByPB/CZUB¿NBzCZB¿NBt*?l?C~%B=[B;C~%B(UBbC_B(UB??0J?"o>bCB=[B?C~%B=[BbC_B(UBx?Y-M?Ew$> C~%BzaB?C~%B=[BbCB=[B1?T?G>bCjBzaB C~%BzaBbCB=[BV?7$Q? ?> C~%BzaBbCjBzaBbC~%BhfBR0?R0?\>zCZB¿NBպCZBVHBbCBVHBN0?ʾ0?\>bCHB¿NBzCZB¿NBbCBVHBt/?o/?+|>zCZB¿NBbCHB¿NBbCZBPB&Y?o?;C~%B¿NB;C~%BVHB/CKmBVHB<:?/?x-?>;C~%B¿NB/CZUB¿NB/C~%ByPBa&1C0;CCN;CC0N;C{*d/+CN;CC@=C]C0=C( 2ӑC0N;CCN;C]C0=CM0 *EC@=CC'i ?CC0 ?C@],1M]C0=CC@=CC0 ?Cd7㧾ښCνTrCYJCb3CɾHCCɾHCeUYe ũb3C YJCb3CɾHCTrCYJCUn ^ChKCb3C YJCTrCYJCVK gb3CϵhKCb3C YJC^ChKC\@$֑CnHCCSYJCCYJC!Ff6 CSYJCCH-hKCChKC@M%|CYJCCSYJCChKCM4 *1qCbCCCCCsCCC#85)ZCCCC*ECׂC*ECa5+u WsCCCCCCׂC*EC`& PCz$GCC;z$GC&CɾHCvDQfCwɾHCCnHCCYJCB!CwɾHCCYJC&CɾHCG=E&CɾHCCYJCCYJCtKEyٴCJCChKCChKCJ"CJCCYJCChKCuWECYJCCYJCChKC+'1+TwCBP?CCz<@CNC<@C1O,NCz<@CCP@UBC>CUBCP1,[NC<@CCz<@C>CUBC4*-qCP@UBCCbCCsCCC/^2CF- 5sCP@UBCsCCC>CUBCå8yC)8SS>CUBCsCCCcCCCn>Ҳ$H9CDCׂC*ECCj*EC=?%[=CDCcCCCׂC*ECOc8)YcCCCsCCCׂC*ECQ>$< PCz$GCCj*ECׂC*ECպBQ *Cz$GCCj*EC PCz$GC<C &CɾHCCz$GC PCz$GCLGA.C,ɾHCCz$GC&CɾHC3GCYJCC,ɾHC&CɾHCILWCYJCC,ɾHCCYJCMLiAýCYJCCJCCYJC4)~~NC<@CC<@CC0fv?C1X+WڇCBP?CNC<@CC0fv?C2,CBP?CC0fv?CC0 ?C0{+]CBP?CC0 ?CC'i ?CD4f)an>CUBCC<@CNC<@CrG:$~pC2UBCC<@C>CUBCc;%}vVcCCCC2UBC>CUBC=i#RCιCCC2UBCcCCCJ>$>cCCCCDCCιCC33jw.k\ښCwzPiHCښCpRɾHCCwzɾHCyY:(:CښCpRɾHCښCYJCXCwzYJC Q4/ 9CwzɾHCښCpRɾHCXCwzYJCL=z'ښCYJCښChKC/CwzhKC;$)XCwzYJCښCYJC/CwzhKCN&5%gښCCCښCąCCċCCC--x2KoښCąCCښC*ECEC*ECn(7 fċCCCښCąCCEC*ECps2-lښC*ECښC/z$GCbCz$GCp. m3WEC*ECښC*ECbCz$GC=58+_ښC/z$GCښCwzPiHCCwzɾHC2;.`ښC/z$GCCwzɾHCbCz$GC8cy*LBbCz$GCCwzɾHCSCɾHC^@$ҏCnHCXCwzYJCCSYJC>#&yCnHCSCɾHCXCwzYJCy8*dA>SCɾHCCwzɾHCXCwzYJC @$/CwzhKCCSYJCXCwzYJCRB"pCH-hKCCSYJC/CwzhKC!{6gښC\?CښCrP<@C[C<@C.(2ښCrP<@CښCwqUBCCUBC#N9[C<@CښCrP<@CCUBCi//wċCCCCCCCbCC,.RښCCCċCCCCbCCn.P0}ښCCCCbCCCUBC=(2]ښCCCCUBCښCwqUBC//;oEC*ECCCCċCCCD 3*.1aC*ECCCCEC*ECB3x$.=]bCz$GCC*ECEC*ECt8Q)MC;z$GCC*ECbCz$GC>8C*'BSCɾHCC;z$GCbCz$GC#=F%-&JrSCɾHCCnHCCwɾHCx(V3J[C<@CCz<@CCBP?Cr*"5ښC\?C[C<@CCBP?CF$)6hښC\?CCBP?CC ?C >6ϠښC\?CC ?CښC ?CB(J3]CUBCCz<@C[C<@CVD,z1CP@UBCCz<@CCUBCU,2e{CUBCCbCCCP@UBC6'(3C ?CCBP?CC'i ?C,^Ǯb3CϵhKCb3C̓MCݿC0MCB[_n) C0hKCb3CϵhKCݿC0MCT_䎼b3C̓MCb3C (OC+ۿC0(OCB^+,|%ݿC0MCb3C̓MC+ۿC0(OCn.c5Vb3C (OCb3C]fVPC޿C0VPCV_"āl<+ۿC0(OCb3C (OC޿C0VPCc?뾕 =b3C]fVPCb3C>s\RCtC0\RCcc =޿C0VPCb3C]fVPCtC0\RCeISᾑ=b3C>s\RCb3CSSCC0SCb1g=tC0\RCb3C>s\RCC0SC'gھ%j=b3CSSCb3CșDUCC0DUC2Oe"u=C0SCb3CSSCC0DUC>Ci0UϾ=b3CșDUCb3CQ2+WCC0+WCfPپp=C0DUCb3CșDUCC0+WCoiʾ<=b3CQ2+WCb3CXC-C0XChξ=C0+WCb3CQ2+WC-C0XChPeIChKCCpMCCMCKNChKCChKCCMCTBOCpMCC۰(OC4C(OCQQw1CMCCpMC4C(OCrW $C۰(OCCVPC CVPC>T 4C(OCC۰(OC CVPC?Z:fǼCVPCC>\RC0C\RCWu T@ CVPCCVPC0C\RC[C>\RCC>SCcCSC%Z(;0C\RCC>\RCcCSCz]â<C>SCCDUCGCDUC1[|>=cCSCC>SCGCDUCua+<CDUCC(+WCC+WC]^%=GCDUCCDUCC+WCau=C(+WCCDXCCXCQa%=C+WCC(+WCCXCRvChKCCMC^ChKCW &CMCTCMC^ChKCW 7CMC4C(OCTCMCZ2x44C(OC*OC(OCTCMCGZ\,4C(OC CVPC*OC(OC![R碼 CVPCiJCVPC*OC(OC=[VC CVPC0C\RCiJCVPCL`I<0C\RCQC\RCiJCVPCf`*fS;0C\RCcCSCQC\RC1bs\RCb3C]fVPCQC\RC['bz<(XCSCb3C>s\RCQC\RCeTᾃ=b3CSSCb3C>s\RC(XCSCe*5ᾤO=cCDUCb3CSSC(XCSC'gھ9j=b3CșDUCb3CSSCcCDUCfپ*z=AsC+WCb3CșDUCcCDUC-hҾB=b3CQ2+WCb3CșDUCAsC+WCzh\Ҿpz=CXCb3CQ2+WCAsC+WClmjiǾQ=b3CXCb3CQ2+WCCXCOdGCwzARCC \RCCwz\RCnQĺ}C \RCCdSCpCwzSCɦO}Cwz\RCC \RCpCwzSCPT f'CdSCCYDUCCwzDUCdQypCwzSCCdSCCwzDUCH&X#+ gۺCYDUCC+WCCwz+WCU:G:CwzDUCCYDUCCwz+WCX& CSCpAC\RCV= pCwzSCCwzDUC>CSCI#Zf:CSC&Z%ڽ:CwzDUCCwz+WCACDUC/[;hLͼC>\RCCVPCpAC\RCvSXF+>CSCC>\RCpAC\RCZC>SCC>\RC>CSC-ZZd;SC>CSC].V<CDUCC>SCACDUCv]Hp3<C(+WCCDUCEC+WC[l_3Q=lNCXCC(+WCEC+WC+bD뾂8r=CDXCC(+WClNCXC?H&DښCLNCښC(OC)CL(OC D="9xɽښC(OCښC0VPCzCLVPCJ@9'Oý)CL(OCښC(OCzCLVPCGT2ښC0VPCښC\RCmeCL\RC5jD"'szCLVPCښC0VPCmeCL\RClOI!rښC\RCښC SC SCLSC9HE~meCL\RCښC\RC SCLSCM>ښC SCښCDUCJCLDUCZI^ # SCLSCښC SCJCLDUCkO_AښCDUCښCY+WC]DCL+WC9M;ϼJCLDUCښCDUC]DCL+WCs#Qߠ;ښCY+WCښC"XCcHCLXCr/OON<]DCL+WCښCY+WCcHCLXCXA~E#ښChKCښCyMC> CwzMCE*>(Ro/CwzhKCښChKC> CwzMCCS!ښCyMCښCLNC)CL(OCiA#NF ښCyMC)CL(OC> CwzMC>ZFFSٽ> CwzMC)CL(OC%Cwz(OCFLɽ)CL(OCzCLVPC%Cwz(OCgHszCLVPCCwzVPC%Cwz(OCZLhyLCwzARCmeCL\RCC \RCɂL%nyPCwzARCCwzVPCmeCL\RCaH)áCwzVPCzCLVPCmeCL\RCFL5tf SCLSCC \RCmeCL\RCQCdSCC \RC SCLSCOQ]1*JCLDUCCdSC SCLSCSlCYDUCCdSCJCLDUCSռ]DCL+WCCYDUCJCLDUCV ޺C+WCCYDUC]DCL+WCV ݆ CwzMCCH-hKC/CwzhKC~qFsCMCCH-hKC> CwzMCF Lٽ%Cwz(OCCMC> CwzMCJIl`ƽC(OCCMC%Cwz(OCJmmYCwzVPCC(OC%Cwz(OCNcCVPCC(OCCwzVPC"OhSCwzVPCCwzARCCVPCiܰʾp=b3CXCb3C0w,YC-C0XC0eྏe=CDXCC&2`ZCC2`ZCɑaW@=CXCCDXCC2`ZCdyMྌ =C&2`ZCC+ [CC2`ZCgQվ=CXCC2`ZCCXCig־=C2`ZCC2`ZCCXC $g<־t=C+ [CC [CܮC[Cfn־(=C+ [CܮC[CC2`ZC7gվO=C2`ZCܮC[CC2`ZC0j~Ǿ=C [CCє]C@Cє]C=f#.վm>ܮC[CC [C@Cє]Cj5>>Cє]CCo!/_CqC!/_C.hPƾ2>@Cє]CCє]CqC!/_CBMjP7>Co!/_CCH_CqC!/_Cuiʾ:=b3CXCDC02`ZCb3C0w,YCEjǾ7=b3CXCCXCDC02`ZCWl(Կ6=CXCC2`ZCDC02`ZCyk_=C2`ZCܮC[CDC02`ZC=l2E\=ܮC[C_C0[CDC02`ZCYlշ! >ܮC[C@Cє]C_C0[CYleӷ >@Cє]Cx}C0є]C_C0[C8k^+>@Cє]CqC!/_Cx}C0є]C8k^+>qC!/_CC0!/_Cx}C0є]CmT>CH_CCq p`CC0p`C+mqe>CH_CC0p`CqC!/_C]j72>qC!/_CC0p`CC0!/_C+iCߵK>Cq p`CCcbCqC0cbCl;>C0p`CCq p`CqC0cbChO6`>CcbCC0bCqC0cbCW JG=C%sXCCwzZCCwzXC^@vI=CwzZCCC2`ZC[C2`ZC|^`M=CwzZC[C2`ZCCwzXC]!Xb=CwzXC[C2`ZClNCXC`69`ۇ=CC2`ZCC"}[CnC[C ^]蕧=[C2`ZCCC2`ZCnC[Ctb" =C"}[CC є]CiCє]CZ_k=nC[CC"}[CiCє]COcbDS=C є]CC~!/_C C!/_C(kaj龺E>iCє]CC є]C C!/_C9bh㾭>C~!/_CCp`C2Cp`C b(Q澽C > C!/_CC~!/_C2Cp`C@aNι7>Cp`CC&aC2Cp`CbMUg=[C2`ZCCDXClNCXC-ePྯl=C&2`ZCCDXC[C2`ZCfe ݾ=C&2`ZC C[CC+ [CRd^=C&2`ZC[C2`ZC C[Chf!ھ =[C2`ZCnC[C C[C fǟپoE=nC[CiCє]C C[Cec۾P=iCє]CP%Cє]C C[Ce ۾iCє]C C!/_CP%Cє]Cgelؾ > C!/_CGDC!/_CP%Cє]Caegؾ8J > C!/_C2Cp`CGDC!/_Cfj6;^%>2Cp`CiCp`CGDC!/_C$e}Ͼ>>>C&aCClcbCCcbCeξ ;>C&aCCcbC2Cp`C 0f;̾6>2Cp`CCcbCiCp`Cg&ž1>ClcbCCWcCCcCGezϾ%?>CcbCClcbCCcCf7ľ+ M>CWcCCdCCcC#gS־u= C[CC [CC+ [Cgվp=P%Cє]CC [C C[Cvi4ʾGDC!/_CCє]CP%Cє]Ci5¾b>Co!/_CCє]CGDC!/_Ci>Co!/_CCp`CCH_Cie>Co!/_CGDC!/_CCp`CԅhUž&>GDC!/_CiCp`CCp`Cgľ7>iCp`CCcbCCp`C|hg[_M>CcbC:?CcbCCp`C-iw! C>CcbCCcC:?CcbCvh#Խ =>CcCiCcC:?CcbC[iO>CdCC,A^eChC^eC"iGO>CdChC^eCCcCeg^>CcChC^eCiCcClw} >Cp`CCq p`CCH_CjjFDO>:?CcbCCq p`CCp`C.iW۵8K>CcbCCq p`C:?CcbCh-`>CcbC C0cCC0bCh.`>CcbC:?CcbC C0cCb&mᦾ9A>:?CcbCiCcC C0cC}kb>iCcChC^eC C0cC}kb>hC^eC9RC0^eC C0cC^TI;ښC"XCښCq2`ZCMCL2`ZCQeښC!/_CښCL|`C5CL!/_CV VJ=C%sXCCwz2`ZCCwzZCV] J=C%sXCcHCLXCCwz2`ZC8YښCL|`CښC'p`C[.Cwzp`C](F]>ښCL|`C[.Cwzp`C5CL!/_C](5]>5CL!/_C[.Cwzp`CCwz!/_CU_xQ >ښC'p`CښCEcbCQCwzcbC]]J >[.Cwzp`CښC'p`CQCwzcbC_(K>ښCEcbCښC$cCvCwzcC ^jD>QCwzcbCښCEcbCvCwzcC]I>ښC$cCښCwzBeCvCwzcC Y\hO=Cwz2`ZCCC2`ZCCwzZCf&\2?$=sCwz[CCC2`ZCCwz2`ZCf_Gى=C"}[CCC2`ZCsCwz[Cq^!a=-Cwzє]CC"}[CsCwz[C`=C є]CC"}[C-Cwzє]C,_a =Cwz!/_CC є]C-Cwzє]Coa꾡=C~!/_CC є]CCwz!/_C?a߇ >[.Cwzp`CC~!/_CCwz!/_C7a龗 >Cp`CC~!/_C[.Cwzp`CK`m6:>Cp`CCcbCC&aClh_U辣G:>Cp`C[.Cwzp`CCcbCcWܾ>[.Cwzp`CQCwzcbCCcbC5c=ܾ >QCwzcbCvCwzcCCcbCxdԾ2>vCwzcCCcCCcbCbվxM>ښCwzBeCښC22^eCCC^eCb$վlM>ښCwzBeCCC^eCvCwzcCcӾH>vCwzcCCC^eCCcC%erϾ =>>CcbCClcbCC&aCeϾbr3>CcCClcbCCcbCIUf˾mt7>CWcCClcbCCcCe<ʾtS>CWcCIC^eCCdC2eʾJtS>CWcCCcCIC^eCnfƾ~J>CcCCC^eCIC^eChzoDV>IC^eCC,A^eCCdCμhsR;~`>C,A^eCC(Q2gCC2gC/h+`>hC^eCC,A^eCC2gCdf䳾>C(Q2gCCZ@gCC2gC(~k@b>hC^eCC2gC9RC0^eC l+">C2gC6C02gC9RC0^eC!jB&>CZ@gCCˮhC%C0hCjG>CZ@gC%C0hCC2gCymH^t>C2gC%C0hC6C02gCiyVܾ>CˮhCC0&iC%C0hCem4˾E>ښC22^eCښC2gC_uC2gCL/b_dվZ>CC^eCښC22^eC_uC2gC!ePʾ@sS>ښC2gCښCwhC_uC2gC{ebž^>CC^eC_uC2gCIC^eC ežd^>_uC2gC C2gCIC^eC+6h6mN>ښCwhCښC2hCPChCg蟽U>ښCwhCPChC_uC2gCeU>žf>_uC2gCPChC C2gCaiJS[>ښC2hCښC*\MgjC'CMgjC2fPChCښC2hC'CMgjChY*h>ښC*\MgjCښCkC'CMgjCΖg9 L`> C2gCC,A^eCIC^eC h;᷾c>C(Q2gCC,A^eC C2gC+f\kG>C(Q2gCChCCZ@gCj*fzdF>C(Q2gC C2gCChCik> C2gCPChCChCsi֪n>PChC'CMgjCChC#jj>'CMgjC=CMgjCChClXbg>ښCkCښC}lC5rClCk`@k>ښCkC5rClC'CMgjCkQKp>'CMgjC5rClC=CMgjC (kyx>ښC}lCښCW5mC5rClCF$j_>ChCCˮhCCZ@gCiUO>CˮhCC0MgjCC0&iCLiMU>CˮhCChCC0MgjC̘lw咾 >ChC=CMgjCC0MgjCmw#r>=CMgjC5rClCC0MgjCGmH>5rClC9C0lCC0MgjCpIleu~>ښCW5mCښCJmCvC0mCp>Jlw~>ښCW5mCvC0mC5rClC9m@7>5rClCvC0mC9C0lC$og7kC>ښCJmCښC0˟nCvC0mCؾո6ښC`9 }$CښCH{%C}C`9 {%Co=O[ln;fCW&/C;fCؾ,"0CGCW&"0C2R;fCؾ,"0C;fCC9qN2C CW&qN2CdPx+WwGCW&"0C;fCؾ,"0C CW&qN2CH} cf;fC`9 -C;fC-CQC`9 -C%PcC蓾;fC-C;fC/C C`9 /CK59 xQC`9 -C;fC-C C`9 /C)Q8N;fC/C;fCW&/CGCW&"0CZQyL;fC/CGCW&"0C C`9 /C0U7|} C`9 /CGCW&"0C;C`9 "0C0U7|}GCW&"0C CW&qN2C;C`9 "0Cc,\-/V CW&qN2CƛC`9 qN2C;C`9 "0C=ɣxb3CD(Z1Cb3C\]qN2CCD(ZqN2C<_4 5b3CM@ /Cb3C@/C.0CM@/C7w=us^b3C@/Cb3C fS^CW&/C.0CM@/CտCM@"0CḪ `᏾TCM@qN2C;fCؾ,"0CտCM@"0CN;fCC9qN2C;fCؾ,"0CTCM@qN2Cj1q<Ǿb3C`9 )Cb3Cj-J*C C`9 J*C+9&Q(b3Cj-J*Cb3C%"4+CC`9 4+CKB58 C`9 J*Cb3Cj-J*CC`9 4+CMA!CW&-C;fC-C;fC`9 -CD"%CPK\/CCfk"0C~CD(Z"0Cp((SMqCD(Z/CCPK\/C~CD(Z"0C2|!C:sqN2Cb3C\]qN2Cb3CD(Z1C0 !qC:s1CC:sqN2Cb3CD(Z1C1" C:s1Cb3CD(Z1C~CD(Z"0C. #C:s1C~CD(Z"0CCfk"0C)s_#ʾCM@4,CCUM-CaCM@-C`.ο"칾qCD(Z/Cb3C@/Cb3CM@ /C,vz!þCD(Z~.CqCD(Z/Cb3CM@ /C-6@#CD(Z~.Cb3CM@ /CaCM@-Ct*$P.CD(Z~.CaCM@-CCUM-CQ-a=""~CD(Z"0Cb3C@/CqCD(Z/C~Q5b3C 7 )þCD(Z~.CrCD(Z-CC_c-C^3˾CD(Z~.CC_c-CCPK\/Ce,׾CPK\/CC_c-CCXcs/C0a;HC:s"0CCXcs/CC:s8%/Cz5*HtӾHC:s"0CCfk"0CCXcs/C&dD.P;Cfk"0CCPK\/CCXcs/CS!-mHC:s"0CC:s1CCfk"0Cד 3^1CM@.*CC AJ*CcCM@J*C'14澲C AJ*CCbLR4+CCCM@4+C-d +49cCM@J*CC AJ*CCCM@4+C# -־rCD(Z-CCUM-CCM@4,C!mV/h꾲CD(ZӞ,CrCD(Z-CCM@4,C*:1׾CD(ZӞ,CCM@4,CCCM@4+C&D0CD(ZӞ,CCCM@4+CCbLR4+Cr.N̾rCD(Z-CCD(Z~.CCUM-C-ʘ.CW&B'CC/(CsCW&(C! /`cCM@J*CCl,J*CCW&)C=g ]-CM@.*CcCM@J*CCW&)C.ᄇCM@.*CCW&)CsCW&(Ci0CM@.*CsCW&(CC/(C# /'dCCM@4+CCl,J*CcCM@J*C h+ᾊCN=4+CCl,J*CCCM@4+C0,^ݾCCM@4+CCM@4,CCN=4+Cx(1y6C`9 e%CCF'C'C`9 F'Ct"*.9sCW&(CC@(CC`9 r'CE/]CW&B'CsCW&(CC`9 r'C 8p2 뾲CW&B'CC`9 r'C'C`9 F'C'@19CW&B'C'C`9 F'CCF'C"g*.;sCW&(CCW&)CC@(C1;jښCr/CښC"0C{[CN;CAC=CztC=CO OJ;fC=C̿C ?C;fC ?C1BO `@O;fC=CztC=C̿C ?CrLcsF]ztC=CAC=C̿C ?C^@dEb3C:s5Cb3Cw5CC:s5CfE|b3Cw5Cb3C`7CؿC:s`7CVAv(lC:s5Cb3Cw5CؿC:s`7C*FY'Շb3C`7Cb3Ce8C*C8C#F.ڇb3C`7C*C8CؿC:s`7CH~ؿC:s`7C*C8CC:s8CO~[ f;fC:sp:CtCQ:C;fCguQ:COw[ f;fC:sp:CC:s8CtCQ:C>H0C:s8C*C8CtCQ:C6,O mCN;C;fCguQ:CtCQ:CtQ8pb;fC| N;C;fCguQ:CCN;CQ`ztC=C;fC| N;CCN;CIRx]];fCTT=C;fC| N;CztC=CS|SztC=C;fC=C;fCTT=C՟D ޔb3C\]qN2Cb3Cznj3CҿCD(Z3C@jCD(ZqN2Cb3C\]qN2CҿCD(Z3CDGGb3Cznj3Cb3C:s5CC:s5CDYKIb3Cznj3CC:s5CҿCD(Z3C4GG0ҿCD(Z3CC:s5CFCD(Z5C`L% t;fCD(Zu6CؿC:s`7C;fC2^`7CH MB z;fCD(Zu6CFCD(Z5CؿC:s`7C2HGFCD(Z5CC:s5CؿC:s`7CL N C:s8C;fC2^`7CؿC:s`7C qNΞ NM|;fCj8C;fC2^`7CC:s8COY )fC:s8C;fC:sp:C;fCj8C*KO R;fCM@,3CҿCD(Z3C;fCcF3CU+K6O L;fCM@,3CTCM@qN2CҿCD(Z3CgGyo2"TCM@qN2CCD(ZqN2CҿCD(Z3C'J( ?FCD(Z5C;fCcF3CҿCD(Z3CPdM);fCR5C;fCcF3CFCD(Z5CPyW[FCD(Z5C;fCD(Zu6C;fCR5CMX%TCM@qN2C;fCM@,3C;fCC9qN2C5V%yDC^d;CCoN;CC^N;C0;X CoN;CC=CC^=C61&3C^N;CCoN;CC^=C-?T{C=CC ?C5eC^ ?C= "nmC^=CC=C5eC^ ?C@2u'?C.7CC;8C!C8CuK8"`5C;8CC+Q:CCQ:CK3)!!C8CC;8CCQ:C5Q%GC+Q:CC^d;CC^N;Cp8˾"ލC+Q:CC^N;CCQ:CM<0 ꄾCQ:CC^N;CxBCN;CM#BPtb3CIb3CQ:Cb3Ch8CCQ:C,>]xBCN;Cb3CQ:CCQ:CA肾b3C[N;Cb3CQ:CxBCN;CTBrUzz{xBCN;Cb3CIeӑb3C`7Cb3Cw5CvC`7C|>vC`7Cb3Ce8Cb3C`7Cd2{!!IJpC:s3Cb3C\]qN2CC:sqN2CA(=Gb3Cznj3Cb3C\]qN2CJpC:s3C&}=JpC:s3Cb3C:s5Cb3Cznj3C7#>3'^,3C`7CC5CC5C..`(yC:`7CC5C3C`7C.(ޢ3C`7CC.7CC:`7Cd"-Ȗ5C3CC[yqN2CCqN2C &F+QCy3CC[yqN2C5C3Cn'5-d65C3CC4CCy3C5-19ľښC^u5CښC`7CC^`7Cz}o80C08CC(8CC^@!8C:rS70ښC08C0C08CC^@!8CD[[8ښC08CC^@!8CC^`7C>9:XښC08CC^`7CښC`7C+YA7Nj!C0Q:CC(8C0C08Cu5C攨Q:CC(8C!C0Q:CL5=T!C0Q:CC0;CC攨Q:C "9QϾښC2CښCd3C C3C<C14C C3CښCd3Cx;p,C14CښCd3CC%5CGW9pľC%5CښCd3CښC-5C$9#ľC^`7CښC-5CښC^u5C@3ɾC^`7CC`7CښC-5CFZ:JC`7CC%5CښC-5Czj18άC^`7CC^@!8CC`7C%\67Ҿ C3CښCl/qN2CښC2C4RKվ C3CCV3CښCl/qN2C ;7(þ C3CC14CCV3Czjqї㑯˽CW&ʺ?C˽C$+<@CCCW&<@CsA̰˽C$+<@C˽CP2UBCCW&UBCuq񬤾>CCW&<@C˽C$+<@CCW&UBCtᑾz˽CP2UBC˽C&E8CCtCW&CC~tҔSmCW&UBC˽CP2UBCtCW&CCvh ˽C&E8CC˽Cє;*ECCW&*EC LuTtCW&CC˽C&E8CCCW&*EC: wх/˽Cє;*EC˽Cʍ=z$GCĚCW&z$GCvTyqCW&*EC˽Cє;*ECĚCW&z$GC wcυ<˽Cʍ=z$GC˽Cє;ɾHC CW&ɾHC5 wхRӤ<ĚCW&z$GC˽Cʍ=z$GC CW&ɾHCxuxO5=˽Cє;ɾHC˽Cq6YJCݫCW&YJCv%v= CW&ɾHC˽Cє;ɾHCݫCW&YJC6x#s"s=˽Cq6YJC˽C3|0hKCCW&hKCwwcv=ݫCW&YJC˽Cq6YJCCW&hKCr sf˽C$ ?C˽CW&ʺ?CCCW&<@Ctʆr˽C$ ?CCCW&<@C,C`9 ?CYv ؉-d,C`9 ?CCCW&<@CʆC`9 <@Cu.CCW&<@CCW&UBCʆC`9 <@C7w;CW&UBCiyC`9 UBCʆC`9 <@C2HwqpCW&UBCtCW&CCiyC`9 UBC y:iGytCW&CCprC`9 CCiyC`9 UBC5yiNi©tCW&CCCW&*ECprC`9 CCyK`;CW&*ECpC`9 *ECprC`9 CCXygH`XCW&*ECĚCW&z$GCpC`9 *EC{vHP<ĚCW&z$GCqC`9 z$GCpC`9 *EC{Gy<ĚCW&z$GC CW&ɾHCqC`9 z$GCM{|4t$= CW&ɾHCGzC`9 ɾHCqC`9 z$GC{J4my{= CW&ɾHCݫCW&YJCGzC`9 ɾHCu {BF@=ݫCW&YJCC`9 YJCGzC`9 ɾHCezn`B@=ݫCW&YJCCW&hKCC`9 YJC@{3}Ǡ=CW&hKCC`9 hKCC`9 YJC)bn`uC:sACC͌uUBC둾C:sUBCK=gx׾C͌uUBCCzCC~C:sCCc.j辀 둾C:sUBCC͌uUBC~C:sCC!Bh&ӾCzCCC*EClC:s*ECagjA׾%碽~C:sCCCzCClC:s*EC[Zj˾tC*ECC*z$GCTaC:sz$GChӾOlC:s*ECC*ECTaC:sz$GCW"lľmC*z$GCCo2ɾHC[C:sɾHCGj̾Y=]\C:sYJCCo2YJCdC:shKCh;Ҩ Cee ?CCVm<@CSCD(Z<@C[peھyoCD(Z ?CCee ?CSCD(Z<@CFhC; CVm<@CC:sAC둾C:sUBCFh@D;CVm<@C둾C:sUBCSCD(Z<@CikPǽSCD(Z<@C둾C:sUBC'>CD(ZUBC!l둾C:sUBC~C:sCC'>CD(ZUBC&Kkoľ~C:sCCa)CD(ZCC'>CD(ZUBCk8ľ%ե~C:sCClC:s*ECa)CD(ZCCjnoKlC:s*ECnCD(Z*ECa)CD(ZCCWn^j?AUlC:s*ECTaC:sz$GCnCD(Z*ECqsRTaC:sz$GCNCD(Zz$GCnCD(Z*EC5qޞ$TaC:sz$GC[C:sɾHCNCD(Zz$GCq~\[C:sɾHCCD(ZɾHCNCD(Zz$GCqoȧe;[C:sɾHC]\C:sYJCCD(ZɾHC>Gs{ߞ/<]\C:sYJC`CD(ZYJCCD(ZɾHC,s͞=]\C:sYJCdC:shKC`CD(ZYJC,s͞=dC:shKC!CD(ZhKC`CD(ZYJCk:foCD(Z ?CSCD(Z<@CCM@ ?CPnzOkؽSCD(Z<@C4CM@<@CCM@ ?C=nqSɽSCD(Z<@C'>CD(ZUBC4CM@<@Cm굾7н'>CD(ZUBCCM@UBC4CM@<@CR n'>CD(ZUBCa)CD(ZCCCM@UBCp'a)CD(ZCCCM@CCCM@UBC5qUMa)CD(ZCCnCD(Z*ECCM@CC3q4nCD(Z*ECQ׽CM@*ECCM@CCqϞWnCD(Z*ECNCD(Zz$GCQ׽CM@*EC[VrWZ챼NCD(Zz$GCҽCM@z$GCQ׽CM@*ECjXr祿NCD(Zz$GCCD(ZɾHCҽCM@z$GCLuU"<CD(ZɾHCֽCM@ɾHCҽCM@z$GCDue<CD(ZɾHC`CD(ZYJCֽCM@ɾHC)u=`CD(ZYJC޽CM@YJCֽCM@ɾHC'u# =`CD(ZYJC!CD(ZhKC޽CM@YJCvЀae=!CD(ZhKCCM@hKC޽CM@YJCiq˽CW&ʺ?C4CM@<@C˽C$+<@CxFq&˽CW&ʺ?CӽCW& ?C4CM@<@CEIo𦭾BٽӽCW& ?CCM@ ?C4CM@<@CqJUuӽCM@UBC˽C$+<@C4CM@<@C'er؝绽˽CP2UBC˽C$+<@CCM@UBCr$s)CM@CC˽CP2UBCCM@UBCns̈́˽C&E8CC˽CP2UBCCM@CCas26Q׽CM@*EC˽C&E8CCCM@CCuP˳˽Cє;*EC˽C&E8CCQ׽CM@*ECuyҽCM@z$GC˽Cє;*ECQ׽CM@*ECKv-=\˽Cʍ=z$GC˽Cє;*ECҽCM@z$GCLv=9<ֽCM@ɾHC˽Cʍ=z$GCҽCM@z$GC`vy{<˽Cє;ɾHC˽Cʍ=z$GCֽCM@ɾHCvj{=޽CM@YJC˽Cє;ɾHCֽCM@ɾHCUjx`bs1=˽Cq6YJC˽Cє;ɾHC޽CM@YJCAx9sf=CM@hKC˽Cq6YJC޽CM@YJC*xʑnn=˽C3|0hKC˽Cq6YJCCM@hKCyzr᝾qӽCW& ?C˽CW&ʺ?C˽C$ ?CVZ} ;fCBC;fCfڕCC@PCCC[6H;fCfڕCC;fC6*EC"4C*ECwZ' @PCCC;fCfڕCC"4C*ECl^%|Ž;fC6*EC;fC~z$GCCz$GC6|\1$Ӱ"4C*EC;fC6*ECCz$GCAjbB1;fC~z$GC;fCmɾHCCɾHC_aUrNCz$GC;fC~z$GCCɾHCc$;fCmɾHC;fCaYJC CYJCb)tCɾHC;fCmɾHC CYJC,e2.ᾦ;fCaYJC;fChKC6 ChKC]c@ CYJC;fCaYJC6 ChKCǙWvF(;fC ?C;fC(<@CC<@C+IV^#DC ?C;fC ?CC<@CX]lI,;fC(<@C;fCUBC6CUBCX'` C<@C;fC(<@C6CUBC^;fCUBC;fCBC@PCCCy^(;fCUBC@PCCC6CUBCM^p6CUBC@PCCC߾CCCp^*m@PCCC"4C*EC߾CCC`bg'꾢"4C*ECʾC*EC߾CCCZ~bCF꾲"4C*ECCz$GCʾC*ECve ߾gzCz$GC Cz$GCʾC*ECft+߾wTCz$GCCɾHC Cz$GC(fܾ4;CɾHCCɾHC Cz$GCfܾ2CɾHC CYJCCɾHCiо CYJCCYJCCɾHCiо CYJC6 ChKCCYJC€kȾ<6 ChKC۴ChKCCYJC:]Z|&)DC ?CC<@CԾC:s ?C 1_K7C<@C(C:s<@CԾC:s ?Cr`ōC:sAC6CUBCC͌uUBC8`#쾧C:sAC(C:s<@C6CUBC_ (C:s<@CC<@C6CUBCc`뾴߾CCCC͌uUBC6CUBCP9fB۾3cCzCCC͌uUBC߾CCCf$۾7ĽʾC*ECCzCC߾CCCpBhR%ӾC*ECCzCCʾC*EC"huӾ(} Cz$GCC*ECʾC*ECphtӾ.}C*z$GCC*EC Cz$GC!hϢӾ'=CɾHCC*z$GC Cz$GClj̾6#Co2ɾHCC*z$GCCɾHCj*̾SWCYJCCo2ɾHCCɾHCk{ȾCo2YJCCo2ɾHCCYJCGk/tȾ<۴ChKCCo2YJCCYJC0m\bE<C'VhKCCo2YJC۴ChKCm8b+7⾭V(C:s<@CCee ?CԾC:s ?Cdiپx CVm<@CCee ?C(C:s<@C[$eBپ2 (C:s<@CC:sACCVm<@COG@Wb3C^}@Cb3C <@C+C^<@CJ/KNJb3C <@Cb3CsUBCgC^UBC LHME+C^<@Cb3C <@CgC^UBCN:-b3CsUBCb3CLCC_ϿC^CCLTP#gC^UBCb3CsUBC_ϿC^CCaR? @J b3CLCCb3C*ECC^*ECZOJr$ _ϿC^CCb3CLCCC^*ECTKe Ke b3C*ECb3C0wEC`C0z$GCS + b3C*EC`C0z$GCC^*EC{WbmֽC^*EC`C0z$GCC^z$GC_W`Q`C0z$GCC0ɾHCC^z$GC xYgrQ㦽C0ɾHCC^ɾHCC^z$GCBYŽZC0ɾHCC0YJCC^ɾHCy]f'C0YJC/vC^YJCC^ɾHCX]* ZC0YJC C0hKC/vC^YJC&ajD C0hKC$qC^hKC/vC^YJCJ>hdZb3CT ?Cb3C^}@C+C^<@C JmUjZb3CT ?C+C^<@C̿C ?CN?̿C ?C+C^<@CwC<@CFwNK+C^<@CgC^UBCwC<@CPh C0fv?C5eC^ ?CC ?CetE)YݑC0UBCb3C <@CgC0<@Cu=GK lPb3CsUBCb3C <@CݑC0UBCvGA`C0CCb3CsUBCݑC0UBCL4i0b3CLCCb3CsUBC`C0CC MEM(6C0*ECb3CLCC`C0CC M$cr(b3C*ECb3CLCC6C0*ECbMbb6C0*ECb3C0wECb3C*EC7Ea5eC^ ?Cb3C^}@Cb3CT ?C9 #DC0 ?CC0fv?CC ?Cpwar=˽C3|0hKC˽CW&dMCCW&hKC$b{b'$<@=˽CW&dMC˽CD%MCC`9 MCYb{&$)2=˽CW&dMCC`9 MCCW&hKC`z7n2@?=CW&hKCC`9 MCC`9 hKC"3z#>˽CD%MC˽C(OCɽC`9 (OCS.z`^#>C`9 MC˽CD%MCɽC`9 (OCuy"">˽C(OC˽C`9 AOCɽC`9 (OC9#ogF=C'VhKCCMCmC:sMC>ynv,=dC:shKCC'VhKCmC:sMCq\=CMCC4|(OCC:s(OCDnߜ=mC:sMCCMCC:s(OClp橾e>=C4|(OCCFuVPC C:sVPC'qT|ʛ=C:s(OCC4|(OC C:sVPCo:g=CFuVPCC:s(QC C:sVPC!sǞx/=dC:shKCmC:sMC!CD(ZhKCڠt"ǒ.=mC:sMCr0CD(ZMC!CD(ZhKCtsD=mC:sMCC:s(OCr0CD(ZMCks8ėG=C:s(OCBCD(Z(OCr0CD(ZMCڰsۗ=C:s(OC C:sVPCBCD(Z(OCEKun= C:sVPCZCD(ZVPCBCD(Z(OCxvL{o=C:s(QCCj\RCvCD(Z\RCUxv@P{=C:s(QCvCD(Z\RC C:sVPCt\_> C:sVPCvCD(Z\RCZCD(ZVPCCvYCv>Cj\RCC]SC(CD(ZSCuuz>vCD(Z\RCCj\RC(CD(ZSCt#t$)>C]SCCD(ZZ;TC(CD(ZSCZCD(ZVPC*CM@VPCKCM@(OCVwg>ZCD(ZVPCvCD(Z\RC*CM@VPCHWwYY>vCD(Z\RCICM@\RC*CM@VPCw,Z'>vCD(Z\RC(CD(ZSCICM@\RC!xU>"e$>(CD(ZSCkCM@SCICM@\RCwz>\+>CD(ZZ;TCCFDUC6CM@DUChw>F+>CD(ZZ;TC6CM@DUC(CD(ZSCw>,+>(CD(ZSC6CM@DUCkCM@SCw>`>>CFDUCCM@UC6CM@DUCnw~r=˽C3|0hKCνCW&MC˽CW&dMCwFm=˽C3|0hKCCM@hKCνCW&MCAyZV=CM@hKC.CM@MCνCW&MCyXV d=.CM@MCKCM@(OCνCW&MC|y[0>KCM@(OCCW&(OCνCW&MCyP0 >KCM@(OC*CM@VPCCW&(OCyc47>*CM@VPC CW&VPCCW&(OCy60d>*CM@VPCICM@\RC CW&VPCy{3I>ICM@\RC$CW&\RC CW&VPCx3F$>ICM@\RCkCM@SC$CW&\RCx5?>kCM@SC$LCW&SC$CW&\RCxfy^zҩ,>kCM@SC6CM@DUC$LCW&SCWx>+콽vO>6CM@DUCvCW&DUC$LCW&SCy>KC>CM@UCCW&VCvCW&DUCʹy@>6CM@DUCCM@UCvCW&DUCa{;1$L=νCW&MC˽CD%MC˽CW&dMCNaz׉# >CW&(OC˽CD%MCνCW&MCz B >˽C(OC˽CD%MCCW&(OCdyii>˽C(OCC`9 VPC˽C`9 AOCgy>i>˽C(OCCW&(OCC`9 VPC{`>CW&(OC CW&VPCC`9 VPCbziAbg> CW&VPC$CW&\RCC`9 VPChzß=>$CW&\RCC`9 \RCC`9 VPCGz?@>$CW&\RC$LCW&SCC`9 \RCGz?@>$LCW&SCj8C`9 SCC`9 \RCy�O>$LCW&SCvCW&DUCj8C`9 SCmy^|yS>vCW&DUCcC`9 DUCj8C`9 SCtzlD>CW&VCC +WC C`9 +WCxznl7D>CW&VC C`9 +WCvCW&DUC@uxø5d>vCW&DUC C`9 +WCcC`9 DUCw"i(|>C +WCC`9 ZWC C`9 +WCYgپ:;fChKC;fCJMCfCMC+e0.ᾷ#<6 ChKC;fChKCfCMCiEj]*ξV?<;fCJMC;fCS(OCRC(OCgXپ"&3=fCMC;fCJMCRC(OCk'_Ǿ=;fCS(OC;fCp)VPC"%CVPC j;M]E=RC(OC;fCS(OC"%CVPClO-š=;fCp)VPC;fC#\RC8C\RC-jƾ="%CVPC;fCp)VPC8C\RCn5y=;fC#\RC;fC_SCMCSCcl#M=8C\RC;fC#\RCMCSCod =;fC_SC;fCDUCKdCDUC.nz³=MCSC;fC_SCKdCDUCVoH=;fCDUC;fCsUCKdCDUC~kiȾQљ<6 ChKCfCMC۴ChKCl[@=fCMCCMC۴ChKClH87=fCMCRC(OCCMC[]m4⽾ޱV=RC(OCCȾC(OCCMCIhm꽾2H=RC(OC"%CVPCCȾC(OCo _="%CVPC,ھCVPCCȾC(OCzo6="%CVPC8C\RC,ھCVPCzo7=8C\RCC\RC,ھCVPCmoɲ=8C\RCMCSCC\RCo﫾7=MCSCCSCC\RCHoϫr=MCSCKdCDUCCSC8p`=KdCDUCCDUCCSC-r䘾Z=;fCsUC;fCe+WC:C+WCrę =;fCsUC:C+WCKdCDUCipL>KdCDUC:C+WCCDUCMgs;fCe+WC;fC#XCXCXCUq:C+WC;fCe+WCXCXCmR9=CMCC'VhKC۴ChKCn=CMCC'VhKCCMC9ZnڸW=CȾC(OCCMCCMC_q_ܠ=C4|(OCCMCCȾC(OCqB=,ھCVPCC4|(OCCȾC(OCO,qPl=CFuVPCC4|(OC,ھCVPCo~_=CFuVPC-C:s\RCC:s(QCspw6=CFuVPC,ھCVPC-C:s\RCor}=,ھCVPCC\RC-C:s\RC;r_6D=C\RCCSC-C:s\RCcs5쐾 h>CSCrƾC:sSC-C:s\RC>js.>CSCCDUCrƾC:sSCs 4>CDUCC:sDUCrƾC:sSC=tQ=>CDUC:C+WCC:sDUCt}+>:C+WCZC:s+WCC:sDUC8Lu`~+^>:C+WCXCXCZC:s+WCBul#>XCXC'C:sXCZC:s+WCxv{K{z=-C:s\RCCj\RCC:s(QC, vz(>rƾC:sSCCj\RC-C:s\RCCviDv=>C]SCCj\RCrƾC:sSC\Pup &>C]SCCD(ZDUCCD(ZZ;TCQuu&>C]SCrƾC:sSCCD(ZDUC(wS_>rƾC:sSCC:sDUCCD(ZDUCvp_ϻ>C:sDUCZC:s+WCCD(ZDUCv6IP4>ZC:s+WC۾CD(Z+WCCD(ZDUCwIu %>ZC:s+WC'C:sXC۾CD(Z+WCڥwr7-r7>'C:sXCCD(ZXC۾CD(Z+WCb!xrD;ϋ(>CD(ZDUCCFDUCCD(ZZ;TCw>a>>CFDUCCM@+WCCM@UC:wՕ:F=>CFDUCCD(ZDUCCM@+WCwc25>CD(ZDUC۾CD(Z+WCCM@+WCwN2&7>۾CD(Z+WCCD(ZXCCM@+WC{w8 qt]>CD(ZXCCM@XCCM@+WCyVt彆)@>CW&+WCCM@UCCM@+WCy꽂C>CW&VCCM@UCCW&+WCEx` #)^>CM@+WCCM@XCCW&+WCҧw뺽q>CM@XC4ѾCW&XCCW&+WCtzlpD>CW&+WCC +WCCW&VC wdw>C +WCrƾC`9 XCC`9 ZWCfwai}x>C +WCCW&+WCrƾC`9 XC_x,bPܕr>CW&+WC4ѾCW&XCrƾC`9 XC0auI. C0hKCݿC0MC$qC^hKCf:ݾ&:;fCJMC;fChKCpC^MC]fQ2ݾ-;fC#XC;fCe+WCCXC`r Α!>;fC#XC;fCweYCXCXC+Sv_Q'>;fCweYC;fC؀2`ZCMC:s2`ZCɋv_]Y$>;fCweYCMC:s2`ZCXCXC@ ukK3>XCXCMC:s2`ZC'C:sXCt]*K>;fC؀2`ZC;fC:sR[CMC:s2`ZCwY7E5>'C:sXCMC:s2`ZCCD(ZXCw"I>MC:s2`ZCX+CD(Z2`ZCCD(ZXCBw'4KM>;fC:sR[C;fCf[CTCD(Z[C5Cw'GM>;fC:sR[CTCD(Z[CMC:s2`ZCw5"[GH>MC:s2`ZCTCD(Z[CX+CD(Z2`ZCURvW'_>;fCf[C;fCD(Z`\CTCD(Z[Czxu ByJ>CD(ZXCX+CD(Z2`ZCCM@XC=Fx:U>X+CD(Z2`ZCCM@2`ZCCM@XCx>I>X+CD(Z2`ZCTCD(Z[CCM@2`ZCxe+%k>TCD(Z[CuACM@[CCM@2`ZCws>;fCD(Z`\C;fCM@Z&]CuACM@[CԠx)5a>TCD(Z[C;fCD(Z`\CuACM@[C3yV>CM@XCCM@2`ZC4ѾCW&XCx륽`a>CM@2`ZCCW&2`ZC4ѾCW&XCCx{yk>CM@2`ZCuACM@[CCW&2`ZC%'xWɛn>uACM@[C0CW&[CCW&2`ZCQvN5x}܄>;fCM@Z&]C;fCW&+]C0CW&[C>w_53s>uACM@[C;fCM@Z&]C0CW&[CZyO5Qa>4ѾCW&XCCW&2`ZCrƾC`9 XCWBx)Bx>CW&2`ZCC`9 2`ZCrƾC`9 XCxg=o>CW&2`ZC0CW&[CC`9 2`ZCFw~>0CW&[C/C`9 [CC`9 2`ZCvZ>;fCW&+]C;fC`9 +]C/C`9 [C1wou>0CW&[C;fCW&+]C/C`9 [CUo ?=b3C0w,YCb3CM2`ZCC^2`ZC{o Ge=b3C0w,YCC^2`ZC-C0XCm*_=-C0XCC^2`ZCu߿C^XC$nz3=b3CM2`ZCb3Cѥ[CC^[Cnc7=C^2`ZCb3CM2`ZCC^[Cpm>b3Cѥ[Cb3C^~]CC^[Coc=u߿C^XCC^2`ZCCXC Cp~n1 >C^2`ZCC2`ZCCXCüp=C^2`ZCC^[CC2`ZCjr )>C^[C׿C[CC2`ZCrF>b3C^~]Cb3C{є]CCє]C1rF>b3C^~]CCє]CC^[C\rI>C^[CCє]C׿C[C#Wrm* u7>b3C{є]Cb3CUd!/_C!C!/_CUqC:>>Cє]Cb3C{є]C!C!/_Cq츈dH>b3CUd!/_Cb3C_C!C!/_Cq]P$>;fC#XC{C2`ZC;fCweYCq M$>;fC#XCCXC{C2`ZCqtE݆b >CXCC2`ZC{C2`ZCXsCB+@*>C2`ZC׿C[C{C2`ZCs$H2>׿C[CC[C{C2`ZC_EtG9>׿C[CCє]CC[Ctp<5>Cє]CǿCє]CC[C*t:pM@>Cє]C!C!/_CǿCє]CN;tirF>!C!/_CC!/_CǿCє]Cyt[]8+K>b3C_Cb3Cp`CCp`C t]O$K>b3C_CCp`C!C!/_Css\hV>!C!/_CCp`CC!/_C`r[:n>b3Cp`Cb3C waCCp`C$Sv,_Q'>{C2`ZC;fC؀2`ZC;fCweYCuVY`G>;fC؀2`ZCTwC:s[C;fC:sR[C#t@]ïI>;fC؀2`ZC{C2`ZCTwC:s[CCv5+I4>{C2`ZCC[CTwC:s[Clv;I6>C[CǿCє]CTwC:s[Clv6iI>ǿCє]CC:sє]CTwC:s[Crv6I>ǿCє]CC!/_CC:sє]C/vpo$@[>C!/_CοC:s!/_CC:sє]Cv$JqY>C!/_CCp`CοC:s!/_C/vqh>Cp`C!C:sp`CοC:s!/_CJ.u1 >b3C waCb3C:sUbC!C:sp`Cv*]Wq>Cp`Cb3C waC!C:sp`Cnw%I>TwC:s[C;fCf[C;fC:sR[CSvQ'i_>;fCf[CCCD(Zє]C;fCD(Z`\Cv,]$]>;fCf[CTwC:s[CCCD(Zє]C-Vx)WJ>TwC:s[CC:sє]CCCD(Zє]C|kwD:[>C:sє]CοC:s!/_CCCD(Zє]Cvi*۽T}>οC:s!/_C鷿CD(Z!/_CCCD(Zє]CwU4ܽ@i>οC:s!/_C!C:sp`C鷿CD(Z!/_C[wҽhn>!C:sp`CMCD(Zp`C鷿CD(Z!/_CB|v*<>b3C:sUbCb3Cb3C:sUbC!CD(ZcbC!C:sp`C"yuwнb>!C:sp`C!CD(ZcbCMCD(Zp`CUt4]>b3CsCM@є]C;fCD(Z`\CCCD(Zє]CwAs>;fCM@Z&]C;fCD(Z`\CsCM@є]CNw[S}>CCD(Zє]C鷿CD(Z!/_CsCM@є]C?w>Js>鷿CD(Z!/_CCM@!/_CsCM@є]CxCGn>鷿CD(Z!/_CMCD(Zp`CCM@!/_CvG[1>MCD(Zp`CݿCM@p`CCM@!/_C[hv [>MCD(Zp`C!CD(ZcbCݿCM@p`Cӓu|~B>!CD(ZcbCCM@cbCݿCM@p`Cntsvs>b3CD(Z&bCb3CM@p cCCM@cbC~tE <ۓ>!CD(ZcbCb3CD(Z&bCCM@cbCBxoW_gs>>hCW&є]C;fCM@Z&]CsCM@є]Ccv|6Y>;fCW&+]C;fCM@Z&]C>hCW&є]CBxTW_sCM@є]CCM@!/_C>hCW&є]COvd+;>CM@!/_C:CW&!/_C>hCW&є]Cv!]>CM@!/_CݿCM@p`C:CW&!/_Cv|>ݿCM@p`CڿCW&p`C:CW&!/_Cu1{MY>ݿCM@p`CCM@cbCڿCW&p`CtHx>CM@cbC=CW&cbCڿCW&p`CIr,;~>b3CM@p cCb3CW&cC=CW&cbCt^>CM@cbCb3CM@p cC=CW&cbCv@9l>HhC`9 є]C;fCW&+]C>hCW&є]Cфv >;fC`9 +]C;fCW&+]CHhC`9 є]CzYv @9 A>>hCW&є]C:CW&!/_CHhC`9 є]C u:CW&!/_CC`9 !/_CHhC`9 є]Cv<}>:CW&!/_CڿCW&p`CC`9 !/_Chuq=>ڿCW&p`CC`9 p`CC`9 !/_Ct=3_>ڿCW&p`C=CW&cbCC`9 p`C (s}_=h>=CW&cbC%C`9 cbCC`9 p`Cq_Hh=>b3CW&cCb3C`9 8bC%C`9 cbCr^=E>=CW&cbCb3CW&cC%C`9 cbCL-neȳ%=DC02`ZCb3CM2`ZCb3C0w,YC)mY=_C0[Cb3CM2`ZCDC02`ZCOnN"=b3Cѥ[Cb3CM2`ZC_C0[C?l꺲1 >b3Cѥ[CR5C^є]Cb3C^~]CV-mL>b3Cѥ[C_C0[CR5C^є]C*-o9 >_C0[Cx}C0є]CR5C^є]Cņ >x}C0є]CC0!/_CR5C^є]C4oWw1>C0!/_CG[C^!/_CR5C^є]CnRSE6>C0!/_CC0p`CG[C^!/_C[o3C>C0p`CC^p`CG[C^!/_CRoX_3>>C0p`CqC0cbCC^p`CoBdJ>qC0cbCXC^cbCC^p`Cmؕ+e>C0bCCLǦcC?C^cCmە5e>C0bC?C^cCqC0cbC7n6撾 _>qC0cbC?C^cCXC^cbCH lG">CLǦcCC^dC?C^cCq0A$>R5C^є]Cb3C{є]Cb3C^~]CLqfؑr2>G[C^!/_Cb3C{є]CR5C^є]Cr憾rm4>b3CUd!/_Cb3C{є]CG[C^!/_C: r{o;E>b3CUd!/_CLCp`Cb3C_Cd rz:E>b3CUd!/_CG[C^!/_CLCp`C rQxX6E>G[C^!/_CC^p`CLCp`Cзq$JK>C^p`CXC^cbCLCp`CqWvٟb>XC^cbC|CcbCLCp`Cq`va>XC^cbC?C^cC|CcbCqa`v>?C^cCXCcC|CcbCGpocg}>C^dCC^eCC^eCGpcg~>C^dCC^eC?C^cCq'an>?C^cCC^eCXCcCuYG>LCp`Cb3Cp`Cb3C_Cr[Gn>b3Cp`CkPCcbCb3C waC"sXVl>b3Cp`CLCp`CkPCcbCt Od>LCp`C|CcbCkPCcbCrOcw>|CcbCXCcCkPCcbCzr:]>XCcCވCcCkPCcbCrU;t>XCcCC^eCވCcC`rn!Ӡ>C^eCC^eCވCcCvFq>[5C:scbCb3C waCkPCcbCtl҃>b3C:sUbCb3C waC[5C:scbCt2꾆>kPCcbCވCcC[5C:scbC=t]>ވCcCboC:scC[5C:scbCs5m>ވCcCC^eCboC:scCs罞>C^eCQC:s^eCboC:scC#vS>[5C:scbCb3Cb3Cb3C[5C:scbCboC:scC_CD(ZcCFptH >boC:scCQC:s^eC_CD(ZcCFptH >QC:s^eC՝CD(Z^eC_CD(ZcCtd>XCM@cCb3CD(Z&bC_CD(ZcCtxx>b3CM@p cCb3CD(Z&bCXCM@cCtd#>_CD(ZcC՝CD(Z^eCXCM@cCsOCԚ>՝CD(Z^eCCM@^eCXCM@cCPt<0>\CW&cCb3CM@p cCXCM@cC(Rs;>b3CW&cCb3CM@p cC\CW&cC's"<Ԛ>XCM@cCCM@^eC\CW&cC3CM@^eCCW&^eC\CW&cCr(D=ž>jC`9 cCb3CW&cC\CW&cCq7Kh=>b3C`9 8bCb3CW&cCjC`9 cCrD=|Ğ>\CW&cCCW&^eCjC`9 cCqp/=>CW&^eCC`9 ^eCjC`9 cCmؕh+e> C0cCCLǦcCC0bCj l͝">CLǦcC<C^^eCC^dCS l8">CLǦcC C0cC<C^^eCGp}cg> C0cC9RC0^eC<C^^eCGpOcg}><C^^eCC^eCC^dC)oOf_>C^eCC?fCC^eC`r!H>C?fCC%gCC^eC`rS!>C^eCC?fCC^eCsmh>C%gCCp2gCC:s2gCnltTSא>C%gCC:s2gCC^eC-Wrt>C^eCC:s2gCQC:s^eC/Qrgfo>Cp2gCC:sKgCC:s2gCIAsVᒽ@>QC:s^eCC:s2gC՝CD(Z^eC*sC:s2gCCD(Z2gC՝CD(Z^eCp|r>C:sKgCCD(Z?gCCD(Z2gCr+bִ>C:s2gCC:sKgCCD(Z2gCTsf*vZ>՝CD(Z^eCCD(Z2gCCM@^eCr?N>CD(Z2gCCM@2gCCM@^eCspʵ>CD(Z?gCCM@?gCCM@2gCpJ>EƬ>CD(Z2gCCD(Z?gCCM@2gCr<*?>CM@^eCCM@2gCCW&^eC8qv =vT>CM@2gCeCW&2gCCW&^eCn6=a>CM@?gCCW& gCeCW&2gCPp =>CM@2gCCM@?gCeCW&2gC?qvd=ץ>CW&^eCeCW&2gCC`9 ^eCY}nS=D>eCW&2gCrC`9 2gCC`9 ^eCHm=. >CW& gCC`9 y=gCrC`9 2gC3l 4=̹>eCW&2gCCW& gCrC`9 2gCFnF``>9RC0^eC6C02gC<C^^eCFnF``>6C02gC9RC^2gC<C^^eC_o: w>6C02gC%C0hC9RC^2gC_o w>%C0hC6C^hC9RC^2gCn)iD>C0&iCCTܠMgjCC^MgjCunoj>C0&iCC^MgjC%C0hCmĹtq7>%C0hCC^MgjC6C^hC~jmhq!>CTܠMgjCC^_sjCC^MgjC)oQf>C^eC$C2gCC?fC)oOf>C^eC<C^^eC$C2gC1qdV\><C^^eC9RC^2gC$C2gC1qdV>9RC^2gC6C^hC$C2gCpvpv25g>6C^hC8eChC$C2gCkyp!2S>6C^hCC^MgjC8eChCgp{51>C^MgjC CMgjC8eChCo5$>C^_sjCCdkC CMgjC-o5>C^MgjCC^_sjC CMgjCcr?A! >C2gCC?fC$C2gC(gq'u>C%gCC?fCC2gCZ+qq ٗ>$C2gC8eChCC2gC#pʼn .>8eChCFChCC2gCr~n[>8eChC CMgjCFChC&iq > CMgjCCMgjCFChCp>CdkCC7kCCMgjCq:.'> CMgjCCdkCCMgjCs2kV>C2gCCp2gCC%gCQrgp>Cp2gC1C:shCC:sKgC.Qrco>Cp2gCC2gC1C:shC'q+Ž>C2gCFChC1C:shC>*rƽx|>FChCCMgjC1C:shCqz>CMgjCvC:sMgjC1C:shCEqy<>C7kCClCC:slCqNl6>C7kCC:slCCMgjCX"p>>CMgjCC:slCvC:sMgjCFRnU>ClCC:siIlCC:slC)s>)CD(ZhCC:sKgC1C:shCo%}`>CD(Z?gCC:sKgC)CD(ZhCǒrF>1C:shCvC:sMgjC)CD(ZhCq Լl>vC:sMgjCpCD(ZMgjC)CD(ZhCpMӼ.>vC:sMgjCC:slCpCD(ZMgjC o:ˠ[@>C:slCCD(ZlCpCD(ZMgjCTng>C:siIlCCD(ZiIlCCD(ZlCCn帠Mη>C:slCC:siIlCCD(ZlCrps;U>*CM@hCCD(Z?gC)CD(ZhCBoP>CM@?gCCD(Z?gC*CM@hC,qDu;z>)CD(ZhCpCD(ZMgjC*CM@hCp"<>pCD(ZMgjCtCM@MgjC*CM@hCoS<8>pCD(ZMgjCCD(ZlCtCM@MgjC o)sCD(ZlCpCM@lCtCM@MgjCk։<@>CD(ZiIlCCM@r2lCpCM@lC\KnR<6>CD(ZlCCD(ZiIlCpCM@lC$ow{a=z>6CW&hCCM@?gC*CM@hCn{6='>CW& gCCM@?gC6CW&hCcp9Kb=í>*CM@hCtCM@MgjC6CW&hC1aoE=[>tCM@MgjCGCW&MgjC6CW&hC5m)=m>C3|0lCCW&kCGCW&MgjCm=K>C3|0lCGCW&MgjCpCM@lCΔn䄅=>pCM@lCGCW&MgjCtCM@MgjCWak뤖=Y>pCM@lCCM@r2lCC3|0lC0m= >sLC`9 hCCW& gC6CW&hCm=Zܴ>C`9 y=gCCW& gCsLC`9 hCn=>6CW&hCGCW&MgjCsLC`9 hCm=xݴ>GCW&MgjChC`9 MgjCsLC`9 hCj>e>CW&kCC`9 [kChC`9 MgjCm=c>GCW&MgjCCW&kChC`9 MgjCnRj >C0MgjCCTܠMgjCC0&iC`mWhG>CTܠMgjC C^lCC^_sjC`m hG>CTܠMgjCC0MgjC C^lCYpUPoz>C0MgjC9C0lC C^lCp/GP>9C0lCvC0mC C^lCZ`pG(">vC0mCKC^mC C^lCrl'>ښC0˟nCښCZ;6oC C^;6oC sQ&>ښC0˟nC C^;6oCvC0mC9oUFݘ>vC0mC C^;6oCKC^mCeq'V>ښCZ;6oCښC^oC C^;6oCp2>WClCC^_sjC C^lC[o$89>CdkCC^_sjCWClCDq3> C^lCKC^mCWClCLo-y>KC^mC.CmCWClCʯqIo>KC^mC C^;6oC.CmC oqX> C^;6oCmqC;6oC.CmC6pN>ښC^oCښC%pCmqC;6oCr X> C^;6oCښC^oCmqC;6oCq޽A*>ClCCdkCWClCot/L>C7kCCdkCClCjpݽ>WClC.CmCClCo$Ƚ˫>.CmC-CmCClC7rʽڝ>.CmCmqC;6oC-CmCopkډc>mqC;6oCbC;6oC-CmCMp()xkv>ښC%pCښC_opCbC;6oC\qbb>mqC;6oCښC%pCbC;6oCPpz9>ClCClCC7kCRn7QS>ClCC:smCC:siIlC;1n{ܷ>ClCClCC:smCpXBl>ClC-CmCC:smCpdBǕ>-CmCbC;6oCC:smCrnI>bC;6oC^C:s;6oCC:smCo&ô>ښC_opCښC:s;tpC^C:s;6oCp@|>bC;6oCښC_opC^C:s;6oCnPk;P˷>CD(ZmCC:siIlCC:smC&TnU>CD(ZiIlCC:siIlCCD(ZmC{n*;6 >C:smC^C:s;6oCCD(ZmC#l<}>^C:s;6oCdCD(Z;6oCCD(ZmC klM=!>ښC:s;tpCښCD(Z>pCdCD(Z;6oCno.^C:s;6oCښC:s;tpCdCD(Z;6oC+ne=|ͺ>CM@mCCD(ZiIlCCD(ZmCIlr<>CM@r2lCCD(ZiIlCCM@mCIlc=#>CD(ZmCdCD(Z;6oCCM@mCB&i[=U>dCD(Z;6oCsCM@;6oCCM@mCLzi w=w>ښCD(Z>pCښCM@ioCsCM@;6oC{'lZ'={>dCD(Z;6oCښCD(Z>pCsCM@;6oC]lI=>C3|0lCCW&lCCW&kCj+=b>CM@r2lCCW&lCC3|0lClX=Xi>CM@r2lCCM@mCCW&lC2@iu#=>CM@mC.CW&mCCW&lC8h= >CM@mCsCM@;6oC.CW&mCIXiP=cX>sCM@;6oCcCW&;6oC.CW&mCsg=>ښCM@ioCښCW&oCcCW&;6oC#Xi2=Y>sCM@;6oCښCM@ioCcCW&;6oCjH>ڶ>HC`9 lCCW&kCCW&lCKXi>>C`9 [kCCW&kCHC`9 lCdh>:>CW&lC.CW&mCHC`9 lCi=8>.CW&mC5IC`9 mCHC`9 lCqi=k>ښC;6oCښC`9 oC5IC`9 mCi<=:>ښC;6oC5IC`9 mCcCW&;6oChN=>cCW&;6oC5IC`9 mC.CW&mC5g.=>cCW&;6oCښCW&oCښC;6oCTPо3p[b3CN@Cb3C_~@{C-CN@{C{6=b3CN@CCN@CCJ@{C 7@b3C_~@{Cb3CN@CCJ@{CLI=`CN@.CCCw@+C>CN@+CNV= CN@C>CN@+CCCw@+Cz<:CN@CCCw@+CCJ@{CꨗŨ:CJ@{CCCw@+CC)!@{C|7$&ښCt%@91CښC]?{CRCt%@{Ci@CN@.CښCN@7QCښC}X@+CYi@sCCw@+CCN@.CښC}X@+C۳xɊ:q#RCt%@{CښC}X@+CښCt%@91C~9B$RCt%@{CC)!@{CښC}X@+Cff>p!C)!@{CCCw@+CښC}X@+Cz_b߾>d_˽CjFJ?h>%C˽C-+?{%C:ĽCjFJ?{%CAUVg˽Ct%@!C˽C@WG"CCt%@WG"C<[;Om^S˽C@WG"C˽C,?#CoCt%@#C^WcB?4JCt%@WG"C˽C@WG"CoCt%@#CS]vM'>]˽C,?#C˽CjFJ?h>%C:ĽCjFJ?{%CmZrjy/d˽C,?#C:ĽCjFJ?{%CoCt%@#C gϾ-oCt%@#C:ĽCjFJ?{%CgCt%@{%CF| w˽CN@؎C˽CBm@CCN@CRd˽CBm@C˽Cs7@ CsCN@ CLJ~Q]tCN@C˽CBm@CsCN@ CZSVg˽Cs7@ C˽Ct%@!CCt%@WG"CoCt%@#CgCt%@{%CA'CN@#Chj?ǾmνgCt%@{%CCN@{%CA'CN@#CD~ HCP7K#CC&#CxCP#C8Q'C&#CCg{%CX5CP{%C#;I*gxCP#CC&#CX5CP{%CP59P5CjFJ? CC2? CuCjFJ? CCmFСC2? CCvPWG"C;CjFJ?WG"C/Z=!䚾uCjFJ? CC2? C;CjFJ?WG"CD} CvPWG"CCP7K#CxCP#CB1੾CvPWG"CxCP#C;CjFJ?WG"CXSj_;CjFJ?WG"CxCP#C\CjFJ?#CvY񾓢q˽CjFJ?h>%CX5CP{%C˽C-+?{%CvY񾰤q˽CjFJ?h>%C\CjFJ?#CX5CP{%C~RBT\CjFJ?#CxCP#CX5CP{%C78=+þCt%@*CCM?CYOCt%@C:99CM?CCjFJ? CuCjFJ? CW;9r~8CM?CuCjFJ? CYOCt%@CE@ΪYOCt%@CuCjFJ? CTCt%@ CfP6u˽Ct%@!C;CjFJ?WG"C˽C@WG"CUP?V#|˽Ct%@!CTCt%@ C;CjFJ?WG"C* Bt̞TCt%@ CuCjFJ? C;CjFJ?WG"CPƤ-\CjFJ?#C˽C@WG"C;CjFJ?WG"CBW[˽C,?#C˽C@WG"C\CjFJ?#CFWLn\CjFJ?#C˽CjFJ?h>%C˽C,?#CI!!CN@ЪCCsv@C†CN@C/p6)վCsv@CC.@ixC CN@ixCu&&&Lƾ†CN@CCsv@C CN@ixC>RᦾYOCt%@C˽CBm@C˽CN@؎C#7AþCt%@*CYOCt%@C˽CN@؎CI 9acCt%@*C˽CN@؎C CN@ixCI1 8ɾCt%@*C CN@ixCC.@ixCCn>qtTCt%@ C˽CBm@CYOCt%@C|LZ ˽Cs7@ C˽CBm@CTCt%@ CzNY !XzTCt%@ C˽Ct%@!C˽Cs7@ CF5;fC~'%C;fC;{%COC{%Cۮ7>*þ;fC"C;fC&K#CC#C_7B.þ;fC&K#C;fC~'%COC{%C̮7>O+þ;fC&K#COC{%CC#C ?ųC#COC{%CC{%C:$%Kԓ;fCPP C;fC CeFCP CP4 ;cɾ;fC C;fCoWG"C׾CPWG"C+%Y踾eFCP C;fC C׾CPWG"CB<=skC#CC&#CCP7K#C>S89þ;fC"CC#CCP7K#C1F9:J;fC"CCP7K#C׾CPWG"C4vPƾ;fC"C׾CPWG"C;fCoWG"C<=NhC{%CC&#CC#CHY oCg{%CC&#CC{%CU#C;fCjFJ? C;fCO4=CQCjFJ?ClR0>¾eFCP CC2? CCjFJ? CO(l;fCPP CeFCP CCjFJ? CL-M ƾ;fCPP CCjFJ? CQCjFJ?CJ$;fCPP CQCjFJ?C;fCO4=C0͞䀾׾CPWG"CC2? CeFCP C;]mCvPWG"CC2? C׾CPWG"C!|:6dv׾CPWG"CCP7K#CCvPWG"Cf$a;fCt%@C;fC?ixCyľCt%@ixChd+'"оQCjFJ?CCM?CCt%@*C[W"\;fCjFJ? CQCjFJ?CCt%@*C"f&>Ծ;fCjFJ? CCt%@*CyľCt%@ixCBf$;fCjFJ? CyľCt%@ixC;fC?ixC-- žQCjFJ?CCjFJ? CCM?CN-N;fCN@C;fC`l@CC,5CN@CC Ǖ3nCN@ЪC,5CN@CC;fC`l@CCU .CN@ЪC;fC`l@CCCsv@Cw $ Csv@C;fC`l@CC;fCD@C٪c$ݝyľCt%@ixC;fCD@C;fCt%@CAJ@yľCt%@ixCC.@ixC;fCD@C,AQ)C.@ixCCsv@C;fCD@CO$:N$=־yľCt%@ixCCt%@*CC.@ixC$Gb3C޳ %Cb3C*{%Cz C޳{%CSJ$6b3C0"Cb3C9#C%ɿC#Cm.,N Wɾz C޳{%C;fC;{%C;fC~'%C%@ϼb3C޳ %Cz C޳{%C;fC~'%CM)c1"a;b3C޳ %C;fC~'%C%ɿC#CRJ$'C Cb3Cs ClCWG"CZe+' о%ɿC#C;fC&K#C;fC"C !J"'b3C0"C%ɿC#C;fC"C$j%.Ͼb3C0"C;fC"ClCWG"C*#gb3C0"ClCWG"Cb3ClmWG"Ce+'о%ɿC#C;fC~'%C;fC&K#CG K(wb3CP{Cb3C%CCPCCCjFJ?CQd /CPixCb3CExixCb3CjFJ?zC,߾O.CP$CCPixCb3CjFJ?zC۾-:CP$Cb3CjFJ?zCCjFJ?CоC-gCP$CCjFJ?CC6 >Coܓ3 CPixCb3CP{Cb3CExixC:0*5Ct%@ CCw?CCmCt%@CC~U־2]CjFJ?Cb3C2?Cb3Ct%@CY˾׷2CjFJ?\CCjFJ?Cb3Ct%@Cɣƾ1f2CjFJ?\Cb3Ct%@CmCt%@CC303CjFJ?\CmCt%@CCCw?CC T־ҙ25CjFJ?Cb3CjFJ?zCb3C2?Cf6F5mCt%@CCCJ@{CCt%@ CKs[3nmCt%@CCb3CF(@CCCJ@{C`7b3CF(@CCb3C_~@{CCJ@{C¾5mCt%@CCb3Ct%@Cb3CF(@CCg. C(#CCK#CbC(#C+2-C(=%CbC(#CCK#Ck/5C(=%CCK#CC${%C2^Y+) C${%CCK#CCs; {%CK]P 1 C޳n!CCWG"CpC޳WG"CJ2]bC(#CC#CC޳#CA_1 C(#CbC(#CC޳#CF62ŸC(#CC޳#CpC޳WG"C0_13 C(#CpC޳WG"CCWG"C2܅bC(#CC(=%CC#Cl/XzC6CCh C8C C#h/T pC޳WG"CC5WG"CC !CV龴/C޳n!CpC޳WG"CC !C,s{0tC޳n!CC !C8C Co/xC޳n!C8C CCh C1(pC޳WG"CC޳#CC5WG"CK;Kr+n C CCCCYCrӾ40CKCC CCYCY#,8C CCYCC6CYn,s8C CC\n CCYC8پ5hC\n CCKCCYCjS1+ 8C CC !CC\n C"1 CP$CCPW=CC$MixC73ѴCkixCCP$CC$MixCGg6C$MixCC CCkixC>ʾV.CCC CC$MixC50ju$CjFJ?\CCjFJ?CC2CC]4^2 C6 >CCjFJ?\CC2CC5]v]2 C2CCCP$CC6 >C2..#CPW=CCP$CC2CC/̠1M%Ct%@ CCt%@CC?CCɧB3!Cw?CCCt%@ CC?CCʧ73d!C?CCCjFJ?\CCw?CC50ku$CjFJ?CCjFJ?\CC?CC ӗ:kC)!@{CCt%@ CCJ@{C1щ7z Ct%@CCt%@ CC)!@{Cӱؾ1 C(#CښC(]"CښC~]#C7oܾ3CK#CC(#CښC~]#Cgwܾ3j }C`9 {%CښC~]#CښC`9 }$C1'}C`9 {%CCs; {%CښC~]#CIܾ4Cs; {%CCK#CښC~]#C)3\ښC޳ CښC CєC޳ Cc%þ7W9C޳n!CєC޳ CښC C--þi7?C޳n!CښC CCWG"C8ʾF3bCWG"CښC CښCnWG"Ch{Ͼm8ښCnWG"CC(#CCWG"ChVվ͟4wښC(]"CC(#CښCnWG"CؒG?0$ښC6CښC_CjCC"TƾQ4єC޳ CCh CC6C뽾1A3G)ښC޳ CєC޳ CC6C緾!1UaښC޳ CC6CjCC !2!ښC޳ CjCCښC_CYUƾm4JєC޳ CC޳n!CCh C9٢~.(ښC8CښC)ixCXCixC[Ưu/$jCCCYCCCq&>/%ښC6CjCCCC8c].'ښC6CCCXCixCWۢ.ծ(ښC6CXCixCښC)ixC46jCCC6CCYC9#0)t*ښCP2CښC( CF4CPC˴<"4̱"XCixCC$MixCCPW=Ccp3Z $ښC8CXCixCCPW=C72P&ښC8CCPW=CF4CPCD2 8'ښC8CF4CPCښC( Ck!4"XCixCCCC$MixCx,=.E.ښCjFJ?CښC>CCCjFJ?CCi2&F4CPCC2CCCjFJ?C&6s#2(ښCP2CF4CPCCjFJ?C N1M8)ښCP2CCjFJ?CCjFJ?CCN7;1+ښCP2CCjFJ?CCښC>CCf2~&F4CPCCPW=CC2CC뱏3'CjFJ?CCC?CCCt%@C-3*ښCjFJ?CCjFJ?CCCt%@CV-n3;|)ښCjFJ?CCt%@CRCt%@{C(ru>2,ښCjFJ?CRCt%@{CښC]?{C?3'CjFJ?CCCjFJ?CC?CC<߅:2#RCt%@{CCt%@CC)!@{Ctړ}CN@Z'CCk@(CCN@(C/y3gy5Ck@(CC3[@J*CCN@J*Ct$ACN@(CCk@(CCN@J*C?y']1C3[@J*CCNG@4+CCN@4+C$&y)g"CN@J*CC3[@J*CCN@4+C0{DgCNG@4+CC5@-CCN@-C?y^,CN@4+CCNG@4+CCN@-C}C5@-CCy @/CdCN@/C<{آD|A;CN@-CC5@-CdCN@/CZ}Rt:Cy @/CC !@"0CDıNCP"0C@CPqN2Cf&CjFJ?"0C{/H7@CPqN2CCjFJ?qN2Cf&CjFJ?"0Ce[ξ“2:ĽCjFJ?{%CbCjFJ?F'CgCt%@{%CljS bCjFJ?F'C"ICt%@F'CgCt%@{%CjhL=bCjFJ?F'CR{CjFJ?(C"ICt%@F'CWp ̽R{CjFJ?(CN3Ct%@(C"ICt%@F'CoMP[R{CjFJ?(C`CjFJ?J*CN3Ct%@(Carj`CjFJ?J*CJCt%@J*CN3Ct%@(Crߤϴ`CjFJ?J*C}MCjFJ?4+CJCt%@J*C8ovQƠJ}MCjFJ?4+CCt%@4+CJCt%@J*C'u涽}MCjFJ?4+Cg:CjFJ?-CCt%@4+Cw'yecfQ=g:CjFJ?-C Ct%@-CCt%@4+Cy Wf=zOg:CjFJ?-C/CjFJ?/C Ct%@-Cdy@/b>/CjFJ?/C5Ct%@/C Ct%@-C ky4bB`5/CjFJ?/Cf&CjFJ?"0C5Ct%@/C{6Tf&CjFJ?"0C&Ct%@"0C5Ct%@/CI{67f&CjFJ?"0CCjFJ?qN2C&Ct%@"0C}3\ pyCjFJ?qN2CCt%@qN2C&Ct%@"0Cdi/bƾ gCt%@{%C"ICt%@F'CCN@{%CAqӷY"ICt%@F'CTCN@F'CCN@{%Cvos_KCN@Z'CN3Ct%@(CCk@(CMs.:ܑCN@Z'CTCN@F'CN3Ct%@(Ckp4K,̽TCN@F'C"ICt%@F'CN3Ct%@(CzrJCt%@J*CCk@(CN3Ct%@(CAxwr#C3[@J*CCk@(CJCt%@J*CrfxUr>LCt%@4+CC3[@J*CJCt%@J*Cx7l{=CNG@4+CC3[@J*CCt%@4+Cx0lϋ= Ct%@-CCNG@4+CCt%@4+C'zmiVC5@-CCNG@4+C Ct%@-C zQV>5Ct%@/CC5@-C Ct%@-C,`|'( Cy @/CC5@-C5Ct%@/CI|@(&Ct%@"0CCy @/C5Ct%@/C}tV Q:C !@"0CCy @/C&Ct%@"0C}V kCt%@qN2CC !@"0C&Ct%@"0C]~潜?:Cg#@qN2CC !@"0CCt%@qN2C[쾔saC(P/CC^a/CrC(/CDn_3m߾_C^a/CC "0C9cC("0C'\p[rC(/CC^a/C9cC("0CbؾBC "0CCK qN2C9C(qN2CYUaETᾴ59cC("0CC "0C9C(qN2C\⾚EyC޳+CC-CaC޳-CH^ucC-CC(P/CrC(/C^㾍cC-CrC(/CaC޳-C3bh׾FaC޳-CrC(/C5C޳/Ca,־kOarC(/C9cC("0C5C޳/C>gľ _99cC("0C C޳"0C5C޳/CǤgľ:9cC("0C9C(qN2C C޳"0C_jN;_4'9C(qN2CqC޳qN2C C޳"0CYIC)CCȗJ*CgCJ*Cg]BljmCȗJ*CC4+C2C4+Ct[j!agCJ*CCȗJ*C2C4+Cr\'⾓>yC4+CC޳+CaC޳-C\5?DyC4+CaC޳-C2C4+CQeS˾gFC2C4+CaC޳-CC-Ce?x˾_HaC޳-C5C޳/CC-CDgľ^95C޳/CݽC/CC-C^m.h˽C) 0C C޳"0C˽C*!"0C*^m q˽C) 0CݽC/C C޳"0C?gľ _9ݽC/C5C޳/C C޳"0CllR,(qC޳qN2C˽C*!"0C C޳"0CEo\УKQ˽CƸqN2C˽C*!"0CqC޳qN2CWPx@dC &CC~@F'CiCF'CyVW5WC~@F'CCu(C/C(CaSd;oiCF'CC~@F'C/C(CbW򾪉Cu(CC)CgCJ*CVlCu(CgCJ*C/C(CIs_QUS/C(CgCJ*C5CJ*C^}XdgCJ*C2C4+C5CJ*CVgϭɾ,2C4+CٽC4+C5CJ*Cjfs:$˽Cw,CC-C˽Co7-C9jj1(˽Cw,CٽC4+CC-CZXfȾTCٽC4+C2C4+CC-CiU{:ݽC/C˽Co7-CC-C?n)˽Cg/C˽Co7-CݽC/C*C;fCC%J*CMcC(J*CEH@ ;fCC%J*C;fCt4+CC(4+C1DpMcC(J*C;fCC%J*CC(4+CF| x;fCt4+C;fC`9 -CQC`9 -C)*H ͜;fCt4+CQC`9 -CC(4+CO^E=C(4+CQC`9 -C6ϾC(-CXkKjC(P/C C`9 /CC^a/CaXipC(P/C6ϾC(-C C`9 /C(YO(Cv6ϾC(-CQC`9 -C C`9 /CW!*;C`9 "0CC^a/C C`9 /C[ 쾍emC "0CC^a/C;C`9 "0C4\doVƛC`9 qN2CC "0C;C`9 "0C ]hl|RCK qN2CC "0CƛC`9 qN2C@ ۂ;fC޳'C;fCV\(C,C޳(C9CCYq 4|;fCV\(C;fC(>*CMcC(J*C`@ U];fCV\(CMcC(J*C,C޳(CZNKg,C޳(CMcC(J*C{ܾC޳J*C{KMcC(J*CC(4+C{ܾC޳J*C_bUKC(4+C웾C޳4+C{ܾC޳J*C4Xy8KC޳+C6ϾC(-CC-C=X%C޳+C웾C޳4+C6ϾC(-CO~T웾C޳4+CC(4+C6ϾC(-CwYǞq6ϾC(-CC(P/CC-CJ>߄6;fC;{%C;fCk F'CCF'Ce8x,OC{%C;fC;{%CCF'Cz> G;fCk F'C;fC޳'C,C޳(Cz>ܩG;fCk F'C,C޳(CCF'CMΗ!CF'C,C޳(CC(CR*jC)C{ܾC޳J*CCȗJ*CRzjC)CC(C{ܾC޳J*CKj!C(C,C޳(C{ܾC޳J*C6SSb웾C޳4+CCȗJ*C{ܾC޳J*CX z{C4+CCȗJ*C웾C޳4+C#*C35Q. ̾b3C`9 )C C`9 J*C;fC(>*C7b3C`9 )C;fC(>*C̿C((C0wZ;b3C`9 )C̿C((Cb3C#M(C?: S5NC`9 4+C;fCC%J*C C`9 J*CFANk6;fCt4+C;fCC%J*CC`9 4+CMA]pC`9 4+C;fC`9 -C;fCt4+C./Xtؾb3C*{%Cb3CiF'C?C޳F'C)D7#˾z C޳{%Cb3C*{%C?C޳F'C*8྾̿C((C;fCV\(C;fC޳'C2bܘϾb3C(EO'C̿C((C;fC޳'C4Pjb3C(EO'C;fC޳'C?C޳F'C0S;b3C(EO'C?C޳F'Cb3CiF'CR8߾̿C((C;fC(>*C;fCV\(Cd+ ξ?C޳F'C;fC;{%Cz C޳{%C36;fCk F'C;fC;{%C?C޳F'Cf6H?C޳F'C;fC޳'C;fCk F'CY%C${%CC> F'CaFC(F'CL,5C({%CC${%CaFC(F'C##RھĊC`9 (Cb3C#M(Cb3C(EO'C^V&羊C`9 r'CĊC`9 (Cb3C(EO'C! )4վC`9 r'Cb3C(EO'CaFC(F'C޸B'澊C`9 r'CaFC(F'CC> F'C#/#PھĊC`9 (Cb3C`9 )Cb3C#M(CX-c &$KaFC(F'Cb3C*{%CC({%C`!!wb3CiF'Cb3C*{%CaFC(F'C[##&JھaFC(F'Cb3C(EO'Cb3CiF'C8 `+'C`9 F'CCs; {%CC`9 e%C7x v('C`9 F'CC> F'CCs; {%C"/C> F'CC${%CCs; {%C!c(.B'C`9 F'CC`9 r'CC> F'C 5- }C`9 {%CC`9 e%CCs; {%Cp~Jݽ Ct%@3CCO@3CCt%@3C\ Vu CO@3CCR @5CCt%@5C~WݽCt%@3CCO@3CCt%@5C3~jjQy[`kЉC(N;CiyC(=C\C޳N;CUz{L*iyC(=COC޳=C\C޳N;C&y$LѭiyC(=CgC( ?COC޳=COh{6]gC( ?ClBC޳ ?COC޳=CTq˽CƸqN2C˽C޳3CɽC޳3CWq=0˽CƸqN2CɽC޳3CICqN2Ct!|ѽICqN2CɽC޳3C_C3C(sɽC޳3CC޳5C_C3C#vڽC޳5CwC5C_C3C8vzdԽC޳5C~C޳`7CwC5Cw?rk*~C޳`7CXeC`7CwC5C=wq"۽~C޳`7CC޳8CXeC`7Cd~zgeHC޳8CWC8CXeC`7CzHѱC޳8CvnC޳Q:CWC8C{(:╽vnC޳Q:CZHCQ:CWC8C;zNV:vnC޳Q:C\C޳N;CZHCQ:C|V%b\C޳N;C:CN;CZHCQ:C |JZ%껀\C޳N;COC޳=C:CN;C:T|!urOC޳=C.C=C:CN;CE|y!΀OC޳=ClBC޳ ?C.C=C}wټlBC޳ ?C")C ?C.C=CNv >{zҽICqN2C_C3CvnCqN2Cwf?r4_C3C9\C3CvnCqN2C>w־q۽_C3CwC5C9\C3Cx~zveHݕwC5CNC5C9\C3CzHsѱwC5CXeC`7CNC5C{52XeC`7C@C`7CNC5C{'2)XeC`7CWC8C@C`7C|h|0'#KWC8C6C8C@C`7C |"~WC8CZHCQ:C6C8C|"ÃZHCQ:C")CQ:C6C8C|"aÃZHCQ:C:CN;C")CQ:C}!:CN;C CN;C")CQ:C}s:CN;C.C=C CN;C/~iP4.C=CC=C CN;C X~A⽐2ڼ.C=C")C ?CC=C|~ؽ")C ?CHC ?CC=CxM]vnCqN2C9\C3C@CPqN2Cz4BRt9\C3Cb4CP3C@CPqN2CzBd9\C3CNC5Cb4CP3CJ| ^.A7NC5C+CP5Cb4CP3C{*.;NC5C@C`7C+CP5C| 7@C`7C!CP`7C+CP5Cf|v;L@C`7C6C8C!CP`7C}AKӼ6C8CfCP8C!CP`7Ck} r66C8C")CQ:CfCP8CikSW")CQ:CCPQ:CfCP8C~⫽چ"")CQ:C CN;CCPQ:C~J. CN;CCPN;CCPQ:C~ٗ*5 CN;CC=CCPN;C85lC=CCP=CCPN;C35}͵C=CHC ?CCP=CH5HC ?C* CP ?CCP=C{ݷ/.u@CPqN2Cb4CP3CCjFJ?qN2CW|b .b4CP3C<CjFJ?3CCjFJ?qN2C|^7b4CP3C+CP5C<CjFJ?3C}v+CP5CwCjFJ?5C<CjFJ?3CVu}\O8+CP5C!CP`7CwCjFJ?5CU~JA]!CP`7C CjFJ?`7CwCjFJ?5CP~b佲Ӽ!CP`7CfCP8C CjFJ?`7CA fCP8C CjFJ?8C CjFJ?`7CB~gOfCP8CCPQ:C CjFJ?8C~$CPQ:CCjFJ?Q:C CjFJ?8C~.CPQ:CCPN;CCjFJ?Q:C.GļN<CPN;C* CjFJ?N;CCjFJ?Q:CRRļCPN;CCP=C* CjFJ?N;Cn2ѼCP=CCjFJ?=C* CjFJ?N;Cy29CP=C* CP ?CCjFJ?=CD<* CP ?C* CjFJ? ?CCjFJ?=C8~Gy|0Ct%@3C<CjFJ?3CCO@3C:~,.Ct%@3CCt%@qN2C<CjFJ?3Ck}; .Ct%@qN2CCjFJ?qN2C<CjFJ?3C8~Iyx wCjFJ?5CCO@3C<CjFJ?3C~DzCR @5CCO@3CwCjFJ?5Cw~mYmBYwCjFJ?5C CjFJ?`7C&Ct%@`7C7R> CjFJ?`7C CjFJ?8C&Ct%@`7C7R> CjFJ?8C&Ct%@8C&Ct%@`7CE>1 CjFJ?8CCjFJ?Q:C&Ct%@8CreQ<CjFJ?Q:CCt%@Q:C&Ct%@8CwQH[<CjFJ?Q:C* CjFJ?N;CCt%@Q:CC<* CjFJ?N;C* Ct%@N;CCt%@Q:C篼* CjFJ?N;CCjFJ?=C* Ct%@N;C{2=<CjFJ?=CCt%@=C* Ct%@N;Co2=c<CjFJ?=C* CjFJ? ?CCt%@=C;5=d<* CjFJ? ?CHCt%@ ?CCt%@=CM~潬Ct%@qN2CCt%@3CCg#@qN2CE10<&Ct%@`7CCaoL@`7CCt%@8P6C㹼9=CaoL@`7CCN@8CCN@7C E:=CaoL@`7C&Ct%@`7CCN@8Cwj<&Ct%@`7C&Ct%@8CCN@8C<<&Ct%@8CCt%@Q:CCN@8C&$<$<Ct%@Q:Cl CN@Q:CCN@8C &<ۯ<Ct%@Q:C* Ct%@N;Cl CN@Q:C5=0=* Ct%@N;CHCN@N;Cl CN@Q:CH5=<* Ct%@N;CCt%@=CHCN@N;CD=H(=Ct%@=CCN@=CHCN@N;ClՁ=ŵ<Ct%@=CHCt%@ ?CCN@=Cnɀ=ړjv #*qC޳qN2C9C(qN2CzC(3C n+Z pC(5C˽Cu3CzC(3C"nƩl˽CY5C˽Cu3CpC(5C+n8J?ӽC(`7C˽CY5CpC(5Cfr(`u˽C=`7C˽CY5C?ӽC(`7CMrK| ?ӽC(`7C˽C(7C˽C=`7Co棾{ qC޳qN2C˽C޳3C˽CƸqN2C3\G辣ChƛC`9 qN2CC`9 b2CCK qN2CyYH,C`9 ?CʆC`9 <@CgC( ?CizM#VʆC`9 <@C\C(<@CgC( ?C>zM9ʆC`9 <@CiyC`9 UBC\C(<@C{8}<+iyC`9 UBCSC(UBC\C(<@CX{&8iyC`9 UBCprC`9 CCSC(UBC{3prC`9 CCMC(CCSC(UBC|3y=prC`9 CCpC`9 *ECMC(CC_|V(pC`9 *ECMC(*ECMC(CC|U(@<pC`9 *ECqC`9 z$GCMC(*EC|<$JkC޳hKCegChKC5MCYJCR~9ؽH0")C ?C6 C<@CHC ?Ct*F26 C<@CC<@CHC ?Ct Faa6 C<@CCUBCC<@CX|CUBCCUBCC<@CW|CUBCCCCCUBC#q<CCCKCCCCUBC#=CCC^'C*ECKCCC#=^'C*ECC*ECKCCC z<^'C*EC+Cz$GCC*ECǑ_=+Cz$GC*Cz$GCC*EC==+Cz$GCy;CɾHC*Cz$GC&=y;CɾHCy;CɾHC*Cz$GC 4a=y;CɾHC5MCYJCy;CɾHC~;hҿ=5MCYJCNCYJCy;CɾHC}+;>5MCYJCegChKCNCYJC-~E=egChKCegChKCNCYJC9%5#\HC ?CC<@C* CP ?C䱼R<C<@C`CP<@C* CP ?CBC<@CCUBC`CP<@Co<CUBCCPUBC`CP<@C<CUBCKCCCCPUBC]%ZZegChKCsCPhKCVCPYJC2w<* CP ?C`CP<@C* CjFJ? ?C)űVCPYJCsCPhKCegCjFJ?YJC({=w>sCPhKCֆCjFJ?hKCegCjFJ?YJC#د5=M,=* CjFJ? ?CCjFJ?<@CHCt%@ ?C%=Z=CjFJ?<@C#Ct%@<@CHCt%@ ?C%= <CjFJ?<@CKCjFJ?UBC#Ct%@<@CQJhZz=-=KCjFJ?UBC#Ct%@UBC#Ct%@<@CQaz=#=KCjFJ?UBCCjFJ?CC#Ct%@UBC~*=ko=CjFJ?CC/Ct%@CC#Ct%@UBC~$ =q=CjFJ?CC+CjFJ?*EC/Ct%@CC ~S==+CjFJ?*EC?Ct%@*EC/Ct%@CC},9=J=+CjFJ?*ECrQ>egCjFJ?YJCCt%@YJCzgCt%@ɾHC"zV>]>egCjFJ?YJCֆCjFJ?hKCCt%@YJCyz+ >?>ֆCjFJ?hKCQCt%@hKCCt%@YJCN:=i=HCt%@ ?C#Ct%@<@C6 CN@ ?C~]=u=#Ct%@<@C,CN@<@C6 CN@ ?CK~=$-=#Ct%@<@C#Ct%@UBC,CN@<@Cs ~5==#Ct%@UBC9CN@UBC,CN@<@Cj!~F=n=#Ct%@UBC/Ct%@CC9CN@UBC)G}G=/=/Ct%@CCICN@CC9CN@UBC;J}J=|=/Ct%@CC?Ct%@*ECICN@CCg}_=}=?Ct%@*ECbVCN@*ECICN@CC^}^=(=?Ct%@*EChPCt%@z$GCbVCN@*ECi|Ӗ>Y=hPCt%@z$GCkCN@z$GCbVCN@*EC1|x>W=hPCt%@z$GCzgCt%@ɾHCkCN@z$GChg{H>h=zgCt%@ɾHCfCN@ɾHCkCN@z$GC+{>>zgCt%@ɾHCCt%@YJCfCN@ɾHCznW> >Ct%@YJCtCN@YJCfCN@ɾHCy>'>Ct%@YJCQCt%@hKCtCN@YJC'Sw8><>QCt%@hKCɽCN@hKCtCN@YJCz|]6=C`9 hKCC`9 MC{C(hKCz|69^=C`9 MCC(MC{C(hKCپ{y>C`9 MCɽC`9 (OCC(MC{kͽ>ɽC`9 (OC䴽C((OCC(MCtzɽE8>˽C`9 AOC˽C("PC䴽C((OCd{@ͽ#>ɽC`9 (OC˽C`9 AOC䴽C((OC`}-:={C(hKCC(MCkC޳hKC}r >C(MC8C޳MCkC޳hKCn|QreH>C(MC䴽C((OC8C޳MC~u|Dw >䴽C((OCUC޳(OC8C޳MCezznCL>˽C("PC˽C޳ȄPCUC޳(OC+U{t*v8>䴽C((OC˽C("PCUC޳(OCGz}2* >kC޳hKC8C޳MCegChKCGz}2* >8C޳MCCMCegChKC|ơT>8C޳MCUC޳(OCCMCV|!>UC޳(OCC(OCCMC\z|@[>˽C޳ȄPC˽CdPCC(OCz¹L>UC޳(OC˽C޳ȄPCC(OC} >egChKCCMCegChKCS|CMC8CMCegChKCX|<CMCC(OC8CMC{,=L2>C(OCC(OC8CMC.y"=`>˽CdPC˽C?PCC(OCyū=m[>C(OC˽CdPCC(OCW|egChKC8CMCsCPhKC|>E\=)>8CMCfCPMCsCPhKCڸ{z[=4)2>8CMCC(OCfCPMC!z ^=fJ>C(OCCP(OCfCPMCζxʥ=rc>˽C?PC˽CPOCCP(OC9y<=_>C(OC˽C?PCCP(OC?{='>sCPhKCfCPMCֆCjFJ?hKCg6z&=4>fCPMCݫCjFJ?MCֆCjFJ?hKC{xv=KO>˽C=(OC˽CjFJ?sNCݫCjFJ?MCxK=IO>˽C=(OCݫCjFJ?MCCP(OC4y}=SI>CP(OCݫCjFJ?MCfCPMCwC=c>CP(OC˽CPOC˽C=(OCiy >Z44>ֆCjFJ?hKCݫCjFJ?MCQCt%@hKC$y>]:>ݫCjFJ?MCɽCt%@MCQCt%@hKCu%>j>˽CjFJ?sNC˽Ct%@`MCɽCt%@MCxG>xN>ݫCjFJ?MC˽CjFJ?sNCɽCt%@MC?YvD>D>˽C@MC˽CN@2 LCɽCN@hKCv+A>neA>˽C@MCɽCN@hKCɽCt%@MCw8>)9>ɽCt%@MCɽCN@hKCQCt%@hKCFt?>i>ɽCt%@MC˽Ct%@`MC˽C@MC&|4L9>ڽC(VPC˽C`9 AOCC`9 VPCzd½2-1>˽C("PC˽C`9 AOCڽC(VPCzX>>C`9 VPCC`9 \RCڽC(VPCzM?>C`9 \RC.C(\RCڽC(VPCzC@>C`9 \RCj8C`9 SC.C(\RC=zSfS>j8C`9 SC,C(SC.C(\RC5zKf:S>j8C`9 SCcC`9 DUC,C(SCDyef>cC`9 DUC[C(DUC,C(SCLyje>cC`9 DUC C`9 +WC[C(DUC?kx㞣 v> C`9 +WCюC(+WC[C(DUC|v+>C`9 ZWCC(tWCюC(+WCx C`9 +WCC`9 ZWCюC(+WC{Z1>ҽC޳VPC˽C("PCڽC(VPCzh?H>˽C޳ȄPC˽C("PCҽC޳VPCQF{RN?>ڽC(VPC.C(\RCҽC޳VPC@z_hQW>.C(\RC4C޳\RCҽC޳VPCnzh~S>.C(\RC,C(SC4C޳\RCuzI?ZO>,C(SC(C޳SC4C޳\RCvfy]z7f>,C(SC[C(DUC(C޳SCͰxr>[C(DUCZC޳DUC(C޳SCvx繻v>[C(DUCюC(+WCZC޳DUCmv$юC(+WC˒C޳+WCZC޳DUC*v<>C(tWCC޳WWC˒C޳+WCEzv<>юC(+WCC(tWC˒C޳+WC{ݞ:H>3ҽCVPC˽C޳ȄPCҽC޳VPCnyKDY`>˽CdPC˽C޳ȄPC3ҽCVPCFz&:VW>ҽC޳VPC4C޳\RC3ҽCVPC zҞ;m[>4C޳\RC5C\RC3ҽCVPCz;cO>4C޳\RC(C޳SC5C\RCw^y8&(C޳SCy.CSC5C\RC~xr< r>(C޳SCZC޳DUCy.CSCvT=T>ZC޳DUCeCDUCy.CSCvU6l=Qщ>C9+WCCVCeCDUCR vq=>C9+WCeCDUC˒C޳+WC!vT=̆>˒C޳+WCeCDUCZC޳DUCdu^p=x>˒C޳+WCC޳WWCC9+WCy#=,`>ڽCVPC˽CdPC3ҽCVPCTy#='`>˽C?PC˽CdPCڽCVPCy62#=A[>3ҽCVPC5C\RCڽCVPCxʡn=6m>5C\RC C\RCڽCVPC' yqo=e>5C\RCy.CSC C\RC\xO=nn>y.CSCy.CSCeCDUCeCDUC}uCDUCCVCCyVC}uCDUC0u=>eCDUCCVC}uCDUC(xe=_>RCPVPC˽C?PCڽCVPCx=_>˽CPOC˽C?PCRCPVPC,;x=l>ڽCVPC C\RCRCPVPCQvx=9}> C\RC CP\RCRCPVPC w?=m> C\RC}uCDUCdCPDUCSCPSC*rߊ=F>CyVCCPUCdCPDUC's=oݔ>}uCDUCCyVCdCPDUCx=)XO>˽C=(OCֽCjFJ?(OC˽CjFJ?sNCwo=c>˽CPOCֽCjFJ?(OC˽C=(OCwu=^>˽CPOCRCPVPCֽCjFJ?(OCv,9>Fj>RCPVPCjCjFJ?VPCֽCjFJ?(OC u>۠|>RCPVPC CP\RCjCjFJ?VPC@w~Y=^m> CP\RC8CjFJ?\RCjCjFJ?VPCπv=y> CP\RCSCPSC8CjFJ?\RCv=Pw>SCPSC2lCjFJ?SC8CjFJ?\RC}r'+ >B>CuDUCCjFJ?.UC2lCjFJ?SCr%' >YA>CuDUC2lCjFJ?SCdCPDUC"t4=H>dCPDUC2lCjFJ?SCSCPSC5r' >28>dCPDUCCPUCCuDUCw >NN>Ct%@(OC˽CjFJ?sNCֽCjFJ?(OCv/>]>˽Ct%@`MC˽CjFJ?sNCCt%@(OC.v>j>ֽCjFJ?(OCjCjFJ?VPCCt%@(OC>1w>]>jCjFJ?VPC%Ct%@VPCCt%@(OC]v>kl>jCjFJ?VPC8CjFJ?\RC%Ct%@VPCv >uj>8CjFJ?\RCVCt%@\RC%Ct%@VPCu/>-w>8CjFJ?\RC2lCjFJ?SCVCt%@\RC/r54>:>2lCjFJ?SCcCt%@SCVCt%@\RC.Wq/.>>CjFJ?.UCCt%@"TCcCt%@SCp$3>\>2lCjFJ?SCCjFJ?.UCcCt%@SCrw}9>9>˽C@MC@CN@MC˽CN@2 LC`>˽Ct%@`MC@CN@MC˽C@MCmu8>Ȩ\>˽Ct%@`MCCt%@(OC@CN@MC v(4>`Y>Ct%@(OCCN@(OC@CN@MCu4>\>Ct%@(OC%Ct%@VPCCN@(OCu4>\>%Ct%@VPCKCN@VPCCN@(OC$u4>خi>%Ct%@VPCVCt%@\RCKCN@VPCrJH>0}>VCt%@\RCCN@\RCKCN@VPCfppL>?5>CF(@SCCN@RCCN@\RChoP>ΐ>CF(@SCCN@\RCcCt%@SC1.qF>>cCt%@SCCN@\RCVCt%@\RC?oqP>>cCt%@SCCt%@"TCCF(@SCW[xYx>rƾC(XCC`9 ZWCrƾC`9 XC)w>C(tWCC`9 ZWCrƾC(XC!wl\˾C޳XCC(tWCrƾC(XCvh<>C޳WWCC(tWC\˾C޳XCϷuϽp=u>C9+WC[C+WCCVCcudp=x>C޳WWC[C+WCC9+WCqtvl=[O>C޳WWC\˾C޳XC[C+WCtX={>\˾C޳XCs۾CXC[C+WCu=>C+WCCVC[C+WC"tw=v>CyVCCVCC+WCGtl=F>[C+WCs۾CXCC+WCs=m_>s۾CXCKCXCC+WCvs=k>i;CP+WCCyVCC+WC; sa&=f۔>CPUCCyVCi;CP+WCus=4>C+WCKCXCi;CP+WC4r+=X>KCXC6 CPXCi;CP+WCr. >*F>CuDUCOCjFJ?DUCCjFJ?.UCr$/ >?>CPUCOCjFJ?DUCCuDUCSyrl >5u>CPUCi;CP+WCOCjFJ?DUCzrݪ >>i;CP+WCCjFJ?+WCOCjFJ?DUCrQ >|>i;CP+WC6 CPXCCjFJ?+WCrQ >|>6 CPXC)CjFJ?XCCjFJ?+WCuOqN >֖>ξCt%@DUCCjFJ?.UCOCjFJ?DUCNqre'>k>Ct%@"TCCjFJ?.UCξCt%@DUCq9'>OCjFJ?DUCCjFJ?+WCξCt%@DUC#5r*>A>CjFJ?+WC6 Ct%@+WCξCt%@DUCq>>CjFJ?+WC)CjFJ?XC6 Ct%@+WCmf>>;>)CjFJ?XCRCt%@XC6 Ct%@+WC pBH>/>CF(@SChCN@SCCN@RC9pH>>Ct%@"TChCN@SCCF(@SCpOH>p>Ct%@"TCξCt%@DUChCN@SCpH>>ξCt%@DUC>CN@DUChCN@SCWipYH>>ξCt%@DUC6 Ct%@+WC>CN@DUCovN>܋>6 Ct%@+WCf8CN@+WC>CN@DUCRm0J>׿>;fCNG@XC;fCN@8XCf8CN@+WCm3J>>;fCNG@XCf8CN@+WCRCt%@XCWFm)lL>oɢ>RCt%@XCf8CN@+WC6 Ct%@+WCm1J>>;fCNG@XC=~CN@XC;fCN@8XC9[x[x>rƾC`9 XCC`9 2`ZCrƾC(XCtws<(z>C`9 2`ZCC(2`ZCrƾC(XCwG<>C`9 2`ZC/C`9 [CC(2`ZCvn<6>/C`9 [C3C([CC(2`ZC s`= >;fC`9 +]C;fC(;]C3C([CvC<&>/C`9 [C;fC`9 +]C3C([CwrƾC(XCC(2`ZC\˾C޳XCv*=o>C(2`ZCC޳2`ZC\˾C޳XCv1=o>C(2`ZC3C([CC޳2`ZCs =c>3C([C[CC޳[CC޳2`ZCs=Җ>;fC(;]C;fC޳|\C[CC޳[Csg=0>3C([C;fC(;]C[CC޳[C%*vr=%>\˾C޳XCC޳2`ZCs۾CXCtǿ=Տ>C޳2`ZCC2`ZCs۾CXCms=F>C޳2`ZC[CC޳[CC2`ZC˓qb=v>[CC޳[C[C[CC2`ZC*q:=Ѡ>;fC޳|\C;fC:\C[C[CrLr=>[CC޳[C;fC޳|\C[C[CzSt=ٸ>s۾CXCC2`ZCKCXCs#=\G>C2`ZC.C2`ZCKCXCgp+=S>;fClV[C;fC [C.C2`ZC{p=a>;fClV[C.C2`ZC[C[CqD=>[C[C.C2`ZCC2`ZC*q9=Ѡ>[C[C;fC:\C;fClV[C#JsD_=>KCXC.C2`ZC6 CPXCJp>4>.C2`ZCNCP2`ZC6 CPXCcn>٨>;fC [C;fCPZCNCP2`ZCo8> >.C2`ZC;fC [CNCP2`ZC0o>ۥ>;fC4>2`ZC;fCjFJ?#ZC)CjFJ?XCn2:>v<>;fC4>2`ZC)CjFJ?XCNCP2`ZCMq' >v>NCP2`ZC)CjFJ?XC6 CPXCcn>٨>NCP2`ZC;fCPZC;fC4>2`ZCSnŏ9>H>;fCjFJ?#ZC;fCt%@I9YCRCt%@XC:mG>>>)CjFJ?XC;fCjFJ?#ZCRCt%@XCgmk3J>Sġ>RCt%@XC;fCt%@I9YC;fCNG@XCv@l=҉>tC(є]C;fC`9 +]CHhC`9 є]Cqsb"d=hʛ>;fC(;]C;fC`9 +]CtC(є]Ctj=Cx>HhC`9 є]CC`9 !/_CtC(є]C ity=>C`9 !/_C*C(!/_CtC(є]Cnuy=X>C`9 !/_CC`9 p`C*C(!/_C)cs =\V>C`9 p`CC(p`C*C(!/_CKq =>b3CcbCb3C(?bCC(p`C Lq=>b3CcbCC(p`C%C`9 cbCr=ji>%C`9 cbCC(p`CC`9 p`CKqd=>%C`9 cbCb3C`9 8bCb3CcbC#sp=>C޳є]C;fC(;]CtC(є]Cs=y>;fC޳|\C;fC(;]CC޳є]CK&tE=Z>tC(є]C*C(!/_CC޳є]Cjq0=Aҟ>*C(!/_CȿC޳!/_CC޳є]Cr =r>*C(!/_CC(p`CȿC޳!/_CǑq=r?>C(p`Ch C޳p`CȿC޳!/_CnI>O>b3C(?bCb3C޳aCh C޳p`Cip-=>C(p`Cb3C(?bCh C޳p`CX>rU= >Cє]C;fC޳|\CC޳є]C>r=b>;fC:\C;fC޳|\CCє]Cq =J>C޳є]CȿC޳!/_CCє]CpȿC޳!/_C`C!/_CCє]COqZ5=>ȿC޳!/_Ch C޳p`C`C!/_CgQnR>b>h C޳p`C,Cp`C`C!/_Cfl">>b3C޳aCb3C`C,Cp`C9nC>>h C޳p`Cb3C޳aC,Cp`C}oj=*>;fClV[C0uC[C;fC [Cs-qO#=< >;fC:\C0uC[C;fClV[C*r.=>;fC:\CCє]C0uC[C͟o4>Ž>Cє]CCє]C0uC[Ckpfp>6>Cє]C`C!/_CCє]CKo*>N >`C!/_C<C!/_CCє]C5m(>ր>b3C:mp`Cb3CH5`C<C!/_C4m8>e>b3C:mp`C<C!/_C,Cp`C nna>>,Cp`C<C!/_C`C!/_ClB>Ҥ>,Cp`Cb3C`Cb3C:mp`Cna>>aCP[C;fC [C0uC[Co>ܥ>;fCPZC;fC [CaCP[C90oI>A>0uC[CCє]CaCP[Co>ۥ>Cє]CݿCPє]CaCP[Co>1ۥ>Cє]C<C!/_CݿCPє]C m,> ><C!/_Cy(CP!/_CݿCPє]C,i:?>+x>b3CH5`Cb3CPe_Cy(CP!/_C l+>:><C!/_Cb3CH5`Cy(CP!/_C\m!>L>;fC4>2`ZC$qCjFJ?2`ZC;fCjFJ?#ZC7m!>>;fCPZC$qCjFJ?2`ZC;fC4>2`ZCn >oϥ>;fCPZCaCP[C$qCjFJ?2`ZCYLnR#>E>aCP[CCjFJ?[C$qCjFJ?2`ZC nV#>P>aCP[CݿCPє]CCjFJ?[CmK-*>8>ݿCPє]C<CjFJ?є]CCjFJ?[CiuB>U>b3CGҾ!/_Cb3CjFJ?,^C<CjFJ?є]C0AixF>/>b3CGҾ!/_C<CjFJ?є]Cy(CP!/_C%m)>L3>y(CP!/_C<CjFJ?є]CݿCPє]C;h#F>7>y(CP!/_Cb3CPe_Cb3CGҾ!/_Cly5>c>mCt%@2`ZC;fCjFJ?#ZC$qCjFJ?2`ZCUnI9>C>;fCt%@I9YC;fCjFJ?#ZCmCt%@2`ZCm5>>$qCjFJ?2`ZCCjFJ?[CmCt%@2`ZCkE`D> V>CjFJ?[CQCt%@[CmCt%@2`ZClTE>>CjFJ?[C<CjFJ?є]CQCt%@[CkjqV><><CjFJ?є]C'1Ct%@є]CQCt%@[Cgx]>H>b3CjFJ?,^Cb3Ct%@]C'1Ct%@є]ChT>uM><CjFJ?є]Cb3CjFJ?,^C'1Ct%@є]Cm1J>¡>;fCt%@I9YC=~CN@XC;fCNG@XCm/J>>;fCt%@I9YCmCt%@2`ZC=~CN@XC GlS>4>mCt%@2`ZCeƿCN@2`ZC=~CN@XC~j+R>֭>mCt%@2`ZCQCt%@[CeƿCN@2`ZCj*k-Q>/>QCt%@[CCN@[CeƿCN@2`ZC]fp>7>b3CYk@є]Cb3CN@v\CCN@[CXfp>n >b3CYk@є]CCN@[C'1Ct%@є]C̳j8P>ί>'1Ct%@є]CCN@[CQCt%@[Ce:p>>'1Ct%@є]Cb3Ct%@]Cb3CYk@є]Cp=>b3CcbC9C(cbCb3C(?bCʻp]=>b3C`9 8bC9C(cbCb3CcbCGq5=~>b3C`9 8bCjC`9 cC9C(cbCn&p=>jC`9 cCԁC(cC9C(cbCbtp"=5/>jC`9 cCC`9 ^eCԁC(cCbtp"=5/>C`9 ^eC&C(^eCԁC(cC(o>VC޳cbCb3C(?bC9C(cbC?8nQh>>b3C޳aCb3C(?bCVC޳cbCTo>L_>9C(cbCԁC(cCVC޳cbCn >N>ԁC(cCC޳cCVC޳cbC|o}n >>ԁC(cC&C(^eCC޳cCq1lR(>>&C(^eCC޳^eCC޳cCm|>|>wxCcbCb3C޳aCVC޳cbC m>>b3C`Cb3C޳aCwxCcbCTn>F>VC޳cbCC޳cCwxCcbC'm%><>C޳cCCcCwxCcbCBkK,>ir>C9^eCC37eCCcCwBk,>r>C9^eCCcCC޳^eCVlB$>ֿ>C޳^eCCcCC޳cCl>颱>b3C:mp`C*OCp`Cb3CH5`Cl&>T>b3C`C*OCp`Cb3C:mp`CRom>Go>b3C`CwxCcbC*OCp`CxkA->O>wxCcbC&CcbC*OCp`C"l->>wxCcbCCcC&CcbC7j=>>CcCNCcC&CcbCdgO>>C37eCC^ZdCNCcCˍj?=>!>CcCC37eCNCcC~CkdD>u>yCPp`Cb3CH5`C*OCp`C6iO;>>>b3CPe_Cb3CH5`CyCPp`CjoC> >*OCp`C&CcbCyCPp`Ck:>>&CcbCCPcbCyCPp`C0gS>B>C?cCCPxcCCPcbC0gS>>C?cCCPcbCNCcCjwS:>:>NCcCCPcbC&CcbCd/gS>B>NCcCC^ZdCC?cCh,F>F>b3CGҾ!/_CTCjFJ?!/_Cb3CjFJ?,^Ch-F>}A>b3CPe_CTCjFJ?!/_Cb3CGҾ!/_Ci'E>O>b3CPe_CyCPp`CTCjFJ?!/_Ci/B>A>yCPp`CCjFJ?p`CTCjFJ?!/_CCkD>s>yCPp`CCPcbCCjFJ?p`Clf-e>d>CPcbCCjFJ?cbCCjFJ?p`CYd;'n>'x>CPxcCCjFJ?bCCjFJ?cbCQf e>,>CPcbCCPxcCCjFJ?cbCgx#Y>>#Ct%@!/_Cb3CjFJ?,^CTCjFJ?!/_C5g&Y>>b3Ct%@]Cb3CjFJ?,^C#Ct%@!/_ChY>ɶ>TCjFJ?!/_CCjFJ?p`C#Ct%@!/_CgY_>>CjFJ?p`C,Ct%@p`C#Ct%@!/_CWSdEn>ދ>CW}?cbCCt%@SaC,Ct%@p`CVd.n>s>CW}?cbC,Ct%@p`CCjFJ?cbCfu^>>CjFJ?cbC,Ct%@p`CCjFJ?p`CYdK1n>w>CjFJ?cbCCjFJ?bCCW}?cbC;f(p>>b3CYk@є]CfCN@є]Cb3CN@v\CvfQp> >b3Ct%@]CfCN@є]Cb3CYk@є]C[fÃp>>b3Ct%@]C#Ct%@!/_CfCN@є]CfWq>k>#Ct%@!/_CCN@!/_CfCN@є]Ca>u>CL^@p`CCN@!m`CCN@!/_CaI>V>CL^@p`CCN@!/_C,Ct%@p`Cfq>Ӷ>,Ct%@p`CCN@!/_C#Ct%@!/_C b>>,Ct%@p`CCt%@SaCCL^@p`Ci2>>C9^eC.C^eCC37eCk>hS><ƻ>BC^eCC37eC.C^eCfgO>>C^ZdCC37eCBC^eCRe X[>e>C?cCCPcCCPxcC{QeV[>l>C^ZdCCPcCC?cC`f1Y>$r>C^ZdCBC^eCCPcC6f]>J>BC^eC6tCP^eCCPcC>TdBn>x> SCjFJ?cCCPxcCCPcCSd:?n>(>CjFJ?bCCPxcC SCjFJ?cChIeeBo>>CPcC6tCP^eC SCjFJ?cCѻcx>u>6tCP^eC?CjFJ?^eC SCjFJ?cCIcrr>>CW}?cbCi0Ct%@cbCCt%@SaCIcrr>z>CjFJ?bCi0Ct%@cbCCW}?cbCbdr>V>CjFJ?bC SCjFJ?cCi0Ct%@cbCam>> SCjFJ?cCCt%@cCi0Ct%@cbCp`~>>CN ?^eCCt%@`eCCt%@cCo`>>CN ?^eCCt%@cC?CjFJ?^eCBct>>?CjFJ?^eCCt%@cC SCjFJ?cC_o>s>CL^@p`CCN@p`CCN@!m`C(_sp>}>Ct%@SaCCN@p`CCL^@p`C`>[>Ct%@SaCi0Ct%@cbCCN@p`C1a>&>i0Ct%@cbCE>C1N|@cCCN@KcC>C1N|@cC>Ct%@cCA>Ct%@cCCt%@`eCC1N|@cC[^.P>>CN ?^eCCt%@^eCCt%@`eC0ZBǛ>0>C1N|@cC#CN@cCCN@KcCZMț>>Ct%@`eC#CN@cCC1N|@cCw\ʖ>>Ct%@`eCCt%@^eC#CN@cC=YAb>1>Ct%@^eC6CN@^eC#CN@cCk0>0>C]d 2gCC(SfC&C(^eCQjk >3>C]d 2gC&C(^eCrC`9 2gCn?y=Z>rC`9 2gC&C(^eCC`9 ^eC“l.>>rC`9 2gCC`9 y=gCC]d 2gCCiޭ+>ܿ>C(SfCC޳eCC޳^eCjN'>>&C(^eCC(SfCC޳^eCpiS+>>C޳^eCC޳eCC9^eCjE>.Ͽ>C]d 2gCC(2gCC(SfCKl0>>C`9 y=gCC(2gCC]d 2gC?4m{Y>G>C`9 y=gCsLC`9 hCC(2gC|m>:>sLC`9 hC+iC(hCC(2gCWHmS>PT>sLC`9 hChC`9 MgjC+iC(hC-i)%>7>hC`9 MgjCC(MgjC+iC(hCEij#>vo>C`9 [kCC(jCC(MgjChx$>>hC`9 MgjCC`9 [kCC(MgjCi%>c>#@C޳2gCC(SfCC(2gCpj(>~>C޳eCC(SfC#@C޳2gCHl'>gR>C(2gC+iC(hC#@C޳2gCaj5>n>+iC(hCC޳hC#@C޳2gCΨib+>>C6MgjCC޳tiCC޳hC Vi/>`>C6MgjCC޳hCC(MgjCJh4>^>C(MgjCC޳hC+iC(hCzhc.>>C(MgjCC(jCC6MgjCg1>n>C޳eC.C^eCC9^eC;j9.>aa>C޳eC#@C޳2gC.C^eC݅hh:>d>#@C޳2gCAiC2gC.C^eC-#j ;>퉸>#@C޳2gCC޳hCAiC2gCi-=>2>C޳hCvChCAiC2gCJe"ZM>C>C޳tiCC$iCvChChf<>0>C޳hCC޳tiCvChCngKQR>>.C^eCAiC2gCBC^eCg4hO>>AiC2gC"C2gCBC^eCPe2j>*>CZhCC3hC"C2gCee>>CZhC"C2gCvChC ivP>~>vChC"C2gCAiC2gC[dd>P >vChCC$iCCZhCgB^>>BC^eC"C2gC6tCP^eCPXej><>"C2gCwCP2gC6tCP^eCa*x>e>C3hCCPrp,>"C2gCC3hCwCP2gC o`>>CbA2gCCjFJ?*fC?CjFJ?^eCk`>>CbA2gC?CjFJ?^eCwCP2gCxdy>?W>wCP2gC?CjFJ?^eC6tCP^eCVh`O>>wCP2gCCPr$>?CjFJ?^eCCjFJ?*fCCN ?^eCh">Eo>C(lCC`9 [kCHC`9 lCj >>C(jCC`9 [kCC(lCűhQ>Cu>HC`9 lC5IC`9 mCC(lCTh%>ys>5IC`9 mCjC(mCC(lC_f'>>ښC`9 oCښC(drnCjC(mCFh>s>5IC`9 mCښC`9 oCjC(mCMh.>>C6MgjC4C޳MgjCC޳tiChV.>_>C(jC4C޳MgjCC6MgjCai->>C(jCC(lC4C޳MgjChT4>>C(lC:C޳lC4C޳MgjCg094>(>C(lCjC(mC:C޳lCWdfL>>jC(mCC޳mC:C޳lCbT>>ښC(drnCښC޳+{>jC(mCښC(drnCC޳mC1gS>>8CMgjCC޳tiC4C޳MgjCoeYM> >C$iCC޳tiC8CMgjC 1gS>>4C޳MgjC:C޳lC8CMgjC%3e`>h>:C޳lCmClC8CMgjC6a5f>B{>ښCmCښCslCmClCaf>s>ښCmCmClCC޳mCn(c^>!>C޳mCmClC:C޳lCaf>>C޳mCښC޳R>CZhC%ChCC3hCbpl>E>C$iC%ChCCZhChMdj>>C$iC8CMgjC%ChCco>>8CMgjCJCMgjC%ChCÞbz>>ښCqP.lCښCkCJCMgjCb|z>d>ښCqP.lCJCMgjCmClCedzo>ڶ>mClCJCMgjC8CMgjC`x>>mClCښCslCښCqP.lCCcr>C>)CPhCC3hC%ChCa' x>J>CPr>%ChCJCMgjC)CPhC)a9>]>JCMgjCVCPMgjC)CPhCG_8>d>ښCkCښCP:jCVCPMgjCIa{>>JCMgjCښCkCVCPMgjCG_>`c>CbA2gC> CjFJ?2gCCjFJ?*fCQF_>j>CPr CjFJ?2gCCbA2gC`S>ݙ>CPr CjFJ?2gC`Z>rt>)CPhCgCjFJ?hC> CjFJ?2gCA]>}>ښC䩾MgjCښCjFJ?viCgCjFJ?hC\.>7h>ښC䩾MgjCgCjFJ?hCVCPMgjC=`)>>VCPMgjCgCjFJ?hC)CPhC^.>C>VCPMgjCښCP:jCښC䩾MgjC^zP>>CjFJ?*fCCt%@^eCCN ?^eCS_H>9>CjFJ?*fC> CjFJ?2gCCt%@^eC<]v>>> CjFJ?2gCMCt%@2gCCt%@^eCiX<>j>ښC?hCښCt%@ifhCMCt%@2gC^Y>u>ښC?hCMCt%@2gCgCjFJ?hC_2}>xr>gCjFJ?hCMCt%@2gC> CjFJ?2gC[>>gCjFJ?hCښCjFJ?viCښC?hC4qX >q>ښCŴ|@2gCښCN@])gC6CN@^eCiX;>k>ښCŴ|@2gC6CN@^eCMCt%@2gC[>>MCt%@2gC6CN@^eCCt%@^eC#jXL;>j>MCt%@2gCښCt%@ifhCښCŴ|@2gC/߾^WS:[CAGBC2APB9CAPB{E>yN2RCoTA˟BښCLAjBC# OAjB]4yXښCLAjBښC@+GA BC# OAjB/t&y~ZC# OAjBښC@+GA BCiIA Bbr`վCqsAgBW@CqsAdBښCcpAdBar@`վCqsAgBښCcpAdBCkAB0fؗbоCkABښCcpAdBښC|dABxs0p>sښC|dABښC ]APBCkAB^ pF劾CkABښC ]APBCHcAPBO}wCYABښC ]APBښCYABRLPwCYABCo _ABښC ]APBCc^u3*1Co _ABCHcAPBښC ]APB}=T8x#ٽ*CYA6BCo _ABCYABC'wz(C[A6BCo _AB*CYA6B&[z*CYA6BCYA'BC[A6B`rj`վW@CqsAdBCqsAgBCNwAdB!oѼsADJCYAfCCbYAԞCCYAԞCژu-uѮCbYAԞCCUA#9ChCYA#9CdBqNvwCYAԞCCbYAԞChCYA#9C>vPDv1CYAKChCYA#9CCUA#9CQx}uʽ 1CYAKCCUA#9C1CXAsC:ntQ1CXAsCCUA#9CC*QAsC-u%3߽C*QAsCCANAmC1CXAsCi;buQĽ1CXAsCCANAmC1CoUAmCCuڽCANAmCCgKAC1CoUAmCfrgQ{1CoUAmCCgKAC1CpSAC`]r3)CgKACC'IAaC1CpSACqp +J1CpSACC'IAaC1CqnRAaC*pV׌C'IAaCCFGA< C1CqnRAaC%Ǿzk@1CqnRAaCCFGA< C1CRA< CIƾkf=VCFGA< CCsEA C1CRA< Cެྂf%<1CRA< CCsEA C1CWRA C2gtCCYAԞCC:^A BCYAfC:kJtCCYAԞC1CB_AԞCC:^A Bn/xy81CB_AԞC1CbA BC:^A B5mYvhCYA#9C1CB_AԞCCYAԞCuSu?1C[A#9C1CB_AԞChCYA#9COvBvhCYA#9C1CYAKC1C[A#9C,ncϽ˽C$'@AfC˽CԤ=A< CC$'@A< CUƾ3jeԽ˽CԤ=A< C˽C$:A CXeC$'@A C밾So|C$'@A< C˽CԤ=A< CXeC$'@A C9~vLCYAfCCYA B˽C2YA B?9~vLCYAfC˽C2YA BCbYAԞC :|vLCbYAԞC˽C2YA B˽C;TAԞC_:FXwį:˽C;TAԞC˽CdOA#9CCbYAԞCsb\wCbYAԞC˽CdOA#9CCUA#9CT\vZ,"˽CdOA#9C˽C.KAsCCUA#9C,'4nBӽC$'@A< CCFGA< C˽Cwn@AaCqȍCFGA< CC'IAaC˽Cwn@AaC Q`nlXeC$'@A CCFGA< CC$'@A< CξiTCsEA CCFGA< CXeC$'@A C3!wECYA BCYAfCC:^A Bot$3C$'@AV CCDF=AC ;C$'@AC})tCDF=ACCy9AaCӽC$'@AaC!qv6d ;C$'@ACCDF=ACӽC$'@AaC*ur̽˽C$'@AfCӽC$'@AaCCy9AaCP͸uرս˽C$'@AfCCy9AaC˽CԤ=A< Clq.˽CԤ=A< CCy9AaCCm5A< CC$q Cm5A< CC1A C˽CԤ=A< C.o[ٽ˽CԤ=A< CC1A C˽C$:A Cw!2wSC$^UA BCOAԞC˽C2YA B'CwOGM˽C2YA BCOAԞC˽C;TAԞCW(j!xG;COAԞCC* KA#9C˽C;TAԞC~(j!xG;˽C;TAԞCC* KA#9C˽CdOA#9C(?xb2C* KA#9CC pFAsC˽CdOA#9Ci7Mx)[#˽CdOA#9CC pFAsC˽C.KAsC·72$xZ,C pFAsCC'AAmC˽C.KAsCqJnx?˽C.KAsCC'AAmC˽C7GAmCo>to3 ;C$'@ACC'AAmCC$'@AV C6yt7 ;C$'@AC˽CCACC'AAmCJxo˽CCAC˽C7GAmCC'AAmCe{W$vӽC$'@AaC˽CCAC ;C$'@AC%$tsM˽Cwn@AaC˽CCACӽC$'@AaCluսӽC$'@AaC˽C$'@AfC˽Cwn@AaCWubu`LD;fC$'@A:C;fCpNrob3C"A CC8q#A< CCA C0>wivmC$'@A(CCm?A#9CqC$'@A#9CїNxrZb3C$'@AKCqC$'@A#9CCm?A#9Ce꽴xs}Vb3C$'@AKCCm?A#9Cb3Cc=AsC,wDhb3Cc=AsCCm?A#9CC(9AsC qSxGKC(9AsCCԜ4AmCb3Cc=AsC: %xIb3Cc=AsCCԜ4AmCb3C48AmC xDSCԜ4AmCC$/ACb3C48AmC,"Sx3wiC$'@AZCC$'@A(CC*BAԞCg*vg{C-&ALCښC-&ACښC!AaCd^*v:n{C$%AaCC-&ALCښC!AaCe*ve{ښC!AaCښCRA< CC$%AaC_9XvKCuC$%AaCښCRA< CCA< CDt碑ښCRA< CښCA CCA< CȄ$t6wCA< CښCA CCJA Cў.x ?nC$'@AZCښC$'@ACښC:A#9C ?ex~iC~),:}cC$'@AtCU)E::C$'@ACC4AC>cC$'@AtCJ C"zCռC-&A+C1C?A+C1C$'@ACvcC$'@AtC"0Fu*AC-&ABC>cC$'@AtCC,AtCc?D'C$'@AC1CaQA=@C$ϼC$'@A=@CS3a3m߽1CgMAC1CaQA=@CC$'@ACx11}GC>cC$'@AtC1CgMACC$'@ACM>s&;1CFGAtC1CgMAC>cC$'@AtC}=( %C>cC$'@AtC1C$'@AC1CFGAtC"^.W˽C7 A C˽C)A+CC7 A+CW*;$˽C)A+C˽CX@{C3C7 A{C#k/5pC7 A+C˽C)A+C3C7 A{C6t$:A f˽C-&AC˽C ACVC-&ACĬ ,7L˽C AC˽CXGAtCd.C-&AtC=@ڊVC-&AC˽C ACd.C-&AtCF;)F/'(C7 A+CC A+CC-&ABC}!/˽C7 A CC7 A+CC-&ABCOo&2w˽C7 A CC-&ABCd.C-&AtC:P4P˽C7 A Cd.C-&AtC˽CXGAtCL&=,@3C7 A{CC A+CC7 A+C~*9̟ꗾCA{CC A+C3C7 A{C־g'˽C$:A C˽C8AOq CpAC$'@AOq CƾJk~XeC$'@A C˽C$:A CpAC$'@AOq C|o^*'˽C8AOq C˽CJ4A CgC$'@A Cg׾ghpAC$'@AOq C˽C8AOq CgC$'@A Ct_C$'@ArCgC$'@A C˽CJ4A CD{^~C$'@ArC˽CJ4A CC?AC|X(T "C?AC˽CJ4A C˽Cb/AC*RvR˽Cb/AC˽C|)A=@CC?ACYN2C?AC˽C|)A=@CCd;A=@CjE냾VC-&AC˽C|)A=@C˽C-&AC}R?wVC-&ACC4AC˽C|)A=@CXKNC4ACCd;A=@C˽C|)A=@Cjs>0d.C-&AtCC4ACVC-&ACg)K5AyC,AtCC4ACd.C-&AtC&dh2d.C-&AtCC-&ABCC,AtCgξ*i pAC$'@AOq CCsEA CXeC$'@A CHdUCQDAOq CCsEA CpAC$'@AOq C\kWdgC$'@A CCQDAOq CpAC$'@AOq C;^?C\tBA CCQDAOq CgC$'@A C^;gC$'@A CC$'@ArCC\tBA C13)\Cp@pCC@{C5Cp@{C 1?ľC7 A/CC_AtC%C7 AtC(. >@麾˽C7 A C%C7 AtCC_AtCu;p-Ⱦ˽C7 A CC_AtC˽C)A+CSV6[Ѿ˽C)A+CC_AtCCyD@+Ct/5Cp@{CCyD@+CCp@pCiI&5Cp@{C˽CX@{CCyD@+C5Ծ˽CX@{C˽C)A+CCyD@+Cj侖^r:YC-&A2rCCM!ACOC-&ACv'LTXCM!ACCA=@CC-&A=@CS㾀^\OC-&ACCM!ACC-&A=@CS|˽C-&ACC-&A=@CCA=@CQ#˽C-&ACCA=@C˽C ACfF€K̢˽C ACCA=@CCmAC@h?Cg%C7 AtCCmACC7 A/C g'%C7 AtC˽C7 A C˽CXGAtCxkPnfC1A CC^-AOq C˽C$:A CľxkSl˽C$:A CC^-AOq C˽C8AOq CB3¾gΘ?C^-AOq CCx(A C˽C8AOq CLھP es˽C8AOq CCx(A C˽CJ4A C例^:YOC-&ACCx(A CC-&A2rC[]^OC-&AC˽Cb/ACCx(A C) پcL.˽Cb/AC˽CJ4A CCx(A CC-&A=@C˽Cb/ACOC-&AC>UT˽C|)A=@C˽Cb/ACC-&A=@C)fHRC-&A=@C˽C-&AC˽C|)A=@CǗ/+;fC&@~C;fCǝ@{CC&@{CDl;fCp@jC;fC_@tCaCp@tCtD9;fC_@tC;fC@+CCp@+C+Fy޾aCp@tC;fC_@tCCp@+C2aC&@{CC@{CCp@pCoK5~;fC&@~CC&@{CCp@pC7Z;fC&@~CCp@pCCp@+Ctt58t;fC&@~CCp@+C;fC@+CӾ‚YU;fC7 A2C;fC A=@C`C7 A=@C_Pι;fC A=@C;fC5ACC7 ACǢӾ>Y`C7 A=@C;fC A=@CC7 AC6YHjξaCp@tCC_AtCC7 A/C?#@G0;fCp@jCaCp@tCC7 A/Cb}H$ξ;fCp@jCC7 A/CC7 ACū߾LI߾;fCp@jCC7 AC;fC5ACQD]⾽Cp@+CC_AtCaCp@tC6=CپCyD@+CC_AtCCp@+C3/8CQCp@+CCp@pCCyD@+C 姾lBQ;fC-&A C;fC#AOq C,C-&AOq Cҷzh\;fC#AOq C;fCYA C>C-&A Cyl͢@,C-&AOq C;fC#AOq C>C-&A ChΰhqXC-&A2rC>C-&A C;fCYA C9gJbC-&A2rC;fCYA CCM!ACKb̾2`CM!AC;fCYA C;fC(AC[оo[C`C7 A=@C;fC(AC;fC7 A2CݾWh`C7 A=@CCA=@C;fC(ACu˾_XCA=@CCM!AC;fC(ACR۾U{C7 ACCA=@C`C7 A=@CUIQ"CmACCA=@CC7 ACL-ƾC7 ACC7 A/CCmAC|1GkDU,C-&AOq C;fC̶)A C;fC-&A C|UjwW,C-&AOq CC^-AOq C;fC̶)A CqM C^-AOq CC1A C;fC̶)A CKk9H>C-&A CC^-AOq C,C-&AOq C,Ih?Cx(A CC^-AOq C>C-&A CPfa>C-&A CC-&A2rCCx(A C ξm=J b3C&@Cb3C~@+CݿC&@+CCܾm71 -CN@{C;fCǝ@{C;fC&@~Chξ 5b3CN@C-CN@{C;fC&@~Cr۾͙7| b3CN@C;fC&@~CݿC&@+C,ɾ8b3CN@CݿC&@+Cb3C~@+CYξHN;fCp@jCb3Cp@b Cb3C~T@tCY^ϾJIA;fC_@tC;fCp@jCb3C~T@tCǾ^ByHݿC&@+Cb3C~T@tCb3C&@Cվ >"ݿC&@+C;fC@+Cb3C~T@tC]ʾ/Dr/;fC@+C;fC_@tCb3C~T@tCԾV=qݿC&@+C;fC&@~C;fC@+ClOcb3C7 AACb3C AC,C7 ACsMc;fC7 A2C,C7 ACb3C ACOìx` ;fC7 A2Cb3C AC;fC A=@Cc]_뵾;fC A=@Cb3C ACb3CA=@C课cVJپb3CA=@Cb3C|@C;fC A=@Ctʾ+V?S;fC A=@Cb3C|@C;fC5ACZþNb3C|@C;fCp@jC;fC5ACTʾK$b3Cp@b C;fCp@jCb3C|@C|hriR;fC-&A CBĿC-&A Cb3C"A Cfr#W;fC-&A Cb3C"A C;fC#AOq C=Dol;fC#AOq Cb3C"A Cb3C)AOq C+>im{b3C)AOq Cb3CPA C;fC#AOq C靾lu`;fC#AOq Cb3CPA C;fCYA C{Eef9,C7 ACb3CPA Cb3C7 AAC$4pGd*,C7 AC;fC(ACb3CPA CiBH;fC(AC;fCYA Cb3CPA C`g*b󝩾,C7 AC;fC7 A2C;fC(ACg?qR[BĿC-&A C;fC-&A C;fC̶)A CuJRBS b3C&@CC&@CCI.@+CFRBR b3C~@+Cb3C&@CCI.@+C*N`=4CI.@+Cb3CN@Cb3C~@+C-9OCN@Cb3CN@CCI.@+C,LU@羊Cp@CCq@CXCp@CvS'"b3Cp@b CXCp@CCq@Cw*PyOb3Cp@b CCq@Cb3C~T@tCfKJb3C~T@tCCq@CC'Y@tC GC'Y@tCb3C&@Cb3C~T@tCOGzC&@Cb3C&@CC'Y@tC𗾕sdb3C7 AACC7 A2CCACИ~meb3C ACb3C7 AACCACs-a`ľCACCB@=@Cb3C AC'Xw`٩b3C ACCB@=@Cb3CA=@C̛ Xc޾XCp@CCB@=@CCp@CjRULXCp@Cb3C|@CCB@=@C'kY$ܾb3C|@Cb3CA=@CCB@=@C QXCp@Cb3Cp@b Cb3C|@CY4q怾CA CCbDAOq Cb3C"A Cilqsob3C"A CCbDAOq Cb3C)AOq C{gnl)CbDAOq CC A Cb3C)AOq CZm򅅾b3C)AOq CC A Cb3CPA C:2qi,C A Cb3C7 AACb3CPA C痾`wdC7 A2Cb3C7 AACC A CO+KO C&@YCCã@tC/C&@tC*k=DEw>CN@+CCI.@+CC&@C@TD6CN@.C>CN@+CC&@C_cD_CN@.CC&@C/C&@tCk!CCN@.C/C&@tCCã@tC2R=i >CN@+CCN@CCI.@+C6~[_ᾲCp@qCC@=@CܑCp@=@C6[f]ᾊCp@CܑCp@=@CC@=@CjXb꾊Cp@CC@=@CCq@C*4o(Xi뾊Cq@CC@=@CCE@Cim C7 ACCp@ixC`qC7 AixC["3Cp@ixCGCp@C`qC7 AixCqcIᾩ8GCp@CUC7 AC`qC7 AixCXcYGCp@C៼Cp@ CUC7 ACim>៼Cp@ CMC7 A CUC7 ACkLm׽j៼Cp@ C/Cp@WG"CMC7 A CCrsFO/Cp@WG"C!MC7 AWG"CMC7 A C;6rj:|/Cp@WG"CCp@#C!MC7 AWG"CyuΐCp@CCȽC&@Cp(Cp@CAMֈCp@CkC&@ixCC@ixCUkL& )Cp@Cp(Cp@CkC&@ixC>^Xf\p(Cp@CȽC&@CkC&@ixCDN ,C&@CC@ixCkC&@ixCW|UCMb@CC@ixC,C&@C@p(Cp@CC8ACCCp@CCG{~CT@CC8ACCp(Cp@C9HRp(Cp@CCp@CCT@C7GJ3C7 A{CC7 A1CCA{C #C&@^lCC@CCKIC&@CCh+* о†CN@C˽C$*@C˽C&@C&$!CN@ЪC†CN@C˽C&@C)X5վCN@ЪC˽C&@CKIC&@CCz#CN@ЪCKIC&@CCC@CC,L[̾ CN@ixC˽C$*@C†CN@Cɍ7n˷˽CZ@ixC˽C$*@C CN@ixC9F%ɬ CN@ixC˽CN@؎C˽CZ@ixC^%`_%<оKIC&@CC˽Cw~@CC˽Cp@ZFC~&2C&@^lCKIC&@CC˽Cp@ZFC< )؎ѾC&@^lC˽Cp@ZFC5Cp@{CUZ)C&@^lC5Cp@{CC@{Cc^%^%?оKIC&@CC˽C&@C˽Cw~@CC,'d+#о5Cp@{C˽Cp@ZFC˽CX@{C8C0-g,5CN@CCC@CCC&@^lC8,;fCN@C,5CN@CCC&@^lC9 |.;fCN@CC&@^lCC&@{Cb/;fCN@CC&@{C;fCǝ@{CBv0-qi,5CN@CCCN@ЪCC@CC>2C&@{CC&@^lCC@{Cܾm7 -CN@{C;fCN@C;fCǝ@{Ct֗RpC[ԋ@{%CCw@F'C8C&@F'C֙qbǼC&@{%CC[ԋ@{%C8C&@F'Cr<蕇Cw@F'CCN@Z'CCN@(Cs ė$Cw@F'CCN@(C8C&@F'Cmx wػ8C&@F'CCN@(CҿC&@(C^xT wƸCN@(CCN@J*CҿC&@(CzZZ4;CN@J*C8C&@J*CҿC&@(C9y!Z8#CN@J*CCN@4+C8C&@J*C!R|,O;CN@4+C¼C&@4+C8C&@J*CH|,,CN@4+CCN@-C¼C&@4+CO} U;CN@-CüC&@-C¼C&@4+CP}C;CN@-CdCN@/CüC&@-C~~$=QݼC&@qN2CؼCp@qN2Cz˼Cp@"0CFyg!=aCp@-CHC7 A-CC7 A4+C~g8F.=aCp@-CyCp@/CHC7 A-CK~-=yCp@/CC7 A/CHC7 A-C$UK- o=yCp@/Cz˼Cp@"0CC7 A/C  a=z˼Cp@"0C3ȼC7 A"0CC7 A/Cl B=z˼Cp@"0CؼCp@qN2C3ȼC7 A"0CN~&FxC7 A(CbC-&A(CGC-&AF'C}fֽ[=FxC7 A(CC7 AJ*CbC-&A(C}6a=C7 AJ*CvC-&AJ*CbC-&A(CC~ TƄ=C7 AJ*CC7 A4+CvC-&AJ*Cne~W=C7 A4+CC-&A4+CvC-&AJ*C~vWW=C7 A4+CHC7 A-CC-&A4+CO8~F R=HC7 A-CVC-&A-CC-&A4+C=HC7 A-CC7 A/CVC-&A-C~W=C7 A/CC-&A/CVC-&A-C.=C7 A/C3ȼC7 A"0CC-&A/C}U)=n=3ȼC7 A"0CϼC-&A"0CC-&A/Cy~=I=3ȼC7 A"0CQݼC7 AqN2CϼC-&A"0Cl}U=>QݼC7 AqN2C@C-&AqN2CϼC-&A"0C1wD1C}(A{%C 4C$'@AF'C1C$'@A&Cvz@t2@>1C}(A{%C4C-&A{%C 4C$'@AF'C>}O3=4C-&A{%CGC-&AF'C 4C$'@AF'C|>GC-&AF'CbC-&A(C 4C$'@AF'CY|L~7>bC-&A(CSC$'@A(C 4C$'@AF'C~QQ=bC-&A(CvC-&AJ*CSC$'@A(C}@>vC-&AJ*C(oC$'@AJ*CSC$'@A(C~c\=vC-&AJ*CC-&A4+C(oC$'@AJ*C}q+ >C-&A4+CC$'@A4+C(oC$'@AJ*C2;~T=C-&A4+CVC-&A-CC$'@A4+C2;~T=VC-&A-CVC$'@A-CC$'@A4+C~U=VC-&A-CC-&A/CVC$'@A-Ch}o=^>C-&A/CC$'@A/CVC$'@A-CJ}=Fr=C-&A/CϼC-&A"0CC$'@A/Cԏ|]̓=>>ϼC-&A"0CQݼC$'@A"0CC$'@A/Cc};=>ϼC-&A"0C@C-&AqN2CQݼC$'@A"0C#|Ȳ=>@C-&AqN2CoC$'@AqN2CQݼC$'@A"0Ccz~C>> 4C$'@AF'C1C[CAF'C1C$'@A&Cɢzၺ:>1C[CAF'CGCYA(C1CYA'C.z2ɾXS<>1C[CAF'C 4C$'@AF'CGCYA(C|zrQ> 4C$'@AF'CSC$'@A(CGCYA(CF}XO{>SC$'@A(C(oC$'@AJ*CGCYA(C/|Qo.>(oC$'@AJ*CjCYAJ*CGCYA(C}Q" >(oC$'@AJ*CC$'@A4+CjCYAJ*Ct|z4<6)>C$'@A4+C CYA4+CjCYAJ*CO8~F< R=C$'@A4+CVC$'@A-C CYA4+CX|\/=>VC$'@A-CBCYA-C CYA4+C}w0=T>VC$'@A-CC$'@A/CBCYA-C{Sͤ=)>C$'@A/CμCYA/CBCYA-CB|:=p>C$'@A/CQݼC$'@A"0CμCYA/Cz= 1>QݼC$'@A"0CCYA"0CμCYA/Cey)>5>CJJBAqN2CCYA[41CCYA"0Cޡy80>_5>CJJBAqN2CCYA"0CoC$'@AqN2C{{u=>oC$'@AqN2CCYA"0CQݼC$'@A"0C{0X=;>OBCqsA(C1CYA'CGCYA(Cay#Dg>1CqsA (C1CYA'COBCqsA(CZ.|!k.>GCYA(CjCYAJ*COBCqsA(CziɱjCYAJ*C(oCqsAJ*COBCqsA(C h|y<~)>jCYAJ*C CYA4+C(oCqsAJ*CV{,==> CYA4+CەCqsA4+C(oCqsAJ*C|-=t> CYA4+CBCYA-CەCqsA4+Cizd==>BCYA-CCqsA-CەCqsA4+C{=p)>BCYA-CμCYA/CCqsA-CNyw=E>μCYA/CCqsA/CCqsA-Cܘx>"iK>Cp{dA"0CCqsA0CCqsA/C"xP>fK>Cp{dA"0CCqsA/CCYA"0CzD=61>CYA"0CCqsA/CμCYA/C^y)>5>CYA"0CCYA[41CCp{dA"0CGys<g>GCA(C1CqsA (COBCqsA(Cw7p<}>1CA(C1CqsA (CGCA(Cz]<\Z>OBCqsA(C(oCqsAJ*CGCA(C,xO=u>(oCqsAJ*CyCAJ*CGCA(C|;{KR==>(oCqsAJ*CەCqsA4+CyCAJ*CӨxҴ= b>ەCqsA4+CCA4+CyCAJ*Czb1=+=>ەCqsA4+CCqsA-CCA4+Cuy$=L>CqsA-CxҼCA-CCA4+C6su)0>Juu>C˃A/CCA.CxҼCA-Csu2>uu>C˃A/CxҼCA-CCqsA/Cyq=cE>CqsA/CxҼCA-CCqsA-Cpwڳ>"J>CqsA/CCqsA0CC˃A/CmoPxTCN@F'CC[ԋ@{%CCN@{%C q]Cw@F'CC[ԋ@{%CTCN@F'C qTCN@F'CCN@Z'CCw@F'CXy( >m9>CJJBAqN2CCYAqN2CCYA[41CwF >rT>Cp{dA"0CCqsA"0CCqsA0Cs y"I>h=>CYA[41CCqsA"0CCp{dA"0CnHy >/9>CYA[41CCYAqN2CCqsA"0Cny: >dz7>CYAqN2C5CqsAqN2CCqsA"0Cht9">>C˃A/CCA/CCA.Cw($>S>CqsA0CCA/CC˃A/Cwp$>3S>CqsA0CCqsA"0CCA/CwH>pN>CqsA"0C0CA"0CCA/Cxq >%7>CqsA"0C5CqsAqN2C0CA"0C2RtL>HGc>5CqsAqN2C`CAqN2C0CA"0Ce8>QCQA3CC-&A-3C@C-&AqN2C[|ij=>CQA3C@C-&AqN2C^C7 A3C ~ =o=^C7 A3C@C-&AqN2CQݼC7 AqN2CXr}V>=N=^C7 A3CC7 A4CCQA3C d{<=v >C-&A-3CC$'@Ak2CoC$'@AqN2C|==>@C-&AqN2CC-&A-3CoC$'@AqN2Cz>'>oC$'@AqN2CC$'@Ak2CCJJBAqN2CWfs<=C@`7CC&@`7CC&@6CëO<ݱ9=CN@7CC&@`7CC@`7Cɹ<9=CN@7CCN@8CC&@`7C1X2=F=CN@8CC&@8CC&@`7C)2=<CN@8Cl CN@Q:CC&@8C4Ї=>5=l CN@Q:CC&@Q:CC&@8C7=V0=l CN@Q:CHCN@N;CC&@Q:C.=r5=HCN@N;C C&@N;CC&@Q:Cn7q=(=HCN@N;CCN@=C C&@N;C~F=z=CN@=C-C&@=C C&@N;CT~`=B<CN@=C6 CN@ ?C-C&@=C;}<=0Ho=6 CN@ ?C9C&@ ?C-C&@=C{%]9=%=l Cp@`7CC&@6CC&@`7Cú~)=@=Cp@6CC&@6Cl Cp@`7C,9==C&@`7CC&@8Cl Cp@`7CIv~]=`=C&@8CfCp@8Cl Cp@`7C.=Z5=C&@8CC&@Q:CfCp@8C=o~>=Я=C&@Q:C*Cp@Q:CfCp@8C;~"="5=C&@Q:C C&@N;C*Cp@Q:Co}}q=V= C&@N;C9Cp@N;C*Cp@Q:C}=Uz= C&@N;C-C&@=C9Cp@N;C7}>=-C&@=CZHCp@=C9Cp@N;Cj}5>o=-C&@=C9C&@ ?CZHCp@=C| >f=9C&@ ?CbVCp@ ?CZHCp@=CT}<=gK=C:@5Cl C7 A5CC7 A4C}N= =Cp@6Cl C7 A5CC:@5C}M= =Cp@6Cl Cp@`7Cl C7 A5CJ|K=JK=l Cp@`7C C7 A`7Cl C7 A5Ct}==l Cp@`7CfCp@8C C7 A`7Cr};D=6=fCp@8C13C7 A8C C7 A`7C}(=c=fCp@8C*Cp@Q:C13C7 A8C+}==*Cp@Q:CCC7 AQ:C13C7 A8C^F},===*Cp@Q:C9Cp@N;CCC7 AQ:Cʹ|& >C¯=9Cp@N;CUC7 AN;CCC7 AQ:C9}i=9Cp@N;CZHCp@=CUC7 AN;C'|>Ct=ZHCp@=CgC7 A=CUC7 AN;C]|ѷ>(=ZHCp@=CbVCp@ ?CgC7 A=Cz3>=bVCp@ ?C+{C7 A ?CgC7 A=Cy|== >CQA3CC-&A3CC-&A-3CQ5}l==C7 A4CC-&A3CCQA3CTP}ӹ= C7 A`7C7C-&A`7CC-&A5Cqr}N=6= C7 A`7C13C7 A8C7C-&A`7C|X}=.=13C7 A8CLC-&A8C7C-&A`7C3}==13C7 A8CCC7 AQ:CLC-&A8C!z*#>=CC7 AQ:CXeC-&AQ:CLC-&A8C{u-$>=CC7 AQ:CUC7 AN;CXeC-&AQ:C {.>xq=UC7 AN;CiyC-&AN;CXeC-&AQ:C K{.>ڮ=UC7 AN;CgC7 A=CiyC-&AN;Cʡx[1R>u=gC7 A=CC-&A=CiyC-&AN;CyayiR>1=gC7 A=C+{C7 A ?CC-&A=C3x Oa>=+{C7 A ?CC-&A ?CC-&A=C{es=[ >C$'@A3CC-&A-3CC-&A3Ce{=>C$'@Ak2CC-&A-3CC$'@A3C;|V2=2=C-&A3CC-&A5CC$'@A3C@^{7 >] >C-&A5C 9C$'@A5CC$'@A3Ci{9 >>C-&A5C7C-&A`7C 9C$'@A5Cz>S >7C-&A`7CUC$'@A`7C 9C$'@A5C||K>=7C-&A`7CLC-&A8CUC$'@A`7C:yB9>S>LC-&A8CsC$'@A8CUC$'@A`7Cy2:>`=LC-&A8CXeC-&AQ:CsC$'@A8CUx{G>˽>XeC-&AQ:C_C$'@AQ:CsC$'@A8CygG>n=XeC-&AQ:CiyC-&AN;C_C$'@AQ:CmwVe>7>iyC-&AN;CC$'@AN;C_C$'@AQ:Cwze>i=iyC-&AN;CC-&A=CC$'@AN;C6v|Up>~>C-&A=CĽC$'@A=CC$'@AN;Ct>>˽CH6A ?C˽C$'@A1=CĽC$'@A=CNulӂ>>˽CH6A ?CĽC$'@A=CC-&A ?CIwq>=C-&A ?CĽC$'@A=CC-&A=CKOz7 > #>C$'@Ak2CCYAqN2CCJJBAqN2CvzQ >^>C$'@Ak2CC$'@A3CCYAqN2C z>>C$'@A3C 9CYA3CCYAqN2C?^{< >\ >C$'@A3C 9C$'@A5C 9CYA3C~yd>> 9C$'@A5CYCYA5C 9CYA3Cqzb> > 9C$'@A5CUC$'@A`7CYCYA5CEx9>?&>UC$'@A`7C#|CYA`7CYCYA5C/y:>DM>UC$'@A`7CsC$'@A8C#|CYA`7CvV>}*>sC$'@A8CCYA8C#|CYA`7C,xBW>tI>sC$'@A8C_C$'@AQ:CCYA8C7um>6>_C$'@AQ:CCYAQ:CCYA8Czs>>˽C>.PAN;C˽CYA:CCYAQ:C't >#>˽C>.PAN;CCYAQ:CC$'@AN;C(v2n>=C$'@AN;CCYAQ:C_C$'@AQ:CpsЏ>_>C$'@AN;CĽC$'@A=C˽CCA=C t>>˽C>.PAN;CC$'@AN;C˽CCA=C$qs6Џ>>ĽC$'@A=C˽C$'@A1=C˽CCA=C(z >8>CYAqN2C 9CYA3C5CqsAqN2C3wk3> 9CYA3CY^CqsA3C5CqsAqN2C&x^4>f]> 9CYA3CYCYA5CY^CqsA3CvuJ>)3>YCYA5CCqsA5CY^CqsA3C*{wxJ>9&>YCYA5C#|CYA`7CCqsA5CltMkh>D>#|CYA`7C謽CqsA`7CCqsA5C>t.y> 5>˽CoA8C˽CqsAj8C謽CqsA`7Cptlmt>M!5>˽CoA8C謽CqsA`7CCYA8Cui>V)>CYA8C謽CqsA`7C#|CYA`7CMry>>CYA8CCYAQ:C˽C^AQ:C-!uu>$>˽CoA8CCYA8C˽C^AQ:C!r^>c>CYAQ:C˽CYA:C˽C^AQ:C%uM>BC>5CqsAqN2CY^CqsA3C`CAqN2CtzW>M>Y^CqsA3CCA3C`CAqN2C)vOX>3>Y^CqsA3CCqsA5CCA3CMqˁ>Θ^>CqsA5CӺCA5CCA3Cq(>N>˽CA`7C˽CA"6CӺCA5Cq,݆>Y(L>˽CA`7CӺCA5C謽CqsA`7Chr_>7C>謽CqsA`7CӺCA5CCqsA5C4rx>4>謽CqsA`7C˽CqsAj8C˽CA`7C`trj>9j>˽CH6A ?CdC$'@A ?C˽C$'@A1=CQs>R>˽C>.PAN;CdCYAN;C˽CYA:C9Ktj^> >˽CCA=CdCYAN;C˽C>.PAN;C'rw>->CYA=CdCYAN;C˽CCA=Cfosُ>>˽C$'@A1=CCYA=C˽CCA=CgIs&>F>˽C$'@A1=CdC$'@A ?CCYA=CZqq>Z>dC$'@A ?C."CYA ?CCYA=Cprl>==>˽CoA8CmӽCqsA8C˽CqsAj8Cs>ݎ/>˽C^AQ:CmӽCqsA8C˽CoA8CXp"U>G>CqsAQ:CmӽCqsA8C˽C^AQ:CGr#h>o>˽CYA:CCqsAQ:C˽C^AQ:Cyrg>B>˽CYA:CdCYAN;CCqsAQ:Co>;a2>dCYAN;C/$CqsAN;CCqsAQ:CpƜ>X>dCYAN;CCYA=C/$CqsAN;C'o>Q$>CYA=C{GCqsA=C/$CqsAN;Co_>B|>CYA=C."CYA ?C{GCqsA=Cvma|>`(>."CYA ?CkCqsA ?C{GCqsA=Cip_>S>˽CA`7CqCA`7C˽CA"6C4~qC_>p~<>˽CqsAj8CqCA`7C˽CA`7C0}qb>'<>˽CqsAj8CmӽCqsA8CqCA`7CnE9>W>mӽCqsA8CCA8CqCA`7CnĚ>hF>mӽCqsA8CCqsAQ:CCA8C5mB>wS>CqsAQ:CCCAQ:CCA8C]n&>1>CqsAQ:C/$CqsAN;CCCAQ:Cmԥ>:>/$CqsAN;CkCAN;CCCAQ:C]n3u>92$>/$CqsAN;C{GCqsA=CkCAN;Cuj ȴ>C>{GCqsA=CCA=CkCAN;Ce&>I>C|A ?CCAg=CCA=C?gL>BB>C|A ?CCA=CkCqsA ?Ck>x&>kCqsA ?CCA=C{GCqsA=C~e>I>C|A ?CþCA ?CCAg=Cޗ}=Dt=6 CN@ ?C,CN@<@C9C&@ ?Cen}(k>:p=,CN@<@CFC&@<@C9C&@ ?Cxn}2k>bf=,CN@<@C9CN@UBCFC&@<@C=|m >=9CN@UBCbVC&@UBCFC&@<@C|i >'s=9CN@UBCICN@CCbVC&@UBCv|?>H=ICN@CCzgC&@CCbVC&@UBC|w>[|=ICN@CCbVCN@*ECzgC&@CC {'> ˧=bVCN@*ECxC&@*ECzgC&@CC1{#u'>U=bVCN@*ECkCN@z$GCxC&@*EC,z5>z5=kCN@z$GCC&@z$GCxC&@*ECz_5>=kCN@z$GCfCN@ɾHCC&@z$GCax I>>fCN@ɾHCC&@ɾHCC&@z$GCow'W>B>˽C>@YJC˽C&@;JCC&@ɾHCwR>>˽C>@YJCC&@ɾHCtCN@YJCx>I> >tCN@YJCC&@ɾHCfCN@ɾHCiu9Z>ҵ;>tCN@YJCɽCN@hKC˽Cl@hKCvqQ> <>˽C>@YJCtCN@YJC˽Cl@hKC} >l;=9C&@ ?CFC&@<@CbVCp@ ?C|Mt>V=FC&@<@CXeCp@<@CbVCp@ ?C~|k>`=FC&@<@CbVC&@UBCXeCp@<@Cq{ϟ'>u=bVC&@UBCxCp@UBCXeCp@<@C${ '>=bVC&@UBCzgC&@CCxCp@UBCվzI5>=zgC&@CCCp@CCxCp@UBCY{5>=xC&@*ECCp@*ECCp@CCEx[>e=xC&@*ECC&@z$GCCp@*ECpwPe>=C&@z$GCCp@z$GCCp@*ECudp>x>˽C5u@ɾHC˽Cp@GCCp@z$GCAvKk>>˽C5u@ɾHCCp@z$GCC&@ɾHCXvd>>C&@ɾHCCp@z$GCC&@z$GCQLvk>>C&@ɾHC˽C&@;JC˽C5u@ɾHCU{B4>=bVCp@ ?CXeCp@<@C+{C7 A ?CKyNN>=XeCp@<@CC7 A<@C+{C7 A ?Cyj;N>7=XeCp@<@CxCp@UBCC7 A<@Cx1\>D$=xCp@UBCC7 AUBCC7 A<@CxBm\>=xCp@UBCCp@CCC7 AUBCn^vx>/=Cp@CCCC7 ACCC7 AUBCt܎>Ɏ>˽CbA*EC˽C7 AӚDCCC7 ACC=u,>W>˽CbA*ECCC7 ACCCp@*EC}v$x>=Cp@*ECCC7 ACCCp@CCtulނ>a=Cp@*ECCp@z$GC˽C @z$GCuX6>&6>˽CbA*ECCp@*EC˽C @z$GCMtk>d->Cp@z$GC˽Cp@GC˽C @z$GCKxxa> =+{C7 A ?CC7 A<@CC-&A ?Cwk>=C7 A<@CC-&A<@CC-&A ?CUuO͂>>˽CwAUBC˽C-&A5fACC-&A<@Cu1>}^>˽CwAUBCC-&A<@CC7 AUBCwk>7`=C7 AUBCC-&A<@CC7 A<@CȮs>o=C7 AUBCCC7 ACC˽CACCu%>@>˽CwAUBCC7 AUBC˽CACCpsՏ>>CC7 ACC˽C7 AӚDC˽CACC8s9>=C-&A ?CC-&A<@C˽Ch+A<@C~u>=˽CH6A ?CC-&A ?C˽Ch+A<@C}rږ>I>C-&A<@C˽C-&A5fAC˽Ch+A<@C w{[>>˽C>@YJC3νC&@YJC˽C&@;JC@u8Z>gD>˽Cl@hKC3νC&@YJC˽C>@YJC"v"{Q><>cC&@hKC3νC&@YJC˽Cl@hKCKv\k>t>˽C5u@ɾHC߽Cp@ɾHC˽Cp@GCKvNk>>˽C&@;JC߽Cp@ɾHC˽C5u@ɾHC6ugn>7>˽C&@;JC3νC&@YJC߽Cp@ɾHCoty>t$>3νC&@YJC|Cp@YJC߽Cp@ɾHCSssx>v_:>3νC&@YJCcC&@hKC|Cp@YJCun7f>j'>cC&@hKCg%Cp@hKC|Cp@YJCSuق>>˽CbA*EC۽C7 A*EC˽C7 AӚDCSuق>h>˽C @z$GC۽C7 A*EC˽CbA*ECuA>[/=JC7 Az$GC۽C7 A*EC˽C @z$GCu>3>˽Cp@GCJC7 Az$GC˽C @z$GC5u_>+>˽Cp@GC߽Cp@ɾHCJC7 Az$GCysjՅ>!>߽Cp@ɾHCNC7 AɾHCJC7 Az$GC[sFɅ>P#>߽Cp@ɾHC|Cp@YJCNC7 AɾHCqt[>>|Cp@YJC09C7 AYJCNC7 AɾHC9t)>+&>|Cp@YJCg%Cp@hKC09C7 AYJCIq>m=>g%Cp@hKCTaC7 AhKC09C7 AYJCt >x>˽CwAUBC=ܽC-&AUBC˽C-&A5fACWt!> >˽CACC=ܽC-&AUBC˽CwAUBCds/ى>>C-&ACC=ܽC-&AUBC˽CACCfnt(+> =˽C7 AӚDCC-&ACC˽CACC7Et>:I>˽C7 AӚDC۽C7 A*ECC-&ACCs݌>>۽C7 A*EC%C-&A*ECC-&ACCt>g=۽C7 A*ECJC7 Az$GC%C-&A*ECr>a >JC7 Az$GC4C-&Az$GC%C-&A*EC~qZ;>Al >JC7 Az$GCNC7 AɾHC4C-&Az$GCq>j!>NC7 AɾHCVC-&AɾHC4C-&Az$GCr+ד>(>NC7 AɾHC09C7 AYJCVC-&AɾHC2pU$>*>09C7 AYJCq{C-&AYJCVC-&AɾHClܧ>Q>C AhKCC-&AcKCq{C-&AYJC\lk>TP>C AhKCq{C-&AYJCTaC7 AhKC~o">p;>TaC7 AhKCq{C-&AYJC09C7 AYJCtp> =˽Ch+A<@CdC$'@A ?C˽CH6A ?CqW>>YC$'@A<@CdC$'@A ?C˽Ch+A<@C|r>XO>˽C-&A5fACYC$'@A<@C˽Ch+A<@CcOrc>Z/>˽C-&A5fAC=ܽC-&AUBCYC$'@A<@C~q֙>xz >=ܽC-&AUBCC$'@AUBCYC$'@A<@Cq>G>=ܽC-&AUBCC-&ACCC$'@AUBCqۘ>o >C-&ACC;C$'@ACCC$'@AUBCq'>>C-&ACC%C-&A*EC;C$'@ACCBpG+>b>%C-&A*EC[C$'@A*EC;C$'@ACCrph> >%C-&A*EC4C-&Az$GC[C$'@A*EC:soh>>4C-&Az$GCq{C$'@Az$GC[C$'@A*EC$fkױ>qP<>CaQ<>CaO>VC-&AɾHCq{C$'@Az$GC4C-&Az$GC'>VC-&AɾHCq{C-&AYJCCSP0AYJCt+'>CafP>q{C-&AYJCC-&AcKCCSP0AYJCqP>>dC$'@A ?CYC$'@A<@C."CYA ?Czp>9>YC$'@A<@CBCYA<@C."CYA ?CVqdb>@ >YC$'@A<@CC$'@AUBCBCYA<@Co"_>|>C$'@AUBCucCYAUBCBCYA<@Cp> >C$'@AUBC;C$'@ACCucCYAUBC~nl>/*>;C$'@ACC`CYACCucCYAUBCbk!>OG>CTA*ECCYADC`CYACCl>>CTA*EC`CYACC[C$'@A*ECBm>q>[C$'@A*EC`CYACC;C$'@ACCti##>C>[C$'@A*ECq{C$'@Az$GCCHAz$GC{l>!>CTA*EC[C$'@A*ECCHAz$GCg>Z9>q{C$'@Az$GCC$'@ALHCCHAz$GCQn>6>."CYA ?CBCYA<@CkCqsA ?Cok(>j.>BCYA<@CCqsA<@CkCqsA ?Cg>0>C].jAUBCCqsA+ACCqsA<@C?i>@h+>C].jAUBCCqsA<@CucCYAUBCUl ڵ> h>ucCYAUBCCqsA<@CBCYA<@C`h#>'>ucCYAUBC`CYACCC^ACC-i*>)>C].jAUBCucCYAUBCC^ACCi!>>`CYACCCYADCC^ACCe>a*>kCqsA ?CCqsA<@CC]wuA<@C3hk>5.>C|A ?CkCqsA ?CC]wuA<@Cje>=/>CqsA<@CCqsA+ACC]wuA<@CFkx>[U>C AhKCeC-&AhKCC-&AcKCib>_C>CaZ.>CSP0AYJCC$'@AɾHCCa .>,˾C$'@AYJCC$'@AɾHCCSP0AYJCyh[>"tX>C-&AcKC,˾C$'@AYJCCSP0AYJCg.iyʶ>T>C-&AcKCeC-&AhKC,˾C$'@AYJCiʳ>fO>eC-&AhKCC$'@AhKC,˾C$'@AYJCj9޽>[>CTA*EC,CYA*ECCYADCi]j>=+>CHAz$GC,CYA*ECCTA*ECDfM>>>ԾCYAz$GC,CYA*ECCHAz$GCe<>@>C$'@ALHCԾCYAz$GCCHAz$GCeI;>b@>C$'@ALHCC$'@AɾHCԾCYAz$GC|hy>7->C$'@AɾHCCYAɾHCԾCYAz$GC|hy>7->C$'@AɾHC,˾C$'@AYJCCYAɾHCe=>k@>,˾C$'@AYJC%CYAYJCCYAɾHC}e>K>,˾C$'@AYJCC$'@AhKC%CYAYJCdd>R>C$'@AhKC"UCYAhKC%CYAYJCg>m0>C].jAUBCӸCqsAUBCCqsA+ACg>ߔ0>C^ACCӸCqsAUBCC].jAUBCVgd>0>߾CqsACCӸCqsAUBCC^ACCh}]>]>CYADC߾CqsACCC^ACCh]>>CYADC,CYA*EC߾CqsACCe+>/>,CYA*ECCqsA*EC߾CqsACC0e\>>>,CYA*ECԾCYAz$GCCqsA*EClXd>9C>ԾCYAz$GC2CqsAz$GCCqsA*EC`e>n*>ԾCYAz$GCCYAɾHC2CqsAz$GCb>w@>CYAɾHC^CqsAɾHC2CqsAz$GC _->'`D>;fChHjAYJC;fCqsA.IC^CqsAɾHCWb>>>;fChHjAYJC^CqsAɾHC%CYAYJC7b&.>Gb=>%CYAYJC^CqsAɾHCCYAɾHC ?`=G>"N>%CYAYJC"UCYAhKC;fC2^AhKC+a>wQ>;fChHjAYJC%CYAYJC;fC2^AhKCfފ>5>C]wuA<@CþCA ?CC|A ?CeJ>;?>CA<@CþCA ?CC]wuA<@Ce>/>CqsA+ACCA<@CC]wuA<@Ce>/>CqsA+ACӸCqsAUBCCA<@Cld>?;>ӸCqsAUBCCAUBCCA<@Cd>i$.>ӸCqsAUBC߾CqsACCCAUBCaN>E>߾CqsACCECACCCAUBC~`>0;/>;fCA*EC;fCA;=ECECACCa2>5N/>;fCA*ECECACCCqsA*ECr b7W>D<,>CqsA*ECECACC߾CqsACC,^h> >>CqsA*EC2CqsAz$GC;fCJAz$GCr`s>|J>;fCA*ECCqsA*EC;fCJAz$GC]<>9=>2CqsAz$GC^CqsAɾHC;fC0uAɾHC^oh>6>>;fCJAz$GC2CqsAz$GC;fC0uAɾHCt]>yB>^CqsAɾHC;fCqsA.IC;fC0uAɾHCK^e>{H>;fChHjAYJCCqsAYJC;fCqsA.ICN]=\>L]>;fC2^AhKCCqsAYJC;fChHjAYJCwN]{]>wN]>CqsAhKCCqsAYJC;fC2^AhKC$]>6>;fCA*ECnCA*EC;fCA;=EC4l\U>6V>;fCJAz$GCnCA*EC;fCA*EC\>U>ƟCAz$GCnCA*EC;fCJAz$GC:y]:>uB>;fC0uAɾHCƟCAz$GC;fCJAz$GC[>OK>_ϿCAɾHCƟCAz$GC;fC0uAɾHC\>F>;fCqsA.IC_ϿCAɾHC;fC0uAɾHCO\>F>;fCqsA.ICCqsAYJC_ϿCAɾHCpXrm>X>CqsAYJCCAYJC_ϿCAɾHCU/?k>b3CܽAhKCb3CAuKCCAYJCU1?>k>b3CܽAhKCCAYJCCqsAhKCwXym>wX>CqsAhKCCAYJCCqsAYJC\S%u?.o>b3CܽAhKCF;CAhKCb3CAuKCwIu7Y>TD>ɽCN@hKC˽CN@2 LC˽Cl@hKCqvvQ><>˽CN@2 LCcC&@hKC˽Cl@hKC5LvfQ>ܻ8>˽CN@2 LC@CN@MCcC&@hKCv'M>4>@CN@MCC&@MCcC&@hKCgtL>jX>@CN@MCCN@(OCC&@MCt4L>X>CN@(OCRHC&@(OCC&@MCtVL>[>CN@(OCKCN@VPCRHC&@(OCqMd>4t>KCN@VPC|C&@VPCRHC&@(OC6Vqpf>{>C@\RCC&@QC|C&@VPC qNb>Ky>C@\RC|C&@VPCCN@\RCq8d>S{>CN@\RC|C&@VPCKCN@VPCJfo`>S>CN@\RCCN@RCC@\RCcue>3>cC&@hKCC&@MCg%Cp@hKC@sx>sG>C&@MC|OCp@MCg%Cp@hKCӃrB9x>YV>C&@MCRHC&@(OC|OCp@MCwp>c>RHC&@(OCCp@(OC|OCp@MC=?n>X#~>C@VPCCp@OCCp@(OCn!>W{>C@VPCCp@(OC|C&@VPC* pL>Gr>|C&@VPCCp@(OCRHC&@(OCjn8 >Ny>|C&@VPCC&@QCC@VPC.qڌ>E>g%Cp@hKC|OCp@MCTaC7 AhKC(oht>qO>|OCp@MCC7 AMCTaC7 AhKC nG>yh>C@(OCC7 AMCC7 AMCw n>Ph>C@(OCC7 AMCCp@(OCnސ>b>Cp@(OCC7 AMC|OCp@MC\ld>3|>Cp@(OCCp@OCC@(OC0Zl>]L>TaC7 AhKCC7 AMCCAMCl:¤>M>C AhKCTaC7 AhKCCAMC# k5)>e>C7 AMCC7 AMCCAMCTqf>{>C@\RCC&@\RCC&@QC{n`d>Q>CN@RCC&@\RCC@\RCoՙ`>A>CN@RChCN@SCC&@\RCSpH\>ʉ>hCN@SCkC&@SCC&@\RCdp\\>>hCN@SC>CN@DUCkC&@SCdp\\>>>CN@DUCA(C&@DUCkC&@SC4Nl@Tl>*>;fCW@+WC;fC&@WCA(C&@DUCkq>>;fCW@+WCA(C&@DUCf8CN@+WCo[>&>f8CN@+WCA(C&@DUC>CN@DUCXkp>9a>f8CN@+WC;fCN@8XC;fCW@+WCZn4 >Oy>C@VPCCp@VPCCp@OCgn= >Ny>C&@QCCp@VPCC@VPC#nR>k[y>C&@QCC&@\RCCp@VPC1o|>j r>C&@\RCCp@\RCCp@VPCm4n>p>C&@\RCkC&@SCCp@\RCrmvG>E>kC&@SC%Cp@SCCp@\RC+km~>kC&@SCA(C&@DUC%Cp@SCkFP>G>A(C&@DUCcCp@DUC%Cp@SC qgX>T>;fC&@WC;fCp@UCcCp@DUC0j"=>>A(C&@DUC;fC&@WCcCp@DUCfnR>_d>C@(OCC7 A(OCC7 AMCm>w>Cp@OCC7 A(OCC@(OC(m>w>Cp@OCCp@VPCC7 A(OC~p>Je>Cp@VPC C7 AVPCC7 A(OCdosP>q>Cp@VPCCp@\RC C7 AVPCkݝ>HS>Cp@\RC*C7 A\RC C7 AVPCi>P>;fCp ASC;fC7 ANSC*C7 A\RCi,y>bP>;fCp ASC*C7 A\RC%Cp@SClfkFO>>%Cp@SC*C7 A\RCCp@\RCg>>%Cp@SCcCp@DUC;fC @DUCir>>;fCp ASC%Cp@SC;fC @DUCd^>>cCp@DUC;fCp@UC;fC @DUCGk>U>CAMCeC-&AhKCC AhKC}*l>@P>־C-&AMCeC-&AhKCCAMC k&>0e>C7 AMC־C-&AMCCAMCadkzӦ>D+a>C7 AMCC7 A(OC־C-&AMC[m/>R>C7 A(OC6C-&A(OC־C-&AMClצ>Gb>C7 A(OC C7 AVPC6C-&A(OCFiF>x> C7 AVPC:C-&AVPC6C-&A(OC_/g%>6>;fC:!A\RC;fC-&A.QC:C-&AVPC ga>.>;fC:!A\RC:C-&AVPC*C7 A\RCnhI>_>*C7 A\RC:C-&AVPC C7 AVPCf>m>*C7 A\RC;fC7 ANSC;fC:!A\RCi>~AN>eC-&AhKC־C-&AMCC$'@AhKCilK>S>־C-&AMCI'C$'@AMCC$'@AhKCOiw>/bO>־C-&AMC6C-&A(OCI'C$'@AMCQf>Kd>6C-&A(OCMZC$'@A(OCI'C$'@AMCb>Q}>;fCT3AVPC;fC$'@A}OCMZC$'@A(OCdrM>v>;fCT3AVPCMZC$'@A(OC:C-&AVPC:eb>:t>:C-&AVPCMZC$'@A(OC6C-&A(OCcv>>:C-&AVPC;fC-&A.QC;fCT3AVPC\aZ<>t;fCivQAMC;fCYALC"UCYAhKCdU>nR>;fCivQAMC"UCYAhKCI'C$'@AMCsd5>O>I'C$'@AMC"UCYAhKCC$'@AhKC}`AN>/K_>I'C$'@AMCMZC$'@A(OC;fC4CA(OCcz>ne>;fCivQAMCI'C$'@AMC;fC4CA(OC^_/>h y>MZC$'@A(OC;fC$'@A}OC;fC4CA(OC_>=PU>"UCYAhKC;fCYALC;fC2^AhKCj3t> C>;fCW@+WClC&@+WC;fC&@WCljt>DE>;fCN@8XClC&@+WC;fCW@+WC,k.q>3\>;fCN@8XC=~CN@XClC&@+WC8k5p> >=~CN@XCC&@XClC&@+WCchv>>\Cp@+WC;fC&@WClC&@+WCpah s>C>;fCp@UC;fC&@WC\Cp@+WChǍ>B>lC&@+WCC&@XC\Cp@+WCjxc>>C&@XCACp@XC\Cp@+WCh; >}>;fCp ASChC7 ASC;fC7 ANSChI>;Г>;fC @DUChC7 ASC;fCp ASC#f;>P>嬿C7 ADUChC7 ASC;fC @DUCd>ɝ>;fCp@UC嬿C7 ADUC;fC @DUC-:e$>v>;fCp@UC\Cp@+WC嬿C7 ADUCYg>>\Cp@+WCHC7 A+WC嬿C7 ADUC=cu>>b3C AXCb3C7 AlXCHC7 A+WCc4g>>b3C AXCHC7 A+WCACp@XC;gӝ>^>ACp@XCHC7 A+WC\Cp@+WC@.ed:>A>;fC:!A\RCvC-&A\RC;fC-&A.QCc$->a>;fC7 ANSCvC-&A\RC;fC:!A\RC`d>r>;fC7 ANSChC7 ASCvC-&A\RCe>>hC7 ASCӷC-&ASCvC-&A\RC d{7>V>hC7 ASC嬿C7 ADUCӷC-&ASCc>{ʚ>嬿C7 ADUCC-&ADUCӷC-&ASCiaܸ>>b3C!A+WCb3C-&AVCC-&ADUCͷb]>ř>b3C!A+WCC-&ADUCHC7 A+WCycW>e>HC7 A+WCC-&ADUC嬿C7 ADUCa>>HC7 A+WCb3C7 AlXCb3C!A+WC'a7>>;fCT3AVPCC$'@AVPC;fC$'@A}OCa}` >>;fC-&A.QCC$'@AVPC;fCT3AVPChGat>C9>;fC-&A.QCvC-&A\RCC$'@AVPC~a/>A>vC-&A\RCѿC$'@A\RCC$'@AVPCD`>3M>vC-&A\RCӷC-&ASCѿC$'@A\RC|_{>Ŭ>ӷC-&ASC`C$'@ASCѿC$'@A\RCR]d>b>b3CA5ADUCb3C$'@AĨTC`C$'@ASCQc^'>#>b3CA5ADUC`C$'@ASCC-&ADUCZ^>G>C-&ADUC`C$'@ASCӷC-&ASC^U> >C-&ADUCb3C-&AVCb3CA5ADUCu`A>/A[>;fCivQAMCCYAMC;fCYALC^_>yr>;fC4CA(OCCYAMC;fCivQAMC9^>az>CYA(OCCYAMC;fC4CA(OC]>}>;fC$'@A}OCCYA(OC;fC4CA(OC]8>}>;fC$'@A}OCC$'@AVPCCYA(OC]@>}>C$'@AVPC6CYAVPCCYA(OCZ>b>b3C XA\RCb3CYAP-RC6CYAVPC[>̫>b3C XA\RC6CYAVPCѿC$'@A\RCgK]K>z>ѿC$'@A\RC6CYAVPCC$'@AVPCX|>K>ѿC$'@A\RC`C$'@ASCb3CfGASCZ>->b3C XA\RCѿC$'@A\RCb3CfGASCsW>'>`C$'@ASCb3C$'@AĨTCb3CfGASCN]]>M]>;fCYALCCqsAhKC;fC2^AhKC,]>QX>;fCYALCCYAMCCqsAhKC[ >Hb>CYAMCCqsAMCCqsAhKCXZ|>{v>CYAMCCYA(OCCqsAMCYA>an~>CYA(OC0CqsA(OCCqsAMC~S>f>b3CfAVPCb3CqsA7OC0CqsA(OCjV:I>+>b3CfAVPC0CqsA(OC6CYAVPC!Y)X>x>6CYAVPC0CqsA(OCCYA(OCVQ>߄>6CYAVPCb3CYAP-RCb3CfAVPC*xU)?[>CqsAhKCCqsAMCb3C!AMC)V~?`>b3CܽAhKCCqsAhKCb3C!AMCR1?sqv>CqsAMC0CqsA(OCb3CKsA(OC* TL? Bx>b3C!AMCCqsAMCb3CKsA(OCMQ?4>0CqsA(OCb3CqsA7OCb3CKsA(OC`>Bm>b3C AXC:C7 AXCb3C7 AlXC_>>b3C!A+WC{DC-&A+WCb3C-&AVC^Y[>3>b3C7 AlXC{DC-&A+WCb3C!A+WCB7_)>6>b3C7 AlXC:C7 AXC{DC-&A+WCS\>S\>:C7 AXC1C-&AXC{DC-&A+WCҐZA>>b3CA5ADUC]C$'@ADUCb3C$'@AĨTCZA>$>b3C-&AVC]C$'@ADUCb3CA5ADUCԗ[P>!ܜ>b3C-&AVC{DC-&A+WC]C$'@ADUC:Y>5>{DC-&A+WCC$'@A+WC]C$'@ADUCW >>{DC-&A+WC1C-&AXCC$'@A+WCxV7>>1C-&AXC C$'@AXCC$'@A+WCߵW\>7H>b3C XA\RC;CYA\RCb3CYAP-RCV>>b3CfGASC;CYA\RCb3C XA\RCTܳ>9G>CYASC;CYA\RCb3CfGASCTj>ࣛ>b3C$'@AĨTCCYASCb3CfGASCT >>b3C$'@AĨTC]C$'@ADUCCYASC}U[ >־>]C$'@ADUCCYADUCCYASCO)>>CRA+WCCYAVCCYADUCfRu>W>CRA+WCCYADUCC$'@A+WCT^>>C$'@A+WCCYADUC]C$'@ADUCP>\ɨ>C$'@A+WC C$'@AXCC@AXCQ>>CRA+WCC$'@A+WCC@AXCwuS2>s>b3CfAVPCsCqsAVPCb3CqsA7OCuS>q>b3CYAP-RCsCqsAVPCb3CfAVPC:pS>>b3CYAP-RC;CYA\RCsCqsAVPCuS>;s>;CYA\RC,CqsA\RCsCqsAVPC[N}W?W#>CrASCCqsAHSC,CqsA\RC-Pb>0>CrASC,CqsA\RCCYASC Qf>>CYASC,CqsA\RC;CYA\RCyO?ׅ>CYASCCYADUCCҊcADUCbP6m>~>CrASCCYASCCҊcADUCM,|?v>CYADUCCYAVCCҊcADUC{Ts?d>b3C!AMCF;CAhKCb3CܽAhKCQk?Pl>$uCAMCF;CAhKCb3C!AMCP|?e>b3CKsA(OC$uCAMCb3C!AMCOP޽?c>DCA(OC$uCAMCb3CKsA(OCKO=?RL>b3CqsA7OCDCA(OCb3CKsA(OC#O5?$>b3CqsA7OCsCqsAVPCDCA(OC\N?>sCqsAVPCqCAVPCDCA(OCG?G>CbA\RCCAJPCqCAVPCK} ?;b>CbA\RCqCAVPC,CqsA\RCCOO?)>,CqsA\RCqCAVPCsCqsAVPCPJc?>,CqsA\RCCqsAHSCCbA\RCMO>)>CRA+WC"CYA+WCCYAVCvfLf>->C@AXC"CYA+WCCRA+WCmdL>1>)|CYAXC"CYA+WCC@AXCK?{T>CrASC=CqsASCCqsAHSC<K?5f>CҊcADUC=CqsASCCrASC Mbs?<>RCqsADUC=CqsASCCҊcADUC~K?'>CYAVCRCqsADUCCҊcADUCK?+$>CYAVC"CYA+WCRCqsADUCH?MQ>"CYA+WCCqsA+WCRCqsADUC0Fa?X>CiAXCCqsAsWCCqsA+WCHU?>CiAXCCqsA+WC)|CYAXC&Hf?$>)|CYAXCCqsA+WC"CYA+WCG?C>CbA\RCDCA\RCCAJPC[Fp& ?՜>CqsAHSCDCA\RCCbA\RCeFk& ?՜>CqsAHSC=CqsASCDCA\RC#JN ?>=CqsASCCASCDCA\RC /C?=]>C{ADUCCAUCCASCD^ ?w>C{ADUCCASCRCqsADUC4dI ?ɚ>RCqsADUCCASC=CqsASCD ?>RCqsADUCCqsA+WCCyA+WCVD& ?>C{ADUCRCqsADUCCyA+WC DL ?o>CqsA+WCCqsAsWCCyA+WCD ?'>CiAXCCqsAXCCqsAsWC @W ?>C{ADUCCADUCCAUC?J?>CyA+WCCADUCC{ADUC@?>BCA+WCCADUCCyA+WCQ=Q?bβ>BCA+WCښC6ۅAXCښCAXC??p>CyA+WCښC6ۅAXCBCA+WC}Z??T>CyA+WCCqsAXCښC6ۅAXCwAt ?f'>CyA+WCCqsAsWCCqsAXCjOo>'>=~CN@XCeƿCN@2`ZCC&@XC/Gjo3s>TŦ>eƿCN@2`ZCC&@2`ZCC&@XCfL>k>b3Cs@[Cb3C&@$}[CC&@2`ZCafXK>j>b3Cs@[CC&@2`ZCCN@[ChiLr>>CN@[CC&@2`ZCeƿCN@2`ZCd'a>@>CN@[Cb3CN@v\Cb3Cs@[CTd]͔>a>b3CQ@2`ZCb3Cp@3'ZCACp@XC#d”>م>b3CQ@2`ZCACp@XCC&@2`ZCh<>>C&@2`ZCACp@XCC&@XCd/Ô>%>C&@2`ZCb3C&@$}[Cb3CQ@2`ZCka}>Al>ACp@XCb3Cp@3'ZCb3C AXCeU>>b3Cs@[CvLC&@[Cb3C&@$}[CEc>~>b3CN@v\CvLC&@[Cb3Cs@[C d>!>b3CN@v\CfCN@є]CvLC&@[Cm!eB>>fCN@є]CC&@є]CvLC&@[C~e>U%>fCN@є]CCN@!/_CC&@є]CV>CN@!/_CC&@!/_CC&@є]C]> >CN@!m`CC&@nL_CC&@!/_Ca> >CN@!/_CCN@!m`CC&@!/_CaL>ظ>b3CQ@2`ZC ?Cp@2`ZCb3Cp@3'ZC!aJ>>b3C&@$}[C ?Cp@2`ZCb3CQ@2`ZCb`>+>b3C&@$}[CvLC&@[C ?Cp@2`ZC'cjn> '>vLC&@[CؐCp@[C ?Cp@2`ZC"Qbߖ>>vLC&@[CC&@є]CؐCp@[Ca'>ټ>C&@є]CCp@є]CؐCp@[C'Zd>~=>C@!/_CCp@G^CCp@є]C8)Zٍ>8>C@!/_CCp@є]CC&@!/_C"`t>G4>C&@!/_CCp@є]CC&@є]CK(Z">g=>C&@!/_CC&@nL_CC@!/_C.]l>=>b3Cp@3'ZC:C7 AXCb3C AXC_㯬>,y>b3Cp@3'ZC ?Cp@2`ZC:C7 AXC(_fq>;> ?Cp@2`ZCNC7 A2`ZC:C7 AXC_i>f}> ?Cp@2`ZCؐCp@[CNC7 A2`ZC^ P>"Դ>ؐCp@[CC7 A[CNC7 A2`ZCoyW^g>o>CI@є]CC7 A\CC7 A[C:X>t>CI@є]CC7 A[CCp@є]C ]>,>Cp@є]CC7 A[CؐCp@[CCW>{>Cp@є]CCp@G^CCI@є]C\[>!>:C7 AXCNC7 A2`ZC1C-&AXCIZQ>R>NC7 A2`ZCC-&A2`ZC1C-&AXCW0K>¸>C2A[CC-&AZCC-&A2`ZCX>>C2A[CC-&A2`ZCC7 A[C]Z>槱>C7 A[CC-&A2`ZCNC7 A2`ZCU>>C7 A[CC7 A\CC2A[CjR>>C+A2`ZCC$'@AHXC C$'@AXCVS>1е>C+A2`ZC C$'@AXCC-&A2`ZC U |>,>C-&A2`ZC C$'@AXC1C-&AXCPT>>C-&A2`ZCC-&AZCC+A2`ZCmNǧ>L`> C$'@AXCC$'@AHXCC@AXC^8×>[>v[C&@p`CCN@!m`CCN@p`C]> >C&@nL_CCN@!m`Cv[C&@p`C_g>N>CN@p`CC>->CN@KcCC&@ bCC&@cbC[g> >;>C@!/_CHCp@!/_CCp@G^Cg&Z>1B>C&@nL_CHCp@!/_CC@!/_C'Zy><>C&@nL_Cv[C&@p`CHCp@!/_CZB>$>v[C&@p`CCp@p`CHCp@!/_ChUoβ>Ȇ>C@cbCCp@NUaCCp@p`CAUɲ>>C@cbCCp@p`CC&@cbCZ#>>C&@cbCCp@p`Cv[C&@p`CUɲ>>C&@cbCC&@ bCC@cbCTUs>>CI@є]C{BC7 Aє]CC7 A\CBT >o>>Cp@G^C{BC7 Aє]CCI@є]CCLV+U>C>Cp@G^CHCp@!/_C{BC7 Aє]C W~>2>HCp@!/_C*C7 A!/_C{BC7 Aє]C1Q}>i>C:@p`CC7 A7_C*C7 A!/_CS<>@>C:@p`C*C7 A!/_CCp@p`CV]>d>Cp@p`C*C7 A!/_CHCp@!/_CR>x>Cp@p`CCp@NUaCC:@p`CV>R>C2A[CDC-&A[CC-&AZCR>>C7 A\CDC-&A[CC2A[CSK>Ӵ>C7 A\C{BC7 Aє]CDC-&A[CR >>{BC7 Aє]C:C-&Aє]CDC-&A[C@K.>>CA!/_CC-&AY'^C:C-&Aє]C/KMQ>_/>CA!/_C:C-&Aє]C*C7 A!/_CǡS}>x>*C7 A!/_C:C-&Aє]C{BC7 Aє]CɛM>؛>*C7 A!/_CC7 A7_CCA!/_CNP>mϻ>C+A2`ZCLZC$'@A2`ZCC$'@AHXCPM>һ>C-&AZCLZC$'@A2`ZCC+A2`ZCސQ`>>C-&AZCDC-&A[CLZC$'@A2`ZC' PF><>DC-&A[CC$'@A[CLZC$'@A2`ZCKm3>>C.Aє]CC$'@AV\CC$'@A[CK+->{>C.Aє]CC$'@A[C:C-&Aє]CM>Z >:C-&Aє]CC$'@A[CDC-&A[CIL>>:C-&Aє]CC-&AY'^CC.Aє]C H?o>)|CYAXCC;WA2`ZCCYA3'ZCK>f>C@AXCC;WA2`ZC)|CYAXCJ|>>>C@AXCLZC$'@A2`ZCC;WA2`ZCQL>Z>C@AXCC$'@AHXCLZC$'@A2`ZCH?>LZC$'@A2`ZCC$'@A[CCODA[CےJI7>>C;WA2`ZCLZC$'@A2`ZCCODA[CEέ?y>C$'@A[CC$'@AV\CCODA[CFՏ?>)|CYAXCCYA3'ZCCiAXCyWͺ>I>#C&@cCCN@KcC#CN@cC9W>x>C&@ bCCN@KcC#C&@cCWwï>>#CN@cC6CN@^eC#C&@cC_CT+>>6CN@^eCC&@^eC#C&@cCsT@>>C@cbCCp@cbCCp@NUaCdT2>>C&@ bCCp@cbCC@cbC Vٵ>E >C&@ bC#C&@cCCp@cbC0S><>#C&@cCTCp@cCCp@cbCP>~!>ښC^@^eCښCp@ddCTCp@cCK@RWB>A>ښC^@^eCTCp@cCC&@^eCa;S)>)>C&@^eCTCp@cC#C&@cC]Q >%>C:@p`C> C7 Ap`CC7 A7_C=O:/>k>Cp@NUaC> C7 Ap`CC:@p`CvPэ>a>Cp@NUaCCp@cbC> C7 Ap`C:>Cp@cbCyC7 AcbC> C7 Ap`CK >6*>ښCB@cCښC7 AbCyC7 AcbCPMX>=>ښCB@cCyC7 AcbCTCp@cCyP> >TCp@cCyC7 AcbCCp@cbCjM>>TCp@cCښCp@ddCښCB@cCK:(>>CA!/_CC-&A!/_CC-&AY'^CK(>,>C7 A7_CC-&A!/_CCA!/_COMe>,>C7 A7_C> C7 Ap`CC-&A!/_CK>{>> C7 Ap`C}C-&Ap`CC-&A!/_CTF>>ښCAcbCښC-&A0aC}C-&Ap`C~H>>ښCAcbC}C-&Ap`CyC7 AcbCJ>7>yC7 AcbC}C-&Ap`C> C7 Ap`C_RH_>F[>yC7 AcbCښC7 AbCښCAcbCG3>4>C.Aє]Ca!C$'@Aє]CC$'@AV\C5Eʭ>U>C-&AY'^Ca!C$'@Aє]CC.Aє]CH>օ>C-&AY'^CC-&A!/_Ca!C$'@Aє]CSH>>C-&A!/_CZC$'@A!/_Ca!C$'@Aє]C DY>/>ښCb,Ap`CښC$'@A__CZC$'@A!/_C%F>T>ښCb,Ap`CZC$'@A!/_C}C-&Ap`C0Hq>B>}C-&Ap`CZC$'@A!/_CC-&A!/_CDo>e>}C-&Ap`CښC-&A0aCښCb,Ap`CD?`>C;WA2`ZCCYA2`ZCCYA3'ZC}D? >CODA[CCYA2`ZCC;WA2`ZCgC(?>ACYA[CCYA2`ZCCODA[CjA+?|>ACYA[CښC`XVAє]CښCYAM]CtA?>CODA[CښC`XVAє]CACYA[ChA?>CODA[Ca!C$'@Aє]CښC`XVAє]C3A?>CODA[CC$'@AV\Ca!C$'@Aє]CA ?>a!C$'@Aє]CZC$'@A!/_CښCoBA!/_CA?>ښC`XVAє]Ca!C$'@Aє]CښCoBA!/_C]4@?>ZC$'@A!/_CښC$'@A__CښCoBA!/_C'B?Z>CYA3'ZCCqsAXCCiAXCѠB]?TN>CYA3'ZCCYA2`ZCCqsAXCbBt?X>CYA2`ZCkCqsA2`ZCCqsAXC?b ?9->ښC xiA[CښCqsA[CkCqsA2`ZCC@ ?p@>ښC xiA[CkCqsA2`ZCACYA[CAL?E>ACYA[CkCqsA2`ZCCYA2`ZC?D?>ACYA[CښCYAM]CښC xiA[C(<}?>CqsAXCkCqsA2`ZCښC2zA2`ZC=?˻>ښC6ۅAXCCqsAXCښC2zA2`ZC:l?"ٿ>kCqsA2`ZCښCqsA[CښC2zA2`ZC}R]x>>ښCN@])gCښC&@eCC&@^eCUfv><>6CN@^eCښCN@])gCC&@^eC}Ry>f>C&@^eCښC&@eCښC^@^eC\S2ښCAxBښCcAB؂CABi441C/A7]BC/ACBCAdB441CAdB1C/A7]BCAdB$e3$e61CuAk5BCuABC8At/B3wc61C At/B1CuAk5BC8At/B3pe6C8At/B1C/A7]B1C At/Bj]3d6C/ACB1C/A7]BC8At/Bx|I@kx|I1CԹABCԹABCAB8D=sґL1CAB1CԹABCAB>=AoLCAB1CuAk5B1CABɼ\ICuAB1CuAk5BCAB#CW #CWCԹAB1CԹABClABh "Y :UClAB1CԹAB1ClAlBN]~N]1CyABCyABCA6B>T^1C>>A6B1CyABCA6B>Y^CA6B1ClAlB1C>>A6B& r]ClAB1ClAlBCA6B^^CyAB1CyABCbLABy)ƽGwbCbLAB1CyAB1CbLA>B6e\_Z`1CAaBCA0BC߿AB0ҽ㾥c1C.AB1CAaBC߿ABR1ҽ*㾃cC߿AB1CbLA>B1C.AB)ĽaaCbLAB1CbLA>BC߿ABȹ8/C/ACB˽C/AAY˽CbLAm1B˽CAB^CbLAB>~Y˽CABCbLAB^CbLAB|>Y˽CAB˽CyA BCbLABQ2+д[˽CyA BCyABCbLAB.6B 뾭]^CbLABC߿ABCA0B9BR]^CbLABCA0B˽CbLAm1BUAN\˽CbLAm1BCA0B˽CApBg9Bv]^CbLABCbLABC߿AB+oU;Q#˽C/AWCAbcB˽CbLAm1B˽CApB^[<;fC]A@qB;fCiAdBEC]AdBo3ƾ&&;fC/A2B;fCFAt/BƾC/At/BY5bEC]AdBCëAdBC/ABj$5;fC]A@qBEC]AdBC/ABiɾc6/h;fC]A@qBC/ABƾC/At/BUھ7 ;fC]A@qBƾC/At/B;fCFAt/BS"[v-;fCuAݳB;fCrABоCuABȃǾsd%o(ƾC/At/BCAt/BCuAtB*ǾXd%!(;fC/A2BƾC/At/BCuAtBU?",x-;fC/A2BCuAtBоCuABָR"w-;fC/A2BоCuAB;fCrAB2lҾIo. ƾC/At/BC/ABCAt/Bs;þ0zR=;fCԹAfLB;fCQKA6B++CԹA6BcʾtC9оCuABC#rABCԹAB5ʾ޼B9;fCuAݳBоCuABCԹAB=þ S=;fCuAݳBCԹAB++CԹA6B49þ ET=;fCuAݳB++CԹA6B;fCQKA6B_ʾ/LD9оCuABCuAtBC#rAB٭ʾD++CԹA6BCA6BClABeʾD++CԹA6BClAB;fCԹAfLBQƾʋΫF;fCԹAfLBClAB;fClA>B}ʾЊD++CԹA6BCԹABCA6B0rs\M;fCyAEdB;fCUABžCyABQt4\M;fCUABCyABžCyABvs\M;fCUAB;fClA>BCyABC ɾ I;fClA>BClABCyAB5.^辖NžCyABCABCbLAVB`/^NžCyABCbLAVB;fCyAEdB@& I侺P;fCyAEdBCbLAVB;fCbLA~BaNžCyABCyABCAB7߾hQ;fCAB;fCg_A\BCA\B~5E߾Q;fCg_A\BCAbcBCA\Bi6a߾Q;fCg_A\B;fCbLA~BCAbcB7߾|Q;fCbLA~BCbLAVBCAbcBnվ+b3C]ABb3ChCAt/B-C]At/B6g ;fC]A@qB-C]At/Bb3ChCAt/B徂4x ;fC]A@qBb3ChCAt/B;fCiAdB4Ծ$t>;fCiAdBb3ChCAt/Bb3Cj?AdB""b3C/A3tBb3CrABC/ABξF%%-C]At/B;fCFAt/B;fC/A2B#:پd's9 b3C]AB-C]At/B;fC/A2Bݾ^(,b3C]AB;fC/A2BC/AB#^3'"b3C]ABC/ABb3CrABM6f -C]At/B;fC]A@qB;fCFAt/BW~+&C/AB;fCrAB;fCuAݳBh=+&C/AB;fCuAݳBb3C/A3tBtԾ}O3b3C/A3tB;fCuAݳBb3CuABP8$-&C/AB;fC/A2B;fCrAB۾ 8;fCԹAfLBb3CԹA(eBb3C$A6B ۾? 8;fCQKA6B;fCԹAfLBb3C$A6B۾ 8b3C$A6B;fCuAݳB;fCQKA6B۾Q 8b3CuAB;fCuAݳBb3C$A6BbnBb3ClAEdBb3CABClABGaBb3CAB;fClA>BClABa̦Bb3CABb3CԹA(eB;fClA>B^@b3CԹA(eB;fCԹAfLB;fClA>B'徇(0FClAB;fCUAB;fCyAEdB)徿(C0FClAB;fCyAEdBb3ClAEdB}ݾ|ݾJb3ClAEdB;fCyAEdBb3CyA~B'徚(0FClAB;fClA>B;fCUAB}ݾE|ݾҀJb3CbLABb3C}A\BxCbLA\B@~ݾ|ݾqJb3C}A\B;fCbLA~BxCbLA\Bݾ8ݾ\Jb3C}A\Bb3CyA~B;fCbLA~B}ݾ|ݾJb3CyA~B;fCyAEdB;fCbLA~BV޾LؾKxCbLA\B;fCg_A\B;fCAB޾ Mؾ.KxCbLA\B;fCABb3CbLABت޾%MؾKb3CbLAB;fCABb3CA.B޾}KؾBKxCbLA\B;fCbLA~B;fCg_A\B#Ҿ&1qb3C]ABC]ABC*At/BqY˾,Bb3ChCAt/Bb3C]ABC*At/B;E|CAdBC*At/BCALBo@߾!<&E|CAdBb3Cj?AdBC*At/B!޾2CuABC EA6B5CuA6B[߾i.2C EA6Bb3CuAB5CuA6Bs߾>2C EA6BC/A}fBb3CuABϋZm00C/A}fBb3C/A3tBb3CuAB#[޾m\?;CԹA}BCֳABwCԹAB+n >75CuA6Bb3C$A6Bb3CԹA(eB:|b -7CuAB5CuA6Bb3CԹA(eB[޾?;CuABb3CԹA(eBwCԹABY޾y@;CuABwCԹABCֳAB| }+75CuA6Bb3CuABb3C$A6B@E_AwCԹABb3CABb3ClAEdB@<_AwCԹABb3ClAEdBCԹA}B!۾yOHCԹA}Bb3ClAEdBClA~B@澒^AwCԹABb3CԹA(eBb3CAB)baWHCyABCA\BRCyA\BbFbᾒWHCA\Bb3CyA~BRCyA\Bfd᾿dZVHCA\BClA~Bb3CyA~B|ݾ}ݾڀJClA~Bb3ClAEdBb3CyA~Br"?GCbLAKBCdhAZ(BCbLAZ(BCLܾjIRCyA\Bb3C}A\Bb3CbLABKܾ jICyABRCyA\Bb3CbLAB8c澻)KBGCyABb3CbLABCbLAZ(Bud&=GCyABCbLAZ(BCdhAZ(BtOܾKiIRCyA\Bb3CyA~Bb3C}A\B㾈ECA !BCbLAKBCbLAZ(B|bFA5CAZ(BCA !BCbLAZ(B @Ӈ㾢(ACbLAZ(Bb3CA.B5CAZ(BdվZIb3CbLABb3CA.BCbLAZ(B93(3(C]ABCtABBC]AB;<[Z5pCAt/BC*At/BC]ABJ851CAnvBCAt/BC]ABRƾc6CAnvBC]ABBC]AB*ξB7 CAnvBBC]ABCtABþp@ CAt/BCALBC*At/B/=%$+C/ABCA6BIC/A6B~&W)BC]ABCABC/A}fB|&W)C]ABBC]ABC/A}fBk/ %#+C]ABC/A}fBIC/A6B0)%x#+C]ABIC/A6BCA6B˾4P2BC]ABC]ABCABȼ4v:CuA$BCeԪABژCuAB Ⱦřy6IC/A6BC EA6BCuAB ȾÙ6C/ABIC/A6BCuABE:C/ABCuABژCuAB2k:C/ABژCuABCeԪABV Ⱦ}6IC/A6BC/A}fBC EA6Bž ?ژCuABCֳABCԹA}BžF ?ژCuABCԹA}BCuA$Bm] FCuA$BCԹA}BCԹA?Bž ?ژCuABCuABCֳABCѾ~DClABCA\B!ClA\BѾ:FDCA\BClA~B!ClA\BmѾDCA\BCԹA?BClA~BUs\MCԹA?BCԹA}BClA~BFDCyAyBCKSAZ(BJCyAZ(B&׾$yJ!ClA\BCA\BCyAB ׾ yJClAB!ClA\BCyAB<DClABCyABJCyAZ(BuDClABJCyAZ(BCKSAZ(B׾DxJ!ClA\BClA~BCA\B`V'CGJCyAZ(BCdhAZ(BCbLAKBe-,@GJCyAZ(BCbLAKBCyAyBE š:CyAyBCbLAKBCbLABc*AGJCyAZ(BCyABCdhAZ(BmIAj8CA;BCABYiCAB#'I쾠j8CABCA !BYiCABG;k8CABCbLABCA !BGV;>CbLABCbLAKBCA !B3~0@-C]ABښC]ABښCGىAB3|q/kq/CtABC]ABښCGىAB^@ ښCGىABCAnvBCtAB\ HFښCABCAnvBښCGىABN-/C/ABښC/A(eBښCA6BkY+ l1CA6BC/ABښCA6Bla+j1ښCA6BC]ABCA6B//ښC]ABC]ABښCA6Bc s>CuA$BښCuA:BښCUABuf:t@CeԪABCuA$BښCUABzh9v@ښCUABC/ABCeԪABO!x?ښC/A(eBC/ABښCUAB- ;BGښCԹA BښC+A\B,CԹA\BBGښC+A\BCԹA?B,CԹA\B OAGښC+A\BښCuA:BCԹA?BHjZIښCuA:BCuA$BCԹA?B`8  K,CԹA\BCA\BClABcq K,CԹA\BClABښCԹA BE|JDښCԹA BClABښClAnB b%!K,CԹA\BCԹA?BCA\BӒپ?(,9>1CQA{%CUClA{%C1ClA'$C\O>}N>1C_pA#CQCyA#C1CyA7K#C\Y>AN>1ClA'$CQCyA#C1C_pA#CT__ɬ>>1ClA'$CUClA{%CQCyA#Cv`ީ>:0>UClA{%CGCyA{%CQCyA#CSRa>>1CM>AWG"ChCbLAWG"C1CbLA ;!CN_>(>1CyA7K#ChCbLAWG"C1CM>AWG"CR->۴>1CyA7K#CQCyA#ChCbLAWG"C~xWBw>>QCyA#C`CbLA#ChCbLAWG"COLRV >0>CpA{%CCbLA2%C`CbLA#C2V>>٭>CpA{%C`CbLA#CGCyA{%CWlWj>>GCyA{%C`CbLA#CQCyA#CB?xh>1C ACVCAC1CAeCL'C?>1CA CVCAC1C AC1DW?G>ICA CVCAC1CA CBJ?>1CbLA ;!CICA C1CA CDz?4 >1CbLA ;!ChCbLAWG"CICA CӹE?d>hCbLAWG"CuCAWG"CICA CMHC?C>CAA#CCAZ"CuCAWG"CwZO*?>CAA#CuCAWG"C`CbLA#CE *?М>`CbLA#CuCAWG"ChCbLAWG"Ce"Kp?J>`CbLA#CCbLA2%CCAA#C ;P>%>CpA{%COCbLA{%CCbLA2%C8EJ,?b,>CAA#CFCA#CCAZ"C6AY ?U>CbLA2%CFCA#CCAA#C:Fs ?0>CbLA2%COCbLA{%CFCA#C`G ?>OCbLA{%C֛CA{%CFCA#C:wF=t}>\QC]A(C1CA(CGCA(Cu=>1C]AR'C1CA(C\QC]A(C3xG=>u>GCA(CyCAJ*C\QC]A(Cvz=>yCAJ*C߉C]AJ*C\QC]A(CxG:=Gb>yCAJ*CCA4+C߉C]AJ*Cv7=s|>CA4+C[C]A4+C߉C]AJ*Csyݎ=L>CA4+CxҼCA-C[C]A4+CKuo>ȡy>xҼCA-CC]A-C[C]A4+C?rk5>z>CA.CC]A-CC]A-C܋u>u>xҼCA-CCA.CC]A-CNt =>vgC/A(C1C]AR'C\QC]A(C|rͧ=ڷ>1C/A/e'C1C]AR'CvgC/A(C|u=V>>\QC]A(C߉C]AJ*CvgC/A(C>rd>>߉C]AJ*CC/AJ*CvgC/A(Cu0 >:{>߉C]AJ*C[C]A4+CC/AJ*C1sHX>g>[C]A4+C߼C/A4+CC/AJ*Co[M>P>CFA-CC/A[,C߼C/A4+CAoiM>KU>CFA-C߼C/A4+CC]A-C2uK#>y>C]A-C߼C/A4+C[C]A4+CqtN>Ή>C]A-CC]A-CCFA-C5o^=>1C8AF'C>CuAF'C1CuA&CqJ=A>1C/A/e'C>CuAF'C1C8AF'Cq =>1C/A/e'CvgC/A(C>CuAF'CmW>{>vgC/A(C-CuA(C>CuAF'CRq0>g>vgC/A(CC/AJ*C-CuA(Cp->.>C/AJ*Cz˼CuAJ*C-CuA(Cla>>CA4+CCuA~+Cz˼CuAJ*Cl_a>,>CA4+Cz˼CuAJ*C߼C/A4+C)sN/>>߼C/A4+Cz˼CuAJ*CC/AJ*Clvnc>잓>߼C/A4+CC/A[,CCA4+CtkSY> >nCԹAF'C1CuA&C>CuAF'CiFS>Գ>1CԹA%C1CuA&CnCԹAF'C0kcY>>>CuAF'C-CuA(CnCԹAF'CAl3O>@>-CuA(C6CԹA(CnCԹAF'C!ij*z>씪>C?AJ*CCԹA8=*C6CԹA(Cxzit>m>C?AJ*C6CԹA(Cz˼CuAJ*Crn_Q>>z˼CuAJ*C6CԹA(C-CuA(CYkv>!>z˼CuAJ*CCuA~+CC?AJ*Cp#fx>>1CԹA%CUClA{%C1CQA{%Cdg`9v>@f>1CԹA%CnCԹAF'CUClA{%CeB>s>nCԹAF'CClAF'CUClA{%Cdi>>nCԹAF'C6CԹA(CClAF'CZe>>6CԹA(CClA(CClAF'Cp_S>:?>CԹA8=*CClA (CClA(Cf>>6CԹA(CCԹA8=*CClA(C*`%>u>UClA{%CClAF'CGCyA{%C7_>4>ClAF'C7CyAF'CGCyA{%CbXr>r>C'A(CCyA<'C7CyAF'C[(>>C'A(C7CyAF'CClA(C+a«>>ClA(C7CyAF'CClAF'C[H>zJ>ClA(CClA (CC'A(C,UP>[>GCyA{%C7CyAF'CC }AF'C?9V^>>CpA{%CGCyA{%CC }AF'C8R5u>XX>7CyAF'CCyA<'CC }AF'C\sw9>e>+-C]A/CCA.CCA/CAr2m5>6l>C]A-CCA.C+-C]A/C]v';>qM>CA/C0CA"0C+-C]A/C1r>0CA"0C`C]A"0C+-C]A/Cc/s8b>8b>0CA"0C`CAqN2C`C]A"0Cc/s8b>8b>`CAqN2CHC]AqN2C`C]A"0CnAV>>CFA-C C/A-CC/A[,C`oW>ҏ>C]A-C C/A-CCFA-C[pmU>>C]A-C+-C]A/C C/A-Cݍq O>-J>+-C]A/C!YC/A/C C/A-C sdP>s>+-C]A/C`C]A"0C!YC/A/Cwp'i>>`C]A"0C`C/A"0C!YC/A/C k">ȕ>˽C±AqN2C˽C/AW=2C`C/A"0Ck>߉>˽C±AqN2C`C/A"0CHC]AqN2Crk>ja>HC]AqN2C`C/A"0C`C]A"0C{9j5p>8&>CA4+C-CuA4+CCuA~+Ckr>O>C/A[,C-CuA4+CCA4+Cln>>C/A[,C C/A-C-CuA4+CQkx> > C/A-CTVCuA-C-CuA4+Co۵|>o> C/A-C!YC/A/CTVCuA-C1kZ>$>!YC/A/CCuA/CTVCuA-CJgF>&>˽CXA"0C˽CuA9e0CCuA/Cg03>0ݕ>˽CXA"0CCuA/C`C/A"0CmfՌ>M>`C/A"0CCuA/C!YC/A/CyiVq>v>`C/A"0C˽C/AW=2C˽CXA"0C d>.[>C?AJ*CCԹAJ*CCԹA8=*Cf>w>CuA~+CCԹAJ*CC?AJ*Cwh$>(>CuA~+C-CuA4+CCԹAJ*Cӳe$[>a>-CuA4+CMPCԹA4+CCԹAJ*C5hQ>>-CuA4+CTVCuA-CMPCԹA4+C f>7>TVCuA-CCԹA-CMPCԹA4+Ce9 >B>˽CRA/C˽CԹA[.CCԹA-CIfo>Ͷ>˽CRA/CCԹA-CCuA/C1i>>CuA/CCԹA-CTVCuA-C)g>&>CuA/C˽CuA9e0C˽CRA/CV`N>1> MClAJ*CCԹA8=*CCԹAJ*Cvw_@D>->ClA (CCԹA8=*C MClAJ*C)bb>D>CԹAJ*CMPCԹA4+C MClAJ*CF`,>)L>MPCԹA4+CClA4+C MClAJ*CdAaڱ>>˽CA-C˽ClAO,CClA4+C0b>X>˽CA-CClA4+CCԹA-Cb>>CԹA-CClA4+CMPCԹA4+C&dd>>CԹA-C˽CԹA[.C˽CA-CX>>C'A(CeQCyA(CCyA<'CBXM>.>ClA (CeQCyA(CC'A(C}Z ?>>ClA (C MClAJ*CeQCyA(CF[nݿ>m> MClAJ*CᦽCyAJ*CeQCyA(CcX>>˽CA4+C˽CyA*CᦽCyAJ*C;[(>`=>˽CA4+CᦽCyAJ*CClA4+Cԇ\!>&>ClA4+CᦽCyAJ*C MClAJ*Cc}]->6>ClA4+C˽ClAO,C˽CA4+CkNC>>C }AF'COCbLA{%CCpA{%CgR>޲>XeCbLAF'COCbLA{%CC }AF'CP?>>CyA<'CXeCbLAF'CC }AF'CQQ!>C[>CyA<'CeQCyA(CXeCbLAF'C\&T3>m>eQCyA(CռCbLA(CXeCbLAF'CP(>1>˽CAJ*C˽CbLA(CռCbLA(C41T>>˽CAJ*CռCbLA(CᦽCyAJ*CT>L>ᦽCyAJ*CռCbLA(CeQCyA(CqT*;>>ᦽCyAJ*C˽CyA*C˽CAJ*CiE~ ?ke>˽C AF'C˽CAh&C֛CA{%CUK?"7>˽C AF'C֛CA{%CXeCbLAF'CF= ?#̨>XeCbLAF'C֛CA{%COCbLA{%CL>>XeCbLAF'CռCbLA(C˽C)A(CI? 3>˽C AF'CXeCbLAF'C˽C)A(CK>>ռCbLA(C˽CbLA(C˽C)A(C0i>>˽C±AqN2CνC/AqN2C˽C/AW=2Cd}>̂>˽CXA"0CkٽCuA"0C˽CuA9e0CMfM>>˽C/AW=2CkٽCuA"0C˽CXA"0C|Kg>n>˽C/AW=2CνC/AqN2CkٽCuA"0CU@d7>e>νC/AqN2CuCuAqN2CkٽCuA"0C'ucn)>!ݟ>˽CRA/CT߽CԹA/C˽CԹA[.CucQ)>ݟ>˽CuA9e0CT߽CԹA/C˽CRA/C}dː>e>˽CuA9e0CkٽCuA"0CT߽CԹA/C]غ>5>kٽCuA"0C/CԹA"0CT߽CԹA/Cta>>kٽCuA"0CuCuAqN2C/CԹA"0C%?`>Tp>uCuAqN2CuCԹAqN2C/CԹA"0Ci^X>>˽CA-CCClA-C˽ClAO,C:.`Ѻ>>˽CԹA[.CCClA-C˽CA-C?Ia8>lV>˽CԹA[.CT߽CԹA/CCClA-C ZL>/e>T߽CԹA/C=ClA/CCClA-C[7Y>>T߽CԹA/C/CԹA"0C=ClA/CWPY8j>3>/CԹA"0CClA"0C=ClA/C3WW>Z>C7AqN2CClA0CClA"0C|iY2f>[>C7AqN2CClA"0CuCԹAqN2C]:>K>uCԹAqN2CClA"0C/CԹA"0CV`>1,>˽CA4+CCyA4+C˽CyA*CiXv|>hY>˽ClAO,CCyA4+C˽CA4+C{Y>!s>˽ClAO,CCClA-CCyA4+C.fTS>>CClA-CUCyA-CCyA4+CPP>>C;A/CCyA.CUCyA-CS*>>C;A/CUCyA-C=ClA/CSV>|Ϋ>=ClA/CUCyA-CCClA-C!TE>>=ClA/CClA"0CCA"0CTP>>C;A/C=ClA/CCA"0CKU>>ClA"0CClA0CCA"0CvP>>˽CAJ*CXCbLAJ*C˽CbLA(CP>c>˽CyA*CXCbLAJ*C˽CAJ*CQ>YƳ>˽CyA*CCyA4+CXCbLAJ*CyOm>>CyA4+CqCbLA4+CXCbLAJ*C2J>9P>CjA-CCbLA,CqCbLA4+C L>˼>CjA-CqCbLA4+CUCyA-CԾPcH>>UCyA-CqCbLA4+CCyA4+C N@>B>UCyA-CCyA.CCjA-CB?k>˽C AF'CRCAF'C˽CAh&C@z?>˽C)A(CRCAF'C˽C AF'CJ.?q>BCA(CRCAF'C˽C)A(CC~F&]?>BCA(CC=AJ*CCA><*C I ?>˽C)A(CC=AJ*CBCA(CZII?7>˽C)A(CXCbLAJ*CC=AJ*C:Ku>Q>˽C)A(C˽CbLA(CXCbLAJ*C8)Gƹ?ѹ>XCbLAJ*CqCbLA4+CCA4+CI?Ĵ>C=AJ*CXCbLAJ*CCA4+CE?a>qCbLA4+CCbLA,CCA4+CVV>i>C7AqN2COClAqN2CClA0C>C;A/C2CyA/CCyA.C;N>>CA"0C2CyA/CC;A/C ?N>>CyA"0C2CyA/CCA"0CUO.>R>ClA0CCyA"0CCA"0CjQW>>ClA0COClAqN2CCyA"0CQFJ?y>OClAqN2C6cCyAqN2CCyA"0C'Gi>~>CjA-C"ԾCbLA-CCbLA,CrIS?>Q>CyA.C"ԾCbLA-CCjA-C_;K>U>CyA.C2CyA/C"ԾCbLA-ChI?>2CyA/Cc1CbLA/C"ԾCbLA-C%CR?<>;fCA"0C;fCbLA/Cc1CbLA/CM$EC\?N>;fCA"0Cc1CbLA/CCyA"0C?)JF?_>CyA"0Cc1CbLA/C2CyA/CaG?>CyA"0C6cCyAqN2C;fC:AqN2C(G?⻯>;fCA"0CCyA"0C;fC:AqN2CmS>i?R>C=AJ*CCAJ*CCA><*C <?6>CA4+CCAJ*CC=AJ*C=E ?6>ECA4+CCAJ*CCA4+C=jG?>ECA4+C;fCrA-C;fCAq-Ch?4?Q;>CA4+C;fCrA-CECA4+C4J@ ?½>CA4+C"ԾCbLA-C;fCrA-C'C?<>CA4+CCbLA,C"ԾCbLA-C|?&X?"i>"ԾCbLA-Cc1CbLA/C;fCjA/CA ?+>;fCrA-C"ԾCbLA-C;fCjA/C}U>32?Α>c1CbLA/C;fCbLA/C;fCjA/Cl@o ?k>;fCA"0CPCbLA"0C;fCbLA/CGB ?#>;fC:AqN2CPCbLA"0C;fCA"0C=?| ?>"CbLAqN2CPCbLA"0C;fC:AqN2C4F?v>;fCrA-CiCA-C;fCAq-C3?>;fCjA/CiCA-C;fCrA-Cz 6X?>׿CA/CiCA-C;fCjA/C02?(>׿CA/Cb3CA"0Cb3CAt0CH6i?N.>;fCjA/Cb3CA"0C׿CA/CM5]?|>;fCjA/CPCbLA"0Cb3CA"0C;?#>;fCjA/C;fCbLA/CPCbLA"0C5!?&>PCbLA"0C"CbLAqN2Cb3CUAqN2C65?KĶ>b3CA"0CPCbLA"0Cb3CUAqN2Coh* Z$?>b3CA"0CECA"0Cb3CAt0Cmh*Z$?>b3CUAqN2CECA"0Cb3CA"0C-!?nȾ>BCAqN2CECA"0Cb3CUAqN2CQtFc>1L>`CAqN2CCA3CHC]AqN2Co>s>CA3CjĽC]A3CHC]AqN2Cll|>y}>˽CA5C˽C]A 4CjĽC]A3C2mђ>Iy>˽CA5CjĽC]A3CӺCA5Cp>$^>ӺCA5CjĽC]A3CCA3Co|L>PM>ӺCA5C˽CA"6C˽CA5C~kӠ>no>HC]AqN2CjĽC]A3C˽C4A3C7mԏ>bu>˽C±AqN2CHC]AqN2C˽C4A3CjR>.{>jĽC]A3C˽C]A 4C˽C4A3C}>˽CA5CtC]A5C˽C]A 4CnKw>[Q>˽CA"6CtC]A5C˽CA5C nby>Q>˽CA"6CqCA`7CtC]A5C8l4>iNf>qCA`7C~-C]A`7CtC]A5Clơ>sV>qCA`7CCA8C~-C]A`7Cj'/>j>CA8C`C]A8C~-C]A`7CQSk!>Q>CA8CCCAQ:C`C]A8Cni>]>CCAQ:CC]AQ:C`C]A8CjdW>4_>CjOAN;CC]A:CC]AQ:C\f=>,GX>CjOAN;CC]AQ:CkCAN;Cck>K8>kCAN;CC]AQ:CCCAQ:C:ds>>>>kCAN;CCA=CC]A=Cg>B>CjOAN;CkCAN;CC]A=Cc>=G>CA=CCAg=CC]A=Chjaw>'>˽C4A3CνC/AqN2C˽C±AqN2C@h¢>7Z> C/A3CνC/AqN2C˽C4A3Ci>>˽C]A 4C C/A3C˽C4A3CLj>n{>˽C]A 4CtC]A5C C/A3C{zi%>j>tC]A5CsDC/A5C C/A3Ck$F>Ue>tC]A5C~-C]A`7CsDC/A5CDg>e~>~-C]A`7C|C/A`7CsDC/A5C}-a>>CA8CC/Am7C|C/A`7C>c'>ӄ>CA8C|C/A`7C`C]A8C|h> i>`C]A8C|C/A`7C~-C]A`7Cc[i>szW>`C]A8CC]AQ:CC`AQ:Cke> \>CA8C`C]A8CC`AQ:Cb&> ,]>C]AQ:CC]A:CC`AQ:Cf;>>νC/AqN2C C/A3CuCuAqN2Ce>> C/A3C\CuA3CuCuAqN2Ca@>>C䡬A5CCuAq5C\CuA3Cbc>_]>C䡬A5C\CuA3CsDC/A5CfF>;}>sDC/A5C\CuA3C C/A3Cfk`2>v>sDC/A5C|C/A`7CCA`7CcE>΃>C䡬A5CsDC/A5CCA`7C0_,>V>|C/A`7CC/Am7CCA`7CozY]r>:>C3ŴA3CCԹA 3CuCԹAqN2CrZ'>>C3ŴA3CuCԹAqN2C\CuA3CP2b6>2>\CuA3CuCԹAqN2CuCuAqN2C&]>>\CuA3CCuAq5CC3ŴA3CyYIv>P:>uCԹAqN2CCԹA 3CC7AqN2C c)>c>CjOAN;CľC]AN;CC]A:Cd>gN>C]A=CľC]AN;CCjOAN;C&ce>X>C]A=CľC]AN;CC]A=Cc!>G>CAg=CC]A=CC]A=CHc!>]H>CAg=CþCA ?CC]A=Ca>PU>þCA ?C&C]A ?CC]A=C8_>>CA8CDC/A8CC/Am7CKb>i>C`AQ:CDC/A8CCA8C`a>ZUs>C/AQ:CDC/A8CC`AQ:CaG>a>C]A:CC/AQ:CC`AQ:Ca)H>qa>C]A:CľC]AN;CC/AQ:ChM_> o>ľC]AN;C)C/AN;CC/AQ:C`=>jV>ľC]AN;CC]A=C)C/AN;CL^>d>C]A=CW^C/A=C)C/AN;C[>2ya>;fCaA ?C;fC/A,=CW^C/A=CC]?U>t^>;fCaA ?CW^C/A=C&C]A ?C"_<>!R>&C]A ?CW^C/A=CC]A=Cp!_>>C䡬A5CٛCuA5CCuAq5C_ӡ>J>CA`7CٛCuA5CC䡬A5CeZU>>CuA`7CٛCuA5CCA`7CZ\X>I*>C/Am7CCuA`7CCA`7C]!l>B >C/Am7CDC/A8CCuA`7CE^>$>DC/A8C7CuA8CCuA`7C_>=r>DC/A8CC/AQ:C7CuA8CZ8>0E>C/AQ:C"^CuAQ:C7CuA8C3Y >}{>;fC}5AN;C;fCuA:C"^CuAQ:CZ>w>;fC}5AN;C"^CuAQ:C)C/AN;C\>Jl>)C/AN;C"^CuAQ:CC/AQ:CY>\1_>)C/AN;CW^C/A=C;fCA=C[>b>;fC}5AN;C)C/AN;C;fCA=CY>!%_>W^C/A=C;fC/A,=C;fCA=CWj>V>C3ŴA3C¾CԹA3CCԹA 3CZx>>CuAq5C¾CԹA3CC3ŴA3CZ>>CuAq5CٛCuA5C¾CԹA3CX)WJ><2>ٛCuA5C CԹA5C¾CԹA3CW'>g>ٛCuA5CCuA`7C CԹA5CÕY} >#>CuA`7CMCԹA`7C CԹA5CkTF>C]>;fCA8C;fCԹAe7CMCԹA`7CUh>>;fCA8CMCԹA`7C7CuA8C[Č>̂>7CuA8CMCԹA`7CCuA`7C;S6?>7CuA8C"^CuAQ:C;fCحAQ:CJW>5>;fCA8C7CuA8C;fCحAQ:CܖT?%v>"^CuAQ:C;fCuA:C;fCحAQ:CvV >>CԹA 3COClAqN2CC7AqN2CKW/> Ƣ>CԹA 3C¾CԹA3COClAqN2C{R>;ɬ>¾CԹA3Ch4ClA3COClAqN2CaGM[ ?;>;fCrA5C;fClA4Ch4ClA3CPL>L>;fCrA5Ch4ClA3C CԹA5CVP>c> CԹA5Ch4ClA3C¾CԹA3CwRN>!> CԹA5CMCԹA`7C;fC'WA`7CZS>[>;fCrA5C CԹA5C;fC'WA`7C.Ru>>Տ>MCԹA`7C;fCԹAe7C;fC'WA`7CK?)c>;fCA3C;fCyA]2C6cCyAqN2CBM?e>;fCA3C6cCyAqN2Ch4ClA3CKH&?:>h4ClA3C6cCyAqN2COClAqN2CjHMr ?<>h4ClA3C;fClA4C;fCA3CNH;?fZ>6cCyAqN2C;fCyA]2C;fC:AqN2CWZU>*e>;fCaA ?CC/A ?C;fC/A,=C9W>*>;fC}5AN;C蚿CuAN;C;fCuA:CX>k>;fCA=C蚿CuAN;C;fC}5AN;C0UJ>w}>׿CuA=C蚿CuAN;C;fCA=C$VV3>Gg>;fC/A,=C׿CuA=C;fCA=CV> b>;fC/A,=CC/A ?C׿CuA=CDR;?}z>C/A ?CCuA ?C׿CuA=CP$>>;fCA8CCԹA8C;fCԹAe7CwRTX?nj>;fCحAQ:CCԹA8C;fCA8CP?>qݿCԹAQ:CCԹA8C;fCحAQ:CDR ?qz>;fCuA:CqݿCԹAQ:C;fCحAQ:CJR ?"z>;fCuA:C蚿CuAN;CqݿCԹAQ:COf?>蚿CuAN;CpCԹAN;CqݿCԹAQ:CJ ?3>b3CxA=Cb3CԹAcb3CxA=CpCԹAN;C׿CuA=CcP?x>׿CuA=CpCԹAN;C蚿CuAN;CK?r>׿CuA=CCuA ?Cb3CܸA ?CM> ?fYy>b3CxA=C׿CuA=Cb3CܸA ?CIMz ?8>;fCrA5CxClA5C;fClA4CO۪?ސ>;fC'WA`7CxClA5C;fCrA5C6SLD?Ǘ>ҿClA`7CxClA5C;fC'WA`7CRLuD?ɗ>;fCԹAe7CҿClA`7C;fC'WA`7C M?"#>;fCԹAe7CCԹA8CҿClA`7C6HI8 ?T>CԹA8CM$ClA8CҿClA`7CcF?>b3CAQ:Cb3ClA( 9CM$ClA8CȘL8= ?H%>b3CAQ:CM$ClA8CqݿCԹAQ:C֩J ? ԋ>qݿCԹAQ:CM$ClA8CCԹA8C5H ?X3>qݿCԹAQ:CpCԹAN;Cb3CΎAN;CUL|N ?'C>b3CAQ:CqݿCԹAQ:Cb3CΎAN;C2YH`?>pCԹAN;Cb3CԹAc;fCA3C(CyA3C;fCyA]2CNH?l>;fClA4C(CyA3C;fCA3CWK?>;fClA4CxClA5C(CyA3CiG?b(>xClA5C3CyA5C(CyA3C4CR?k2>b3CA`7Cb3CyAD$6C3CyA5CcEU ?6>b3CA`7C3CyA5CҿClA`7CDJ ?@>ҿClA`7C3CyA5CxClA5CjD/c?P>ҿClA`7CM$ClA8Cb3CA8CF1} ?w>b3CA`7CҿClA`7Cb3CA8CfF]?>M$ClA8Cb3ClA( 9Cb3CA8CA7@?>"CbLAqN2Cb3CA3Cb3CbLA63C4@?O>;fC:AqN2Cb3CA3C"CbLAqN2CR><?U>;fC:AqN2C(CyA3Cb3CA3CUFhG ?G>;fC:AqN2C;fCyA]2C(CyA3C >?>(CyA3C3CyA5Cb3CA5C~>?\>b3CA3C(CyA3Cb3CA5C>?/>3CyA5Cb3CyAD$6Cb3CA5CZ5?@>"CbLAqN2Cb3CbLA63Cb3CUAqN2CHhS?D>b3CxA=C5eCԹA=Cb3CԹAcb3CܸA ?C5eCԹA=Cb3CxA=CH? >5CԹA ?C5eCԹA=Cb3CܸA ?CwCz?>b3CAQ:CrnClAQ:Cb3ClA( 9CCY?>b3CΎAN;CrnClAQ:Cb3CAQ:CB?Gđ>&ClAN;CrnClAQ:Cb3CΎAN;Cb6Ay?c>&ClAN;CCjA=CClAu=CCF? >b3CΎAN;CCjA=C&ClAN;CvC?>b3CΎAN;C5eCԹA=CCjA=C F[2?G݇>b3CΎAN;Cb3CԹAc5eCԹA=C5CԹA ?CCA ?CDH?Iy>CjA=C5eCԹA=CCA ?C;˜?(ϩ>b3CA`7CkCyA`7Cb3CyAD$6C;?\Ω>b3CA8CkCyA`7Cb3CA`7C?N?>CyA8CkCyA`7Cb3CA8Cd:;?1ԗ>CyA8CC^AQ:CCyA9C>{@`?G>b3CA8CC^AQ:CCyA8C|>?oڌ>b3CA8CrnClAQ:CC^AQ:CiCFv?>b3CA8Cb3ClA( 9CrnClAQ:C=\?>rnClAQ:C&ClAN;CCAN;C<>B?>C^AQ:CrnClAQ:CCAN;C>?̖>&ClAN;CClAu=CCAN;C-7A?>b3CA3Cg^CbLA3Cb3CbLA63C9X:?>b3CA5Cg^CbLA3Cb3CA3CX5?>CbLA5Cg^CbLA3Cb3CA5C6'? >CbLA5CCV)A`7CCbLA6CԼ6)? >b3CA5CCV)A`7CCbLA5C`6p(?~>b3CA5CkCyA`7CCV)A`7C6+?L>b3CA5Cb3CyAD$6CkCyA`7C14i#?>kCyA`7CCyA8CC*A8C47Ï?g>CV)A`7CkCyA`7CC*A8CB5ܝ$?>CyA8CCyA9CC*A8C>*)?߯>BCAqN2CC|!A3CCAm3C/#?;>b3CUAqN2CC|!A3CBCAqN2Cto/$?>b3CUAqN2Cg^CbLA3CC|!A3CY5?R>b3CUAqN2Cb3CbLA63Cg^CbLA3CD0 $?啪>g^CbLA3CCbLA5CCA5CD0i$?U>C|!A3Cg^CbLA3CCA5C1&?Y>CbLA5CCbLA6CCA5C0<? >CjA=CClA=CClAu=CJCA ?CClA=CCjA=Cj9M="?0>PClA ?CClA=CCA ?C_8/O ?c>C^AQ:CCyAQ:CCyA9C8 ?>CAN;CCyAQ:CC^AQ:Cf5l#?+#>mCyAN;CCyAQ:CCAN;CR6$?\>ClAu=CmCyAN;CCAN;C78$?>ClAu=CClA=CmCyAN;C2*F'?>ClA=CCyA=CmCyAN;C>1`+?4>CA ?CCyA=CCyA=CN4(?˜>CA ?CCyA=CPClA ?CD4(?v3>PClA ?CCyA=CClA=C0|$?>CV)A`7C` CbLA`7CCbLA6C;!1$?զ>C*A8C` CbLA`7CCV)A`7C0E%?]o>CbLA8C` CbLA`7CC*A8Ce.BT)? >CbLA8CC:AQ:CCbLA:C1]/&?>C*A8CC:AQ:CCbLA8C/*?m!>C*A8CCyAQ:CC:AQ:Cw2;'?>C*A8CCyA9CCyAQ:C-"-?䍑>CyAQ:CmCyAN;CCCyAN;Cm/)?w>C:AQ:CCyAQ:CCCyAN;C-=-?>mCyAN;CCyA=CCA=C--?->CCyAN;CmCyAN;CCA=CW..?.>CyA=CCyA=CCA=C&#Z8/?FG>C|!A3C"CA3CCAm3C?'#8/?C>CA5C"CA3CC|!A3C&,?а>jCA5C"CA3CCA5C}!2?a >jCA5CCnA`7CCAk6C*7'.-?'>CA5CCnA`7CjCA5C7P%=0?>CA5C` CbLA`7CCnA`7CL+S+?|h>CA5CCbLA6C` CbLA`7C*):.?R>` CbLA`7CCbLA8CCA8CO&S2?>CnA`7C` CbLA`7CCA8C)i/? }>CbLA8CCbLA:CCA8C/.[/.?rY>CA ?CCyA ?CCyA=C!U%1?P>C:AQ:CCbLAQ:CCbLA:C%1?>CCyAN;CCbLAQ:CC:AQ:C1&1?cp>lBCbLAN;CCbLAQ:CCCyAN;C$5?>lBCbLAN;CښCA=CښCbLAv=C-='2?•>lBCbLAN;CCCyAN;CښCA=CE'H2?>CCyAN;CCA=CښCA=C.J&C6?$>CyA=CCyA ?CښC A ?C'@`4?V>CyA=CښC A ?CCA=C"(3?\>CA=CښC A ?CښCA=CW5?r~>CnA`7CCA`7CCAk6Cb7?:>CA8CCA`7CCnA`7Cߐ*9?]^>viCA8CCA`7CCA8C"f?viCA8CښC4AQ:CښCA0v9C f9?>CA8CښC4AQ:CviCA8C 3QE9?;>CA8CCbLAQ:CښC4AQ:C" 6?>CA8CCbLA:CCbLAQ:C!)T7?܎>CbLAQ:ClBCbLAN;CښC'AN;Cğ):?9L>ښC4AQ:CCbLAQ:CښC'AN;C "ae8?G>lBCbLAN;CښCbLAv=CښC'AN;CDb>>=>þCA ?CCA<@C&C]A ?C`D>YJ>CA<@CGTC]A<@C&C]A ?CMK^g>>H>;fCAUBC;fC]AZACGTC]A<@C_q>2F>;fCAUBCGTC]A<@CCAUBCaذ>;9>CAUBCGTC]A<@CCA<@C^w]>qB>CAUBCECACC;fCTACCcY_>$J>;fCAUBCCAUBC;fCTACCN^->B->ECACC;fCA;=EC;fCTACC\>EF>&C]A ?CGTC]A<@C;fCgA<@C$^@>xK>;fCaA ?C&C]A ?C;fCgA<@C~\>eF>GTC]A<@C;fC]AZAC;fCgA<@C \y>K>;fCAUBC)C]AUBC;fC]AZACk\>zNR>;fCTACC)C]AUBC;fCAUBCpY>F2_>ķC]ACC)C]AUBC;fCTACC4[L>F4>;fCA;=ECķC]ACC;fCTACC~[0>D4>;fCA;=ECnCA*ECķC]ACCHGX>G>nCA*ECC]A*ECķC]ACCyW>P>nCA*ECƟCAz$GCC]A*ECVK?[>ƟCAz$GCC]Az$GCC]A*ECR ?X>b3CYAɾHCb3C]AGCC]Az$GC3CT?EV>b3CYAɾHCC]Az$GC_ϿCAɾHC$V?tG>_ϿCAɾHCC]Az$GCƟCAz$GC^T?T_T>_ϿCAɾHCCAYJCb3C`jAYJC_^T?]T>b3CYAɾHC_ϿCAɾHCb3C`jAYJCkSP!?h>CAYJCb3CAuKCb3C`jAYJC;[Q>RaS>;fCgA<@CC/A ?C;fCaA ?C4X>_c>ʿC/A<@CC/A ?C;fCgA<@C7 YL>ĖM>;fC]AZACʿC/A<@C;fCgA<@CEyY>`H>;fC]AZAC)C]AUBCʿC/A<@CRU{?`>)C]AUBCC/AUBCʿC/A<@CRS]?l^>b3CACCb3C/AXCCC/AUBCT?_>b3CACCC/AUBCķC]ACCU?[>ķC]ACCC/AUBC)C]AUBCÐSK?KC>ķC]ACCC]A*ECb3CJ͚A*ECgUOS?Q>b3CACCķC]ACCb3CJ͚A*ECRj ?X>C]A*ECC]Az$GCb3CRAz$GCGR0 ?X>b3CJ͚A*ECC]A*ECb3CRAz$GCR_ ?5X>C]Az$GCb3C]AGCb3CRAz$GCM9* ?t>b3CO0A<@Cb3CuA?CCuA ?CطOI?s>b3CO0A<@CCuA ?CʿC/A<@CݢSa?^>ʿC/A<@CCuA ?CC/A ?C(xNA ?gZY>ʿC/A<@CC/AUBCb3CZߤAUBCUPy/ ?c>b3CO0A<@CʿC/A<@Cb3CZߤAUBCxN@B ?QY>C/AUBCb3C/AXCCb3CZߤAUBCjK?r>CuA ?Cb3CuA?Cb3CܸA ?CPl ?*[>b3CYAɾHCQC]AɾHCb3C]AGCPl ?[>b3C`jAYJCQC]AɾHCb3CYAɾHCgPQl ?[>C]AYJCQC]AɾHCb3C`jAYJCUO1?p>b3CAuKCC]AYJCb3C`jAYJCQP|?k>b3CAuKCF;CAhKCC]AYJCdOA?p>F;CAhKCtC]AhKCC]AYJCtQ?b>b3CACC(6C/ACCb3C/AXCCQ !?.[Y>b3CJ͚A*EC(6C/ACCb3CACCNe ?-_>mC/A*EC(6C/ACCb3CJ͚A*ECNx ?_>b3CRAz$GCmC/A*ECb3CJ͚A*ECN ?_> C/Az$GCmC/A*ECb3CRAz$GCN! ?_>b3C]AGC C/Az$GCb3CRAz$GCKOˑ ?{Z>b3C]AGCQC]AɾHC C/Az$GC N< ?b>QC]AɾHCsC/AɾHC C/Az$GC!Gd'?K|>C)AYJCC/A ICsC/AɾHCfG-?M|>C)AYJCsC/AɾHCC]AYJCvNZD ? UY>C]AYJCsC/AɾHCQC]AɾHCH?gh>C]AYJCtC]AhKCCAhKC$H?gh>C)AYJCC]AYJCCAhKCKc ?Dy>b3CO0A<@CRCuA<@Cb3CuA?CL`?k>b3CZߤAUBCRCuA<@Cb3CO0A<@CޭKs ?)n>ߎCuAUBCRCuA<@Cb3CZߤAUBCL?]>b3C/AXCCߎCuAUBCb3CZߤAUBC:LM?C4]>b3C/AXCC(6C/ACCߎCuAUBCI?qj>(6C/ACCgCuACCߎCuAUBCnD?op>CRA*ECCuA8RECgCuACC`F?q>CRA*ECgCuACCmC/A*EC~Jv?![>mC/A*ECgCuACC(6C/ACC7G]?W>mC/A*EC C/Az$GCCSAz$GCkG?W>CRA*ECmC/A*ECCSAz$GCF?Z> C/Az$GCsC/AɾHCCAɾHCZG?1X\>CSAz$GC C/Az$GCCAɾHCdE]?OOy>sC/AɾHCC/A ICCAɾHCqI$}?9v>b3CuA?C5CԹA ?Cb3CܸA ?CrI|?6v>b3CuA?CRCuA<@C5CԹA ?C=F@!?>RCuA<@CCԹA<@C5CԹA ?C[#B/Q?t>CeAUBCCԹA=ACCԹA<@CoF7+?Dp>CeAUBCCԹA<@CߎCuAUBC7GD-?j>ߎCuAUBCCԹA<@CRCuA<@C D-2?d>ߎCuAUBCgCuACCC0\ACC|FP?4l>CeAUBCߎCuAUBCC0\ACCrDR?-p>gCuACCCuA8RECC0\ACCA?>5CԹA ?CCԹA<@CC@oA<@CxkC?H>CA ?C5CԹA ?CC@oA<@C#BYP?|t>CԹA<@CCԹA=ACC@oA<@ClCm?LK>C)AYJCC/AYJCC/A ICqD?p>CAhKCC/AYJCC)AYJCpD?p>^C/AhKCC/AYJCCAhKCB#X?t>CRA*ECU CuA*ECCuA8RECCX?_>CSAz$GCU CuA*ECCRA*EC@«?c>ECuAz$GCU CuA*ECCSAz$GC~@2?܊g>CAɾHCECuAz$GCCSAz$GC??i>mCuAɾHCECuAz$GCCAɾHC>?>C/A ICmCuAɾHCCAɾHCc??"4>C/A ICC/AYJCmCuAɾHCW6>o?n>C/AYJCCuAYJCmCuAɾHCj9S$?r~>C@AhKCCuA3jJCCuAYJC}C@AhKCCuAYJC^C/AhKC~?A? j>^C/AhKCCuAYJCC/AYJC?1?Fx>CeAUBC-CԹAUBCCԹA=AC?2?Zx>C0\ACC-CԹAUBCCeAUBCb??x>+pCԹACC-CԹAUBCC0\ACCS??x>CuA8REC+pCԹACCC0\ACCf@p4?Zr>CuA8RECU CuA*EC+pCԹACC? ?w>U CuA*ECCԹA*EC+pCԹACC`9#?>CRAz$GCCԹA$FCCԹA*ECÑ91#?<>CRAz$GCCԹA*ECECuAz$GCD@?рc>ECuAz$GCCԹA*ECU CuA*EC:|%?c>ECuAz$GCmCuAɾHCC .AɾHC;*%?id>CRAz$GCECuAz$GCC .AɾHC9ZH$?K~>mCuAɾHCCuAYJCCs7AYJC9Uh$?k~>C .AɾHCmCuAɾHCCs7AYJCo9J$?Y|~>CuAYJCCuA3jJCCs7AYJC k9h="?>C@oA<@CPClA ?CCA ?Co<?榄>ژClA<@CPClA ?CC@oA<@C6K&?}>ژClA<@CCu(AUBCClAAC,]<?T>C@oA<@CCu(AUBCژClA<@CN:d$?cv>C@oA<@C-CԹAUBCCu(AUBC?[?x>C@oA<@CCԹA=AC-CԹAUBC7'?n>-CԹAUBC+pCԹACCC.>ACC:-$?߼{>Cu(AUBC-CԹAUBCC.>ACC7'?n>+pCԹACCCԹA*ECCwA*EC7-'?n>C.>ACC+pCԹACCCwA*EC7&?6>CԹA*ECCԹA$FCCwA*ECK4)?T~>PClA ?CژClA<@CC{+A<@C4ݓ)?~>CA ?CPClA ?CC{+A<@C[4l)?,>ژClA<@CClAACC{+A<@C 7&?6>C@AhKCCuAhKCCuA3jJC6I&?>CRAz$GCRCԹAz$GCCԹA$FCy8,'?ah>C .AɾHCRCԹAz$GCCRAz$GCTO5R*?q>@CԹAɾHCRCԹAz$GCC .AɾHC[4m)?*>Cs7AYJC@CԹAɾHCC .AɾHC[[4m)?++>OCԹAYJC@CԹAɾHCCs7AYJCb.W`.?Fc>OCԹAYJCښCAhKCښCԹAJCe3p)?J߆>Cs7AYJCښCAhKCOCԹAYJC 2,?* |>Cs7AYJCCuAhKCښCAhKC7&?;>Cs7AYJCCuA3jJCCuAhKC>1[+?Z3>Cu(AUBCClAUBCClAACL1,?h߃>C.>ACCClAUBCCu(AUBCԧ1%,?x>1ClACCClAUBCC.>ACC2(,?Squ>CwA*EC1ClACCC.>ACC//?>}ClA*EC1ClACCCwA*ECl)\4?*>}ClA*ECښCnAz$GCښClA$FC /k /?Ec>CwA*ECښCnAz$GC}ClA*EC / /?d>CwA*ECRCԹAz$GCښCnAz$GC]4k)?+>CwA*ECCԹA$FCRCԹAz$GC00*10?Hj>RCԹAz$GC@CԹAɾHCښC=wAɾHC0000?j>ښCnAz$GCRCԹAz$GCښC=wAɾHC,,2??`{>@CԹAɾHCOCԹAYJCښCBƺAYJC?/@/?x=>ښC=wAɾHC@CԹAɾHCښCBƺAYJC+-1?s>OCԹAYJCښCԹAJCښCBƺAYJC.}.?}>C{+A<@CCyA ?CCA ?C+;1?x6>gCyA<@CCyA ?CC{+A<@Ci(#4?>gCyA<@CښCNAUBCښCyAACs+a1?>C{+A<@CښCNAUBCgCyA<@Cj+oD1?>C{+A<@CClAUBCښCNAUBC.I.?E*>C{+A<@CClAACClAUBC$,b1?/>ClAUBC1ClACCښCACC x,: 2? >ښCNAUBCClAUBCښCACC<)4?!{>1ClACC}ClA*ECښCfA*ECn, 1?T>ښCACC1ClACCښCfA*ECk)^4?,*>}ClA*ECښClA$FCښCfA*ECII&"6?>CyA ?CgCyA<@CښCcA<@CJ&'6?: >ښC A ?CCyA ?CښCcA<@CQI&*6?s>gCyA<@CښCyAACښCcA<@CJ?C>C AMCC]A|MCtC]AhKCK ?>C AMCtC]AhKC$uCAMCP5 ?j>$uCAMCtC]AhKCF;CAhKCML.C ?K%{>$uCAMCDCA(OCCmA(OC L]D ?Z!{>C AMC$uCAMCCmA(OC jI(#?݅>DCA(OCqCAVPCCTAAVPCJ̇ ?\U>CmA(OCDCA(OCCTAAVPChG)?gG>qCAVPCCAJPCCTAAVPCHG-?N|>tC]AhKCC]A|MCCAhKCEV?҃>C AMCcC]AMCC]A|MC EU?؃>CmA(OCcC]AMCC AMCHl?1>EC]A(OCcC]AMCCmA(OCYF+?x͋>CTAAVPCEC]A(OCCmA(OC F3+?ˋ>C]AVPCEC]A(OCCTAAVPCGoC?>C]AVPCCc8A\RCC]A_RCEc?Sʔ>CTAAVPCCc8A\RCC]AVPCEЋ?y>CTAAVPCDCA\RCCc8A\RCG?C>CTAAVPCCAJPCDCA\RCvMCJ ?;>DCA\RCCASCCASC E`A?5^>Cc8A\RCDCA\RCCASC@7G?肢>CASCCAUCCASClC?mH>C]A|MC^C/AhKCCAhKC.xC?*>C]A|MCcC]AMC^C/AhKC)lC!?'G>cC]AMCC/AMC^C/AhKC<~=?d݈>C<֝A(OCC/AmzNCC/AMC?]?Έ>C<֝A(OCC/AMCEC]A(OC/C&E?}>EC]A(OCC/AMCcC]AMC? ?]͆>EC]A(OCC]AVPCCGAVPC_?>?Ά>C<֝A(OCEC]A(OCCGAVPC%>I?`>C]AVPCC]A_RCCGAVPC݃>?M~>^C/AhKCC/AMCCdAMCP<("?u>C@AhKC^C/AhKCCdAMC=?w߈>C/AMCC/AmzNCCdAMC >O?d>Cc8A\RCYC]A\RCC]A_RCX>+>?>CASCYC]A\RCCc8A\RC>=?W>l1C]ASCYC]A\RCCASCe<?Lu>CAUCl1C]ASCCASC={"?>CAUCCADUCl1C]ASC^<?>CADUC2C]ADUCl1C]ASCL9?>ښCseA+WCښC]AaUC2C]ADUCM<?+">ښCseA+WC2C]ADUCBCA+WC BCA+WC2C]ADUCCADUC;g?a>BCA+WCښCAXCښCseA+WC8L"?>C<֝A(OCC/A(OCC/AmzNC8"?>CGAVPCC/A(OCC<֝A(OC>;B~ ?\>":C/AVPCC/A(OCCGAVPC9Li?ɔ>C]A_RC":C/AVPCCGAVPCd9]h?Ĕ>C]A_RCYC]A\RC":C/AVPC@9i?]ɔ>YC]A\RC2C/A\RC":C/AVPCQz63!?i>ښCcASCښC/A RC2C/A\RCp8V:?Ԛ>ښCcASC2C/A\RCl1C]ASCe9?™>l1C]ASC2C/A\RCYC]A\RC?8? >l1C]ASC2C]ADUCښCoADUC 7Je?h>ښCcASCl1C]ASCښCoADUCj7d?>2C]ADUCښC]AaUCښCoADUCJ7'?f^}>CdAMCCuAhKCC@AhKC7<&?N|>YCuAMCCuAhKCCdAMC5W3w(?M>YCuAMCښCA(OCښCuANC5gg%? w>CdAMCښCA(OCYCuAMC5)%?>CdAMCC/A(OCښCA(OC8o"?2>CdAMCC/AmzNCC/A(OC|^6&?ȅ>C/A(OC":C/AVPCښC̦AVPC6oo&?b>ښCA(OCC/A(OCښC̦AVPCO15%?>":C/AVPC2C/A\RCښCl0A\RC35%?M>ښC̦AVPC":C/AVPCښCl0A\RC 4$?e>2C/A\RCښC/A RCښCl0A\RCt//?tq>CuAhKCYCuAMCښCAMC2",?i{>ښCAhKCCuAhKCښCAMC`.a.?}d>YCuAMCښCuANCښCAMCߝuʾyj_C\)BkBCyi(BBDC\)BB/¾2^˽Cp#BB˽CR#BBvǽCp#BB*EȾ]vǽCp#BBCyi(BBC\)BkBW1Ⱦ]vǽCp#BBC\)BkB˽Cp#BB;>}[˽Cp#BBC\)BkB˽C\)B8BϾ`V˽Cp#BBCp#BQBCBBB \˽CR#BB˽Cp#BBCBBB@CϾH`VCp#BQB˽Cp#BBC\)B0BX¾! ɾsVC\)B0B˽Cp#BB˽C\)B8B!۾ξ@N;fCB6+B;fCHBB)CBBܾ\ɾO)CBBCBBBCp#BQBܾ]ɾO)CBBCp#BQB;fCB6+BؾľR;fCB6+BCp#BQB;fCp#BB߾qӾL;fC\)BiB;fCo#B}BtC\)B}B{߾oӾL;fCo#B}BC\)B0BtC\)B}B߾ ӾoL;fCo#B}B;fCp#BBC\)B0B׾WuʾBP;fCp#BBCp#BQBC\)B0BaǾGb3Ce4BLEBb3C'MBBCe4BB\-ngIb3CBBb3Ce4BLEBCe4BB+ ܻIhCBBb3CBBCe4BB4ǯþJb3CB%7Bb3CB}B1CB}BǾGhCBB;fCHBB;fCB6+BǾVGb3CBBhCBB;fCB6+B39þrJb3CBB;fCB6+B1CB}B7þMJb3CBB1CB}Bb3CB}BZ]DJb3Cp#B{Bb3CB%7B1CB}B7YDJasCp#B}Bb3Cp#B{B1CB}B`?JJ1CB}B;fCp#BBasCp#B}BYDJ;fCB6+B;fCp#BB1CB}BSξHb3C\)BYBb3C(BUBtC\)BUBRξHasCp#B}B;fCo#B}B;fC\)BiBRξHb3Cp#B{BasCp#B}B;fC\)BiBRξHb3Cp#B{B;fC\)BiBtC\)BUBRξxHb3Cp#B{BtC\)BUBb3C(BUBo?WξHasCp#B}B;fCp#BB;fCo#B}B7S;?AC( BoBCOBBKC( BB^ þ CKC( BBb3C'MBBb3Ce4BLEB; þ' CKC( BBb3Ce4BLEBC( BoB- þ< CC( BoBb3Ce4BLEBCe4BBI|DCBuBCrB}BCB}BI}DCrB}Bb3CBBCB}BI{0DCrB}BCe4BBb3CBBI|DCe4BBb3Ce4BLEBb3CBB'˽CCB}Bb3CB}Bb3CB%7BV̽CCB}Bb3CB%7BCBuB: FCBuBb3CB%7BCBBͽCCB}Bb3CBBb3CB}B^ͽCCp#BMBC BUBCp#BUBͽCC BUBb3Cp#B{BCp#BUBNͽCC BUBCBBb3Cp#B{BC ^FCBBb3CB%7Bb3Cp#B{B|9Ⱦ&'BCp#BUBb3C(BUBb3C\)BYBD{8Ⱦ'BCp#BUBb3C\)BYBCp#BMBX{9Ⱦ'BCp#BMBb3C\)BYBC\)B+Bq{8Ⱦ'BCp#BUBb3Cp#B{Bb3C(BUB4 MTھ7CaBBCrAB4CaBB ?AþR=C( BCBCB}B0C( B}Bpcƾ{I;4CaBBCOBBC( BoBcƾI;CaBB4CaBBC( BoBg =þ5S=CaBBC( BoB0C( B}B >þT=CaBB0C( B}BCB}B3&&>Ce4BBC( BCB0C( B}B4&&>k-Ce4B}BCe4BB0C( B}B &'>0C( B}BCe4BBk-Ce4B}B'8'&>C( BoBCe4BB0C( B}BQ FCBuOBC<BUBjCBUBƳ?k-Ce4B}BCrB}BCBuBƳ?Ce4BBk-Ce4B}BCBuB0 ?ECe4BBCBuBjCBUB$ = ZECe4BBjCBUBC<BUBT Ƴ1?k-Ce4B}BCe4BBCrB}BBCBBCBuOBjCBUBO ]XuA5ACBUBCBBjCBUB XuAjCBUBCBB5ACBUB | P^CCBuBCBBjCBUB g(sA5ACBUBC BUBCp#BMB gsA5ACBUBCp#BMBCBBK qaa?CBBCp#BMBCp#B'B g)sA5ACBUBCBBC BUB˾{r:C\)BfBC#B?!B@=C\)B?!B˾s:C#B?!BC\)B+B@=C\)B?!B̾Wf:C#B?!BCp#B'BC\)B+B ~ľ>Cp#B'BCp#BMBC\)B+B:#dᄐd6ښCYA^BښCAxB؂CAB, ~z4CYABښCYA^B؂CABݾ5ښCaBiBښC ^A}B>CaB}BA Rھ7CYABCrABCaBB pTھ 7ښCYA^BCYABCaBBwݾ5ښCYA^BCaBB>CaB}Bݾ5ښCYA^B>CaB}BښC ^A}BQ<:>CaB}BCB}BC( BCB.:>CaB}BC( BCBښCaBiBaTpľ8ښCaBiBC( BCBښC( B Bƻe:>CaB}BCaBBCB}B_=(y<ښCe4B(BښC>X BUBm:Ce4BUBq> w<ښC>X BUBCe4BBm:Ce4BUB=x<ښC>X BUBښC( B BCe4BBguu:ښC( B BC( BCBCe4BBa{x?m:Ce4BUBC<BUBCBuOBo?m:Ce4BUBCBuOBښCe4B(BIhܩn;ښCe4B(BCBuOBښCBB{ln?m:Ce4BUBCe4BBC<BUB9y;ښCB 4BښCB?!BnPCB?!B;;ښCB?!BCBBnPCB?!B:=;ښCB?!BښCBBCBB<*j9ښCBBCBuOBCBB&<|9ښCp#B茾BښCB 4BnPCB?!B*j;8Cp#B?!BښCp#B茾BnPCB?!Br#v8nPCB?!BCp#B'BCp#B?!B u=u:CBBCp#B'BnPCB?!Bt Ⱦ6ښC\)B!̼BښCH%BBBC\)BB0 Ⱦ<6Cp#B?!BC#B?!BC\)BfB Ⱦ6ښCp#B茾BCp#B?!BC\)BfB Ⱦ6ښCp#B茾BC\)BfBBC\)BBG Ⱦ6ښCp#B茾BBC\)BBښCH%BBfQȾ6Cp#B?!BCp#B'BC#B?!B/aCA0B1CAaBCYAىBmܾcCYAىB1CAaB1CYAB 7H0Ia1CaB:BCaBBC^XA\BW ־d1CB\B1CaB:BC^XA\B9 Z־dC^XA\B1CYAB1CB\BR9PbCYAىB1CYABC^XA\BW;ɾݓfCaBB1CaB:BC( BBW;ɾݓfC( BB1CaB:B1C( B4/BH>Ͼd1Ce4B/BCe4BBCs BZ(Bv>ɾkf1C|BZ(B1Ce4B/BCs BZ(BW>ɾ]lfCs BZ(B1C( B4/B1C|BZ(BJ:(Ͼ-IeC( BB1C( B4/BCs BZ(B7I7ɾeCe4BB1Ce4B/BCBB$XՇ¾fCBB1Ce4B/B1CBmBA!rdfǾcCBFBCBB[CBBmr=cǾcCBB1CB B[CBB rfǾcCBBCBB1CB BBIYFQ6gCBB1CBmB1CB BJtZNf[CBB1CBB1Cp#B;Bt}Mf[CBB1Cp#B;BCBFB__ƾPbCBFB1Cp#B;BCp#BBήt7WNf[CBB1CB B1CBBtʾj_Cyi(BB1C\)ByBDC\)BB xʾi_Cyi(BBCp#BB1C\)ByBcCp#BB1Cp#B;B1C\)ByB\F\˽CYAB˽C:A\B+CYA\B\+꾗\˽C:A\BCYAىB+CYA\B\Z\˽C:A\B˽CApBCYAىBPp^˽CApBCA0BCYAىBw_t߾yt_+CYA\BC^XA\BCaBBt_s߾t_+CYA\BCaBB˽CYABu_Lt߾t_˽CYABCaBB˽CaBb"Bx_u߾s_+CYA\BCYAىBC^XA\Bu|Ҿ`˽C( BB˽CBZ(B?TC( BZ(B|ҾX`˽CBZ(BC( BB?TC( BZ(B׵|ԖҾ`˽CBZ(B˽CaBb"BC( BBӞd= Ⱦd˽CaBb"BCaBBC( BB ~̾a?TC( BZ(BCs BZ(BCe4BB!~̾a?TC( BZ(BCe4BB˽C( BB鄾Ѿ_˽C( BBCe4BB˽Ce4B !BZ~̾a?TC( BZ(BC( BBCs BZ(BёbMо(3^˽CBcB˽C:BBkCBB ґNо2^˽C:BBCBBkCBB:ґOо2^˽C:BB˽Ce4B !BCBB:`3ƾPb˽Ce4B !BCe4BBCBBVfľV`kCBBCBBCBFBḟľn`kCBBCBFB˽CBcBmKξk\˽CBcBCBFB˽CBBf=ľ?`kCBBCBBCBB ¾^˽CR#BBCp#BBvǽCp#BB¾^˽CR#BB˽CBBCp#BB¾^˽CBBCBFBCp#BBGȾn]vǽCp#BBCp#BBCyi(BB֓2[ W˽CYABCYABCMA\Bpm "Y˽C:A\B˽CYABCMA\B"YCMA\B˽CApB˽C:A\B,T7aWCAbcB˽CApBCMA\Bɛ2߾XCaByBCݳBZ(ByCaBZ(BǛň߾XCݳBZ(B˽CaBb"ByCaBZ(B&ț8߾"XCݳBZ(BCYAB˽CaBb"BKwھZCYAB˽CYAB˽CaBb"Bmξk\yCaBZ(B˽CBZ(B˽C( BBnզξ@k\yCaBZ(B˽C( BBCaByBŸzӾgLZCaByB˽C( BBC( BmBlYξk\yCaBZ(B˽CaBb"B˽CBZ(Bt~ǾR\C( BmB˽C( BBCe4B$BRm ξk\Ce4B$B˽C( BB˽Ce4B !B.⭾ܾV˽CBcBCBSBC=MBB8ξa\˽C:BB˽CBcBC=MBBG^ξa\C=MBB˽Ce4B !B˽C:BB›߾aXCe4B$B˽Ce4B !BC=MBB֮K/ƾͯZCBSB˽CBcBCB*B𹪾̾ZCB*B˽CBcB˽CBB`,\CBBB˽CBB˽CR#BBЩҾ\YCB*B˽CBBCBBBv0OPCA\BCMA\BCYABJ&I侶PCA\BCYAB;fCAB@& I侺P;fCABCYAB;fCYA.B l?PCA\BCAbcBCMA\BþݾPCaByB;fCaBzB;fC!AZ(B3`9پSCݳBZ(BCaByB;fC!AZ(BZ2پ S;fC!AZ(BCYABCݳBZ(B:޾Q;fCYA.BCYAB;fC!AZ(Bzƾ";MT;fC( BQB;fC BBbC( BBTǾX;HT;fC BBC( BmBbC( BB!ǾY;.GT;fC BB;fCaBzBC( BmBǾ;PGT;fCaBzBCaByBC( BmB!ľ.ؾ3 R;fCe4B0FB;fC( BQBbC( BBھӾzMCe4BB;fCe4B0FBbC( BB׋ھӾ MbC( BBCe4B$BCe4BB ɾTX¾sVC( BmBCe4B$BbC( BBIھm?ԾMCe4BBC=MBBCBSBEھ.ԾMCe4BBCBSB;fCe4B0FBդ;ǾQGT;fCe4B0FBCBSB;fCBB/gھ[ԾfMCe4BBCe4B$BC=MBBٹ۾ ξN;fCHBBCB*B)CBBշ۾ξN;fCHBB;fCBBCB*Bξ\V~VU;fCBBCBSBCB*Bܾ Vɾ[O)CBBCB*BCBBBcᾇb[WHb3CYA)aBb3CrLAZ(BiCYAZ(BrrᾝNHb3CrLAZ(B;fCYA.BiCYAZ(Bg]f!UHb3CrLAZ(Bb3CA.B;fCYA.B}ݾ|ݾJb3CA.B;fCAB;fCYA.BU޾(Fb3CaBBb3C BB CaBB ׾{pJiCYAZ(B;fC!AZ(B;fCaBzBM ׾xJb3CYA)aBiCYAZ(B;fCaBzBP뾊޾)Fb3CYA)aB;fCaBzB CaBBV9޾'Fb3CYA)aB CaBBb3C BB ׾YwJiCYAZ(B;fCYA.B;fC!AZ(B&;ľMľ3K CaBB;fCaBzB;fC BBL2ǾSGb3C'MBB;fCe4B0FBCe4BBU8Ǿ Gb3C'MBBb3C( BB;fCe4B0FB8W˾NEb3C( BB;fC( BQB;fCe4B0FBOC2ICe4BB;fCBBhCBBh+M ϻI;fCe4B0FB;fCBBCe4BB=ǾGhCBB;fCBB;fCHBB-]<CYA,BCABECYABf8۾B5CAZ(Bb3CrLAZ(Bb3CYA)aBۚ*۾BCA !B5CAZ(Bb3CYA)aBA*<CA !Bb3CYA)aBECYAB5徱<CA !BECYABCABk<۾aB5CAZ(Bb3CA.Bb3CrLAZ(BP׾e?ECYABb3C BBb3CaBBR׾d?ECYABb3CaBBCYA,BQQ׾d?CYA,Bb3CaBBCaBc_BQ׾e?ECYABb3CYA)aBb3C BBS;?ACOBBb3C( BBKC( BBS;?ACOBBCaBc_Bb3C( BBzS;?ACaBc_Bb3CaBBb3C( BBy þO CKC( BBb3C( BBb3C'MBB0O:YiCABCABCYA,BLP:YiCABCYA,BCA;BSnXF8CA;BCYA,BCYAXB㾽P:YiCABCA !BCAB Tھ7CrABCaBc_B4CaBB bھX7CrABCYAXBCaBc_B rjӾ;CYAXBCYA,BCaBc_Bcƾ0I;4CaBBCaBc_BCOBBL6 뾋m4؂CABCYAXBCYABSXXF8CA;BCYAXB؂CABn _ھ7CYABCYAXBCrAB?Ib?1C]B{CC( B{C1C( B C$y?Q?1C B+Cz˼Ce4B+C1Ce4B CWCL!?z?z˼Ce4B+CC B{CCe4BinCU# qd?F?1C B+CC B{Cz˼Ce4B+Ci +?=U?1C B+CC( B{CC B{Ch W??1C B+C1C( B CC( B{C?#?1C7BtC^ӼCBtC1CBeC ??^ӼCBtCCƁB+CCBC_??1C7BtCCƁB+C^ӼCBtCJ??1C7BtCz˼Ce4B+CCƁB+C&??1C7BtC1Ce4B Cz˼Ce4B+CI\$??z˼Ce4B+CCe4BinCCƁB+CXپ֘/?L?1CB:CCBCCBCwxh1'?Z?1CBCCBC1CB:C,?~?1CBeC^ӼCBtCCBtC2]%?+?1CBeCCBtC1CBC/.??1CBCCBtCCBCT,??^ӼCBtCCBCCBtCs׾1??1Cp#BCC5,"B=@CCp#BC} ԾR3?F?1CcB=@CC5,"B=@C1Cp#BCI־5?=?C5,"B=@C1CcB=@C1CB:CӾ4?Y?CBCC5,"B=@C1CB:C|6?m?1C^(B CItC\)B C1C\)BCi@?<1?ItC\)B CC<'BCC\)BC#m@??'?ItC\)B C1C^(B CC<'BCľ+7?|?1C^(B C1C,#BCC<'BCfľ.8?8?C<'BC1C,#BC1Cp#BC:ʾ|?>??TCp#B=@C˽C; BC˽Cp#BCmke=??C5,"B=@C˽C; BC?TCp#B=@C~^8?X?C5,"B=@CCBC˽C; BCn:b7?s?C5,"B=@CCBCCBC¾d=?B ?CBC˽CBtC˽C; BCݞIF?x ?C\)BC˽C)BC˽C\)BC梾޲B??C<'BC˽C)BCC\)BCt>??Cp#BC?TCp#B=@C˽Cr%B=@Cu%B?u?Cp#BC˽Cr%B=@CC<'BC{C?VD?C<'BC˽Cr%B=@C˽C)BCB?p??TCp#B=@C˽Cp#BC˽Cr%B=@C4˾}~0?$?˽CB+CCB+C˽CBCBϾ9?"?CB+CC¢B{CCBC|Ӿ7?,?CB+C˽CB+CC¢B{Cܾ62??˽CB+C˽CB{CC¢B{CF7??˽ChIBtC28CBtC˽CBtCĹP9?f?28CBtCCB`B+CCBCϽG8?f?˽ChIBtCCB`B+C28CBtCZ6?>?˽ChIBtCCB+CCB`B+Cjž5?z?˽ChIBtC˽CBCCB+Ceɾ>?U ?CB+CCBCCB`B+CNJB??˽Cp#BCC#BCCp#B0C2M???˽C; BCC#BC˽Cp#BCұ@?2A?˽CBtC28CBtCClBtCAұ֤@?>?˽CBtCClBtC˽C; BC䪾D? ?˽C; BCClBtCC#BC ӱ@?A?28CBtCCBCClBtC I?}?˽C)BC?ӽC\)BC˽C\)BCeJ?N ??ӽC\)BCCc'B=@CC\)B^CI?T??ӽC\)BC˽C)BCCc'B=@C4㎾']F?3?˽C)BC˽Cr%B=@CCc'B=@C玾kbF?+?Cc'B=@C˽Cr%B=@C˽Cp#BC𙾪lJ?a?Cp#B0CCc'B=@C˽Cp#BC/Rb3C&BCC#BtCC5'BCOS6:Y?>3>°Cp#BtCCp#BOCC#BtCrI;T?r ?CQB{C}CB{CCBqKC&Y?F?Cp#BOCC0!B+CCp#BDCSѻV?t6?CB+CC0!B+CCp#BOCR;dZ?>CBqKC}CB{CCB{Cr>W?Si?CBqKCCB{CCB+CV]?P>CB+CCB{CC0!B+CD{B`?v>C\)BCCQ(BCC\)B 'CVgŽ.Y?6C?C5'BCCQ(BCC\)BCv˽`?8>CQ(BCC5'BCC$BtC-!]?y>C5'BCC#BtCC$BtCVCκ[?u>C$BtCC#BtCCp#BOCZn]?>Cp#BDCC$BtCCp#BOC3Ou%,a?>Cp#BDCښC!B+CښCp#BUKC,Z?)?C0!B+CښC!B+CCp#BDCqUb?X>ښC!B+CC0!B+CښCzB{CF0^?!B>C0!B+CCB{CښCzB{C[¼b?>C\)B 'CښC/(BCښC\)B<C+M `?>CQ(BCښC/(BCC\)B 'C#~a?2>ښC/(BCCQ(BCښC%BtC}a?^F>CQ(BCC$BtCښC%BtC_f_?_>ښC%BtCC$BtCCp#BDCh!d?>ښCp#BUKCښC%BtCCp#BDC-M?>>1C%ACAKCYAC1CYAC)z2V?}">1CAixCAKCYAC1C%AC.m%"?>(CYAixCAKCYAC1CAixC?-9-?Ԁ>(CYAixCC=ACCYA?C773h&?U>1CAixCC=AC(CYAixC4;1#?VA>1CAixCVCACC=AC:}?(>1CAixC1CAeCVCAC8I ?2'>VCACICA CCHA C<6$?fǍ>C=ACVCACCHA C;OH?m4>ICA CuCAWG"CC]AWG"C.9} ?%>CHA CICA CC]AWG"CE=*? =>uCAWG"CCAZ"CC]AWG"C?K?1CK-BCCCaBCC1CaBRC3 -&?M>CaBCCC9cBCCaB|C&+ ?~>1CK-BCCC9cBCCaBCC ]"B*(?6>1CK-BCCAKCYACC9cBC=("?% >1CK-BCC1CYACAKCYAC$/?ů>AKCYAC(CYAixCCAixC8&),?gٵ>C9cBCAKCYACCAixC'3?>(CYAixCCYA?CCAixC~k!?X?C( B{CC0{BCCC( BfECLA???1C]B{CC0{BCCC( B{Ct!?v?1C]B{CCaBCCC0{BCCs9?)L?1C]B{C1CaBRCCaBCC@)?>CaBCCCaB|CC0{BCCh$??C( B{CC( BfECC B{C)0?>C=ACCYACCYA?C{)0?\Z>CHA CCYACC=ACM-+N-?>JiCYA CCYACCHA C,e,?ڞ>C]AWG"CJiCYA CCHA CR4p'?.>CYAWG"CJiCYA CC]AWG"C6ԍ)?yj>CYAWG"C˽CA#C˽CYAP"C6)?j>C]AWG"C˽CA#CCYAWG"Cn:_!?Z>C]AWG"CFCA#C˽CA#C`:T!?P>C]AWG"CCAZ"CFCA#CFCA#C֛CA{%C˽CA{%Cm9 ?Ӿ>˽CA#CFCA#C˽CA{%ChM+?>C9cBCF"CaBCCaB|C -b1?]>CAixCF"CaBCC9cBCn3?c>CaBixCF"CaBCCAixCu |=?>CaBixC˽C@BC˽CaB&C{8?>CAixC˽C@BCCaBixCu QQ;?>CAixCCYAC˽C@BC+$Ia6?S>CAixCCYA?CCYAC4 )=?b>CYACJiCYA C˽CA CH˽C@BCCYAC˽CA C(u4?#>JiCYA CCYAWG"C˽CAWG"C>?s>˽CA CJiCYA C˽CAWG"C]*6?a[>CYAWG"C˽CYAP"C˽CAWG"C %? ?C0{BCC}C( BCCC( BfEC 5?q>}C( BCC˽C7BC˽C( BiCh} /?o>C0{BCC˽C7BC}C( BCCtH4?'>C0{BCCF"CaBC˽C7BCL8.? >C0{BCCCaB|CF"CaBCz>?(G>F"CaBCCaBixC˽ClkBixC;?Է>˽C7BCF"CaBC˽ClkBixCoB?˔>CaBixC˽CaB&C˽ClkBixCk.? ?Ce4B{C˽C BCC˽Ce4BC}u+?:?C B{C˽C BCCCe4B{Cjv-?¯?C B{C}C( BCC˽C BCC(??C B{CC( BfEC}C( BCC (5?ۚ>}C( BCC˽C( BiC˽C BCC"fI^1??Ce4B{C˽Ce4BC˽CB{C\6)?j>˽CA#CCYA#C˽CYAP"C_3&?>˽CA{%CCYA#C˽CA#CA7*#?>$LCYA{%CCYA#C˽CA{%C B?A>˽C@BC CaBC˽CaB&ChD?ؑ>˽CA C CaBC˽C@BC6 w@?>cCaB C CaBC˽CA CD?]>cCaB CCBWG"CCaB^!C{tB?_>cCaB C˽CA CCBWG"CՅ>?@s>˽CA C˽CAWG"CCBWG"C1'9?.W>˽CYAP"CCYA#CCjB#CP;(@8?^]>˽CYAP"CCjB#C˽CAWG"C"F:A?yz0>˽CAWG"CCjB#CCBWG"Ci.Fj.? >CYA#C$LCYA{%CCGA{%C@&O8?Kk>CjB#CCYA#CCGA{%C}-:? >˽C7BC2C( BC˽C( BiCC?>2C( BCCBixCC( BCA?)>2C( BC˽C7BCCBixC}D?uv>˽C7BC˽ClkBixCCBixCam cI?>˽CaB&C CaBCCgBC {H?>˽CaB&CCgBC˽ClkBixC> J?.Ք>˽ClkBixCCgBCCBixC@fp,J? v> CaBCcCaB CCB C M?7j>CgBC CaBCCB CޢK?Q>cCaB CCaB^!CCB Chn辡5? ?˽Ce4BCCBCCCe4B,+C_#2?zY ?˽C BCCCBCC˽Ce4BCZ>??>˽C( BiC2C( BCCp BCuŊ;?[>˽C( BiCCp BC˽C BCCK˽C BCCCp BCCBCCD:F?>2C( BCC( BCCp BC6?K ?C¢B{C˽CB{C˽Ce4BC,X{8?H?Ce4B,+CC¢B{C˽Ce4BCG?`>CBWG"CrCaBWG"CCaB^!CwI?M8>CjB#CrCaBWG"CCBWG"C/ZUYD?ô.>CaB#CrCaBWG"CCjB#C%iA?qv>CGA{%CCaB#CCjB#C &:?ptU>(CaB{%CCaB#CCGA{%C<g,F?&->CBixC]̾C( BixCC( BC)bhM?>CgBC]̾C( BixCCBixC5N?>EC( BC]̾C( BixCCgBC;^T?&l>EC( BC;fCآB C;fC( BRCNjR?rl>EC( BCCgBC;fCآB C6q2R?y>p>CgBCCB C;fCآB CKjL?tX>CaB^!CrCaBWG"C;fCoBWG"C.#L?$R>CaB^!C;fCoBWG"CCB C[U?>CB C;fCoBWG"C;fCآB CK?%>rCaBWG"CCaB#C;fCNB#CO?C!>;fCoBWG"CrCaBWG"C;fCNB#C*E?E>CaB#C(CaB{%C;fCB{%CI K?3>;fCNB#CCaB#C;fCB{%Cɇվz9?z ?CBCCECe4BCCCe4B,+C ؾPG?>ECe4BCC;fCCBC;fCe4BC*LB?j>ECe4BCCCBCC;fCCBC.߾JC?~>CBCCCp BC;fCCBC9ホN?ظ>C( BC]̾C( BixC;fCʓ BixC=rLK?>C( BC;fCʓ BixCCp BC|N?>Cp BC;fCʓ BixC;fCCBCoT? Z>]̾C( BixCEC( BC;fCQb BCxoT?=Y>;fCʓ BixC]̾C( BixC;fCQb BCV mX?dc>EC( BC;fC( BRC;fCQb BC' D?#?CB{C;fC:RBCC;fCB*CA?,?C¢B{C;fC:RBCCCB{CpȾ=?: ?C¢B{CECe4BCC;fC:RBCC0ҾECe4BCC;fCe4BC;fC:RBCC,;F??CB{C;fCB*C;fCB{CW?n>;fCآB CC( B C;fC( BRCtLZ?`#>;fCoBWG"CC( B C;fCآB Cu cW?T >XC( BWG"CC( B C;fCoBWG"Cd cW? >;fCNB#CXC( BWG"C;fCoBWG"CG  U?)x>C( B#CXC( BWG"C;fCNB#CR7Q?>C( B#Cb3C9~ B{%Cb3C( B%C |?U?=C( B#C;fCNB#Cb3C9~ B{%C L?sD5>;fCNB#C;fCB{%Cb3C9~ B{%C)ؾ G?n>;fCCBCCe4BC;fCe4BCOྑN?#>Ce4BCb3CBixCb3Ce4B3TCN?q>Ce4BC;fCCBCb3CBixCQ۾-Q?rX>;fCCBC;fCʓ BixCb3CBixC@YFY?K3>b3CBixC;fCʓ BixCb3C BC;QX?~Y>;fCʓ BixC;fCQb BCb3C BCg[?a>;fC( BRCC( B Cb3C\- B C 3[?Pf>;fC( BRCb3C\- B C;fCQb BClwT]?gUZ>;fCQb BCb3C\- B Cb3C BCAt\?2>C( B CXC( BWG"Cb3C5D BWG"Cj=_?,.=b3C\- B CC( B Cb3C5D BWG"CQZ?+=XC( BWG"CC( B#Cb3Clf B#C]? =b3C5D BWG"CXC( BWG"Cb3Clf B#CkaZ?M=C( B#Cb3C( B%Cb3Clf B#CƤ>L??;fCB*Cb3C+BCCb3CB0CaE?'+ ?;fC:RBCCb3C+BCC;fCB*Cɾ&O?>;fCe4BCCe4BCb3CBC-ɾKWK?<>;fCe4BCb3CBC;fC:RBCCﺾNR?;>;fC:RBCCb3CBCb3C+BCCоFV?κ>Ce4BCb3Ce4B3TCb3CBC)fJ??b3C*B{C;fCB{C;fCB*C⡾`CN?7?b3CB0Cb3C*B{C;fCB*C 4W?9>b3C9~ B{%CB